index
int64
0
0
repo_id
stringlengths
21
232
file_path
stringlengths
34
259
content
stringlengths
1
14.1M
__index_level_0__
int64
0
10k
0
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg/modules/helm_chart_db.go
/* * Copyright 2019-2020 VMware, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * http://www.apache.org/licenses/LICENSE-2.0 * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * */ package modules import ( "errors" ) func (e *HelmChart) DropTable() { DB.Migrator().DropTable(&HelmChart{}) } func (e *HelmChart) InitTable() error { return DB.AutoMigrate(&HelmChart{}) } func (e *HelmChart) GetList() ([]HelmChart, error) { var helmCharts HelmCharts table := DB.Model(e) if e.Uuid != "" { table = table.Where("uuid = ?", e.Uuid) } if e.Name != "" { table = table.Where("name = ?", e.Name) } if e.Chart != "" { table = table.Where("chart = ?", e.Chart) } if e.Version != "" { table = table.Where("version = ?", e.Version) } if e.AppVersion != "" { table = table.Where("app_version = ?", e.AppVersion) } if err := table.Find(&helmCharts).Error; err != nil { return nil, err } return helmCharts, nil } func (e *HelmChart) Get() (HelmChart, error) { var cluster HelmChart table := DB.Model(e) if e.Uuid != "" { table = table.Where("uuid = ?", e.Uuid) } if e.Name != "" { table = table.Where("name = ?", e.Name) } if e.Chart != "" { table = table.Where("chart = ?", e.Chart) } if e.Version != "" { table = table.Where("version = ?", e.Version) } if e.AppVersion != "" { table = table.Where("app_version = ?", e.AppVersion) } if err := table.First(&cluster).Error; err != nil { return HelmChart{}, err } return cluster, nil } func (e *HelmChart) Insert() (id int, err error) { // check name namespace var count int64 DB.Model(&HelmChart{}).Where("version = ?", e.Version).Count(&count) if count > 0 { err = errors.New("helmChart already exists, version = " + e.Version) return } //Add data if err = DB.Model(&HelmChart{}).Create(&e).Error; err != nil { return } id = int(e.ID) return } func (e *HelmChart) Upload() (err error) { var count int64 if err = DB.Model(&HelmChart{}).Where("version = ?", e.Version).Count(&count).Error; err != nil { return } if count > 0 { DB.Delete(&HelmChart{}, "version = ?", e.Version) } if err = DB.Model(&HelmChart{}).Create(&e).Error; err != nil { return } return } func (e *HelmChart) Update(id int) (update HelmChart, err error) { if err = DB.First(&update, id).Error; err != nil { return } if err = DB.Model(&update).Updates(&e).Error; err != nil { return } return } func (e *HelmChart) Delete(id int) (success bool, err error) { if err = DB.Where("ID = ?", id).Delete(e).Error; err != nil { success = false return } success = true return } func (e *HelmChart) DeleteByUuid(Uuid string) (success bool, err error) { if err = DB.Where("uuid = ?", Uuid).Delete(e).Error; err != nil { success = false return } success = true return } func (e *HelmChart) IsExisted() bool { var count int64 DB.Model(&HelmChart{}).Where("name = ?", e.Name).Where("version = ?", e.Version).Count(&count) if DB.Error == nil && count > 0 { return true } return false }
9,800
0
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg/modules/namespace.go
/* * Copyright 2019-2020 VMware, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * http://www.apache.org/licenses/LICENSE-2.0 * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * */ package modules import ( "fmt" "time" "github.com/FederatedAI/KubeFATE/k8s-deploy/pkg/service" "k8s.io/apimachinery/pkg/util/duration" ) type Namespace struct { Name string Status string Labels map[string]string Annotations map[string]string Age string } type Namespaces []Namespace func (e *Namespace) GetList() (Namespaces, error) { namespaceList, err := service.GetNamespaces() if err != nil { return nil, err } var namespaces Namespaces for _, v := range namespaceList { namespaces = append(namespaces, Namespace{ Name: v.Name, Status: fmt.Sprint(v.Status.Phase), Labels: v.Labels, Annotations: v.Annotations, Age: duration.HumanDuration(time.Since(v.CreationTimestamp.Time)), }) } return namespaces, nil }
9,801
0
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg/modules/helm_chart_special.go
/* * Copyright 2019-2020 VMware, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * http://www.apache.org/licenses/LICENSE-2.0 * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * */ package modules import ( "errors" "fmt" "sigs.k8s.io/yaml" "github.com/FederatedAI/KubeFATE/k8s-deploy/pkg/service" "helm.sh/helm/v3/pkg/action" "helm.sh/helm/v3/pkg/chart/loader" "helm.sh/helm/v3/pkg/cli" "github.com/rs/zerolog/log" "helm.sh/helm/v3/pkg/chart" ) func (e *HelmChart) ChartRequestedTohelmChart(chartRequested *chart.Chart) (*HelmChart, error) { if chartRequested == nil || chartRequested.Raw == nil { log.Error().Msg("chartRequested not exist") return nil, errors.New("chartRequested not exist") } var chartData string var valuesData string var ValuesTemplate string for _, v := range chartRequested.Raw { if v.Name == "Chart.yaml" { chartData = string(v.Data) } if v.Name == "values.yaml" { valuesData = string(v.Data) } if v.Name == "values-template.yaml" { ValuesTemplate = string(v.Data) } } helmChart := NewHelmChart(chartRequested.Name(), chartData, valuesData, chartRequested.Templates, chartRequested.Metadata.Version, chartRequested.AppVersion()) helmChart.ValuesTemplate = ValuesTemplate return helmChart, nil } func HelmChartDownload(chartName, chartVersion string) (*HelmChart, error) { err := service.RepoAddAndUpdate() if err != nil { log.Warn().Err(err).Msg("RepoAddAndUpdate error, check kubefate.yaml at env FATECLOUD_REPO_URL values,") return nil, err } chartPath := service.GetChartPath(chartName) settings := cli.New() cfg := new(action.Configuration) client := action.NewInstall(cfg) client.ChartPathOptions.Version = chartVersion cp, err := client.ChartPathOptions.LocateChart(chartPath, settings) if err != nil { return nil, err } log.Debug().Str("FateChart chartPath:", cp).Msg("chartPath:") // Check chart dependencies to make sure all are present in /charts chartRequested, err := loader.Load(cp) if err != nil { return nil, err } helmChart, err := ChartRequestedTohelmChart(chartRequested) if err != nil { return nil, err } return helmChart, nil } func ChartRequestedTohelmChart(chartRequested *chart.Chart) (*HelmChart, error) { if chartRequested == nil || chartRequested.Raw == nil { log.Error().Msg("chartRequested not exist") return nil, errors.New("chartRequested not exist") } var chartData string var valuesData string var ValuesTemplate string for _, v := range chartRequested.Raw { if v.Name == "Chart.yaml" { chartData = string(v.Data) } if v.Name == "values.yaml" { valuesData = string(v.Data) } if v.Name == "values-template.yaml" { ValuesTemplate = string(v.Data) } } helmChart := NewHelmChart(chartRequested.Name(), chartData, valuesData, chartRequested.Templates, chartRequested.Metadata.Version, chartRequested.AppVersion()) helmChart.ValuesTemplate = ValuesTemplate return helmChart, nil } func GetFateChart(chartName, chartVersion string) (*HelmChart, error) { hc := &HelmChart{ Name: chartName, Version: chartVersion, } if hc.IsExisted() { fc, err := hc.Get() if err != nil { return nil, err } return &fc, nil } log.Warn().Str("chartName", chartName).Str("chartVersion", chartVersion).Msg("Chart does not exist in the database") helmChart, err := HelmChartDownload(chartName, chartVersion) if err != nil { return nil, err } _, err = helmChart.Insert() if err != nil { return nil, err } return helmChart, nil } func (e *HelmChart) GetChartValuesTemplates() (string, error) { if e.ValuesTemplate == "" { return "", errors.New("FateChart ValuesTemplate not exist") } return e.ValuesTemplate, nil } func (e *HelmChart) GetChartValues(v map[string]interface{}) (map[string]interface{}, error) { // template to values template, err := e.GetChartValuesTemplates() if err != nil { log.Err(err).Msg("GetChartValuesTemplates error") return nil, err } values, err := service.MapToConfig(v, template) if err != nil { log.Err(err).Interface("v", v).Interface("template", template).Msg("MapToConfig error") return nil, err } // values to map vals := make(map[string]interface{}) err = yaml.Unmarshal([]byte(values), &vals) if err != nil { log.Err(err).Msg("values yaml Unmarshal error") return nil, err } return vals, nil } // todo get chart by version from repository func (e *HelmChart) ToHelmChart() (*chart.Chart, error) { if e == nil { return nil, errors.New("FateChart not exist") } return e.ConvertToChart() } func (e *HelmChart) ConvertToChart() (*chart.Chart, error) { c := new(chart.Chart) templates := e.Templates // Chart file chartData := []byte(e.Chart) c.Raw = append(c.Raw, &chart.File{Name: "Chart.yaml", Data: chartData}) if c.Metadata == nil { c.Metadata = new(chart.Metadata) } if err := yaml.Unmarshal(chartData, c.Metadata); err != nil { return c, fmt.Errorf("cannot load Chart.yaml %s", err) } if c.Metadata.APIVersion == "" { c.Metadata.APIVersion = chart.APIVersionV1 } // Values file valuesData := []byte(e.Values) c.Raw = append(c.Raw, &chart.File{Name: "values.yaml", Data: chartData}) c.Values = make(map[string]interface{}) if err := yaml.Unmarshal(valuesData, &c.Values); err != nil { return c, fmt.Errorf("cannot load Chart.yaml %s", err) } // Template files for _, template := range templates { c.Raw = append(c.Raw, template) c.Templates = append(c.Templates, &chart.File{Name: template.Name, Data: template.Data}) } // TODO: Handling Chart.lock, values.schema.json, requirements.yaml, requirements.lock files return c, nil }
9,802
0
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg/modules/user_db.go
/* * Copyright 2019-2020 VMware, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * http://www.apache.org/licenses/LICENSE-2.0 * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * */ package modules import ( "errors" ) func (e *User) DropTable() { DB.Migrator().DropTable(&User{}) } func (e *User) InitTable() error { return DB.AutoMigrate(&User{}) } func (e *User) GetList() ([]User, error) { var users Users table := DB.Model(e) if e.Uuid != "" { table = table.Where("uuid = ?", e.Uuid) } if e.Username != "" { table = table.Where("username = ?", e.Username) } if e.Email != "" { table = table.Where("email = ?", e.Email) } if e.Status != 0 { table = table.Where("status = ?", e.Status) } if err := table.Find(&users).Error; err != nil { return nil, err } for _, u := range users { u.Password = "" } return users, nil } func (e *User) Get() (User, error) { var user User table := DB.Model(e).Unscoped() if e.Uuid != "" { table = table.Where("uuid = ?", e.Uuid) } if e.Username != "" { table = table.Where("username = ?", e.Username) } if e.Email != "" { table = table.Where("email = ?", e.Email) } if e.Status != 0 { table = table.Where("status = ?", e.Status) } if err := table.First(&user).Error; err != nil { return User{}, err } user.Password = "" return user, nil } func (e *User) Insert() (id int, err error) { e.Encrypt() // check username var count int64 DB.Model(&User{}).Where("username = ?", e.Username).Count(&count) if count > 0 { err = errors.New("Account already exists!") return } //Add data if err = DB.Model(&User{}).Create(&e).Error; err != nil { return } id = int(e.ID) return } func (e *User) Update(id uint) (update User, err error) { if err = DB.First(&update, id).Error; err != nil { return } e.Encrypt() if err = DB.Model(&update).Updates(&e).Error; err != nil { return } update.Password = "" return } func (e *User) DeleteById(id uint) (success bool, err error) { if err = DB.Unscoped().Where("ID = ?", id).Delete(e).Error; err != nil { success = false return } success = true return } func (e *User) Delete() (success bool, err error) { user, err := e.Get() if err != nil { return false, err } return user.DeleteById(user.ID) }
9,803
0
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg/modules/cluster_db.go
/* * Copyright 2019-2020 VMware, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * http://www.apache.org/licenses/LICENSE-2.0 * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * */ package modules import ( "fmt" ) func (e *Cluster) DropTable() { DB.Migrator().DropTable(&Cluster{}) } func (e *Cluster) InitTable() error { return DB.AutoMigrate(&Cluster{}) } func (e *Cluster) GetList() ([]Cluster, error) { var clusters Clusters table := DB.Debug().Model(e) if e.Uuid != "" { table = table.Where("uuid = ?", e.Uuid) } if e.Name != "" { table = table.Where("name = ?", e.Name) } if e.NameSpace != "" { table = table.Where("name_space = ?", e.NameSpace) } if e.ChartName != "" { table = table.Where("chart_name = ?", e.ChartName) } if e.ChartVersion != "" { table = table.Where("chart_version = ?", e.ChartVersion) } if e.Status != 0 { table = table.Where("status = ?", e.Status) } if e.Status != 0 { table = table.Unscoped() } if err := table.Find(&clusters).Error; err != nil { return nil, err } return clusters, nil } func (e *Cluster) GetListAll(all bool) ([]Cluster, error) { var clusters Clusters table := DB.Debug().Model(e) if e.Uuid != "" { table = table.Where("uuid = ?", e.Uuid) } if e.Name != "" { table = table.Where("name = ?", e.Name) } if e.NameSpace != "" { table = table.Where("name_space = ?", e.NameSpace) } if e.ChartName != "" { table = table.Where("chart_name = ?", e.ChartName) } if e.ChartVersion != "" { table = table.Where("chart_version = ?", e.ChartVersion) } if e.Status != 0 { table = table.Where("status = ?", e.Status) } if all { table = table.Unscoped() } if err := table.Find(&clusters).Error; err != nil { return nil, err } return clusters, nil } func (e *Cluster) Get() (Cluster, error) { var cluster Cluster table := DB.Debug().Model(e) if e.Uuid != "" { table = table.Where("uuid = ?", e.Uuid) } if e.Name != "" { table = table.Where("name = ?", e.Name) } if e.NameSpace != "" { table = table.Where("name_space = ?", e.NameSpace) } if e.ChartName != "" { table = table.Where("chart_name = ?", e.ChartName) } if e.ChartVersion != "" { table = table.Where("chart_version = ?", e.ChartVersion) } if e.Status != 0 { table = table.Where("status = ?", e.Status) } if err := table.First(&cluster).Error; err != nil { return Cluster{}, err } return cluster, nil } func (e *Cluster) Insert() (id int, err error) { // check name namespace var count int64 DB.Debug().Model(&Cluster{}).Where("name = ?", e.Name).Where("name_space = ?", e.NameSpace).Count(&count) if count > 0 { err = fmt.Errorf("cluster already exists in database, name = %s, namespace=%s", e.Name, e.NameSpace) return } //Add data if err = DB.Model(&Cluster{}).Create(&e).Error; err != nil { return } id = int(e.ID) return } func (e *Cluster) Update(id int) (update Cluster, err error) { if err = DB.First(&update, id).Error; err != nil { return } if err = DB.Model(&update).Updates(&e).Error; err != nil { return } return } func (e *Cluster) UpdateByUuid(uuid string) (update Cluster, err error) { if err = DB.Debug().Where("uuid = ?", uuid).First(&update).Error; err != nil { return } if err = DB.Debug().Model(&update).Updates(&e).Error; err != nil { return } return } func (e *Cluster) deleteById(id uint) (success bool, err error) { if err = DB.Debug().Where("ID = ?", id).Delete(e).Error; err != nil { success = false return } success = true return } func (e *Cluster) Delete() (bool, error) { cluster, err := e.Get() if err != nil { return false, err } err = cluster.SetStatus(ClusterStatusDeleted) if err != nil { return false, err } return e.deleteById(cluster.ID) } func (e *Cluster) IsExisted(name, namespace string) bool { var count int64 DB.Debug().Model(&Cluster{}).Where("name = ?", name).Where("name_space = ?", namespace).Count(&count) if DB.Error == nil && count > 0 { return true } return false } func (e *Cluster) SetStatus(status ClusterStatus) error { if err := DB.Debug().Model(e).Update("status", status).Error; err != nil { return err } return nil } func (e *Cluster) SetSpec(spec MapStringInterface) error { if err := DB.Debug().Model(e).Update("spec", spec).Error; err != nil { return err } return nil } func (e *Cluster) SetValues(values string) error { if err := DB.Debug().Model(e).Update("values", values).Error; err != nil { return err } return nil }
9,804
0
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/FederatedAI/KubeFATE/k8s-deploy/pkg/modules/user.go
/* * Copyright 2019-2020 VMware, Inc. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. * You may obtain a copy of the License at * http://www.apache.org/licenses/LICENSE-2.0 * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * */ package modules import ( "bytes" "crypto/sha256" "errors" "fmt" uuid "github.com/satori/go.uuid" "golang.org/x/crypto/pbkdf2" "gorm.io/gorm" "k8s.io/apimachinery/pkg/util/rand" ) const saltSize = 128 type User struct { Uuid string `json:"uuid,omitempty" gorm:"type:varchar(36);index;unique"` Username string `json:"username,omitempty" gorm:"index;unique;not null"` Password string `json:"password,omitempty" gorm:"type:varchar(512);not null"` Salt string `json:"salt,omitempty" gorm:"type:varchar(128);not null"` Email string `json:"email,omitempty" gorm:"type:varchar(255)"` Status UserStatus `json:"userStatus,omitempty" gorm:"size:8;not null"` gorm.Model } type Users []User type UserStatus int8 const ( Deprecate_u UserStatus = iota + 1 Available_u ) func (s UserStatus) String() string { names := map[UserStatus]string{ Deprecate_u: "Deprecate", Available_u: "Available", } return names[s] } func (s UserStatus) MarshalJSON() ([]byte, error) { buffer := bytes.NewBufferString(`"`) buffer.WriteString(s.String()) buffer.WriteString(`"`) return buffer.Bytes(), nil } // UnmarshalJSON sets *m to a copy of data. func (s *UserStatus) UnmarshalJSON(data []byte) error { if s == nil { return errors.New("json.RawMessage: UnmarshalJSON on nil pointer") } var UserStatus UserStatus switch string(data) { case "\"Deprecate\"": UserStatus = Deprecate_u case "\"Available\"": UserStatus = Available_u default: return errors.New("data can't UnmarshalJSON") } *s = UserStatus return nil } func encryption(plaintext, salt string) string { iterations := 100000 digest := sha256.New secretaries := pbkdf2.Key([]byte(plaintext), []byte(salt), iterations, 256, digest) return fmt.Sprintf("%x", secretaries) } func NewUser(username string, password string, email string) *User { salt := rand.String(saltSize) u := &User{ Uuid: uuid.NewV4().String(), Username: username, Password: password, Salt: salt, Email: email, Status: Deprecate_u, } return u } func (e *User) IsValid() bool { gotUser := new(User) DB.Where("username = ?", e.Username).First(&gotUser) if DB.Error != nil || gotUser == nil { return false } if gotUser.Password != encryption(e.Password, gotUser.Salt) { return false } return true } func (e *User) IsExisted() bool { var count int64 DB.Model(&User{}).Where("username = ?", e.Username).Count(&count) if DB.Error == nil && count > 0 { return true } return false } func (e *User) Encrypt() { e.Password = encryption(e.Password, e.Salt) return }
9,805
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/LICENSE
MIT License Copyright (c) Microsoft Corporation. All rights reserved. Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE
9,806
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/context/context.go
package context import "context" // Background returns a default context with logger discarded. func Background() context.Context { ctx := context.Background() return WithLoggerDiscarded(ctx) }
9,807
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/context/logger.go
package context import ( "context" "io" "io/ioutil" "github.com/containerd/containerd/log" "github.com/sirupsen/logrus" ) // WithLogger returns a new context with the provided logger. // This method wraps github.com/containerd/containerd/log.WithLogger() func WithLogger(ctx context.Context, logger *logrus.Entry) context.Context { return log.WithLogger(ctx, logger) } // WithLoggerFromWriter returns a new context with the logger, writting to the provided logger. func WithLoggerFromWriter(ctx context.Context, writer io.Writer) context.Context { logger := logrus.New() logger.Out = writer entry := logrus.NewEntry(logger) return WithLogger(ctx, entry) } // WithLoggerDiscarded returns a new context with the logger, writting to nothing. func WithLoggerDiscarded(ctx context.Context) context.Context { return WithLoggerFromWriter(ctx, ioutil.Discard) } // GetLogger retrieves the current logger from the context. // This method wraps github.com/containerd/containerd/log.GetLogger() func GetLogger(ctx context.Context) *logrus.Entry { return log.GetLogger(ctx) }
9,808
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/oras/push_opts.go
package oras import ( "context" "fmt" "io" "path/filepath" "strings" "sync" "github.com/containerd/containerd/images" orascontent "github.com/deislabs/oras/pkg/content" ocispec "github.com/opencontainers/image-spec/specs-go/v1" "github.com/pkg/errors" ) type pushOpts struct { config *ocispec.Descriptor configMediaType string configAnnotations map[string]string manifest *ocispec.Descriptor manifestAnnotations map[string]string validateName func(desc ocispec.Descriptor) error baseHandlers []images.Handler } func pushOptsDefaults() *pushOpts { return &pushOpts{ validateName: ValidateNameAsPath, } } // PushOpt allows callers to set options on the oras push type PushOpt func(o *pushOpts) error // WithConfig overrides the config - setting this will ignore WithConfigMediaType and WithConfigAnnotations func WithConfig(config ocispec.Descriptor) PushOpt { return func(o *pushOpts) error { o.config = &config return nil } } // WithConfigMediaType overrides the config media type func WithConfigMediaType(mediaType string) PushOpt { return func(o *pushOpts) error { o.configMediaType = mediaType return nil } } // WithConfigAnnotations overrides the config annotations func WithConfigAnnotations(annotations map[string]string) PushOpt { return func(o *pushOpts) error { o.configAnnotations = annotations return nil } } // WithManifest overrides the manifest - setting this will ignore WithManifestConfigAnnotations func WithManifest(manifest ocispec.Descriptor) PushOpt { return func(o *pushOpts) error { o.manifest = &manifest return nil } } // WithManifestAnnotations overrides the manifest annotations func WithManifestAnnotations(annotations map[string]string) PushOpt { return func(o *pushOpts) error { o.manifestAnnotations = annotations return nil } } // WithNameValidation validates the image title in the descriptor. // Pass nil to disable name validation. func WithNameValidation(validate func(desc ocispec.Descriptor) error) PushOpt { return func(o *pushOpts) error { o.validateName = validate return nil } } // ValidateNameAsPath validates name in the descriptor as file path in order // to generate good packages intended to be pulled using the FileStore or // the oras cli. // For cross-platform considerations, only unix paths are accepted. func ValidateNameAsPath(desc ocispec.Descriptor) error { // no empty name path, ok := orascontent.ResolveName(desc) if !ok || path == "" { return orascontent.ErrNoName } // path should be clean if target := filepath.ToSlash(filepath.Clean(path)); target != path { return errors.Wrap(ErrDirtyPath, path) } // path should be slash-separated if strings.Contains(path, "\\") { return errors.Wrap(ErrPathNotSlashSeparated, path) } // disallow absolute path: covers unix and windows format if strings.HasPrefix(path, "/") { return errors.Wrap(ErrAbsolutePathDisallowed, path) } if len(path) > 2 { c := path[0] if path[1] == ':' && path[2] == '/' && ('a' <= c && c <= 'z' || 'A' <= c && c <= 'Z') { return errors.Wrap(ErrAbsolutePathDisallowed, path) } } // disallow path traversal if strings.HasPrefix(path, "../") || path == ".." { return errors.Wrap(ErrPathTraversalDisallowed, path) } return nil } // WithPushBaseHandler provides base handlers, which will be called before // any push specific handlers. func WithPushBaseHandler(handlers ...images.Handler) PushOpt { return func(o *pushOpts) error { o.baseHandlers = append(o.baseHandlers, handlers...) return nil } } // WithPushStatusTrack report results to a provided writer func WithPushStatusTrack(writer io.Writer) PushOpt { return WithPushBaseHandler(pushStatusTrack(writer)) } func pushStatusTrack(writer io.Writer) images.Handler { var printLock sync.Mutex return images.HandlerFunc(func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { if name, ok := orascontent.ResolveName(desc); ok { printLock.Lock() defer printLock.Unlock() fmt.Fprintln(writer, "Uploading", desc.Digest.Encoded()[:12], name) } return nil, nil }) }
9,809
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/oras/pull.go
package oras import ( "context" "sync" orascontent "github.com/deislabs/oras/pkg/content" "github.com/containerd/containerd/content" "github.com/containerd/containerd/images" "github.com/containerd/containerd/log" "github.com/containerd/containerd/remotes" ocispec "github.com/opencontainers/image-spec/specs-go/v1" "github.com/pkg/errors" "golang.org/x/sync/semaphore" ) // Pull pull files from the remote func Pull(ctx context.Context, resolver remotes.Resolver, ref string, ingester content.Ingester, opts ...PullOpt) (ocispec.Descriptor, []ocispec.Descriptor, error) { if resolver == nil { return ocispec.Descriptor{}, nil, ErrResolverUndefined } opt := pullOptsDefaults() for _, o := range opts { if err := o(opt); err != nil { return ocispec.Descriptor{}, nil, err } } _, desc, err := resolver.Resolve(ctx, ref) if err != nil { return ocispec.Descriptor{}, nil, err } fetcher, err := resolver.Fetcher(ctx, ref) if err != nil { return ocispec.Descriptor{}, nil, err } layers, err := fetchContent(ctx, fetcher, desc, ingester, opt) if err != nil { return ocispec.Descriptor{}, nil, err } return desc, layers, nil } func fetchContent(ctx context.Context, fetcher remotes.Fetcher, desc ocispec.Descriptor, ingester content.Ingester, opts *pullOpts) ([]ocispec.Descriptor, error) { var descriptors []ocispec.Descriptor lock := &sync.Mutex{} picker := images.HandlerFunc(func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { if isAllowedMediaType(desc.MediaType, opts.allowedMediaTypes...) { if opts.filterName(desc) { lock.Lock() defer lock.Unlock() descriptors = append(descriptors, desc) } return nil, nil } return nil, nil }) store := opts.contentProvideIngester if store == nil { store = newHybridStoreFromIngester(ingester) } handlers := []images.Handler{ filterHandler(opts, opts.allowedMediaTypes...), } handlers = append(handlers, opts.baseHandlers...) handlers = append(handlers, remotes.FetchHandler(store, fetcher), picker, images.ChildrenHandler(store), ) handlers = append(handlers, opts.callbackHandlers...) if err := opts.dispatch(ctx, images.Handlers(handlers...), nil, desc); err != nil { return nil, err } return descriptors, nil } func filterHandler(opts *pullOpts, allowedMediaTypes ...string) images.HandlerFunc { return func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { switch { case isAllowedMediaType(desc.MediaType, ocispec.MediaTypeImageManifest, ocispec.MediaTypeImageIndex): return nil, nil case isAllowedMediaType(desc.MediaType, allowedMediaTypes...): if opts.filterName(desc) { return nil, nil } log.G(ctx).Warnf("blob no name: %v", desc.Digest) default: log.G(ctx).Warnf("unknown type: %v", desc.MediaType) } return nil, images.ErrStopHandler } } func isAllowedMediaType(mediaType string, allowedMediaTypes ...string) bool { if len(allowedMediaTypes) == 0 { return true } for _, allowedMediaType := range allowedMediaTypes { if mediaType == allowedMediaType { return true } } return false } // dispatchBFS behaves the same as images.Dispatch() but in sequence with breath-first search. func dispatchBFS(ctx context.Context, handler images.Handler, weighted *semaphore.Weighted, descs ...ocispec.Descriptor) error { for i := 0; i < len(descs); i++ { desc := descs[i] children, err := handler.Handle(ctx, desc) if err != nil { switch err := errors.Cause(err); err { case images.ErrSkipDesc: continue // don't traverse the children. case ErrStopProcessing: return nil } return err } descs = append(descs, children...) } return nil } func filterName(desc ocispec.Descriptor) bool { name, ok := orascontent.ResolveName(desc) return ok && len(name) > 0 }
9,810
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/oras/store.go
package oras import ( "context" "errors" orascontent "github.com/deislabs/oras/pkg/content" "github.com/containerd/containerd/content" "github.com/opencontainers/go-digest" ocispec "github.com/opencontainers/image-spec/specs-go/v1" ) // ensure interface var ( _ content.Store = &hybridStore{} ) type hybridStore struct { cache *orascontent.Memorystore provider content.Provider ingester content.Ingester } func newHybridStoreFromProvider(provider content.Provider) *hybridStore { return &hybridStore{ cache: orascontent.NewMemoryStore(), provider: provider, } } func newHybridStoreFromIngester(ingester content.Ingester) *hybridStore { return &hybridStore{ cache: orascontent.NewMemoryStore(), ingester: ingester, } } func (s *hybridStore) Set(desc ocispec.Descriptor, content []byte) { s.cache.Set(desc, content) } // ReaderAt provides contents func (s *hybridStore) ReaderAt(ctx context.Context, desc ocispec.Descriptor) (content.ReaderAt, error) { readerAt, err := s.cache.ReaderAt(ctx, desc) if err == nil { return readerAt, nil } if s.provider != nil { return s.provider.ReaderAt(ctx, desc) } return nil, err } // Writer begins or resumes the active writer identified by desc func (s *hybridStore) Writer(ctx context.Context, opts ...content.WriterOpt) (content.Writer, error) { var wOpts content.WriterOpts for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil, err } } if isAllowedMediaType(wOpts.Desc.MediaType, ocispec.MediaTypeImageManifest, ocispec.MediaTypeImageIndex) || s.ingester == nil { return s.cache.Writer(ctx, opts...) } return s.ingester.Writer(ctx, opts...) } // TODO: implement (needed to create a content.Store) // TODO: do not return empty content.Info // Abort completely cancels the ingest operation targeted by ref. func (s *hybridStore) Info(ctx context.Context, dgst digest.Digest) (content.Info, error) { return content.Info{}, nil } // TODO: implement (needed to create a content.Store) // Update updates mutable information related to content. // If one or more fieldpaths are provided, only those // fields will be updated. // Mutable fields: // labels.* func (s *hybridStore) Update(ctx context.Context, info content.Info, fieldpaths ...string) (content.Info, error) { return content.Info{}, errors.New("not yet implemented: Update (content.Store interface)") } // TODO: implement (needed to create a content.Store) // Walk will call fn for each item in the content store which // match the provided filters. If no filters are given all // items will be walked. func (s *hybridStore) Walk(ctx context.Context, fn content.WalkFunc, filters ...string) error { return errors.New("not yet implemented: Walk (content.Store interface)") } // TODO: implement (needed to create a content.Store) // Delete removes the content from the store. func (s *hybridStore) Delete(ctx context.Context, dgst digest.Digest) error { return errors.New("not yet implemented: Delete (content.Store interface)") } // TODO: implement (needed to create a content.Store) func (s *hybridStore) Status(ctx context.Context, ref string) (content.Status, error) { // Status returns the status of the provided ref. return content.Status{}, errors.New("not yet implemented: Status (content.Store interface)") } // TODO: implement (needed to create a content.Store) // ListStatuses returns the status of any active ingestions whose ref match the // provided regular expression. If empty, all active ingestions will be // returned. func (s *hybridStore) ListStatuses(ctx context.Context, filters ...string) ([]content.Status, error) { return []content.Status{}, errors.New("not yet implemented: ListStatuses (content.Store interface)") } // TODO: implement (needed to create a content.Store) // Abort completely cancels the ingest operation targeted by ref. func (s *hybridStore) Abort(ctx context.Context, ref string) error { return errors.New("not yet implemented: Abort (content.Store interface)") }
9,811
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/oras/errors.go
package oras import ( "errors" "fmt" ) // Common errors var ( ErrResolverUndefined = errors.New("resolver undefined") ) // Path validation related errors var ( ErrDirtyPath = errors.New("dirty path") ErrPathNotSlashSeparated = errors.New("path not slash separated") ErrAbsolutePathDisallowed = errors.New("absolute path disallowed") ErrPathTraversalDisallowed = errors.New("path traversal disallowed") ) // ErrStopProcessing is used to stop processing an oras operation. // This error only makes sense in sequential pulling operation. var ErrStopProcessing = fmt.Errorf("stop processing")
9,812
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/oras/push.go
package oras import ( "context" "encoding/json" "github.com/containerd/containerd/content" "github.com/containerd/containerd/images" "github.com/containerd/containerd/remotes" artifact "github.com/deislabs/oras/pkg/artifact" digest "github.com/opencontainers/go-digest" specs "github.com/opencontainers/image-spec/specs-go" ocispec "github.com/opencontainers/image-spec/specs-go/v1" ) // Push pushes files to the remote func Push(ctx context.Context, resolver remotes.Resolver, ref string, provider content.Provider, descriptors []ocispec.Descriptor, opts ...PushOpt) (ocispec.Descriptor, error) { if resolver == nil { return ocispec.Descriptor{}, ErrResolverUndefined } opt := pushOptsDefaults() for _, o := range opts { if err := o(opt); err != nil { return ocispec.Descriptor{}, err } } if opt.validateName != nil { for _, desc := range descriptors { if err := opt.validateName(desc); err != nil { return ocispec.Descriptor{}, err } } } pusher, err := resolver.Pusher(ctx, ref) if err != nil { return ocispec.Descriptor{}, err } desc, store, err := pack(provider, descriptors, opt) if err != nil { return ocispec.Descriptor{}, err } var wrapper func(images.Handler) images.Handler if len(opt.baseHandlers) > 0 { wrapper = func(h images.Handler) images.Handler { return images.Handlers(append(opt.baseHandlers, h)...) } } if err := remotes.PushContent(ctx, pusher, desc, store, nil, wrapper); err != nil { return ocispec.Descriptor{}, err } return desc, nil } //func pack(store *hybridStore, descriptors []ocispec.Descriptor, opts *pushOpts) (ocispec.Descriptor, error) { func pack(provider content.Provider, descriptors []ocispec.Descriptor, opts *pushOpts) (ocispec.Descriptor, content.Store, error) { store := newHybridStoreFromProvider(provider) // Config var config ocispec.Descriptor if opts.config == nil { configBytes := []byte("{}") config = ocispec.Descriptor{ MediaType: artifact.UnknownConfigMediaType, Digest: digest.FromBytes(configBytes), Size: int64(len(configBytes)), } store.Set(config, configBytes) } else { config = *opts.config } if opts.configAnnotations != nil { config.Annotations = opts.configAnnotations } if opts.configMediaType != "" { config.MediaType = opts.configMediaType } // Manifest if opts.manifest != nil { return *opts.manifest, store, nil } if descriptors == nil { descriptors = []ocispec.Descriptor{} // make it an empty array to prevent potential server-side bugs } manifest := ocispec.Manifest{ Versioned: specs.Versioned{ SchemaVersion: 2, // historical value. does not pertain to OCI or docker version }, Config: config, Layers: descriptors, Annotations: opts.manifestAnnotations, } manifestBytes, err := json.Marshal(manifest) if err != nil { return ocispec.Descriptor{}, nil, err } manifestDescriptor := ocispec.Descriptor{ MediaType: ocispec.MediaTypeImageManifest, Digest: digest.FromBytes(manifestBytes), Size: int64(len(manifestBytes)), } store.Set(manifestDescriptor, manifestBytes) return manifestDescriptor, store, nil }
9,813
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/oras/pull_opts.go
package oras import ( "context" "fmt" "io" "sync" orascontent "github.com/deislabs/oras/pkg/content" "github.com/containerd/containerd/images" "github.com/opencontainers/go-digest" ocispec "github.com/opencontainers/image-spec/specs-go/v1" "golang.org/x/sync/semaphore" ) type pullOpts struct { allowedMediaTypes []string dispatch func(context.Context, images.Handler, *semaphore.Weighted, ...ocispec.Descriptor) error baseHandlers []images.Handler callbackHandlers []images.Handler contentProvideIngester orascontent.ProvideIngester filterName func(ocispec.Descriptor) bool } // PullOpt allows callers to set options on the oras pull type PullOpt func(o *pullOpts) error func pullOptsDefaults() *pullOpts { return &pullOpts{ dispatch: images.Dispatch, filterName: filterName, } } // WithAllowedMediaType sets the allowed media types func WithAllowedMediaType(allowedMediaTypes ...string) PullOpt { return func(o *pullOpts) error { o.allowedMediaTypes = append(o.allowedMediaTypes, allowedMediaTypes...) return nil } } // WithAllowedMediaTypes sets the allowed media types func WithAllowedMediaTypes(allowedMediaTypes []string) PullOpt { return func(o *pullOpts) error { o.allowedMediaTypes = append(o.allowedMediaTypes, allowedMediaTypes...) return nil } } // WithPullByBFS opt to pull in sequence with breath-first search func WithPullByBFS(o *pullOpts) error { o.dispatch = dispatchBFS return nil } // WithPullBaseHandler provides base handlers, which will be called before // any pull specific handlers. func WithPullBaseHandler(handlers ...images.Handler) PullOpt { return func(o *pullOpts) error { o.baseHandlers = append(o.baseHandlers, handlers...) return nil } } // WithPullCallbackHandler provides callback handlers, which will be called after // any pull specific handlers. func WithPullCallbackHandler(handlers ...images.Handler) PullOpt { return func(o *pullOpts) error { o.callbackHandlers = append(o.callbackHandlers, handlers...) return nil } } // WithContentProvideIngester opt to the provided Provider and Ingester // for file system I/O, including caches. func WithContentProvideIngester(store orascontent.ProvideIngester) PullOpt { return func(o *pullOpts) error { o.contentProvideIngester = store return nil } } // WithPullEmptyNameAllowed allows pulling blobs with empty name. func WithPullEmptyNameAllowed() PullOpt { return func(o *pullOpts) error { o.filterName = func(ocispec.Descriptor) bool { return true } return nil } } // WithPullStatusTrack report results to stdout func WithPullStatusTrack(writer io.Writer) PullOpt { return WithPullCallbackHandler(pullStatusTrack(writer)) } func pullStatusTrack(writer io.Writer) images.Handler { var printLock sync.Mutex return images.HandlerFunc(func(ctx context.Context, desc ocispec.Descriptor) ([]ocispec.Descriptor, error) { if name, ok := orascontent.ResolveName(desc); ok { digestString := desc.Digest.String() if err := desc.Digest.Validate(); err == nil { if algo := desc.Digest.Algorithm(); algo == digest.SHA256 { digestString = desc.Digest.Encoded()[:12] } } printLock.Lock() defer printLock.Unlock() fmt.Fprintln(writer, "Downloaded", digestString, name) } return nil, nil }) }
9,814
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/interface.go
package content import "github.com/containerd/containerd/content" // ProvideIngester is the interface that groups the basic Read and Write methods. type ProvideIngester interface { content.Provider content.Ingester }
9,815
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/iowriter.go
package content import ( "context" "io" "io/ioutil" "github.com/containerd/containerd/content" "github.com/opencontainers/go-digest" ) // IoContentWriter writer that wraps an io.Writer, so the results can be streamed to // an open io.Writer. For example, can be used to pull a layer and write it to a file, or device. type IoContentWriter struct { writer io.Writer digester digest.Digester size int64 hash *digest.Digest } // NewIoContentWriter create a new IoContentWriter. // // By default, it calculates the hash when writing. If the option `skipHash` is true, // it will skip doing the hash. Skipping the hash is intended to be used only // if you are confident about the validity of the data being passed to the writer, // and wish to save on the hashing time. func NewIoContentWriter(writer io.Writer, opts ...WriterOpt) content.Writer { w := writer if w == nil { w = ioutil.Discard } // process opts for default wOpts := DefaultWriterOpts() for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil } } ioc := &IoContentWriter{ writer: w, digester: digest.Canonical.Digester(), // we take the OutputHash, since the InputHash goes to the passthrough writer, // which then passes the processed output to us hash: wOpts.OutputHash, } return NewPassthroughWriter(ioc, func(r io.Reader, w io.Writer, done chan<- error) { // write out the data to the io writer var ( err error ) // we could use io.Copy, but calling it with the default blocksize is identical to // io.CopyBuffer. Otherwise, we would need some way to let the user flag "I want to use // io.Copy", when it should not matter to them b := make([]byte, wOpts.Blocksize, wOpts.Blocksize) _, err = io.CopyBuffer(w, r, b) done <- err }, opts...) } func (w *IoContentWriter) Write(p []byte) (n int, err error) { n, err = w.writer.Write(p) if err != nil { return 0, err } w.size += int64(n) if w.hash == nil { w.digester.Hash().Write(p[:n]) } return } func (w *IoContentWriter) Close() error { return nil } // Digest may return empty digest or panics until committed. func (w *IoContentWriter) Digest() digest.Digest { return w.digester.Digest() } // Commit commits the blob (but no roll-back is guaranteed on an error). // size and expected can be zero-value when unknown. // Commit always closes the writer, even on error. // ErrAlreadyExists aborts the writer. func (w *IoContentWriter) Commit(ctx context.Context, size int64, expected digest.Digest, opts ...content.Opt) error { return nil } // Status returns the current state of write func (w *IoContentWriter) Status() (content.Status, error) { return content.Status{}, nil } // Truncate updates the size of the target blob func (w *IoContentWriter) Truncate(size int64) error { return nil }
9,816
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/oci.go
package content import ( "encoding/json" "io/ioutil" "os" "path/filepath" "github.com/containerd/containerd/content" "github.com/containerd/containerd/content/local" specs "github.com/opencontainers/image-spec/specs-go" ocispec "github.com/opencontainers/image-spec/specs-go/v1" ) // OCIStore provides content from the file system with the OCI-Image layout. // Reference: https://github.com/opencontainers/image-spec/blob/master/image-layout.md type OCIStore struct { content.Store root string index *ocispec.Index nameMap map[string]ocispec.Descriptor } // NewOCIStore creates a new OCI store func NewOCIStore(rootPath string) (*OCIStore, error) { fileStore, err := local.NewStore(rootPath) if err != nil { return nil, err } store := &OCIStore{ Store: fileStore, root: rootPath, } if err := store.validateOCILayoutFile(); err != nil { return nil, err } if err := store.LoadIndex(); err != nil { return nil, err } return store, nil } // LoadIndex reads the index.json from the file system func (s *OCIStore) LoadIndex() error { path := filepath.Join(s.root, OCIImageIndexFile) indexFile, err := os.Open(path) if err != nil { if !os.IsNotExist(err) { return err } s.index = &ocispec.Index{ Versioned: specs.Versioned{ SchemaVersion: 2, // historical value }, } s.nameMap = make(map[string]ocispec.Descriptor) return nil } defer indexFile.Close() if err := json.NewDecoder(indexFile).Decode(&s.index); err != nil { return err } s.nameMap = make(map[string]ocispec.Descriptor) for _, desc := range s.index.Manifests { if name := desc.Annotations[ocispec.AnnotationRefName]; name != "" { s.nameMap[name] = desc } } return nil } // SaveIndex writes the index.json to the file system func (s *OCIStore) SaveIndex() error { indexJSON, err := json.Marshal(s.index) if err != nil { return err } path := filepath.Join(s.root, OCIImageIndexFile) return ioutil.WriteFile(path, indexJSON, 0644) } // AddReference adds or updates an reference to index. func (s *OCIStore) AddReference(name string, desc ocispec.Descriptor) { if desc.Annotations == nil { desc.Annotations = map[string]string{ ocispec.AnnotationRefName: name, } } else { desc.Annotations[ocispec.AnnotationRefName] = name } if _, ok := s.nameMap[name]; ok { s.nameMap[name] = desc for i, ref := range s.index.Manifests { if name == ref.Annotations[ocispec.AnnotationRefName] { s.index.Manifests[i] = desc return } } // Process should not reach here. // Fallthrough to `Add` scenario and recover. s.index.Manifests = append(s.index.Manifests, desc) return } s.index.Manifests = append(s.index.Manifests, desc) s.nameMap[name] = desc } // DeleteReference deletes an reference from index. func (s *OCIStore) DeleteReference(name string) { if _, ok := s.nameMap[name]; !ok { return } delete(s.nameMap, name) for i, desc := range s.index.Manifests { if name == desc.Annotations[ocispec.AnnotationRefName] { s.index.Manifests[i] = s.index.Manifests[len(s.index.Manifests)-1] s.index.Manifests = s.index.Manifests[:len(s.index.Manifests)-1] return } } } // ListReferences lists all references in index. func (s *OCIStore) ListReferences() map[string]ocispec.Descriptor { return s.nameMap } // validateOCILayoutFile ensures the `oci-layout` file func (s *OCIStore) validateOCILayoutFile() error { layoutFilePath := filepath.Join(s.root, ocispec.ImageLayoutFile) layoutFile, err := os.Open(layoutFilePath) if err != nil { if !os.IsNotExist(err) { return err } layout := ocispec.ImageLayout{ Version: ocispec.ImageLayoutVersion, } layoutJSON, err := json.Marshal(layout) if err != nil { return err } return ioutil.WriteFile(layoutFilePath, layoutJSON, 0644) } defer layoutFile.Close() var layout *ocispec.ImageLayout err = json.NewDecoder(layoutFile).Decode(&layout) if err != nil { return err } if layout.Version != ocispec.ImageLayoutVersion { return ErrUnsupportedVersion } return nil }
9,817
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/file.go
package content import ( "compress/gzip" "context" "io" "io/ioutil" "os" "path/filepath" "strings" "sync" "time" "github.com/containerd/containerd/content" "github.com/containerd/containerd/errdefs" digest "github.com/opencontainers/go-digest" ocispec "github.com/opencontainers/image-spec/specs-go/v1" "github.com/pkg/errors" ) // ensure interface var ( _ ProvideIngester = &FileStore{} ) // FileStore provides content from the file system type FileStore struct { DisableOverwrite bool AllowPathTraversalOnWrite bool // Reproducible enables stripping times from added files Reproducible bool root string descriptor *sync.Map // map[digest.Digest]ocispec.Descriptor pathMap *sync.Map tmpFiles *sync.Map } // NewFileStore creats a new file store func NewFileStore(rootPath string) *FileStore { return &FileStore{ root: rootPath, descriptor: &sync.Map{}, pathMap: &sync.Map{}, tmpFiles: &sync.Map{}, } } // Add adds a file reference func (s *FileStore) Add(name, mediaType, path string) (ocispec.Descriptor, error) { if path == "" { path = name } path = s.MapPath(name, path) fileInfo, err := os.Stat(path) if err != nil { return ocispec.Descriptor{}, err } var desc ocispec.Descriptor if fileInfo.IsDir() { desc, err = s.descFromDir(name, mediaType, path) } else { desc, err = s.descFromFile(fileInfo, mediaType, path) } if err != nil { return ocispec.Descriptor{}, err } if desc.Annotations == nil { desc.Annotations = make(map[string]string) } desc.Annotations[ocispec.AnnotationTitle] = name s.set(desc) return desc, nil } func (s *FileStore) descFromFile(info os.FileInfo, mediaType, path string) (ocispec.Descriptor, error) { file, err := os.Open(path) if err != nil { return ocispec.Descriptor{}, err } defer file.Close() digest, err := digest.FromReader(file) if err != nil { return ocispec.Descriptor{}, err } if mediaType == "" { mediaType = DefaultBlobMediaType } return ocispec.Descriptor{ MediaType: mediaType, Digest: digest, Size: info.Size(), }, nil } func (s *FileStore) descFromDir(name, mediaType, root string) (ocispec.Descriptor, error) { // generate temp file file, err := s.tempFile() if err != nil { return ocispec.Descriptor{}, err } defer file.Close() s.MapPath(name, file.Name()) // compress directory digester := digest.Canonical.Digester() zw := gzip.NewWriter(io.MultiWriter(file, digester.Hash())) defer zw.Close() tarDigester := digest.Canonical.Digester() if err := tarDirectory(root, name, io.MultiWriter(zw, tarDigester.Hash()), s.Reproducible); err != nil { return ocispec.Descriptor{}, err } // flush all if err := zw.Close(); err != nil { return ocispec.Descriptor{}, err } if err := file.Sync(); err != nil { return ocispec.Descriptor{}, err } // generate descriptor if mediaType == "" { mediaType = DefaultBlobDirMediaType } info, err := file.Stat() if err != nil { return ocispec.Descriptor{}, err } return ocispec.Descriptor{ MediaType: mediaType, Digest: digester.Digest(), Size: info.Size(), Annotations: map[string]string{ AnnotationDigest: tarDigester.Digest().String(), AnnotationUnpack: "true", }, }, nil } func (s *FileStore) tempFile() (*os.File, error) { file, err := ioutil.TempFile("", TempFilePattern) if err != nil { return nil, err } s.tmpFiles.Store(file.Name(), file) return file, nil } // Close frees up resources used by the file store func (s *FileStore) Close() error { var errs []string s.tmpFiles.Range(func(name, _ interface{}) bool { if err := os.Remove(name.(string)); err != nil { errs = append(errs, err.Error()) } return true }) return errors.New(strings.Join(errs, "; ")) } // ReaderAt provides contents func (s *FileStore) ReaderAt(ctx context.Context, desc ocispec.Descriptor) (content.ReaderAt, error) { desc, ok := s.get(desc) if !ok { return nil, ErrNotFound } name, ok := ResolveName(desc) if !ok { return nil, ErrNoName } path := s.ResolvePath(name) file, err := os.Open(path) if err != nil { return nil, err } return sizeReaderAt{ readAtCloser: file, size: desc.Size, }, nil } // Writer begins or resumes the active writer identified by desc func (s *FileStore) Writer(ctx context.Context, opts ...content.WriterOpt) (content.Writer, error) { var wOpts content.WriterOpts for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil, err } } desc := wOpts.Desc name, ok := ResolveName(desc) if !ok { return nil, ErrNoName } path, err := s.resolveWritePath(name) if err != nil { return nil, err } file, afterCommit, err := s.createWritePath(path, desc, name) if err != nil { return nil, err } now := time.Now() return &fileWriter{ store: s, file: file, desc: desc, digester: digest.Canonical.Digester(), status: content.Status{ Ref: name, Total: desc.Size, StartedAt: now, UpdatedAt: now, }, afterCommit: afterCommit, }, nil } func (s *FileStore) resolveWritePath(name string) (string, error) { path := s.ResolvePath(name) if !s.AllowPathTraversalOnWrite { base, err := filepath.Abs(s.root) if err != nil { return "", err } target, err := filepath.Abs(path) if err != nil { return "", err } rel, err := filepath.Rel(base, target) if err != nil { return "", ErrPathTraversalDisallowed } rel = filepath.ToSlash(rel) if strings.HasPrefix(rel, "../") || rel == ".." { return "", ErrPathTraversalDisallowed } } if s.DisableOverwrite { if _, err := os.Stat(path); err == nil { return "", ErrOverwriteDisallowed } else if !os.IsNotExist(err) { return "", err } } return path, nil } func (s *FileStore) createWritePath(path string, desc ocispec.Descriptor, prefix string) (*os.File, func() error, error) { if value, ok := desc.Annotations[AnnotationUnpack]; !ok || value != "true" { if err := os.MkdirAll(filepath.Dir(path), 0755); err != nil { return nil, nil, err } file, err := os.Create(path) return file, nil, err } if err := os.MkdirAll(path, 0755); err != nil { return nil, nil, err } file, err := s.tempFile() checksum := desc.Annotations[AnnotationDigest] afterCommit := func() error { return extractTarGzip(path, prefix, file.Name(), checksum) } return file, afterCommit, err } // MapPath maps name to path func (s *FileStore) MapPath(name, path string) string { path = s.resolvePath(path) s.pathMap.Store(name, path) return path } // ResolvePath returns the path by name func (s *FileStore) ResolvePath(name string) string { if value, ok := s.pathMap.Load(name); ok { if path, ok := value.(string); ok { return path } } // using the name as a fallback solution return s.resolvePath(name) } func (s *FileStore) resolvePath(path string) string { if filepath.IsAbs(path) { return path } return filepath.Join(s.root, path) } func (s *FileStore) set(desc ocispec.Descriptor) { s.descriptor.Store(desc.Digest, desc) } func (s *FileStore) get(desc ocispec.Descriptor) (ocispec.Descriptor, bool) { value, ok := s.descriptor.Load(desc.Digest) if !ok { return ocispec.Descriptor{}, false } desc, ok = value.(ocispec.Descriptor) return desc, ok } type fileWriter struct { store *FileStore file *os.File desc ocispec.Descriptor digester digest.Digester status content.Status afterCommit func() error } func (w *fileWriter) Status() (content.Status, error) { return w.status, nil } // Digest returns the current digest of the content, up to the current write. // // Cannot be called concurrently with `Write`. func (w *fileWriter) Digest() digest.Digest { return w.digester.Digest() } // Write p to the transaction. func (w *fileWriter) Write(p []byte) (n int, err error) { n, err = w.file.Write(p) w.digester.Hash().Write(p[:n]) w.status.Offset += int64(len(p)) w.status.UpdatedAt = time.Now() return n, err } func (w *fileWriter) Commit(ctx context.Context, size int64, expected digest.Digest, opts ...content.Opt) error { var base content.Info for _, opt := range opts { if err := opt(&base); err != nil { return err } } if w.file == nil { return errors.Wrap(errdefs.ErrFailedPrecondition, "cannot commit on closed writer") } file := w.file w.file = nil if err := file.Sync(); err != nil { file.Close() return errors.Wrap(err, "sync failed") } fileInfo, err := file.Stat() if err != nil { file.Close() return errors.Wrap(err, "stat failed") } if err := file.Close(); err != nil { return errors.Wrap(err, "failed to close file") } if size > 0 && size != fileInfo.Size() { return errors.Wrapf(errdefs.ErrFailedPrecondition, "unexpected commit size %d, expected %d", fileInfo.Size(), size) } if dgst := w.digester.Digest(); expected != "" && expected != dgst { return errors.Wrapf(errdefs.ErrFailedPrecondition, "unexpected commit digest %s, expected %s", dgst, expected) } w.store.set(w.desc) if w.afterCommit != nil { return w.afterCommit() } return nil } // Close the writer, flushing any unwritten data and leaving the progress in // tact. func (w *fileWriter) Close() error { if w.file == nil { return nil } w.file.Sync() err := w.file.Close() w.file = nil return err } func (w *fileWriter) Truncate(size int64) error { if size != 0 { return ErrUnsupportedSize } w.status.Offset = 0 w.digester.Hash().Reset() if _, err := w.file.Seek(0, io.SeekStart); err != nil { return err } return w.file.Truncate(0) }
9,818
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/multireader.go
package content import ( "context" "fmt" "github.com/containerd/containerd/content" ocispec "github.com/opencontainers/image-spec/specs-go/v1" ) // MultiReader store to read content from multiple stores. It finds the content by asking each underlying // store to find the content, which it does based on the hash. // // Example: // fileStore := NewFileStore(rootPath) // memoryStore := NewMemoryStore() // // load up content in fileStore and memoryStore // multiStore := MultiReader([]content.Provider{fileStore, memoryStore}) // // You now can use multiStore anywhere that content.Provider is accepted type MultiReader struct { stores []content.Provider } // AddStore add a store to read from func (m *MultiReader) AddStore(store ...content.Provider) { m.stores = append(m.stores, store...) } // ReaderAt get a reader func (m MultiReader) ReaderAt(ctx context.Context, desc ocispec.Descriptor) (content.ReaderAt, error) { for _, store := range m.stores { r, err := store.ReaderAt(ctx, desc) if r != nil && err == nil { return r, nil } } // we did not find any return nil, fmt.Errorf("not found") }
9,819
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/consts.go
package content import ( "github.com/opencontainers/go-digest" ocispec "github.com/opencontainers/image-spec/specs-go/v1" ) const ( // DefaultBlobMediaType specifies the default blob media type DefaultBlobMediaType = ocispec.MediaTypeImageLayer // DefaultBlobDirMediaType specifies the default blob directory media type DefaultBlobDirMediaType = ocispec.MediaTypeImageLayerGzip ) const ( // TempFilePattern specifies the pattern to create temporary files TempFilePattern = "oras" ) const ( // AnnotationDigest is the annotation key for the digest of the uncompressed content AnnotationDigest = "io.deis.oras.content.digest" // AnnotationUnpack is the annotation key for indication of unpacking AnnotationUnpack = "io.deis.oras.content.unpack" ) const ( // OCIImageIndexFile is the file name of the index from the OCI Image Layout Specification // Reference: https://github.com/opencontainers/image-spec/blob/master/image-layout.md#indexjson-file OCIImageIndexFile = "index.json" ) const ( // DefaultBlocksize default size of each slice of bytes read in each write through in gunzipand untar. // Simply uses the same size as io.Copy() DefaultBlocksize = 32768 ) const ( // what you get for a blank digest BlankHash = digest.Digest("sha256:e3b0c44298fc1c149afbf4c8996fb92427ae41e4649b934ca495991b7852b855") )
9,820
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/utils.go
package content import ( "archive/tar" "compress/gzip" "fmt" "io" "os" "path/filepath" "strings" "time" digest "github.com/opencontainers/go-digest" ocispec "github.com/opencontainers/image-spec/specs-go/v1" "github.com/pkg/errors" ) // ResolveName resolves name from descriptor func ResolveName(desc ocispec.Descriptor) (string, bool) { name, ok := desc.Annotations[ocispec.AnnotationTitle] return name, ok } // tarDirectory walks the directory specified by path, and tar those files with a new // path prefix. func tarDirectory(root, prefix string, w io.Writer, stripTimes bool) error { tw := tar.NewWriter(w) defer tw.Close() if err := filepath.Walk(root, func(path string, info os.FileInfo, err error) error { if err != nil { return err } // Rename path name, err := filepath.Rel(root, path) if err != nil { return err } name = filepath.Join(prefix, name) name = filepath.ToSlash(name) // Generate header var link string mode := info.Mode() if mode&os.ModeSymlink != 0 { if link, err = os.Readlink(path); err != nil { return err } } header, err := tar.FileInfoHeader(info, link) if err != nil { return errors.Wrap(err, path) } header.Name = name header.Uid = 0 header.Gid = 0 header.Uname = "" header.Gname = "" if stripTimes { header.ModTime = time.Time{} header.AccessTime = time.Time{} header.ChangeTime = time.Time{} } // Write file if err := tw.WriteHeader(header); err != nil { return errors.Wrap(err, "tar") } if mode.IsRegular() { file, err := os.Open(path) if err != nil { return err } defer file.Close() if _, err := io.Copy(tw, file); err != nil { return errors.Wrap(err, path) } } return nil }); err != nil { return err } return nil } // extractTarDirectory extracts tar file to a directory specified by the `root` // parameter. The file name prefix is ensured to be the string specified by the // `prefix` parameter and is trimmed. func extractTarDirectory(root, prefix string, r io.Reader) error { tr := tar.NewReader(r) for { header, err := tr.Next() if err != nil { if err == io.EOF { return nil } return err } // Name check name := header.Name path, err := ensureBasePath(root, prefix, name) if err != nil { return err } path = filepath.Join(root, path) // Link check switch header.Typeflag { case tar.TypeLink, tar.TypeSymlink: link := header.Linkname if !filepath.IsAbs(link) { link = filepath.Join(filepath.Dir(name), link) } if _, err := ensureBasePath(root, prefix, link); err != nil { return err } } // Create content switch header.Typeflag { case tar.TypeReg: err = writeFile(path, tr, header.FileInfo().Mode()) case tar.TypeDir: err = os.MkdirAll(path, header.FileInfo().Mode()) case tar.TypeLink: err = os.Link(header.Linkname, path) case tar.TypeSymlink: err = os.Symlink(header.Linkname, path) default: continue // Non-regular files are skipped } if err != nil { return err } // Change access time and modification time if possible (error ignored) os.Chtimes(path, header.AccessTime, header.ModTime) } } // ensureBasePath ensures the target path is in the base path, // returning its relative path to the base path. func ensureBasePath(root, base, target string) (string, error) { path, err := filepath.Rel(base, target) if err != nil { return "", err } cleanPath := filepath.ToSlash(filepath.Clean(path)) if cleanPath == ".." || strings.HasPrefix(cleanPath, "../") { return "", fmt.Errorf("%q is outside of %q", target, base) } // No symbolic link allowed in the relative path dir := filepath.Dir(path) for dir != "." { if info, err := os.Lstat(filepath.Join(root, dir)); err != nil { if !os.IsNotExist(err) { return "", err } } else if info.Mode()&os.ModeSymlink != 0 { return "", fmt.Errorf("no symbolic link allowed between %q and %q", base, target) } dir = filepath.Dir(dir) } return path, nil } func writeFile(path string, r io.Reader, perm os.FileMode) error { file, err := os.OpenFile(path, os.O_WRONLY|os.O_CREATE|os.O_TRUNC, perm) if err != nil { return err } defer file.Close() _, err = io.Copy(file, r) return err } func extractTarGzip(root, prefix, filename, checksum string) error { file, err := os.Open(filename) if err != nil { return err } defer file.Close() zr, err := gzip.NewReader(file) if err != nil { return err } defer zr.Close() var r io.Reader = zr var verifier digest.Verifier if checksum != "" { if digest, err := digest.Parse(checksum); err == nil { verifier = digest.Verifier() r = io.TeeReader(r, verifier) } } if err := extractTarDirectory(root, prefix, r); err != nil { return err } if verifier != nil && !verifier.Verified() { return errors.New("content digest mismatch") } return nil }
9,821
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/untar.go
package content import ( "archive/tar" "fmt" "io" "github.com/containerd/containerd/content" ) // NewUntarWriter wrap a writer with an untar, so that the stream is untarred // // By default, it calculates the hash when writing. If the option `skipHash` is true, // it will skip doing the hash. Skipping the hash is intended to be used only // if you are confident about the validity of the data being passed to the writer, // and wish to save on the hashing time. func NewUntarWriter(writer content.Writer, opts ...WriterOpt) content.Writer { // process opts for default wOpts := DefaultWriterOpts() for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil } } return NewPassthroughWriter(writer, func(r io.Reader, w io.Writer, done chan<- error) { tr := tar.NewReader(r) var err error for { _, err := tr.Next() if err == io.EOF { // clear the error, since we do not pass an io.EOF err = nil break // End of archive } if err != nil { // pass the error on err = fmt.Errorf("UntarWriter tar file header read error: %v", err) break } // write out the untarred data // we can handle io.EOF, just go to the next file // any other errors should stop and get reported b := make([]byte, wOpts.Blocksize, wOpts.Blocksize) for { var n int n, err = tr.Read(b) if err != nil && err != io.EOF { err = fmt.Errorf("UntarWriter file data read error: %v\n", err) break } l := n if n > len(b) { l = len(b) } if _, err2 := w.Write(b[:l]); err2 != nil { err = fmt.Errorf("UntarWriter error writing to underlying writer: %v", err2) break } if err == io.EOF { // go to the next file break } } // did we break with a non-nil and non-EOF error? if err != nil && err != io.EOF { break } } done <- err }, opts...) } // NewUntarWriterByName wrap multiple writers with an untar, so that the stream is untarred and passed // to the appropriate writer, based on the filename. If a filename is not found, it will not pass it // to any writer. The filename "" will handle any stream that does not have a specific filename; use // it for the default of a single file in a tar stream. func NewUntarWriterByName(writers map[string]content.Writer, opts ...WriterOpt) content.Writer { // process opts for default wOpts := DefaultWriterOpts() for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil } } // construct an array of content.Writer nameToIndex := map[string]int{} var writerSlice []content.Writer for name, writer := range writers { writerSlice = append(writerSlice, writer) nameToIndex[name] = len(writerSlice) - 1 } // need a PassthroughMultiWriter here return NewPassthroughMultiWriter(writerSlice, func(r io.Reader, ws []io.Writer, done chan<- error) { tr := tar.NewReader(r) var err error for { header, err := tr.Next() if err == io.EOF { // clear the error, since we do not pass an io.EOF err = nil break // End of archive } if err != nil { // pass the error on err = fmt.Errorf("UntarWriter tar file header read error: %v", err) break } // get the filename filename := header.Name index, ok := nameToIndex[filename] if !ok { index, ok = nameToIndex[""] if !ok { // we did not find this file or the wildcard, so do not process this file continue } } // write out the untarred data // we can handle io.EOF, just go to the next file // any other errors should stop and get reported b := make([]byte, wOpts.Blocksize, wOpts.Blocksize) for { var n int n, err = tr.Read(b) if err != nil && err != io.EOF { err = fmt.Errorf("UntarWriter file data read error: %v\n", err) break } l := n if n > len(b) { l = len(b) } if _, err2 := ws[index].Write(b[:l]); err2 != nil { err = fmt.Errorf("UntarWriter error writing to underlying writer at index %d for name '%s': %v", index, filename, err2) break } if err == io.EOF { // go to the next file break } } // did we break with a non-nil and non-EOF error? if err != nil && err != io.EOF { break } } done <- err }, opts...) }
9,822
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/passthrough.go
package content import ( "context" "errors" "io" "time" "github.com/containerd/containerd/content" "github.com/opencontainers/go-digest" ) // PassthroughWriter takes an input stream and passes it through to an underlying writer, // while providing the ability to manipulate the stream before it gets passed through type PassthroughWriter struct { writer content.Writer pipew *io.PipeWriter digester digest.Digester size int64 underlyingWriter *underlyingWriter reader *io.PipeReader hash *digest.Digest done chan error } // NewPassthroughWriter creates a pass-through writer that allows for processing // the content via an arbitrary function. The function should do whatever processing it // wants, reading from the Reader to the Writer. When done, it must indicate via // sending an error or nil to the Done func NewPassthroughWriter(writer content.Writer, f func(r io.Reader, w io.Writer, done chan<- error), opts ...WriterOpt) content.Writer { // process opts for default wOpts := DefaultWriterOpts() for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil } } r, w := io.Pipe() pw := &PassthroughWriter{ writer: writer, pipew: w, digester: digest.Canonical.Digester(), underlyingWriter: &underlyingWriter{ writer: writer, digester: digest.Canonical.Digester(), hash: wOpts.OutputHash, }, reader: r, hash: wOpts.InputHash, done: make(chan error, 1), } go f(r, pw.underlyingWriter, pw.done) return pw } func (pw *PassthroughWriter) Write(p []byte) (n int, err error) { n, err = pw.pipew.Write(p) if pw.hash == nil { pw.digester.Hash().Write(p[:n]) } pw.size += int64(n) return } func (pw *PassthroughWriter) Close() error { pw.pipew.Close() pw.writer.Close() return nil } // Digest may return empty digest or panics until committed. func (pw *PassthroughWriter) Digest() digest.Digest { if pw.hash != nil { return *pw.hash } return pw.digester.Digest() } // Commit commits the blob (but no roll-back is guaranteed on an error). // size and expected can be zero-value when unknown. // Commit always closes the writer, even on error. // ErrAlreadyExists aborts the writer. func (pw *PassthroughWriter) Commit(ctx context.Context, size int64, expected digest.Digest, opts ...content.Opt) error { pw.pipew.Close() err := <-pw.done pw.reader.Close() if err != nil && err != io.EOF { return err } // Some underlying writers will validate an expected digest, so we need the option to pass it // that digest. That is why we caluclate the digest of the underlying writer throughout the write process. return pw.writer.Commit(ctx, pw.underlyingWriter.size, pw.underlyingWriter.Digest(), opts...) } // Status returns the current state of write func (pw *PassthroughWriter) Status() (content.Status, error) { return pw.writer.Status() } // Truncate updates the size of the target blob func (pw *PassthroughWriter) Truncate(size int64) error { return pw.writer.Truncate(size) } // underlyingWriter implementation of io.Writer to write to the underlying // io.Writer type underlyingWriter struct { writer content.Writer digester digest.Digester size int64 hash *digest.Digest } // Write write to the underlying writer func (u *underlyingWriter) Write(p []byte) (int, error) { n, err := u.writer.Write(p) if err != nil { return 0, err } if u.hash == nil { u.digester.Hash().Write(p) } u.size += int64(len(p)) return n, nil } // Size get total size written func (u *underlyingWriter) Size() int64 { return u.size } // Digest may return empty digest or panics until committed. func (u *underlyingWriter) Digest() digest.Digest { if u.hash != nil { return *u.hash } return u.digester.Digest() } // PassthroughMultiWriter single writer that passes through to multiple writers, allowing the passthrough // function to select which writer to use. type PassthroughMultiWriter struct { writers []*PassthroughWriter pipew *io.PipeWriter digester digest.Digester size int64 reader *io.PipeReader hash *digest.Digest done chan error startedAt time.Time updatedAt time.Time ref string } func NewPassthroughMultiWriter(writers []content.Writer, f func(r io.Reader, w []io.Writer, done chan<- error), opts ...WriterOpt) content.Writer { // process opts for default wOpts := DefaultWriterOpts() for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil } } var pws []*PassthroughWriter r, w := io.Pipe() for _, writer := range writers { pws = append(pws, &PassthroughWriter{ writer: writer, pipew: w, digester: digest.Canonical.Digester(), underlyingWriter: &underlyingWriter{ writer: writer, digester: digest.Canonical.Digester(), hash: wOpts.OutputHash, }, reader: r, hash: wOpts.InputHash, done: make(chan error, 1), }) } pmw := &PassthroughMultiWriter{ writers: pws, startedAt: time.Now(), updatedAt: time.Now(), done: make(chan error, 1), } // get our output writers var uws []io.Writer for _, uw := range pws { uws = append(uws, uw.underlyingWriter) } go f(r, uws, pmw.done) return pmw } func (pmw *PassthroughMultiWriter) Write(p []byte) (n int, err error) { n, err = pmw.pipew.Write(p) if pmw.hash == nil { pmw.digester.Hash().Write(p[:n]) } pmw.size += int64(n) pmw.updatedAt = time.Now() return } func (pmw *PassthroughMultiWriter) Close() error { pmw.pipew.Close() for _, w := range pmw.writers { w.Close() } return nil } // Digest may return empty digest or panics until committed. func (pmw *PassthroughMultiWriter) Digest() digest.Digest { if pmw.hash != nil { return *pmw.hash } return pmw.digester.Digest() } // Commit commits the blob (but no roll-back is guaranteed on an error). // size and expected can be zero-value when unknown. // Commit always closes the writer, even on error. // ErrAlreadyExists aborts the writer. func (pmw *PassthroughMultiWriter) Commit(ctx context.Context, size int64, expected digest.Digest, opts ...content.Opt) error { pmw.pipew.Close() err := <-pmw.done pmw.reader.Close() if err != nil && err != io.EOF { return err } // Some underlying writers will validate an expected digest, so we need the option to pass it // that digest. That is why we caluclate the digest of the underlying writer throughout the write process. for _, w := range pmw.writers { // maybe this should be Commit(ctx, pw.underlyingWriter.size, pw.underlyingWriter.Digest(), opts...) w.done <- err if err := w.Commit(ctx, size, expected, opts...); err != nil { return err } } return nil } // Status returns the current state of write func (pmw *PassthroughMultiWriter) Status() (content.Status, error) { return content.Status{ StartedAt: pmw.startedAt, UpdatedAt: pmw.updatedAt, Total: pmw.size, }, nil } // Truncate updates the size of the target blob, but cannot do anything with a multiwriter func (pmw *PassthroughMultiWriter) Truncate(size int64) error { return errors.New("truncate unavailable on multiwriter") }
9,823
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/errors.go
package content import "errors" // Common errors var ( ErrNotFound = errors.New("not_found") ErrNoName = errors.New("no_name") ErrUnsupportedSize = errors.New("unsupported_size") ErrUnsupportedVersion = errors.New("unsupported_version") ) // FileStore errors var ( ErrPathTraversalDisallowed = errors.New("path_traversal_disallowed") ErrOverwriteDisallowed = errors.New("overwrite_disallowed") )
9,824
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/gunzip.go
package content import ( "compress/gzip" "fmt" "io" "github.com/containerd/containerd/content" ) // NewGunzipWriter wrap a writer with a gunzip, so that the stream is gunzipped // // By default, it calculates the hash when writing. If the option `skipHash` is true, // it will skip doing the hash. Skipping the hash is intended to be used only // if you are confident about the validity of the data being passed to the writer, // and wish to save on the hashing time. func NewGunzipWriter(writer content.Writer, opts ...WriterOpt) content.Writer { // process opts for default wOpts := DefaultWriterOpts() for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil } } return NewPassthroughWriter(writer, func(r io.Reader, w io.Writer, done chan<- error) { gr, err := gzip.NewReader(r) if err != nil { done <- fmt.Errorf("error creating gzip reader: %v", err) return } // write out the uncompressed data b := make([]byte, wOpts.Blocksize, wOpts.Blocksize) for { var n int n, err = gr.Read(b) if err != nil && err != io.EOF { err = fmt.Errorf("GunzipWriter data read error: %v\n", err) break } l := n if n > len(b) { l = len(b) } if _, err2 := w.Write(b[:l]); err2 != nil { err = fmt.Errorf("GunzipWriter: error writing to underlying writer: %v", err2) break } if err == io.EOF { // clear the error err = nil break } } gr.Close() done <- err }, opts...) }
9,825
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/memory.go
package content import ( "bytes" "context" "sync" "time" "github.com/containerd/containerd/content" "github.com/containerd/containerd/errdefs" digest "github.com/opencontainers/go-digest" ocispec "github.com/opencontainers/image-spec/specs-go/v1" "github.com/pkg/errors" ) // ensure interface var ( _ content.Provider = &Memorystore{} _ content.Ingester = &Memorystore{} ) // Memorystore provides content from the memory type Memorystore struct { descriptor map[digest.Digest]ocispec.Descriptor content map[digest.Digest][]byte nameMap map[string]ocispec.Descriptor lock *sync.Mutex } // NewMemoryStore creats a new memory store func NewMemoryStore() *Memorystore { return &Memorystore{ descriptor: make(map[digest.Digest]ocispec.Descriptor), content: make(map[digest.Digest][]byte), nameMap: make(map[string]ocispec.Descriptor), lock: &sync.Mutex{}, } } // Add adds content func (s *Memorystore) Add(name, mediaType string, content []byte) ocispec.Descriptor { var annotations map[string]string if name != "" { annotations = map[string]string{ ocispec.AnnotationTitle: name, } } if mediaType == "" { mediaType = DefaultBlobMediaType } desc := ocispec.Descriptor{ MediaType: mediaType, Digest: digest.FromBytes(content), Size: int64(len(content)), Annotations: annotations, } s.Set(desc, content) return desc } // ReaderAt provides contents func (s *Memorystore) ReaderAt(ctx context.Context, desc ocispec.Descriptor) (content.ReaderAt, error) { desc, content, ok := s.Get(desc) if !ok { return nil, ErrNotFound } return sizeReaderAt{ readAtCloser: nopCloser{ ReaderAt: bytes.NewReader(content), }, size: desc.Size, }, nil } // Writer begins or resumes the active writer identified by desc func (s *Memorystore) Writer(ctx context.Context, opts ...content.WriterOpt) (content.Writer, error) { var wOpts content.WriterOpts for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil, err } } desc := wOpts.Desc name, _ := ResolveName(desc) now := time.Now() return &memoryWriter{ store: s, buffer: bytes.NewBuffer(nil), desc: desc, digester: digest.Canonical.Digester(), status: content.Status{ Ref: name, Total: desc.Size, StartedAt: now, UpdatedAt: now, }, }, nil } // Set adds the content to the store func (s *Memorystore) Set(desc ocispec.Descriptor, content []byte) { s.lock.Lock() defer s.lock.Unlock() s.descriptor[desc.Digest] = desc s.content[desc.Digest] = content if name, ok := ResolveName(desc); ok && name != "" { s.nameMap[name] = desc } } // Get finds the content from the store func (s *Memorystore) Get(desc ocispec.Descriptor) (ocispec.Descriptor, []byte, bool) { s.lock.Lock() defer s.lock.Unlock() desc, ok := s.descriptor[desc.Digest] if !ok { return ocispec.Descriptor{}, nil, false } content, ok := s.content[desc.Digest] return desc, content, ok } // GetByName finds the content from the store by name (i.e. AnnotationTitle) func (s *Memorystore) GetByName(name string) (ocispec.Descriptor, []byte, bool) { s.lock.Lock() defer s.lock.Unlock() desc, ok := s.nameMap[name] if !ok { return ocispec.Descriptor{}, nil, false } content, ok := s.content[desc.Digest] return desc, content, ok } type memoryWriter struct { store *Memorystore buffer *bytes.Buffer desc ocispec.Descriptor digester digest.Digester status content.Status } func (w *memoryWriter) Status() (content.Status, error) { return w.status, nil } // Digest returns the current digest of the content, up to the current write. // // Cannot be called concurrently with `Write`. func (w *memoryWriter) Digest() digest.Digest { return w.digester.Digest() } // Write p to the transaction. func (w *memoryWriter) Write(p []byte) (n int, err error) { n, err = w.buffer.Write(p) w.digester.Hash().Write(p[:n]) w.status.Offset += int64(len(p)) w.status.UpdatedAt = time.Now() return n, err } func (w *memoryWriter) Commit(ctx context.Context, size int64, expected digest.Digest, opts ...content.Opt) error { var base content.Info for _, opt := range opts { if err := opt(&base); err != nil { return err } } if w.buffer == nil { return errors.Wrap(errdefs.ErrFailedPrecondition, "cannot commit on closed writer") } content := w.buffer.Bytes() w.buffer = nil if size > 0 && size != int64(len(content)) { return errors.Wrapf(errdefs.ErrFailedPrecondition, "unexpected commit size %d, expected %d", len(content), size) } if dgst := w.digester.Digest(); expected != "" && expected != dgst { return errors.Wrapf(errdefs.ErrFailedPrecondition, "unexpected commit digest %s, expected %s", dgst, expected) } w.store.Set(w.desc, content) return nil } func (w *memoryWriter) Close() error { w.buffer = nil return nil } func (w *memoryWriter) Truncate(size int64) error { if size != 0 { return ErrUnsupportedSize } w.status.Offset = 0 w.digester.Hash().Reset() w.buffer.Truncate(0) return nil }
9,826
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/multiwriter.go
package content import ( "context" ctrcontent "github.com/containerd/containerd/content" ) // MultiWriterIngester an ingester that can provide a single writer or multiple writers for a single // descriptor. Useful when the target of a descriptor can have multiple items within it, e.g. a layer // that is a tar file with multiple files, each of which should go to a different stream, some of which // should not be handled at all type MultiWriterIngester interface { ctrcontent.Ingester Writers(ctx context.Context, opts ...ctrcontent.WriterOpt) (map[string]ctrcontent.Writer, error) }
9,827
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/opts.go
package content import ( "errors" "github.com/opencontainers/go-digest" ) type WriterOpts struct { InputHash *digest.Digest OutputHash *digest.Digest Blocksize int MultiWriterIngester bool } type WriterOpt func(*WriterOpts) error func DefaultWriterOpts() WriterOpts { return WriterOpts{ InputHash: nil, OutputHash: nil, Blocksize: DefaultBlocksize, } } // WithInputHash provide the expected input hash to a writer. Writers // may suppress their own calculation of a hash on the stream, taking this // hash instead. If the Writer processes the data before passing it on to another // Writer layer, this is the hash of the *input* stream. // // To have a blank hash, use WithInputHash(BlankHash). func WithInputHash(hash digest.Digest) WriterOpt { return func(w *WriterOpts) error { w.InputHash = &hash return nil } } // WithOutputHash provide the expected output hash to a writer. Writers // may suppress their own calculation of a hash on the stream, taking this // hash instead. If the Writer processes the data before passing it on to another // Writer layer, this is the hash of the *output* stream. // // To have a blank hash, use WithInputHash(BlankHash). func WithOutputHash(hash digest.Digest) WriterOpt { return func(w *WriterOpts) error { w.OutputHash = &hash return nil } } // WithBlocksize set the blocksize used by the processor of data. // The default is DefaultBlocksize, which is the same as that used by io.Copy. // Includes a safety check to ensure the caller doesn't actively set it to <= 0. func WithBlocksize(blocksize int) WriterOpt { return func(w *WriterOpts) error { if blocksize <= 0 { return errors.New("blocksize must be greater than or equal to 0") } w.Blocksize = blocksize return nil } } // WithMultiWriterIngester the passed ingester also implements MultiWriter // and should be used as such. If this is set to true, but the ingester does not // implement MultiWriter, calling Writer should return an error. func WithMultiWriterIngester() WriterOpt { return func(w *WriterOpts) error { w.MultiWriterIngester = true return nil } }
9,828
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/readerat.go
package content import ( "io" "github.com/containerd/containerd/content" ) // ensure interface var ( _ content.ReaderAt = sizeReaderAt{} ) type readAtCloser interface { io.ReaderAt io.Closer } type sizeReaderAt struct { readAtCloser size int64 } func (ra sizeReaderAt) Size() int64 { return ra.size } type nopCloser struct { io.ReaderAt } func (nopCloser) Close() error { return nil }
9,829
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/content/decompressstore.go
package content import ( "context" "errors" "strings" ctrcontent "github.com/containerd/containerd/content" ) // DecompressStore store to decompress content and extract from tar, if needed, wrapping // another store. By default, a FileStore will simply take each artifact and write it to // a file, as a MemoryStore will do into memory. If the artifact is gzipped or tarred, // you might want to store the actual object inside tar or gzip. Wrap your Store // with DecompressStore, and it will check the media-type and, if relevant, // gunzip and/or untar. // // For example: // // fileStore := NewFileStore(rootPath) // decompressStore := store.NewDecompressStore(fileStore, WithBlocksize(blocksize)) // // The above example works if there is no tar, i.e. each artifact is just a single file, perhaps gzipped, // or if there is only one file in each tar archive. In other words, when each content.Writer has only one target output stream. // However, if you have multiple files in each tar archive, each archive of which is an artifact layer, then // you need a way to select how to handle each file in the tar archive. In other words, when each content.Writer has more than one // target output stream. In that case, use the following example: // // multiStore := NewMultiStore(rootPath) // some store that can handle different filenames // decompressStore := store.NewDecompressStore(multiStore, WithBlocksize(blocksize), WithMultiWriterIngester()) // type DecompressStore struct { ingester ctrcontent.Ingester blocksize int multiWriterIngester bool } func NewDecompressStore(ingester ctrcontent.Ingester, opts ...WriterOpt) DecompressStore { // we have to reprocess the opts to find the blocksize var wOpts WriterOpts for _, opt := range opts { if err := opt(&wOpts); err != nil { // TODO: we probably should handle errors here continue } } return DecompressStore{ingester, wOpts.Blocksize, wOpts.MultiWriterIngester} } // Writer get a writer func (d DecompressStore) Writer(ctx context.Context, opts ...ctrcontent.WriterOpt) (ctrcontent.Writer, error) { // the logic is straightforward: // - if there is a desc in the opts, and the mediatype is tar or tar+gzip, then pass the correct decompress writer // - else, pass the regular writer var ( writer ctrcontent.Writer err error multiIngester MultiWriterIngester ok bool ) // check to see if we are supposed to use a MultiWriterIngester if d.multiWriterIngester { multiIngester, ok = d.ingester.(MultiWriterIngester) if !ok { return nil, errors.New("configured to use multiwriter ingester, but ingester does not implement multiwriter") } } // we have to reprocess the opts to find the desc var wOpts ctrcontent.WriterOpts for _, opt := range opts { if err := opt(&wOpts); err != nil { return nil, err } } // figure out if compression and/or archive exists desc := wOpts.Desc // before we pass it down, we need to strip anything we are removing here // and possibly update the digest, since the store indexes things by digest hasGzip, hasTar, modifiedMediaType := checkCompression(desc.MediaType) wOpts.Desc.MediaType = modifiedMediaType opts = append(opts, ctrcontent.WithDescriptor(wOpts.Desc)) // determine if we pass it blocksize, only if positive writerOpts := []WriterOpt{} if d.blocksize > 0 { writerOpts = append(writerOpts, WithBlocksize(d.blocksize)) } writer, err = d.ingester.Writer(ctx, opts...) if err != nil { return nil, err } // do we need to wrap with an untar writer? if hasTar { // if not multiingester, get a regular writer if multiIngester == nil { writer = NewUntarWriter(writer, writerOpts...) } else { writers, err := multiIngester.Writers(ctx, opts...) if err != nil { return nil, err } writer = NewUntarWriterByName(writers, writerOpts...) } } if hasGzip { if writer == nil { writer, err = d.ingester.Writer(ctx, opts...) if err != nil { return nil, err } } writer = NewGunzipWriter(writer, writerOpts...) } return writer, nil } // checkCompression check if the mediatype uses gzip compression or tar. // Returns if it has gzip and/or tar, as well as the base media type without // those suffixes. func checkCompression(mediaType string) (gzip, tar bool, mt string) { mt = mediaType gzipSuffix := "+gzip" tarSuffix := ".tar" if strings.HasSuffix(mt, gzipSuffix) { mt = mt[:len(mt)-len(gzipSuffix)] gzip = true } if strings.HasSuffix(mt, tarSuffix) { mt = mt[:len(mt)-len(tarSuffix)] tar = true } return }
9,830
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/auth/client.go
package auth import ( "context" "errors" "net/http" "github.com/containerd/containerd/remotes" ) // Common errors var ( ErrNotLoggedIn = errors.New("not logged in") ) // Client provides authentication operations for remotes. type Client interface { // Login logs in to a remote server identified by the hostname. Login(ctx context.Context, hostname, username, secret string, insecure bool) error // Logout logs out from a remote server identified by the hostname. Logout(ctx context.Context, hostname string) error // Resolver returns a new authenticated resolver. Resolver(ctx context.Context, client *http.Client, plainHTTP bool) (remotes.Resolver, error) }
9,831
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/auth
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/auth/docker/client.go
package docker import ( "os" "github.com/deislabs/oras/pkg/auth" "github.com/docker/cli/cli/config" "github.com/docker/cli/cli/config/configfile" "github.com/docker/cli/cli/config/credentials" "github.com/pkg/errors" ) // Client provides authentication operations for docker registries. type Client struct { configs []*configfile.ConfigFile } // NewClient creates a new auth client based on provided config paths. // If not config path is provided, the default path is used. // Credentials are read from the first config and fall backs to next. // All changes will only be written to the first config file. func NewClient(configPaths ...string) (auth.Client, error) { if len(configPaths) == 0 { cfg, err := config.Load(config.Dir()) if err != nil { return nil, err } if !cfg.ContainsAuth() { cfg.CredentialsStore = credentials.DetectDefaultStore(cfg.CredentialsStore) } return &Client{ configs: []*configfile.ConfigFile{cfg}, }, nil } var configs []*configfile.ConfigFile for _, path := range configPaths { cfg, err := loadConfigFile(path) if err != nil { return nil, errors.Wrap(err, path) } configs = append(configs, cfg) } return &Client{ configs: configs, }, nil } func (c *Client) primaryCredentialsStore(hostname string) credentials.Store { return c.configs[0].GetCredentialsStore(hostname) } // loadConfigFile reads the configuration files from the given path. func loadConfigFile(path string) (*configfile.ConfigFile, error) { cfg := configfile.New(path) if _, err := os.Stat(path); err == nil { file, err := os.Open(path) if err != nil { return nil, err } defer file.Close() if err := cfg.LoadFromReader(file); err != nil { return nil, err } } else if !os.IsNotExist(err) { return nil, err } if !cfg.ContainsAuth() { cfg.CredentialsStore = credentials.DetectDefaultStore(cfg.CredentialsStore) } return cfg, nil }
9,832
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/auth
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/auth/docker/login.go
package docker import ( "context" ctypes "github.com/docker/cli/cli/config/types" "github.com/docker/docker/api/types" "github.com/docker/docker/registry" ) // Login logs in to a docker registry identified by the hostname. func (c *Client) Login(ctx context.Context, hostname, username, secret string, insecure bool) error { hostname = resolveHostname(hostname) cred := types.AuthConfig{ Username: username, ServerAddress: hostname, } if username == "" { cred.IdentityToken = secret } else { cred.Password = secret } opts := registry.ServiceOptions{} if insecure { opts.InsecureRegistries = []string{hostname} } // Login to ensure valid credential remote, err := registry.NewService(opts) if err != nil { return err } if _, token, err := remote.Auth(ctx, &cred, "oras"); err != nil { return err } else if token != "" { cred.Username = "" cred.Password = "" cred.IdentityToken = token } // Store credential return c.primaryCredentialsStore(hostname).Store(ctypes.AuthConfig(cred)) }
9,833
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/auth
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/auth/docker/logout.go
package docker import ( "context" "github.com/deislabs/oras/pkg/auth" "github.com/docker/cli/cli/config/configfile" ) // Logout logs out from a docker registry identified by the hostname. func (c *Client) Logout(_ context.Context, hostname string) error { hostname = resolveHostname(hostname) var configs []*configfile.ConfigFile for _, config := range c.configs { if _, ok := config.AuthConfigs[hostname]; ok { configs = append(configs, config) } } if len(configs) == 0 { return auth.ErrNotLoggedIn } // Log out form the primary config only as backups are read-only. return c.primaryCredentialsStore(hostname).Erase(hostname) }
9,834
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/auth
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/auth/docker/resolver.go
package docker import ( "context" "net/http" "github.com/containerd/containerd/remotes" "github.com/containerd/containerd/remotes/docker" ctypes "github.com/docker/cli/cli/config/types" "github.com/docker/docker/registry" ) // Resolver returns a new authenticated resolver. func (c *Client) Resolver(_ context.Context, client *http.Client, plainHTTP bool) (remotes.Resolver, error) { return docker.NewResolver(docker.ResolverOptions{ Credentials: c.Credential, Client: client, PlainHTTP: plainHTTP, }), nil } // Credential returns the login credential of the request host. func (c *Client) Credential(hostname string) (string, string, error) { hostname = resolveHostname(hostname) var ( auth ctypes.AuthConfig err error ) for _, cfg := range c.configs { auth, err = cfg.GetAuthConfig(hostname) if err != nil { // fall back to next config continue } if auth.IdentityToken != "" { return "", auth.IdentityToken, nil } if auth.Username == "" && auth.Password == "" { // fall back to next config continue } return auth.Username, auth.Password, nil } return "", "", err } // resolveHostname resolves Docker specific hostnames func resolveHostname(hostname string) string { switch hostname { case registry.IndexHostname, registry.IndexName, registry.DefaultV2Registry.Host: return registry.IndexServer } return hostname }
9,835
0
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg
kubeflow_public_repos/fate-operator/vendor/github.com/deislabs/oras/pkg/artifact/consts.go
package artifact const ( // UnknownConfigMediaType is the default mediaType used when no // config media type is specified. UnknownConfigMediaType = "application/vnd.unknown.config.v1+json" )
9,836
0
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io/jsonpath/README.md
[![GoDoc](https://godoc.org/github.com/exponent-io/jsonpath?status.svg)](https://godoc.org/github.com/exponent-io/jsonpath) [![Build Status](https://travis-ci.org/exponent-io/jsonpath.svg?branch=master)](https://travis-ci.org/exponent-io/jsonpath) # jsonpath This package extends the [json.Decoder](https://golang.org/pkg/encoding/json/#Decoder) to support navigating a stream of JSON tokens. You should be able to use this extended Decoder places where a json.Decoder would have been used. This Decoder has the following enhancements... * The [Scan](https://godoc.org/github.com/exponent-io/jsonpath/#Decoder.Scan) method supports scanning a JSON stream while extracting particular values along the way using [PathActions](https://godoc.org/github.com/exponent-io/jsonpath#PathActions). * The [SeekTo](https://godoc.org/github.com/exponent-io/jsonpath#Decoder.SeekTo) method supports seeking forward in a JSON token stream to a particular path. * The [Path](https://godoc.org/github.com/exponent-io/jsonpath#Decoder.Path) method returns the path of the most recently parsed token. * The [Token](https://godoc.org/github.com/exponent-io/jsonpath#Decoder.Token) method has been modified to distinguish between strings that are object keys and strings that are values. Object key strings are returned as the [KeyString](https://godoc.org/github.com/exponent-io/jsonpath#KeyString) type rather than a native string. ## Installation go get -u github.com/exponent-io/jsonpath ## Example Usage #### SeekTo ```go import "github.com/exponent-io/jsonpath" var j = []byte(`[ {"Space": "YCbCr", "Point": {"Y": 255, "Cb": 0, "Cr": -10}}, {"Space": "RGB", "Point": {"R": 98, "G": 218, "B": 255}} ]`) w := json.NewDecoder(bytes.NewReader(j)) var v interface{} w.SeekTo(1, "Point", "G") w.Decode(&v) // v is 218 ``` #### Scan with PathActions ```go var j = []byte(`{"colors":[ {"Space": "YCbCr", "Point": {"Y": 255, "Cb": 0, "Cr": -10, "A": 58}}, {"Space": "RGB", "Point": {"R": 98, "G": 218, "B": 255, "A": 231}} ]}`) var actions PathActions // Extract the value at Point.A actions.Add(func(d *Decoder) error { var alpha int err := d.Decode(&alpha) fmt.Printf("Alpha: %v\n", alpha) return err }, "Point", "A") w := NewDecoder(bytes.NewReader(j)) w.SeekTo("colors", 0) var ok = true var err error for ok { ok, err = w.Scan(&actions) if err != nil && err != io.EOF { panic(err) } } ```
9,837
0
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io/jsonpath/LICENSE
The MIT License (MIT) Copyright (c) 2015 Exponent Labs LLC Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
9,838
0
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io/jsonpath/pathaction.go
package jsonpath // pathNode is used to construct a trie of paths to be matched type pathNode struct { matchOn interface{} // string, or integer childNodes []pathNode action DecodeAction } // match climbs the trie to find a node that matches the given JSON path. func (n *pathNode) match(path JsonPath) *pathNode { var node *pathNode = n for _, ps := range path { found := false for i, n := range node.childNodes { if n.matchOn == ps { node = &node.childNodes[i] found = true break } else if _, ok := ps.(int); ok && n.matchOn == AnyIndex { node = &node.childNodes[i] found = true break } } if !found { return nil } } return node } // PathActions represents a collection of DecodeAction functions that should be called at certain path positions // when scanning the JSON stream. PathActions can be created once and used many times in one or more JSON streams. type PathActions struct { node pathNode } // DecodeAction handlers are called by the Decoder when scanning objects. See PathActions.Add for more detail. type DecodeAction func(d *Decoder) error // Add specifies an action to call on the Decoder when the specified path is encountered. func (je *PathActions) Add(action DecodeAction, path ...interface{}) { var node *pathNode = &je.node for _, ps := range path { found := false for i, n := range node.childNodes { if n.matchOn == ps { node = &node.childNodes[i] found = true break } } if !found { node.childNodes = append(node.childNodes, pathNode{matchOn: ps}) node = &node.childNodes[len(node.childNodes)-1] } } node.action = action }
9,839
0
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io/jsonpath/decoder.go
package jsonpath import ( "encoding/json" "io" ) // KeyString is returned from Decoder.Token to represent each key in a JSON object value. type KeyString string // Decoder extends the Go runtime's encoding/json.Decoder to support navigating in a stream of JSON tokens. type Decoder struct { json.Decoder path JsonPath context jsonContext } // NewDecoder creates a new instance of the extended JSON Decoder. func NewDecoder(r io.Reader) *Decoder { return &Decoder{Decoder: *json.NewDecoder(r)} } // SeekTo causes the Decoder to move forward to a given path in the JSON structure. // // The path argument must consist of strings or integers. Each string specifies an JSON object key, and // each integer specifies an index into a JSON array. // // Consider the JSON structure // // { "a": [0,"s",12e4,{"b":0,"v":35} ] } // // SeekTo("a",3,"v") will move to the value referenced by the "a" key in the current object, // followed by a move to the 4th value (index 3) in the array, followed by a move to the value at key "v". // In this example, a subsequent call to the decoder's Decode() would unmarshal the value 35. // // SeekTo returns a boolean value indicating whether a match was found. // // Decoder is intended to be used with a stream of tokens. As a result it navigates forward only. func (d *Decoder) SeekTo(path ...interface{}) (bool, error) { if len(path) == 0 { return len(d.path) == 0, nil } last := len(path) - 1 if i, ok := path[last].(int); ok { path[last] = i - 1 } for { if d.path.Equal(path) { return true, nil } _, err := d.Token() if err == io.EOF { return false, nil } else if err != nil { return false, err } } } // Decode reads the next JSON-encoded value from its input and stores it in the value pointed to by v. This is // equivalent to encoding/json.Decode(). func (d *Decoder) Decode(v interface{}) error { switch d.context { case objValue: d.context = objKey break case arrValue: d.path.incTop() break } return d.Decoder.Decode(v) } // Path returns a slice of string and/or int values representing the path from the root of the JSON object to the // position of the most-recently parsed token. func (d *Decoder) Path() JsonPath { p := make(JsonPath, len(d.path)) copy(p, d.path) return p } // Token is equivalent to the Token() method on json.Decoder. The primary difference is that it distinguishes // between strings that are keys and and strings that are values. String tokens that are object keys are returned as a // KeyString rather than as a native string. func (d *Decoder) Token() (json.Token, error) { t, err := d.Decoder.Token() if err != nil { return t, err } if t == nil { switch d.context { case objValue: d.context = objKey break case arrValue: d.path.incTop() break } return t, err } switch t := t.(type) { case json.Delim: switch t { case json.Delim('{'): if d.context == arrValue { d.path.incTop() } d.path.push("") d.context = objKey break case json.Delim('}'): d.path.pop() d.context = d.path.inferContext() break case json.Delim('['): if d.context == arrValue { d.path.incTop() } d.path.push(-1) d.context = arrValue break case json.Delim(']'): d.path.pop() d.context = d.path.inferContext() break } case float64, json.Number, bool: switch d.context { case objValue: d.context = objKey break case arrValue: d.path.incTop() break } break case string: switch d.context { case objKey: d.path.nameTop(t) d.context = objValue return KeyString(t), err case objValue: d.context = objKey case arrValue: d.path.incTop() } break } return t, err } // Scan moves forward over the JSON stream consuming all the tokens at the current level (current object, current array) // invoking each matching PathAction along the way. // // Scan returns true if there are more contiguous values to scan (for example in an array). func (d *Decoder) Scan(ext *PathActions) (bool, error) { rootPath := d.Path() // If this is an array path, increment the root path in our local copy. if rootPath.inferContext() == arrValue { rootPath.incTop() } for { // advance the token position _, err := d.Token() if err != nil { return false, err } match: var relPath JsonPath // capture the new JSON path path := d.Path() if len(path) > len(rootPath) { // capture the path relative to where the scan started relPath = path[len(rootPath):] } else { // if the path is not longer than the root, then we are done with this scan // return boolean flag indicating if there are more items to scan at the same level return d.Decoder.More(), nil } // match the relative path against the path actions if node := ext.node.match(relPath); node != nil { if node.action != nil { // we have a match so execute the action err = node.action(d) if err != nil { return d.Decoder.More(), err } // The action may have advanced the decoder. If we are in an array, advancing it further would // skip tokens. So, if we are scanning an array, jump to the top without advancing the token. if d.path.inferContext() == arrValue && d.Decoder.More() { goto match } } } } }
9,840
0
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io/jsonpath/.travis.yml
language: go go: - 1.5 - tip
9,841
0
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io
kubeflow_public_repos/fate-operator/vendor/github.com/exponent-io/jsonpath/path.go
// Extends the Go runtime's json.Decoder enabling navigation of a stream of json tokens. package jsonpath import "fmt" type jsonContext int const ( none jsonContext = iota objKey objValue arrValue ) // AnyIndex can be used in a pattern to match any array index. const AnyIndex = -2 // JsonPath is a slice of strings and/or integers. Each string specifies an JSON object key, and // each integer specifies an index into a JSON array. type JsonPath []interface{} func (p *JsonPath) push(n interface{}) { *p = append(*p, n) } func (p *JsonPath) pop() { *p = (*p)[:len(*p)-1] } // increment the index at the top of the stack (must be an array index) func (p *JsonPath) incTop() { (*p)[len(*p)-1] = (*p)[len(*p)-1].(int) + 1 } // name the key at the top of the stack (must be an object key) func (p *JsonPath) nameTop(n string) { (*p)[len(*p)-1] = n } // infer the context from the item at the top of the stack func (p *JsonPath) inferContext() jsonContext { if len(*p) == 0 { return none } t := (*p)[len(*p)-1] switch t.(type) { case string: return objKey case int: return arrValue default: panic(fmt.Sprintf("Invalid stack type %T", t)) } } // Equal tests for equality between two JsonPath types. func (p *JsonPath) Equal(o JsonPath) bool { if len(*p) != len(o) { return false } for i, v := range *p { if v != o[i] { return false } } return true } func (p *JsonPath) HasPrefix(o JsonPath) bool { for i, v := range o { if v != (*p)[i] { return false } } return true }
9,842
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/interface.go
package hcsshim import ( "io" "time" "github.com/Microsoft/hcsshim/internal/schema1" ) // ProcessConfig is used as both the input of Container.CreateProcess // and to convert the parameters to JSON for passing onto the HCS type ProcessConfig = schema1.ProcessConfig type Layer = schema1.Layer type MappedDir = schema1.MappedDir type MappedPipe = schema1.MappedPipe type HvRuntime = schema1.HvRuntime type MappedVirtualDisk = schema1.MappedVirtualDisk // AssignedDevice represents a device that has been directly assigned to a container // // NOTE: Support added in RS5 type AssignedDevice = schema1.AssignedDevice // ContainerConfig is used as both the input of CreateContainer // and to convert the parameters to JSON for passing onto the HCS type ContainerConfig = schema1.ContainerConfig type ComputeSystemQuery = schema1.ComputeSystemQuery // Container represents a created (but not necessarily running) container. type Container interface { // Start synchronously starts the container. Start() error // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. Shutdown() error // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. Terminate() error // Waits synchronously waits for the container to shutdown or terminate. Wait() error // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. WaitTimeout(time.Duration) error // Pause pauses the execution of a container. Pause() error // Resume resumes the execution of a container. Resume() error // HasPendingUpdates returns true if the container has updates pending to install. HasPendingUpdates() (bool, error) // Statistics returns statistics for a container. Statistics() (Statistics, error) // ProcessList returns details for the processes in a container. ProcessList() ([]ProcessListItem, error) // MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) // CreateProcess launches a new process within the container. CreateProcess(c *ProcessConfig) (Process, error) // OpenProcess gets an interface to an existing process within the container. OpenProcess(pid int) (Process, error) // Close cleans up any state associated with the container but does not terminate or wait for it. Close() error // Modify the System Modify(config *ResourceModificationRequestResponse) error } // Process represents a running or exited process. type Process interface { // Pid returns the process ID of the process within the container. Pid() int // Kill signals the process to terminate but does not wait for it to finish terminating. Kill() error // Wait waits for the process to exit. Wait() error // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. WaitTimeout(time.Duration) error // ExitCode returns the exit code of the process. The process must have // already terminated. ExitCode() (int, error) // ResizeConsole resizes the console of the process. ResizeConsole(width, height uint16) error // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. CloseStdin() error // Close cleans up any state associated with the process but does not kill // or wait on it. Close() error }
9,843
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/hnsnetwork.go
package hcsshim import ( "github.com/Microsoft/hcsshim/internal/hns" ) // Subnet is assoicated with a network and represents a list // of subnets available to the network type Subnet = hns.Subnet // MacPool is assoicated with a network and represents a list // of macaddresses available to the network type MacPool = hns.MacPool // HNSNetwork represents a network in HNS type HNSNetwork = hns.HNSNetwork // HNSNetworkRequest makes a call into HNS to update/query a single network func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) { return hns.HNSNetworkRequest(method, path, request) } // HNSListNetworkRequest makes a HNS call to query the list of available networks func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) { return hns.HNSListNetworkRequest(method, path, request) } // GetHNSNetworkByID func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) { return hns.GetHNSNetworkByID(networkID) } // GetHNSNetworkName filtered by Name func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) { return hns.GetHNSNetworkByName(networkName) }
9,844
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/CODEOWNERS
* @microsoft/containerplat /hcn/* @nagiesek
9,845
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/go.mod
module github.com/Microsoft/hcsshim go 1.13 require ( github.com/Microsoft/go-winio v0.4.16-0.20201130162521-d1ffc52c7331 github.com/containerd/cgroups v0.0.0-20200531161412-0dbf7f05ba59 github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 github.com/containerd/containerd v1.3.2 github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc // indirect github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 // indirect github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd github.com/gogo/protobuf v1.3.1 github.com/golang/protobuf v1.3.2 // indirect github.com/kr/pretty v0.1.0 // indirect github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 // indirect github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f // indirect github.com/opencontainers/runtime-spec v1.0.2 github.com/pkg/errors v0.9.1 github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7 // indirect github.com/sirupsen/logrus v1.4.2 github.com/stretchr/testify v1.4.0 // indirect github.com/urfave/cli v1.22.2 go.opencensus.io v0.22.0 golang.org/x/net v0.0.0-20191004110552-13f9640d40b9 // indirect golang.org/x/sync v0.0.0-20190423024810-112230192c58 golang.org/x/sys v0.0.0-20201201145000-ef89a241ccb3 google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873 // indirect google.golang.org/grpc v1.23.1 gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 // indirect gopkg.in/yaml.v2 v2.2.8 // indirect gotest.tools v2.2.0+incompatible // indirect )
9,846
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/zsyscall_windows.go
// Code generated mksyscall_windows.exe DO NOT EDIT package hcsshim import ( "syscall" "unsafe" "golang.org/x/sys/windows" ) var _ unsafe.Pointer // Do the interface allocations only once for common // Errno values. const ( errnoERROR_IO_PENDING = 997 ) var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) ) // errnoErr returns common boxed Errno values, to prevent // allocations at runtime. func errnoErr(e syscall.Errno) error { switch e { case 0: return nil case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } // TODO: add more here, after collecting data on the common // error values see on Windows. (perhaps when running // all.bat?) return e } var ( modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll") procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId") ) func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) { r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return }
9,847
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/.gometalinter.json
{ "Vendor": true, "Deadline": "2m", "Sort": [ "linter", "severity", "path", "line" ], "Skip": [ "internal\\schema2" ], "EnableGC": true, "Enable": [ "gofmt" ] }
9,848
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/README.md
# hcsshim [![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master) This package contains the Golang interface for using the Windows [Host Compute Service](https://techcommunity.microsoft.com/t5/containers/introducing-the-host-compute-service-hcs/ba-p/382332) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS). It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well. ## Contributing This project welcomes contributions and suggestions. Most contributions require you to agree to a Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us the rights to use your contribution. For details, visit https://cla.microsoft.com. When you submit a pull request, a CLA-bot will automatically determine whether you need to provide a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions provided by the bot. You will only need to do this once across all repos using our CLA. We also ask that contributors [sign their commits](https://git-scm.com/docs/git-commit) using `git commit -s` or `git commit --signoff` to certify they either authored the work themselves or otherwise have permission to use it in this project. ## Code of Conduct This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/). For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact [[email protected]](mailto:[email protected]) with any additional questions or comments. ## Dependencies This project requires Golang 1.9 or newer to build. For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements). ## Reporting Security Issues Security issues and bugs should be reported privately, via email, to the Microsoft Security Response Center (MSRC) at [[email protected]](mailto:[email protected]). You should receive a response within 24 hours. If for some reason you do not, please follow up via email to ensure we received your original message. Further information, including the [MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in the [Security TechCenter](https://technet.microsoft.com/en-us/security/default). For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet --------------- Copyright (c) 2018 Microsoft Corp. All rights reserved.
9,849
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/layer.go
package hcsshim import ( "context" "crypto/sha1" "path/filepath" "github.com/Microsoft/go-winio/pkg/guid" "github.com/Microsoft/hcsshim/internal/wclayer" ) func layerPath(info *DriverInfo, id string) string { return filepath.Join(info.HomeDir, id) } func ActivateLayer(info DriverInfo, id string) error { return wclayer.ActivateLayer(context.Background(), layerPath(&info, id)) } func CreateLayer(info DriverInfo, id, parent string) error { return wclayer.CreateLayer(context.Background(), layerPath(&info, id), parent) } // New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility. func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { return wclayer.CreateScratchLayer(context.Background(), layerPath(&info, layerId), parentLayerPaths) } func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error { return wclayer.CreateScratchLayer(context.Background(), layerPath(&info, layerId), parentLayerPaths) } func DeactivateLayer(info DriverInfo, id string) error { return wclayer.DeactivateLayer(context.Background(), layerPath(&info, id)) } func DestroyLayer(info DriverInfo, id string) error { return wclayer.DestroyLayer(context.Background(), layerPath(&info, id)) } // New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility. func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error { return wclayer.ExpandScratchSize(context.Background(), layerPath(&info, layerId), size) } func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error { return wclayer.ExpandScratchSize(context.Background(), layerPath(&info, layerId), size) } func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error { return wclayer.ExportLayer(context.Background(), layerPath(&info, layerId), exportFolderPath, parentLayerPaths) } func GetLayerMountPath(info DriverInfo, id string) (string, error) { return wclayer.GetLayerMountPath(context.Background(), layerPath(&info, id)) } func GetSharedBaseImages() (imageData string, err error) { return wclayer.GetSharedBaseImages(context.Background()) } func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error { return wclayer.ImportLayer(context.Background(), layerPath(&info, layerID), importFolderPath, parentLayerPaths) } func LayerExists(info DriverInfo, id string) (bool, error) { return wclayer.LayerExists(context.Background(), layerPath(&info, id)) } func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error { return wclayer.PrepareLayer(context.Background(), layerPath(&info, layerId), parentLayerPaths) } func ProcessBaseLayer(path string) error { return wclayer.ProcessBaseLayer(context.Background(), path) } func ProcessUtilityVMImage(path string) error { return wclayer.ProcessUtilityVMImage(context.Background(), path) } func UnprepareLayer(info DriverInfo, layerId string) error { return wclayer.UnprepareLayer(context.Background(), layerPath(&info, layerId)) } type DriverInfo struct { Flavour int HomeDir string } type GUID [16]byte func NameToGuid(name string) (id GUID, err error) { g, err := wclayer.NameToGuid(context.Background(), name) return g.ToWindowsArray(), err } func NewGUID(source string) *GUID { h := sha1.Sum([]byte(source)) var g GUID copy(g[0:], h[0:16]) return &g } func (g *GUID) ToString() string { return guid.FromWindowsArray(*g).String() } type LayerReader = wclayer.LayerReader func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) { return wclayer.NewLayerReader(context.Background(), layerPath(&info, layerID), parentLayerPaths) } type LayerWriter = wclayer.LayerWriter func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) { return wclayer.NewLayerWriter(context.Background(), layerPath(&info, layerID), parentLayerPaths) } type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR
9,850
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/Protobuild.toml
version = "unstable" generator = "gogoctrd" plugins = ["grpc", "fieldpath"] # Control protoc include paths. Below are usually some good defaults, but feel # free to try it without them if it works for your project. [includes] # Include paths that will be added before all others. Typically, you want to # treat the root of the project as an include, but this may not be necessary. before = ["./protobuf"] # Paths that should be treated as include roots in relation to the vendor # directory. These will be calculated with the vendor directory nearest the # target package. packages = ["github.com/gogo/protobuf"] # Paths that will be added untouched to the end of the includes. We use # `/usr/local/include` to pickup the common install location of protobuf. # This is the default. after = ["/usr/local/include"] # This section maps protobuf imports to Go packages. These will become # `-M` directives in the call to the go protobuf generator. [packages] "gogoproto/gogo.proto" = "github.com/gogo/protobuf/gogoproto" "google/protobuf/any.proto" = "github.com/gogo/protobuf/types" "google/protobuf/empty.proto" = "github.com/gogo/protobuf/types" "google/protobuf/descriptor.proto" = "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" "google/protobuf/field_mask.proto" = "github.com/gogo/protobuf/types" "google/protobuf/timestamp.proto" = "github.com/gogo/protobuf/types" "google/protobuf/duration.proto" = "github.com/gogo/protobuf/types" "github/containerd/cgroups/stats/v1/metrics.proto" = "github.com/containerd/cgroups/stats/v1" [[overrides]] prefixes = ["github.com/Microsoft/hcsshim/internal/shimdiag"] plugins = ["ttrpc"] # Lock down runhcs config [[descriptors]] prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/options" target = "cmd/containerd-shim-runhcs-v1/options/next.pb.txt" ignore_files = [ "google/protobuf/descriptor.proto", "gogoproto/gogo.proto" ] [[descriptors]] prefix = "github.com/Microsoft/hcsshim/cmd/containerd-shim-runhcs-v1/stats" target = "cmd/containerd-shim-runhcs-v1/stats/next.pb.txt" ignore_files = [ "google/protobuf/descriptor.proto", "gogoproto/gogo.proto" ]
9,851
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/LICENSE
The MIT License (MIT) Copyright (c) 2015 Microsoft Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
9,852
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/appveyor.yml
version: 0.1.{build} image: Visual Studio 2017 clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim environment: GOPATH: c:\gopath PATH: "%GOPATH%\\bin;C:\\gometalinter-2.0.12-windows-amd64;%PATH%" stack: go 1.13.4 build_script: - appveyor DownloadFile https://github.com/alecthomas/gometalinter/releases/download/v2.0.12/gometalinter-2.0.12-windows-amd64.zip - 7z x gometalinter-2.0.12-windows-amd64.zip -y -oC:\ > NUL - gometalinter.exe --config .gometalinter.json ./... - go build ./cmd/containerd-shim-runhcs-v1 - go build ./cmd/runhcs - go build ./cmd/tar2ext4 - go build ./cmd/wclayer - go build ./cmd/device-util - go build ./internal/tools/grantvmgroupaccess - go build ./internal/tools/uvmboot - go build ./internal/tools/zapdir - go test -v ./... -tags admin - cd test - go test -v ./internal -tags admin - go test -c ./containerd-shim-runhcs-v1/ -tags functional - go test -c ./cri-containerd/ -tags functional - go test -c ./functional/ -tags functional - go test -c ./runhcs/ -tags functional artifacts: - path: 'containerd-shim-runhcs-v1.exe' - path: 'runhcs.exe' - path: 'tar2ext4.exe' - path: 'device-util.exe' - path: 'wclayer.exe' - path: 'grantvmgroupaccess.exe' - path: 'uvmboot.exe' - path: 'zapdir.exe' - path: './test/containerd-shim-runhcs-v1.test.exe' - path: './test/cri-containerd.test.exe' - path: './test/functional.test.exe' - path: './test/runhcs.test.exe'
9,853
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/errors.go
package hcsshim import ( "fmt" "syscall" "github.com/Microsoft/hcsshim/internal/hns" "github.com/Microsoft/hcsshim/internal/hcs" "github.com/Microsoft/hcsshim/internal/hcserror" ) var ( // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist // ErrElementNotFound is an error encountered when the object being referenced does not exist ErrElementNotFound = hcs.ErrElementNotFound // ErrElementNotFound is an error encountered when the object being referenced does not exist ErrNotSupported = hcs.ErrNotSupported // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported // decimal -2147024883 / hex 0x8007000d ErrInvalidData = hcs.ErrInvalidData // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed ErrHandleClose = hcs.ErrHandleClose // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method ErrAlreadyClosed = hcs.ErrAlreadyClosed // ErrInvalidNotificationType is an error encountered when an invalid notification type is used ErrInvalidNotificationType = hcs.ErrInvalidNotificationType // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation ErrInvalidProcessState = hcs.ErrInvalidProcessState // ErrTimeout is an error encountered when waiting on a notification times out ErrTimeout = hcs.ErrTimeout // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for // a different expected notification ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service // is lost while waiting for a notification ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort // ErrUnexpectedValue is an error encountered when hcs returns an invalid value ErrUnexpectedValue = hcs.ErrUnexpectedValue // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState // ErrProcNotFound is an error encountered when the the process cannot be found ErrProcNotFound = hcs.ErrProcNotFound // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage // ErrNotSupported is an error encountered when hcs doesn't support the request ErrPlatformNotSupported = hcs.ErrPlatformNotSupported ) type EndpointNotFoundError = hns.EndpointNotFoundError type NetworkNotFoundError = hns.NetworkNotFoundError // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { Process *process Operation string ExtraInfo string Err error Events []hcs.ErrorEvent } // ContainerError is an error encountered in HCS during an operation on a Container object type ContainerError struct { Container *container Operation string ExtraInfo string Err error Events []hcs.ErrorEvent } func (e *ContainerError) Error() string { if e == nil { return "<nil>" } if e.Container == nil { return "unexpected nil container for error: " + e.Err.Error() } s := "container " + e.Container.system.ID() if e.Operation != "" { s += " encountered an error during " + e.Operation } switch e.Err.(type) { case nil: break case syscall.Errno: s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) default: s += fmt.Sprintf(": %s", e.Err.Error()) } for _, ev := range e.Events { s += "\n" + ev.String() } if e.ExtraInfo != "" { s += " extra info: " + e.ExtraInfo } return s } func makeContainerError(container *container, operation string, extraInfo string, err error) error { // Don't double wrap errors if _, ok := err.(*ContainerError); ok { return err } containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err} return containerError } func (e *ProcessError) Error() string { if e == nil { return "<nil>" } if e.Process == nil { return "Unexpected nil process for error: " + e.Err.Error() } s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID()) if e.Operation != "" { s += " encountered an error during " + e.Operation } switch e.Err.(type) { case nil: break case syscall.Errno: s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err)) default: s += fmt.Sprintf(": %s", e.Err.Error()) } for _, ev := range e.Events { s += "\n" + ev.String() } return s } func makeProcessError(process *process, operation string, extraInfo string, err error) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { return err } processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err} return processError } // IsNotExist checks if an error is caused by the Container or Process not existing. // Note: Currently, ErrElementNotFound can mean that a Process has either // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound or ErrProcNotFound. func IsNotExist(err error) bool { if _, ok := err.(EndpointNotFoundError); ok { return true } if _, ok := err.(NetworkNotFoundError); ok { return true } return hcs.IsNotExist(getInnerError(err)) } // IsAlreadyClosed checks if an error is caused by the Container or Process having been // already closed by a call to the Close() method. func IsAlreadyClosed(err error) bool { return hcs.IsAlreadyClosed(getInnerError(err)) } // IsPending returns a boolean indicating whether the error is that // the requested operation is being completed in the background. func IsPending(err error) bool { return hcs.IsPending(getInnerError(err)) } // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { return hcs.IsTimeout(getInnerError(err)) } // IsAlreadyStopped returns a boolean indicating whether the error is caused by // a Container or Process being already stopped. // Note: Currently, ErrElementNotFound can mean that a Process has either // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound or ErrProcNotFound. func IsAlreadyStopped(err error) bool { return hcs.IsAlreadyStopped(getInnerError(err)) } // IsNotSupported returns a boolean indicating whether the error is caused by // unsupported platform requests // Note: Currently Unsupported platform requests can be mean either // ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage // is thrown from the Platform func IsNotSupported(err error) bool { return hcs.IsNotSupported(getInnerError(err)) } func getInnerError(err error) error { switch pe := err.(type) { case nil: return nil case *ContainerError: err = pe.Err case *ProcessError: err = pe.Err } return err } func convertSystemError(err error, c *container) error { if serr, ok := err.(*hcs.SystemError); ok { return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events} } return err } func convertProcessError(err error, p *process) error { if perr, ok := err.(*hcs.ProcessError); ok { return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events} } return err }
9,854
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/hnspolicylist.go
package hcsshim import ( "github.com/Microsoft/hcsshim/internal/hns" ) // RoutePolicy is a structure defining schema for Route based Policy type RoutePolicy = hns.RoutePolicy // ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy type ELBPolicy = hns.ELBPolicy // LBPolicy is a structure defining schema for LoadBalancing based Policy type LBPolicy = hns.LBPolicy // PolicyList is a structure defining schema for Policy list request type PolicyList = hns.PolicyList // HNSPolicyListRequest makes a call into HNS to update/query a single network func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) { return hns.HNSPolicyListRequest(method, path, request) } // HNSListPolicyListRequest gets all the policy list func HNSListPolicyListRequest() ([]PolicyList, error) { return hns.HNSListPolicyListRequest() } // PolicyListRequest makes a HNS call to modify/query a network policy list func PolicyListRequest(method, path, request string) (*PolicyList, error) { return hns.PolicyListRequest(method, path, request) } // GetPolicyListByID get the policy list by ID func GetPolicyListByID(policyListID string) (*PolicyList, error) { return hns.GetPolicyListByID(policyListID) } // AddLoadBalancer policy list for the specified endpoints func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) { return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort) } // AddRoute adds route policy list for the specified endpoints func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) { return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled) }
9,855
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/container.go
package hcsshim import ( "context" "fmt" "os" "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" "github.com/Microsoft/hcsshim/internal/mergemaps" "github.com/Microsoft/hcsshim/internal/schema1" ) // ContainerProperties holds the properties for a container and the processes running in that container type ContainerProperties = schema1.ContainerProperties // MemoryStats holds the memory statistics for a container type MemoryStats = schema1.MemoryStats // ProcessorStats holds the processor statistics for a container type ProcessorStats = schema1.ProcessorStats // StorageStats holds the storage statistics for a container type StorageStats = schema1.StorageStats // NetworkStats holds the network statistics for a container type NetworkStats = schema1.NetworkStats // Statistics is the structure returned by a statistics call on a container type Statistics = schema1.Statistics // ProcessList is the structure of an item returned by a ProcessList call on a container type ProcessListItem = schema1.ProcessListItem // MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container type MappedVirtualDiskController = schema1.MappedVirtualDiskController // Type of Request Support in ModifySystem type RequestType = schema1.RequestType // Type of Resource Support in ModifySystem type ResourceType = schema1.ResourceType // RequestType const const ( Add = schema1.Add Remove = schema1.Remove Network = schema1.Network ) // ResourceModificationRequestResponse is the structure used to send request to the container to modify the system // Supported resource types are Network and Request Types are Add/Remove type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse type container struct { system *hcs.System waitOnce sync.Once waitErr error waitCh chan struct{} } // createComputeSystemAdditionalJSON is read from the environment at initialisation // time. It allows an environment variable to define additional JSON which // is merged in the CreateComputeSystem call to HCS. var createContainerAdditionalJSON []byte func init() { createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON")) } // CreateContainer creates a new container with the given configuration but does not start it. func CreateContainer(id string, c *ContainerConfig) (Container, error) { fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON) if err != nil { return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err) } system, err := hcs.CreateComputeSystem(context.Background(), id, fullConfig) if err != nil { return nil, err } return &container{system: system}, err } // OpenContainer opens an existing container by ID. func OpenContainer(id string) (Container, error) { system, err := hcs.OpenComputeSystem(context.Background(), id) if err != nil { return nil, err } return &container{system: system}, err } // GetContainers gets a list of the containers on the system that match the query func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) { return hcs.GetComputeSystems(context.Background(), q) } // Start synchronously starts the container. func (container *container) Start() error { return convertSystemError(container.system.Start(context.Background()), container) } // Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds. func (container *container) Shutdown() error { err := container.system.Shutdown(context.Background()) if err != nil { return convertSystemError(err, container) } return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Shutdown"} } // Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds. func (container *container) Terminate() error { err := container.system.Terminate(context.Background()) if err != nil { return convertSystemError(err, container) } return &ContainerError{Container: container, Err: ErrVmcomputeOperationPending, Operation: "hcsshim::ComputeSystem::Terminate"} } // Waits synchronously waits for the container to shutdown or terminate. func (container *container) Wait() error { err := container.system.Wait() if err == nil { err = container.system.ExitError() } return convertSystemError(err, container) } // WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It // returns false if timeout occurs. func (container *container) WaitTimeout(timeout time.Duration) error { container.waitOnce.Do(func() { container.waitCh = make(chan struct{}) go func() { container.waitErr = container.Wait() close(container.waitCh) }() }) t := time.NewTimer(timeout) defer t.Stop() select { case <-t.C: return &ContainerError{Container: container, Err: ErrTimeout, Operation: "hcsshim::ComputeSystem::Wait"} case <-container.waitCh: return container.waitErr } } // Pause pauses the execution of a container. func (container *container) Pause() error { return convertSystemError(container.system.Pause(context.Background()), container) } // Resume resumes the execution of a container. func (container *container) Resume() error { return convertSystemError(container.system.Resume(context.Background()), container) } // HasPendingUpdates returns true if the container has updates pending to install func (container *container) HasPendingUpdates() (bool, error) { return false, nil } // Statistics returns statistics for the container. This is a legacy v1 call func (container *container) Statistics() (Statistics, error) { properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeStatistics) if err != nil { return Statistics{}, convertSystemError(err, container) } return properties.Statistics, nil } // ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call func (container *container) ProcessList() ([]ProcessListItem, error) { properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeProcessList) if err != nil { return nil, convertSystemError(err, container) } return properties.ProcessList, nil } // This is a legacy v1 call func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) { properties, err := container.system.Properties(context.Background(), schema1.PropertyTypeMappedVirtualDisk) if err != nil { return nil, convertSystemError(err, container) } return properties.MappedVirtualDiskControllers, nil } // CreateProcess launches a new process within the container. func (container *container) CreateProcess(c *ProcessConfig) (Process, error) { p, err := container.system.CreateProcess(context.Background(), c) if err != nil { return nil, convertSystemError(err, container) } return &process{p: p.(*hcs.Process)}, nil } // OpenProcess gets an interface to an existing process within the container. func (container *container) OpenProcess(pid int) (Process, error) { p, err := container.system.OpenProcess(context.Background(), pid) if err != nil { return nil, convertSystemError(err, container) } return &process{p: p}, nil } // Close cleans up any state associated with the container but does not terminate or wait for it. func (container *container) Close() error { return convertSystemError(container.system.Close(), container) } // Modify the System func (container *container) Modify(config *ResourceModificationRequestResponse) error { return convertSystemError(container.system.Modify(context.Background(), config), container) }
9,856
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/hnsendpoint.go
package hcsshim import ( "github.com/Microsoft/hcsshim/internal/hns" ) // HNSEndpoint represents a network endpoint in HNS type HNSEndpoint = hns.HNSEndpoint // Namespace represents a Compartment. type Namespace = hns.Namespace //SystemType represents the type of the system on which actions are done type SystemType string // SystemType const const ( ContainerType SystemType = "Container" VirtualMachineType SystemType = "VirtualMachine" HostType SystemType = "Host" ) // EndpointAttachDetachRequest is the structure used to send request to the container to modify the system // Supported resource types are Network and Request Types are Add/Remove type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest // EndpointResquestResponse is object to get the endpoint request response type EndpointResquestResponse = hns.EndpointResquestResponse // HNSEndpointRequest makes a HNS call to modify/query a network endpoint func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) { return hns.HNSEndpointRequest(method, path, request) } // HNSListEndpointRequest makes a HNS call to query the list of available endpoints func HNSListEndpointRequest() ([]HNSEndpoint, error) { return hns.HNSListEndpointRequest() } // HotAttachEndpoint makes a HCS Call to attach the endpoint to the container func HotAttachEndpoint(containerID string, endpointID string) error { endpoint, err := GetHNSEndpointByID(endpointID) isAttached, err := endpoint.IsAttached(containerID) if isAttached { return err } return modifyNetworkEndpoint(containerID, endpointID, Add) } // HotDetachEndpoint makes a HCS Call to detach the endpoint from the container func HotDetachEndpoint(containerID string, endpointID string) error { endpoint, err := GetHNSEndpointByID(endpointID) isAttached, err := endpoint.IsAttached(containerID) if !isAttached { return err } return modifyNetworkEndpoint(containerID, endpointID, Remove) } // ModifyContainer corresponding to the container id, by sending a request func modifyContainer(id string, request *ResourceModificationRequestResponse) error { container, err := OpenContainer(id) if err != nil { if IsNotExist(err) { return ErrComputeSystemDoesNotExist } return getInnerError(err) } defer container.Close() err = container.Modify(request) if err != nil { if IsNotSupported(err) { return ErrPlatformNotSupported } return getInnerError(err) } return nil } func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error { requestMessage := &ResourceModificationRequestResponse{ Resource: Network, Request: request, Data: endpointID, } err := modifyContainer(containerID, requestMessage) if err != nil { return err } return nil } // GetHNSEndpointByID get the Endpoint by ID func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) { return hns.GetHNSEndpointByID(endpointID) } // GetHNSEndpointByName gets the endpoint filtered by Name func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) { return hns.GetHNSEndpointByName(endpointName) }
9,857
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/hnssupport.go
package hcsshim import ( "github.com/Microsoft/hcsshim/internal/hns" ) type HNSSupportedFeatures = hns.HNSSupportedFeatures type HNSAclFeatures = hns.HNSAclFeatures func GetHNSSupportedFeatures() HNSSupportedFeatures { return hns.GetHNSSupportedFeatures() }
9,858
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/hcsshim.go
// Shim for the Host Compute Service (HCS) to manage Windows Server // containers and Hyper-V containers. package hcsshim import ( "syscall" "github.com/Microsoft/hcsshim/internal/hcserror" ) //go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go //sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId const ( // Specific user-visible exit codes WaitErrExecFailed = 32767 ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115) WSAEINVAL = syscall.Errno(10022) // Timeout on wait calls TimeoutInfinite = 0xFFFFFFFF ) type HcsError = hcserror.HcsError
9,859
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/hnspolicy.go
package hcsshim import ( "github.com/Microsoft/hcsshim/internal/hns" ) // Type of Request Support in ModifySystem type PolicyType = hns.PolicyType // RequestType const const ( Nat = hns.Nat ACL = hns.ACL PA = hns.PA VLAN = hns.VLAN VSID = hns.VSID VNet = hns.VNet L2Driver = hns.L2Driver Isolation = hns.Isolation QOS = hns.QOS OutboundNat = hns.OutboundNat ExternalLoadBalancer = hns.ExternalLoadBalancer Route = hns.Route Proxy = hns.Proxy ) type ProxyPolicy = hns.ProxyPolicy type NatPolicy = hns.NatPolicy type QosPolicy = hns.QosPolicy type IsolationPolicy = hns.IsolationPolicy type VlanPolicy = hns.VlanPolicy type VsidPolicy = hns.VsidPolicy type PaPolicy = hns.PaPolicy type OutboundNatPolicy = hns.OutboundNatPolicy type ActionType = hns.ActionType type DirectionType = hns.DirectionType type RuleType = hns.RuleType const ( Allow = hns.Allow Block = hns.Block In = hns.In Out = hns.Out Host = hns.Host Switch = hns.Switch ) type ACLPolicy = hns.ACLPolicy type Policy = hns.Policy
9,860
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/process.go
package hcsshim import ( "context" "io" "sync" "time" "github.com/Microsoft/hcsshim/internal/hcs" ) // ContainerError is an error encountered in HCS type process struct { p *hcs.Process waitOnce sync.Once waitCh chan struct{} waitErr error } // Pid returns the process ID of the process within the container. func (process *process) Pid() int { return process.p.Pid() } // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *process) Kill() error { found, err := process.p.Kill(context.Background()) if err != nil { return convertProcessError(err, process) } if !found { return &ProcessError{Process: process, Err: ErrElementNotFound, Operation: "hcsshim::Process::Kill"} } return nil } // Wait waits for the process to exit. func (process *process) Wait() error { return convertProcessError(process.p.Wait(), process) } // WaitTimeout waits for the process to exit or the duration to elapse. It returns // false if timeout occurs. func (process *process) WaitTimeout(timeout time.Duration) error { process.waitOnce.Do(func() { process.waitCh = make(chan struct{}) go func() { process.waitErr = process.Wait() close(process.waitCh) }() }) t := time.NewTimer(timeout) defer t.Stop() select { case <-t.C: return &ProcessError{Process: process, Err: ErrTimeout, Operation: "hcsshim::Process::Wait"} case <-process.waitCh: return process.waitErr } } // ExitCode returns the exit code of the process. The process must have // already terminated. func (process *process) ExitCode() (int, error) { code, err := process.p.ExitCode() if err != nil { err = convertProcessError(err, process) } return code, err } // ResizeConsole resizes the console of the process. func (process *process) ResizeConsole(width, height uint16) error { return convertProcessError(process.p.ResizeConsole(context.Background(), width, height), process) } // Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes; it should be possible to // call this multiple times to get multiple interfaces. func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) { stdin, stdout, stderr, err := process.p.StdioLegacy() if err != nil { err = convertProcessError(err, process) } return stdin, stdout, stderr, err } // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *process) CloseStdin() error { return convertProcessError(process.p.CloseStdin(context.Background()), process) } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *process) Close() error { return convertProcessError(process.p.Close(), process) }
9,861
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/functional_tests.ps1
# Requirements so far: # dockerd running # - image microsoft/nanoserver (matching host base image) docker load -i c:\baseimages\nanoserver.tar # - image alpine (linux) docker pull --platform=linux alpine # TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true" #$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please" #pushd uvm go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./... #popd
9,862
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/go.sum
cloud.google.com/go v0.26.0/go.mod h1:aQUYkXzVsufM+DwF1aE+0xfcU+56JwCaLick0ClmMTw= github.com/BurntSushi/toml v0.3.1 h1:WXkYYl6Yr3qBf1K79EBnL4mak0OimBfB0XUf9Vl28OQ= github.com/BurntSushi/toml v0.3.1/go.mod h1:xHWCNGjB5oqiDr8zfno3MHue2Ht5sIBksp03qcyfWMU= github.com/Microsoft/go-winio v0.4.15-0.20200908182639-5b44b70ab3ab h1:9pygWVFqbY9lPxM0peffumuVDyMuIMzNLyO9uFjJuQo= github.com/Microsoft/go-winio v0.4.15-0.20200908182639-5b44b70ab3ab/go.mod h1:tTuCMEN+UleMWgg9dVx4Hu52b1bJo+59jBh3ajtinzw= github.com/Microsoft/go-winio v0.4.16-0.20201130162521-d1ffc52c7331 h1:3YnB7Hpmh1lPecPE8doMOtYCrMdrpedZOvxfuNES/Vk= github.com/Microsoft/go-winio v0.4.16-0.20201130162521-d1ffc52c7331/go.mod h1:XB6nPKklQyQ7GC9LdcBEcBl8PF76WugXOPRXwdLnMv0= github.com/cilium/ebpf v0.0.0-20200110133405-4032b1d8aae3/go.mod h1:MA5e5Lr8slmEg9bt0VpxxWqJlO4iwu3FBdHUzV7wQVg= github.com/client9/misspell v0.3.4/go.mod h1:qj6jICC3Q7zFZvVWo7KLAzC3yx5G7kyvSDkc90ppPyw= github.com/containerd/cgroups v0.0.0-20200531161412-0dbf7f05ba59 h1:qWj4qVYZ95vLWwqyNJCQg7rDsG5wPdze0UaPolH7DUk= github.com/containerd/cgroups v0.0.0-20200531161412-0dbf7f05ba59/go.mod h1:pA0z1pT8KYB3TCXK/ocprsh7MAkoW8bZVzPdih9snmM= github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1 h1:uict5mhHFTzKLUCufdSLym7z/J0CbBJT59lYbP9wtbg= github.com/containerd/console v0.0.0-20180822173158-c12b1e7919c1/go.mod h1:Tj/on1eG8kiEhd0+fhSDzsPAFESxzBBvdyEgyryXffw= github.com/containerd/containerd v1.3.2 h1:ForxmXkA6tPIvffbrDAcPUIB32QgXkt2XFj+F0UxetA= github.com/containerd/containerd v1.3.2/go.mod h1:bC6axHOhabU15QhwfG7w5PipXdVtMXFTttgp+kVtyUA= github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc h1:TP+534wVlf61smEIq1nwLLAjQVEK2EADoW3CX9AuT+8= github.com/containerd/continuity v0.0.0-20190426062206-aaeac12a7ffc/go.mod h1:GL3xCUCBDV3CZiTSEKksMWbLE66hEyuu9qyDOOqM47Y= github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448 h1:PUD50EuOMkXVcpBIA/R95d56duJR9VxhwncsFbNnxW4= github.com/containerd/fifo v0.0.0-20190226154929-a9fb20d87448/go.mod h1:ODA38xgv3Kuk8dQz2ZQXpnv/UZZUHUCL7pnLehbXgQI= github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3 h1:esQOJREg8nw8aXj6uCN5dfW5cKUBiEJ/+nni1Q/D/sw= github.com/containerd/go-runc v0.0.0-20180907222934-5a6d9f37cfa3/go.mod h1:IV7qH3hrUgRmyYrtgEeGWJfWbgcHL9CSRruz2Vqcph0= github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de h1:dlfGmNcE3jDAecLqwKPMNX6nk2qh1c1Vg1/YTzpOOF4= github.com/containerd/ttrpc v0.0.0-20190828154514-0e0f228740de/go.mod h1:PvCDdDGpgqzQIzDW1TphrGLssLDZp2GuS+X5DkEJB8o= github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd h1:JNn81o/xG+8NEo3bC/vx9pbi/g2WI8mtP2/nXzu297Y= github.com/containerd/typeurl v0.0.0-20180627222232-a93fcdb778cd/go.mod h1:Cm3kwCdlkCfMSHURc+r6fwoGH6/F1hH3S4sg0rLFWPc= github.com/coreos/go-systemd/v22 v22.0.0/go.mod h1:xO0FLkIi5MaZafQlIrOotqXZ90ih+1atmu1JpKERPPk= github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= github.com/cpuguy83/go-md2man/v2 v2.0.0 h1:EoUDS0afbrsXAZ9YQ9jdu/mZ2sXgT1/2yyNng4PGlyM= github.com/cpuguy83/go-md2man/v2 v2.0.0/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/docker/go-units v0.4.0 h1:3uh0PgVws3nIA0Q+MwDC8yjEPf9zjRfZZWXZYDct3Tw= github.com/docker/go-units v0.4.0/go.mod h1:fgPhTUdO+D/Jk86RDLlptpiXQzgHJF7gydDDbaIK4Dk= github.com/godbus/dbus/v5 v5.0.3/go.mod h1:xhWf0FNVPg57R7Z0UbKHbJfkEywrmjJnf7w5xrFpKfA= github.com/gogo/protobuf v1.3.1 h1:DqDEcV5aeaTmdFBePNpYsp3FlcVH/2ISVVM9Qf8PSls= github.com/gogo/protobuf v1.3.1/go.mod h1:SlYgWuQ5SjCEi6WLHjHCa1yvBfUnHcTbrrZtXPKa29o= github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b h1:VKtxabqXZkF25pY9ekfRL6a582T4P37/31XEstQ5p58= github.com/golang/glog v0.0.0-20160126235308-23def4e6c14b/go.mod h1:SBH7ygxi8pfUlaOkMMuAQtPIUF8ecWP5IEl/CR7VP2Q= github.com/golang/mock v1.1.1/go.mod h1:oTYuIxOrZwtPieC+H1uAHpcLFnEyAGVDL/k47Jfbm0A= github.com/golang/protobuf v1.2.0 h1:P3YflyNX/ehuJFLhxviNdFxQPkGK5cDcApsge1SqnvM= github.com/golang/protobuf v1.2.0/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/golang/protobuf v1.3.1 h1:YF8+flBXS5eO826T4nzqPrxfhQThhXl0YzfuUPu4SBg= github.com/golang/protobuf v1.3.1/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/golang/protobuf v1.3.2 h1:6nsPYzhq5kReh6QImI3k5qWzO4PEbvbIW2cwSfR/6xs= github.com/golang/protobuf v1.3.2/go.mod h1:6lQm79b+lXiMfvg/cZm0SGofjICqVBUtrP5yJMmIC1U= github.com/google/go-cmp v0.2.0/go.mod h1:oXzfMopK8JAjlY9xF4vHSVASa0yLyX7SntLO5aqRK0M= github.com/google/go-cmp v0.3.0 h1:crn/baboCvb5fXaQ0IJ1SGTsTVrWpDsCWC8EGETZijY= github.com/google/go-cmp v0.3.0/go.mod h1:8QqcDgzrUqlUb/G2PQTWiueGozuR1884gddMywk6iLU= github.com/hashicorp/golang-lru v0.5.1 h1:0hERBMJE1eitiLkihrMvRVBYAkpHzc/J3QdDN+dAcgU= github.com/hashicorp/golang-lru v0.5.1/go.mod h1:/m3WP610KZHVQ1SGc6re/UDhFvYD7pJ4Ao+sR/qLZy8= github.com/kisielk/errcheck v1.2.0/go.mod h1:/BMXB+zMLi60iA8Vv6Ksmxu/1UDYcXs4uQLJ+jE2L00= github.com/kisielk/gotool v1.0.0/go.mod h1:XhKaO+MFFWcvkIS/tQcRk01m1F5IRFswLeQ+oQHNcck= github.com/konsorten/go-windows-terminal-sequences v1.0.1 h1:mweAR1A6xJ3oS2pRaGiHgQ4OO8tzTaLawm8vnODuwDk= github.com/konsorten/go-windows-terminal-sequences v1.0.1/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= github.com/konsorten/go-windows-terminal-sequences v1.0.2 h1:DB17ag19krx9CFsz4o3enTrPXyIXCl+2iCXH/aMAp9s= github.com/konsorten/go-windows-terminal-sequences v1.0.2/go.mod h1:T0+1ngSBFLxvqU3pZ+m/2kptfBszLMUkC4ZK/EgS/cQ= github.com/kr/pretty v0.1.0 h1:L/CwN0zerZDmRFUapSPitk6f+Q3+0za1rQkzVuMiMFI= github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo= github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= github.com/kr/text v0.1.0 h1:45sCR5RtlFHMR4UwH9sdQ5TC8v0qDQCHnXt+kaKSTVE= github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2 h1:QhPf3A2AZW3tTGvHPg0TA+CR3oHbVLlXUhlghqISp1I= github.com/opencontainers/go-digest v0.0.0-20180430190053-c9281466c8b2/go.mod h1:cMLVZDEM3+U2I4VmLI6N8jQYUd2OVphdqWwCJHrFt2s= github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f h1:a969LJ4IQFwRHYqonHtUDMSh9i54WcKggeEkQ3fZMl4= github.com/opencontainers/runc v0.0.0-20190115041553-12f6a991201f/go.mod h1:qT5XzbpPznkRYVz/mWwUaVBUv2rmF59PVA73FjuZG0U= github.com/opencontainers/runtime-spec v1.0.2 h1:UfAcuLBJB9Coz72x1hgl8O5RVzTdNiaglX6v2DM6FI0= github.com/opencontainers/runtime-spec v1.0.2/go.mod h1:jwyrGlmzljRJv/Fgzds9SsS/C5hL+LL3ko9hs6T5lQ0= github.com/pkg/errors v0.8.1 h1:iURUrRGxPUNPdy5/HRSm+Yj6okJ6UtLINN0Q9M4+h3I= github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pkg/errors v0.9.1 h1:FEBLx1zS214owpjy7qsBeixbURkuhQAwrK5UwLGTwt4= github.com/pkg/errors v0.9.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7 h1:hhvfGDVThBnd4kYisSFmYuHYeUhglxcwag7FhVPH9zM= github.com/prometheus/procfs v0.0.0-20180125133057-cb4147076ac7/go.mod h1:c3At6R/oaqEKCNdg8wHV1ftS6bRYblBhIjjI8uT2IGk= github.com/russross/blackfriday/v2 v2.0.1 h1:lPqVAte+HuHNfhJ/0LC98ESWRz8afy9tM/0RK8m9o+Q= github.com/russross/blackfriday/v2 v2.0.1/go.mod h1:+Rmxgy9KzJVeS9/2gXHxylqXiyQDYRxCVz55jmeOWTM= github.com/shurcooL/sanitized_anchor_name v1.0.0 h1:PdmoCO6wvbs+7yrJyMORt4/BmY5IYyJwS/kOiWx8mHo= github.com/shurcooL/sanitized_anchor_name v1.0.0/go.mod h1:1NzhyTcUVG4SuEtjjoZeVRXNmyL/1OwPU0+IJeTBvfc= github.com/sirupsen/logrus v1.4.1 h1:GL2rEmy6nsikmW0r8opw9JIRScdMF5hA8cOYLH7In1k= github.com/sirupsen/logrus v1.4.1/go.mod h1:ni0Sbl8bgC9z8RoU9G6nDWqqs/fq4eDPysMBDgk/93Q= github.com/sirupsen/logrus v1.4.2 h1:SPIRibHv4MatM3XXNO2BJeFLZwZ2LvZgfQ5+UNI2im4= github.com/sirupsen/logrus v1.4.2/go.mod h1:tLMulIdttU9McNUspp0xgXVQah82FyeX6MwdIuYE2rE= github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/objx v0.1.1/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/testify v1.2.2 h1:bSDNvY7ZPG5RlJ8otE/7V6gMiyenm9RtJ7IUVIAoJ1w= github.com/stretchr/testify v1.2.2/go.mod h1:a8OnRcib4nhh0OaRAV+Yts87kKdq0PP7pXfy6kDkUVs= github.com/stretchr/testify v1.4.0 h1:2E4SXV/wtOkTonXsotYi4li6zVWxYlZuYNCXe9XRJyk= github.com/stretchr/testify v1.4.0/go.mod h1:j7eGeouHqKxXV5pUuKE4zz7dFj8WfuZ+81PSLYec5m4= github.com/urfave/cli v1.22.2 h1:gsqYFH8bb9ekPA12kRo0hfjngWQjkJPlN9R0N78BoUo= github.com/urfave/cli v1.22.2/go.mod h1:Gos4lmkARVdJ6EkW0WaNv/tZAAMe9V7XWyB60NtXRu0= go.opencensus.io v0.22.0 h1:C9hSCOW830chIVkdja34wa6Ky+IzWllkUinR+BtRZd4= go.opencensus.io v0.22.0/go.mod h1:+kGneAE2xo2IficOXnaByMWTGM9T73dGwxeWcUqIpI8= golang.org/x/crypto v0.0.0-20190308221718-c2843e01d9a2/go.mod h1:djNgcEr1/C05ACkg1iLfiJU5Ep61QUkGW8qpdssI0+w= golang.org/x/exp v0.0.0-20190121172915-509febef88a4/go.mod h1:CJ0aWSM057203Lf6IL+f9T1iT9GByDxfZKAQTCR3kQA= golang.org/x/lint v0.0.0-20181026193005-c67002cb31c3/go.mod h1:UVdnD1Gm6xHRNCYTkRU2/jEulfH38KcIWyp/GAMgvoE= golang.org/x/lint v0.0.0-20190227174305-5b3e6a55c961/go.mod h1:wehouNa3lNwaWXcvxsM5YxQ5yQlVC4a0KAMCusXpPoU= golang.org/x/lint v0.0.0-20190313153728-d0100b6bd8b3/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= golang.org/x/net v0.0.0-20180724234803-3673e40ba225/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20180826012351-8a410e7b638d/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190213061140-3a22650c66bd/go.mod h1:mL1N/T3taQHkDXs73rZJwtUhF3w3ftmwwsq0BUmARs4= golang.org/x/net v0.0.0-20190311183353-d8887717615a h1:oWX7TPOiFAMXLq8o0ikBYfCJVlRHBcsciT5bXOrH628= golang.org/x/net v0.0.0-20190311183353-d8887717615a/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09 h1:KaQtG+aDELoNmXYas3TVkGNYRuq8JQ1aa7LJt8EXVyo= golang.org/x/net v0.0.0-20190501004415-9ce7a6920f09/go.mod h1:t9HGtf8HONx5eT2rtn7q6eTqICYqUVnKs3thJo3Qplg= golang.org/x/net v0.0.0-20191004110552-13f9640d40b9 h1:rjwSpXsdiK0dV8/Naq3kAw9ymfAeJIyd0upUIElB+lI= golang.org/x/net v0.0.0-20191004110552-13f9640d40b9/go.mod h1:z5CRVTTTmAJ677TzLLGU+0bjPO0LkuOLi4/5GtJWs/s= golang.org/x/oauth2 v0.0.0-20180821212333-d2e6202438be/go.mod h1:N/0e6XlmueqKjAGxoOufVs8QHGRruUQn6yWY3a++T0U= golang.org/x/sync v0.0.0-20180314180146-1d60e4601c6f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20181108010431-42b317875d0f/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6 h1:bjcUS9ztw9kFmmIxJInhon/0Is3p+EHBKNgquIzo1OI= golang.org/x/sync v0.0.0-20190227155943-e225da77a7e6/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sync v0.0.0-20190423024810-112230192c58 h1:8gQV6CLnAEikrhgkHFbMAEhagSSnXWGV915qUMm9mrU= golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= golang.org/x/sys v0.0.0-20180830151530-49385e6e1522/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20180905080454-ebe1bf3edb33/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= golang.org/x/sys v0.0.0-20190422165155-953cdadca894/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190502145724-3ef323f4f1fd/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3 h1:7TYNF4UdlohbFwpNH04CoPMp1cHUZgO1Ebq5r2hIjfo= golang.org/x/sys v0.0.0-20190916202348-b4ddaad3f8a3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20191022100944-742c48ecaeb7/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20200120151820-655fe14d7479 h1:LhLiKguPgZL+Tglay4GhVtfF0kb8cvOJ0dHTCBO8YNI= golang.org/x/sys v0.0.0-20200120151820-655fe14d7479/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/sys v0.0.0-20201201145000-ef89a241ccb3 h1:kzM6+9dur93BcC2kVlYl34cHU+TYZLanmpSJHVMmL64= golang.org/x/sys v0.0.0-20201201145000-ef89a241ccb3/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= golang.org/x/text v0.3.0 h1:g61tztE5qeGQ89tm6NTjjM9VPIm088od1l6aSorWRWg= golang.org/x/text v0.3.0/go.mod h1:NqM8EUOU14njkJ3fqMW+pc6Ldnwhi/IjpwHt7yyuwOQ= golang.org/x/text v0.3.2 h1:tW2bmiBqwgJj/UpqtC8EpXEZVYOwU0yG4iWbprSVAcs= golang.org/x/text v0.3.2/go.mod h1:bEr9sfX3Q8Zfm5fL9x+3itogRgK3+ptLWKqgva+5dAk= golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20181030221726-6c7e314b6563/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190114222345-bf090417da8b/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= golang.org/x/tools v0.0.0-20190226205152-f727befe758c/go.mod h1:9Yl7xja0Znq3iFh3HoIrodX9oNMXvdceNzlUR8zjMvY= golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= golang.org/x/tools v0.0.0-20190524140312-2c0ae7006135/go.mod h1:RgjU9mgBXZiqYHBnxXauZ1Gv1EHHAz9KjViQ78xBX0Q= google.golang.org/appengine v1.1.0/go.mod h1:EbEs0AVv82hx2wNQdGPgUI5lhzA/G0D9YwlJXL52JkM= google.golang.org/appengine v1.4.0/go.mod h1:xpcJRLb0r/rnEns0DIKYYv+WjYCduHsrkT7/EB5XEv4= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8 h1:Nw54tB0rB7hY/N0NQvRW8DG4Yk3Q6T9cu9RcFQDu1tc= google.golang.org/genproto v0.0.0-20180817151627-c66870c02cf8/go.mod h1:JiN7NxoALGmiZfu7CAH4rXhgtRTLTxftemlI0sWmxmc= google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb h1:i1Ppqkc3WQXikh8bXiwHqAN5Rv3/qDCcRk0/Otx73BY= google.golang.org/genproto v0.0.0-20190425155659-357c62f0e4bb/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873 h1:nfPFGzJkUDX6uBmpN/pSw7MbOAWegH5QDQuoXFHedLg= google.golang.org/genproto v0.0.0-20190502173448-54afdca5d873/go.mod h1:VzzqZJRnGkLBvHegQrXjBqPurQTc5/KpmUdxsrq26oE= google.golang.org/grpc v1.19.0/go.mod h1:mqu4LbDTu4XGKhr4mRzUsmM4RtVoemTSY81AxZiDr8c= google.golang.org/grpc v1.20.1 h1:Hz2g2wirWK7H0qIIhGIqRGTuMwTE8HEKFnDZZ7lm9NU= google.golang.org/grpc v1.20.1/go.mod h1:10oTOabMzJvdu6/UiuZezV6QK5dSlG84ov/aaiqXj38= google.golang.org/grpc v1.23.1 h1:q4XQuHFC6I28BKZpo6IYyb3mNO+l7lSOxRuYTCiDfXk= google.golang.org/grpc v1.23.1/go.mod h1:Y5yQAOtifL1yxbo5wqy6BxZv8vAUGQwXBOALyacEbxg= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127 h1:qIbj1fsPNlZgppZ+VLlY7N33q108Sa+fhmuc+sWQYwY= gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/yaml.v2 v2.2.2 h1:ZCJp+EgiOT7lHqUV2J862kp8Qj64Jo6az82+3Td9dZw= gopkg.in/yaml.v2 v2.2.2/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gopkg.in/yaml.v2 v2.2.8 h1:obN1ZagJSUGI0Ek/LBmuj4SNLPfIny3KsKFopxRdj10= gopkg.in/yaml.v2 v2.2.8/go.mod h1:hI93XBmqTisBFMUTm0b8Fm+jr3Dg1NNxqwp+5A1VGuI= gotest.tools v2.2.0+incompatible h1:VsBPFP1AI068pPrMxtb/S8Zkgf9xEmTLJjfM+P5UIEo= gotest.tools v2.2.0+incompatible/go.mod h1:DsYFclhRJ6vuDpmuTbkuFWG+y2sxOXAzmJt81HFBacw= honnef.co/go/tools v0.0.0-20190102054323-c2f93a96b099/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4= honnef.co/go/tools v0.0.0-20190523083050-ea95bdfd59fc/go.mod h1:rf3lG4BRIbNafJWhAfAdb/ePZxsR/4RtNHQocxwk9r4=
9,863
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/hnsglobals.go
package hcsshim import ( "github.com/Microsoft/hcsshim/internal/hns" ) type HNSGlobals = hns.HNSGlobals type HNSVersion = hns.HNSVersion var ( HNSVersion1803 = hns.HNSVersion1803 ) func GetHNSGlobals() (*HNSGlobals, error) { return hns.GetHNSGlobals() }
9,864
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/osversion/osversion_windows.go
package osversion import ( "fmt" "golang.org/x/sys/windows" ) // OSVersion is a wrapper for Windows version information // https://msdn.microsoft.com/en-us/library/windows/desktop/ms724439(v=vs.85).aspx type OSVersion struct { Version uint32 MajorVersion uint8 MinorVersion uint8 Build uint16 } // https://msdn.microsoft.com/en-us/library/windows/desktop/ms724833(v=vs.85).aspx type osVersionInfoEx struct { OSVersionInfoSize uint32 MajorVersion uint32 MinorVersion uint32 BuildNumber uint32 PlatformID uint32 CSDVersion [128]uint16 ServicePackMajor uint16 ServicePackMinor uint16 SuiteMask uint16 ProductType byte Reserve byte } // Get gets the operating system version on Windows. // The calling application must be manifested to get the correct version information. func Get() OSVersion { var err error osv := OSVersion{} osv.Version, err = windows.GetVersion() if err != nil { // GetVersion never fails. panic(err) } osv.MajorVersion = uint8(osv.Version & 0xFF) osv.MinorVersion = uint8(osv.Version >> 8 & 0xFF) osv.Build = uint16(osv.Version >> 16) return osv } // Build gets the build-number on Windows // The calling application must be manifested to get the correct version information. func Build() uint16 { return Get().Build } func (osv OSVersion) ToString() string { return fmt.Sprintf("%d.%d.%d", osv.MajorVersion, osv.MinorVersion, osv.Build) }
9,865
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/osversion/windowsbuilds.go
package osversion const ( // RS1 (version 1607, codename "Redstone 1") corresponds to Windows Server // 2016 (ltsc2016) and Windows 10 (Anniversary Update). RS1 = 14393 // RS2 (version 1703, codename "Redstone 2") was a client-only update, and // corresponds to Windows 10 (Creators Update). RS2 = 15063 // RS3 (version 1709, codename "Redstone 3") corresponds to Windows Server // 1709 (Semi-Annual Channel (SAC)), and Windows 10 (Fall Creators Update). RS3 = 16299 // RS4 (version 1803, codename "Redstone 4") corresponds to Windows Server // 1803 (Semi-Annual Channel (SAC)), and Windows 10 (April 2018 Update). RS4 = 17134 // RS5 (version 1809, codename "Redstone 5") corresponds to Windows Server // 2019 (ltsc2019), and Windows 10 (October 2018 Update). RS5 = 17763 // V19H1 (version 1903) corresponds to Windows Server 1903 (semi-annual // channel). V19H1 = 18362 // V19H2 (version 1909) corresponds to Windows Server 1909 (semi-annual // channel). V19H2 = 18363 // V20H1 (version 2004) corresponds to Windows Server 2004 (semi-annual // channel). V20H1 = 19041 // V20H2 corresponds to Windows Server 20H2 (semi-annual channel). V20H2 = 19042 )
9,866
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/zsyscall_windows.go
// Code generated mksyscall_windows.exe DO NOT EDIT package computestorage import ( "syscall" "unsafe" "golang.org/x/sys/windows" ) var _ unsafe.Pointer // Do the interface allocations only once for common // Errno values. const ( errnoERROR_IO_PENDING = 997 ) var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) ) // errnoErr returns common boxed Errno values, to prevent // allocations at runtime. func errnoErr(e syscall.Errno) error { switch e { case 0: return nil case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } // TODO: add more here, after collecting data on the common // error values see on Windows. (perhaps when running // all.bat?) return e } var ( modcomputestorage = windows.NewLazySystemDLL("computestorage.dll") procHcsImportLayer = modcomputestorage.NewProc("HcsImportLayer") procHcsExportLayer = modcomputestorage.NewProc("HcsExportLayer") procHcsDestoryLayer = modcomputestorage.NewProc("HcsDestoryLayer") procHcsSetupBaseOSLayer = modcomputestorage.NewProc("HcsSetupBaseOSLayer") procHcsInitializeWritableLayer = modcomputestorage.NewProc("HcsInitializeWritableLayer") procHcsAttachLayerStorageFilter = modcomputestorage.NewProc("HcsAttachLayerStorageFilter") procHcsDetachLayerStorageFilter = modcomputestorage.NewProc("HcsDetachLayerStorageFilter") procHcsFormatWritableLayerVhd = modcomputestorage.NewProc("HcsFormatWritableLayerVhd") procHcsGetLayerVhdMountPath = modcomputestorage.NewProc("HcsGetLayerVhdMountPath") procHcsSetupBaseOSVolume = modcomputestorage.NewProc("HcsSetupBaseOSVolume") ) func hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 _p1, hr = syscall.UTF16PtrFromString(sourceFolderPath) if hr != nil { return } var _p2 *uint16 _p2, hr = syscall.UTF16PtrFromString(layerData) if hr != nil { return } return _hcsImportLayer(_p0, _p1, _p2) } func _hcsImportLayer(layerPath *uint16, sourceFolderPath *uint16, layerData *uint16) (hr error) { if hr = procHcsImportLayer.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsImportLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(sourceFolderPath)), uintptr(unsafe.Pointer(layerData))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 _p1, hr = syscall.UTF16PtrFromString(exportFolderPath) if hr != nil { return } var _p2 *uint16 _p2, hr = syscall.UTF16PtrFromString(layerData) if hr != nil { return } var _p3 *uint16 _p3, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsExportLayer(_p0, _p1, _p2, _p3) } func _hcsExportLayer(layerPath *uint16, exportFolderPath *uint16, layerData *uint16, options *uint16) (hr error) { if hr = procHcsExportLayer.Find(); hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsExportLayer.Addr(), 4, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(exportFolderPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsDestroyLayer(layerPath string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } return _hcsDestroyLayer(_p0) } func _hcsDestroyLayer(layerPath *uint16) (hr error) { if hr = procHcsDestoryLayer.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsDestoryLayer.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 _p1, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsSetupBaseOSLayer(_p0, handle, _p1) } func _hcsSetupBaseOSLayer(layerPath *uint16, handle windows.Handle, options *uint16) (hr error) { if hr = procHcsSetupBaseOSLayer.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSetupBaseOSLayer.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(handle), uintptr(unsafe.Pointer(options))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsInitializeWritableLayer(writableLayerPath string, layerData string, options string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(writableLayerPath) if hr != nil { return } var _p1 *uint16 _p1, hr = syscall.UTF16PtrFromString(layerData) if hr != nil { return } var _p2 *uint16 _p2, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsInitializeWritableLayer(_p0, _p1, _p2) } func _hcsInitializeWritableLayer(writableLayerPath *uint16, layerData *uint16, options *uint16) (hr error) { if hr = procHcsInitializeWritableLayer.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsInitializeWritableLayer.Addr(), 3, uintptr(unsafe.Pointer(writableLayerPath)), uintptr(unsafe.Pointer(layerData)), uintptr(unsafe.Pointer(options))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 _p1, hr = syscall.UTF16PtrFromString(layerData) if hr != nil { return } return _hcsAttachLayerStorageFilter(_p0, _p1) } func _hcsAttachLayerStorageFilter(layerPath *uint16, layerData *uint16) (hr error) { if hr = procHcsAttachLayerStorageFilter.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsAttachLayerStorageFilter.Addr(), 2, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(layerData)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsDetachLayerStorageFilter(layerPath string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } return _hcsDetachLayerStorageFilter(_p0) } func _hcsDetachLayerStorageFilter(layerPath *uint16) (hr error) { if hr = procHcsDetachLayerStorageFilter.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsDetachLayerStorageFilter.Addr(), 1, uintptr(unsafe.Pointer(layerPath)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) { if hr = procHcsFormatWritableLayerVhd.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsFormatWritableLayerVhd.Addr(), 1, uintptr(handle), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) { if hr = procHcsGetLayerVhdMountPath.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetLayerVhdMountPath.Addr(), 2, uintptr(vhdHandle), uintptr(unsafe.Pointer(mountPath)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(layerPath) if hr != nil { return } var _p1 *uint16 _p1, hr = syscall.UTF16PtrFromString(volumePath) if hr != nil { return } var _p2 *uint16 _p2, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsSetupBaseOSVolume(_p0, _p1, _p2) } func _hcsSetupBaseOSVolume(layerPath *uint16, volumePath *uint16, options *uint16) (hr error) { if hr = procHcsSetupBaseOSVolume.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSetupBaseOSVolume.Addr(), 3, uintptr(unsafe.Pointer(layerPath)), uintptr(unsafe.Pointer(volumePath)), uintptr(unsafe.Pointer(options))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return }
9,867
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/storage.go
// Package computestorage is a wrapper around the HCS storage APIs. These are new storage APIs introduced // separate from the original graphdriver calls intended to give more freedom around creating // and managing container layers and scratch spaces. package computestorage import ( hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) //go:generate go run ../mksyscall_windows.go -output zsyscall_windows.go storage.go //sys hcsImportLayer(layerPath string, sourceFolderPath string, layerData string) (hr error) = computestorage.HcsImportLayer? //sys hcsExportLayer(layerPath string, exportFolderPath string, layerData string, options string) (hr error) = computestorage.HcsExportLayer? //sys hcsDestroyLayer(layerPath string) (hr error) = computestorage.HcsDestoryLayer? //sys hcsSetupBaseOSLayer(layerPath string, handle windows.Handle, options string) (hr error) = computestorage.HcsSetupBaseOSLayer? //sys hcsInitializeWritableLayer(writableLayerPath string, layerData string, options string) (hr error) = computestorage.HcsInitializeWritableLayer? //sys hcsAttachLayerStorageFilter(layerPath string, layerData string) (hr error) = computestorage.HcsAttachLayerStorageFilter? //sys hcsDetachLayerStorageFilter(layerPath string) (hr error) = computestorage.HcsDetachLayerStorageFilter? //sys hcsFormatWritableLayerVhd(handle windows.Handle) (hr error) = computestorage.HcsFormatWritableLayerVhd? //sys hcsGetLayerVhdMountPath(vhdHandle windows.Handle, mountPath **uint16) (hr error) = computestorage.HcsGetLayerVhdMountPath? //sys hcsSetupBaseOSVolume(layerPath string, volumePath string, options string) (hr error) = computestorage.HcsSetupBaseOSVolume? // LayerData is the data used to describe parent layer information. type LayerData struct { SchemaVersion hcsschema.Version `json:"SchemaVersion,omitempty"` Layers []hcsschema.Layer `json:"Layers,omitempty"` } // ExportLayerOptions are the set of options that are used with the `computestorage.HcsExportLayer` syscall. type ExportLayerOptions struct { IsWritableLayer bool `json:"IsWritableLayer,omitempty"` } // OsLayerType is the type of layer being operated on. type OsLayerType string const ( // OsLayerTypeContainer is a container layer. OsLayerTypeContainer OsLayerType = "Container" // OsLayerTypeVM is a virtual machine layer. OsLayerTypeVM OsLayerType = "Vm" ) // OsLayerOptions are the set of options that are used with the `SetupBaseOSLayer` and // `SetupBaseOSVolume` calls. type OsLayerOptions struct { Type OsLayerType `json:"Type,omitempty"` DisableCiCacheOptimization bool `json:"DisableCiCacheOptimization,omitempty"` SkipUpdateBcdForBoot bool `json:"SkipUpdateBcdForBoot,omitempty"` }
9,868
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/format.go
package computestorage import ( "context" "fmt" "github.com/Microsoft/hcsshim/internal/oc" "go.opencensus.io/trace" "golang.org/x/sys/windows" ) // FormatWritableLayerVhd formats a virtual disk for use as a writable container layer. // // If the VHD is not mounted it will be temporarily mounted. func FormatWritableLayerVhd(ctx context.Context, vhdHandle windows.Handle) (err error) { title := "hcsshim.FormatWritableLayerVhd" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() err = hcsFormatWritableLayerVhd(vhdHandle) if err != nil { return fmt.Errorf("failed to format writable layer vhd: %s", err) } return nil }
9,869
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/setup.go
package computestorage import ( "context" "encoding/json" "errors" "fmt" "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/osversion" "go.opencensus.io/trace" "golang.org/x/sys/windows" ) // SetupBaseOSLayer sets up a layer that contains a base OS for a container. // // `layerPath` is a path to a directory containing the layer. // // `vhdHandle` is an empty file handle of `options.Type == OsLayerTypeContainer` // or else it is a file handle to the 'SystemTemplateBase.vhdx' if `options.Type // == OsLayerTypeVm`. // // `options` are the options applied while processing the layer. func SetupBaseOSLayer(ctx context.Context, layerPath string, vhdHandle windows.Handle, options OsLayerOptions) (err error) { title := "hcsshim.SetupBaseOSLayer" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( trace.StringAttribute("layerPath", layerPath), ) bytes, err := json.Marshal(options) if err != nil { return err } err = hcsSetupBaseOSLayer(layerPath, vhdHandle, string(bytes)) if err != nil { return fmt.Errorf("failed to setup base OS layer: %s", err) } return nil } // SetupBaseOSVolume sets up a volume that contains a base OS for a container. // // `layerPath` is a path to a directory containing the layer. // // `volumePath` is the path to the volume to be used for setup. // // `options` are the options applied while processing the layer. func SetupBaseOSVolume(ctx context.Context, layerPath, volumePath string, options OsLayerOptions) (err error) { if osversion.Get().Build < 19645 { return errors.New("SetupBaseOSVolume is not present on builds older than 19645") } title := "hcsshim.SetupBaseOSVolume" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( trace.StringAttribute("layerPath", layerPath), trace.StringAttribute("volumePath", volumePath), ) bytes, err := json.Marshal(options) if err != nil { return err } err = hcsSetupBaseOSVolume(layerPath, volumePath, string(bytes)) if err != nil { return fmt.Errorf("failed to setup base OS layer: %s", err) } return nil }
9,870
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/mount.go
package computestorage import ( "context" "fmt" "github.com/Microsoft/hcsshim/internal/interop" "github.com/Microsoft/hcsshim/internal/oc" "go.opencensus.io/trace" "golang.org/x/sys/windows" ) // GetLayerVhdMountPath returns the volume path for a virtual disk of a writable container layer. func GetLayerVhdMountPath(ctx context.Context, vhdHandle windows.Handle) (path string, err error) { title := "hcsshim.GetLayerVhdMountPath" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() var mountPath *uint16 err = hcsGetLayerVhdMountPath(vhdHandle, &mountPath) if err != nil { return "", fmt.Errorf("failed to get vhd mount path: %s", err) } path = interop.ConvertAndFreeCoTaskMemString(mountPath) return path, nil }
9,871
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/import.go
package computestorage import ( "context" "encoding/json" "fmt" "github.com/Microsoft/hcsshim/internal/oc" "go.opencensus.io/trace" ) // ImportLayer imports a container layer. // // `layerPath` is a path to a directory to import the layer to. If the directory // does not exist it will be automatically created. // // `sourceFolderpath` is a pre-existing folder that contains the layer to // import. // // `layerData` is the parent layer data. func ImportLayer(ctx context.Context, layerPath, sourceFolderPath string, layerData LayerData) (err error) { title := "hcsshim.ImportLayer" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( trace.StringAttribute("layerPath", layerPath), trace.StringAttribute("sourceFolderPath", sourceFolderPath), ) bytes, err := json.Marshal(layerData) if err != nil { return err } err = hcsImportLayer(layerPath, sourceFolderPath, string(bytes)) if err != nil { return fmt.Errorf("failed to import layer: %s", err) } return nil }
9,872
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/helpers.go
package computestorage import ( "context" "os" "path/filepath" "syscall" "github.com/Microsoft/go-winio/pkg/security" "github.com/Microsoft/go-winio/vhd" "github.com/pkg/errors" "golang.org/x/sys/windows" ) const defaultVHDXBlockSizeInMB = 1 // SetupContainerBaseLayer is a helper to setup a containers scratch. It // will create and format the vhdx's inside and the size is configurable with the sizeInGB // parameter. // // `layerPath` is the path to the base container layer on disk. // // `baseVhdPath` is the path to where the base vhdx for the base layer should be created. // // `diffVhdPath` is the path where the differencing disk for the base layer should be created. // // `sizeInGB` is the size in gigabytes to make the base vhdx. func SetupContainerBaseLayer(ctx context.Context, layerPath, baseVhdPath, diffVhdPath string, sizeInGB uint64) (err error) { var ( hivesPath = filepath.Join(layerPath, "Hives") layoutPath = filepath.Join(layerPath, "Layout") ) // We need to remove the hives directory and layout file as `SetupBaseOSLayer` fails if these files // already exist. `SetupBaseOSLayer` will create these files internally. We also remove the base and // differencing disks if they exist in case we're asking for a different size. if _, err := os.Stat(hivesPath); err == nil { if err := os.RemoveAll(hivesPath); err != nil { return errors.Wrap(err, "failed to remove prexisting hives directory") } } if _, err := os.Stat(layoutPath); err == nil { if err := os.RemoveAll(layoutPath); err != nil { return errors.Wrap(err, "failed to remove prexisting layout file") } } if _, err := os.Stat(baseVhdPath); err == nil { if err := os.RemoveAll(baseVhdPath); err != nil { return errors.Wrap(err, "failed to remove base vhdx path") } } if _, err := os.Stat(diffVhdPath); err == nil { if err := os.RemoveAll(diffVhdPath); err != nil { return errors.Wrap(err, "failed to remove differencing vhdx") } } createParams := &vhd.CreateVirtualDiskParameters{ Version: 2, Version2: vhd.CreateVersion2{ MaximumSize: sizeInGB * 1024 * 1024 * 1024, BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, }, } handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) if err != nil { return errors.Wrap(err, "failed to create vhdx") } defer func() { if err != nil { syscall.CloseHandle(handle) os.RemoveAll(baseVhdPath) if os.Stat(diffVhdPath); err == nil { os.RemoveAll(diffVhdPath) } } }() if err = FormatWritableLayerVhd(ctx, windows.Handle(handle)); err != nil { return err } // Base vhd handle must be closed before calling SetupBaseLayer in case of Container layer if err = syscall.CloseHandle(handle); err != nil { return errors.Wrap(err, "failed to close vhdx handle") } options := OsLayerOptions{ Type: OsLayerTypeContainer, } // SetupBaseOSLayer expects an empty vhd handle for a container layer and will // error out otherwise. if err = SetupBaseOSLayer(ctx, layerPath, 0, options); err != nil { return err } // Create the differencing disk that will be what's copied for the final rw layer // for a container. if err = vhd.CreateDiffVhd(diffVhdPath, baseVhdPath, defaultVHDXBlockSizeInMB); err != nil { return errors.Wrap(err, "failed to create differencing disk") } if err = security.GrantVmGroupAccess(baseVhdPath); err != nil { return errors.Wrapf(err, "failed to grant vm group access to %s", baseVhdPath) } if err = security.GrantVmGroupAccess(diffVhdPath); err != nil { return errors.Wrapf(err, "failed to grant vm group access to %s", diffVhdPath) } return nil } // SetupUtilityVMBaseLayer is a helper to setup a UVMs scratch space. It will create and format // the vhdx inside and the size is configurable by the sizeInGB parameter. // // `uvmPath` is the path to the UtilityVM filesystem. // // `baseVhdPath` is the path to where the base vhdx for the UVM should be created. // // `diffVhdPath` is the path where the differencing disk for the UVM should be created. // // `sizeInGB` specifies the size in gigabytes to make the base vhdx. func SetupUtilityVMBaseLayer(ctx context.Context, uvmPath, baseVhdPath, diffVhdPath string, sizeInGB uint64) (err error) { // Remove the base and differencing disks if they exist in case we're asking for a different size. if _, err := os.Stat(baseVhdPath); err == nil { if err := os.RemoveAll(baseVhdPath); err != nil { return errors.Wrap(err, "failed to remove base vhdx") } } if _, err := os.Stat(diffVhdPath); err == nil { if err := os.RemoveAll(diffVhdPath); err != nil { return errors.Wrap(err, "failed to remove differencing vhdx") } } // Just create the vhdx for utilityVM layer, no need to format it. createParams := &vhd.CreateVirtualDiskParameters{ Version: 2, Version2: vhd.CreateVersion2{ MaximumSize: sizeInGB * 1024 * 1024 * 1024, BlockSizeInBytes: defaultVHDXBlockSizeInMB * 1024 * 1024, }, } handle, err := vhd.CreateVirtualDisk(baseVhdPath, vhd.VirtualDiskAccessNone, vhd.CreateVirtualDiskFlagNone, createParams) if err != nil { return errors.Wrap(err, "failed to create vhdx") } defer func() { if err != nil { syscall.CloseHandle(handle) os.RemoveAll(baseVhdPath) if os.Stat(diffVhdPath); err == nil { os.RemoveAll(diffVhdPath) } } }() // If it is a UtilityVM layer then the base vhdx must be attached when calling // `SetupBaseOSLayer` attachParams := &vhd.AttachVirtualDiskParameters{ Version: 2, } if err := vhd.AttachVirtualDisk(handle, vhd.AttachVirtualDiskFlagNone, attachParams); err != nil { return errors.Wrapf(err, "failed to attach virtual disk") } options := OsLayerOptions{ Type: OsLayerTypeVM, } if err := SetupBaseOSLayer(ctx, uvmPath, windows.Handle(handle), options); err != nil { return err } // Detach and close the handle after setting up the layer as we don't need the handle // for anything else and we no longer need to be attached either. if err = vhd.DetachVirtualDisk(handle); err != nil { return errors.Wrap(err, "failed to detach vhdx") } if err = syscall.CloseHandle(handle); err != nil { return errors.Wrap(err, "failed to close vhdx handle") } // Create the differencing disk that will be what's copied for the final rw layer // for a container. if err = vhd.CreateDiffVhd(diffVhdPath, baseVhdPath, defaultVHDXBlockSizeInMB); err != nil { return errors.Wrap(err, "failed to create differencing disk") } if err := security.GrantVmGroupAccess(baseVhdPath); err != nil { return errors.Wrapf(err, "failed to grant vm group access to %s", baseVhdPath) } if err := security.GrantVmGroupAccess(diffVhdPath); err != nil { return errors.Wrapf(err, "failed to grant vm group access to %s", diffVhdPath) } return nil }
9,873
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/detach.go
package computestorage import ( "context" "fmt" "github.com/Microsoft/hcsshim/internal/oc" "go.opencensus.io/trace" ) // DetachLayerStorageFilter detaches the layer storage filter on a writable container layer. // // `layerPath` is a path to a directory containing the layer to export. func DetachLayerStorageFilter(ctx context.Context, layerPath string) (err error) { title := "hcsshim.DetachLayerStorageFilter" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) err = hcsDetachLayerStorageFilter(layerPath) if err != nil { return fmt.Errorf("failed to detach layer storage filter: %s", err) } return nil }
9,874
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/destroy.go
package computestorage import ( "context" "fmt" "github.com/Microsoft/hcsshim/internal/oc" "go.opencensus.io/trace" ) // DestroyLayer deletes a container layer. // // `layerPath` is a path to a directory containing the layer to export. func DestroyLayer(ctx context.Context, layerPath string) (err error) { title := "hcsshim.DestroyLayer" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("layerPath", layerPath)) err = hcsDestroyLayer(layerPath) if err != nil { return fmt.Errorf("failed to destroy layer: %s", err) } return nil }
9,875
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/attach.go
package computestorage import ( "context" "encoding/json" "fmt" "github.com/Microsoft/hcsshim/internal/oc" "go.opencensus.io/trace" ) // AttachLayerStorageFilter sets up the layer storage filter on a writable // container layer. // // `layerPath` is a path to a directory the writable layer is mounted. If the // path does not end in a `\` the platform will append it automatically. // // `layerData` is the parent read-only layer data. func AttachLayerStorageFilter(ctx context.Context, layerPath string, layerData LayerData) (err error) { title := "hcsshim.AttachLayerStorageFilter" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( trace.StringAttribute("layerPath", layerPath), ) bytes, err := json.Marshal(layerData) if err != nil { return err } err = hcsAttachLayerStorageFilter(layerPath, string(bytes)) if err != nil { return fmt.Errorf("failed to attach layer storage filter: %s", err) } return nil }
9,876
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/initialize.go
package computestorage import ( "context" "encoding/json" "fmt" "github.com/Microsoft/hcsshim/internal/oc" "go.opencensus.io/trace" ) // InitializeWritableLayer initializes a writable layer for a container. // // `layerPath` is a path to a directory the layer is mounted. If the // path does not end in a `\` the platform will append it automatically. // // `layerData` is the parent read-only layer data. func InitializeWritableLayer(ctx context.Context, layerPath string, layerData LayerData) (err error) { title := "hcsshim.InitializeWritableLayer" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( trace.StringAttribute("layerPath", layerPath), ) bytes, err := json.Marshal(layerData) if err != nil { return err } // Options are not used in the platform as of RS5 err = hcsInitializeWritableLayer(layerPath, string(bytes), "") if err != nil { return fmt.Errorf("failed to intitialize container layer: %s", err) } return nil }
9,877
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/computestorage/export.go
package computestorage import ( "context" "encoding/json" "fmt" "github.com/Microsoft/hcsshim/internal/oc" "go.opencensus.io/trace" ) // ExportLayer exports a container layer. // // `layerPath` is a path to a directory containing the layer to export. // // `exportFolderPath` is a pre-existing folder to export the layer to. // // `layerData` is the parent layer data. // // `options` are the export options applied to the exported layer. func ExportLayer(ctx context.Context, layerPath, exportFolderPath string, layerData LayerData, options ExportLayerOptions) (err error) { title := "hcsshim.ExportLayer" ctx, span := trace.StartSpan(ctx, title) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( trace.StringAttribute("layerPath", layerPath), trace.StringAttribute("exportFolderPath", exportFolderPath), ) ldbytes, err := json.Marshal(layerData) if err != nil { return err } obytes, err := json.Marshal(options) if err != nil { return err } err = hcsExportLayer(layerPath, exportFolderPath, string(ldbytes), string(obytes)) if err != nil { return fmt.Errorf("failed to export layer: %s", err) } return nil }
9,878
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/log/g.go
package log import ( "context" "github.com/sirupsen/logrus" "go.opencensus.io/trace" ) // G returns a `logrus.Entry` with the `TraceID, SpanID` from `ctx` if `ctx` // contains an OpenCensus `trace.Span`. func G(ctx context.Context) *logrus.Entry { span := trace.FromContext(ctx) if span != nil { sctx := span.SpanContext() return logrus.WithFields(logrus.Fields{ "traceID": sctx.TraceID.String(), "spanID": sctx.SpanID.String(), // "parentSpanID": TODO: JTERRY75 - Try to convince OC to export this? }) } return logrus.NewEntry(logrus.StandardLogger()) }
9,879
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go
package hcs import ( "context" "encoding/json" "errors" "strings" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/cow" "github.com/Microsoft/hcsshim/internal/log" "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/schema1" hcsschema "github.com/Microsoft/hcsshim/internal/schema2" "github.com/Microsoft/hcsshim/internal/timeout" "github.com/Microsoft/hcsshim/internal/vmcompute" "go.opencensus.io/trace" ) type System struct { handleLock sync.RWMutex handle vmcompute.HcsSystem id string callbackNumber uintptr closedWaitOnce sync.Once waitBlock chan struct{} waitError error exitError error os, typ string } func newSystem(id string) *System { return &System{ id: id, waitBlock: make(chan struct{}), } } // CreateComputeSystem creates a new compute system with the given configuration but does not start it. func CreateComputeSystem(ctx context.Context, id string, hcsDocumentInterface interface{}) (_ *System, err error) { operation := "hcsshim::CreateComputeSystem" // hcsCreateComputeSystemContext is an async operation. Start the outer span // here to measure the full create time. ctx, span := trace.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", id)) computeSystem := newSystem(id) hcsDocumentB, err := json.Marshal(hcsDocumentInterface) if err != nil { return nil, err } hcsDocument := string(hcsDocumentB) var ( identity syscall.Handle resultJSON string createError error ) computeSystem.handle, resultJSON, createError = vmcompute.HcsCreateComputeSystem(ctx, id, hcsDocument, identity) if createError == nil || IsPending(createError) { defer func() { if err != nil { computeSystem.Close() } }() if err = computeSystem.registerCallback(ctx); err != nil { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. computeSystem.Terminate(ctx) return nil, makeSystemError(computeSystem, operation, "", err, nil) } } events, err := processAsyncHcsResult(ctx, createError, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate) if err != nil { if err == ErrTimeout { // Terminate the compute system if it still exists. We're okay to // ignore a failure here. computeSystem.Terminate(ctx) } return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events) } go computeSystem.waitBackground() if err = computeSystem.getCachedProperties(ctx); err != nil { return nil, err } return computeSystem, nil } // OpenComputeSystem opens an existing compute system by ID. func OpenComputeSystem(ctx context.Context, id string) (*System, error) { operation := "hcsshim::OpenComputeSystem" computeSystem := newSystem(id) handle, resultJSON, err := vmcompute.HcsOpenComputeSystem(ctx, id) events := processHcsResult(ctx, resultJSON) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, events) } computeSystem.handle = handle defer func() { if err != nil { computeSystem.Close() } }() if err = computeSystem.registerCallback(ctx); err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } go computeSystem.waitBackground() if err = computeSystem.getCachedProperties(ctx); err != nil { return nil, err } return computeSystem, nil } func (computeSystem *System) getCachedProperties(ctx context.Context) error { props, err := computeSystem.Properties(ctx) if err != nil { return err } computeSystem.typ = strings.ToLower(props.SystemType) computeSystem.os = strings.ToLower(props.RuntimeOSType) if computeSystem.os == "" && computeSystem.typ == "container" { // Pre-RS5 HCS did not return the OS, but it only supported containers // that ran Windows. computeSystem.os = "windows" } return nil } // OS returns the operating system of the compute system, "linux" or "windows". func (computeSystem *System) OS() string { return computeSystem.os } // IsOCI returns whether processes in the compute system should be created via // OCI. func (computeSystem *System) IsOCI() bool { return computeSystem.os == "linux" && computeSystem.typ == "container" } // GetComputeSystems gets a list of the compute systems on the system that match the query func GetComputeSystems(ctx context.Context, q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) { operation := "hcsshim::GetComputeSystems" queryb, err := json.Marshal(q) if err != nil { return nil, err } computeSystemsJSON, resultJSON, err := vmcompute.HcsEnumerateComputeSystems(ctx, string(queryb)) events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } if computeSystemsJSON == "" { return nil, ErrUnexpectedValue } computeSystems := []schema1.ContainerProperties{} if err = json.Unmarshal([]byte(computeSystemsJSON), &computeSystems); err != nil { return nil, err } return computeSystems, nil } // Start synchronously starts the computeSystem. func (computeSystem *System) Start(ctx context.Context) (err error) { operation := "hcsshim::System::Start" // hcsStartComputeSystemContext is an async operation. Start the outer span // here to measure the full start time. ctx, span := trace.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() if computeSystem.handle == 0 { return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } resultJSON, err := vmcompute.HcsStartComputeSystem(ctx, computeSystem.handle, "") events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart) if err != nil { return makeSystemError(computeSystem, operation, "", err, events) } return nil } // ID returns the compute system's identifier. func (computeSystem *System) ID() string { return computeSystem.id } // Shutdown requests a compute system shutdown. func (computeSystem *System) Shutdown(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() operation := "hcsshim::System::Shutdown" if computeSystem.handle == 0 { return nil } resultJSON, err := vmcompute.HcsShutdownComputeSystem(ctx, computeSystem.handle, "") events := processHcsResult(ctx, resultJSON) switch err { case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: default: return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Terminate requests a compute system terminate. func (computeSystem *System) Terminate(ctx context.Context) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() operation := "hcsshim::System::Terminate" if computeSystem.handle == 0 { return nil } resultJSON, err := vmcompute.HcsTerminateComputeSystem(ctx, computeSystem.handle, "") events := processHcsResult(ctx, resultJSON) switch err { case nil, ErrVmcomputeAlreadyStopped, ErrComputeSystemDoesNotExist, ErrVmcomputeOperationPending: default: return makeSystemError(computeSystem, operation, "", err, events) } return nil } // waitBackground waits for the compute system exit notification. Once received // sets `computeSystem.waitError` (if any) and unblocks all `Wait` calls. // // This MUST be called exactly once per `computeSystem.handle` but `Wait` is // safe to call multiple times. func (computeSystem *System) waitBackground() { operation := "hcsshim::System::waitBackground" ctx, span := trace.StartSpan(context.Background(), operation) defer span.End() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) err := waitForNotification(ctx, computeSystem.callbackNumber, hcsNotificationSystemExited, nil) switch err { case nil: log.G(ctx).Debug("system exited") case ErrVmcomputeUnexpectedExit: log.G(ctx).Debug("unexpected system exit") computeSystem.exitError = makeSystemError(computeSystem, operation, "", err, nil) err = nil default: err = makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.closedWaitOnce.Do(func() { computeSystem.waitError = err close(computeSystem.waitBlock) }) oc.SetSpanStatus(span, err) } // Wait synchronously waits for the compute system to shutdown or terminate. If // the compute system has already exited returns the previous error (if any). func (computeSystem *System) Wait() error { <-computeSystem.waitBlock return computeSystem.waitError } // ExitError returns an error describing the reason the compute system terminated. func (computeSystem *System) ExitError() error { select { case <-computeSystem.waitBlock: if computeSystem.waitError != nil { return computeSystem.waitError } return computeSystem.exitError default: return errors.New("container not exited") } } // Properties returns the requested container properties targeting a V1 schema container. func (computeSystem *System) Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() operation := "hcsshim::System::Properties" queryBytes, err := json.Marshal(schema1.PropertyQuery{PropertyTypes: types}) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) events := processHcsResult(ctx, resultJSON) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, events) } if propertiesJSON == "" { return nil, ErrUnexpectedValue } properties := &schema1.ContainerProperties{} if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // PropertiesV2 returns the requested container properties targeting a V2 schema container. func (computeSystem *System) PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() operation := "hcsshim::System::PropertiesV2" queryBytes, err := json.Marshal(hcsschema.PropertyQuery{PropertyTypes: types}) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } propertiesJSON, resultJSON, err := vmcompute.HcsGetComputeSystemProperties(ctx, computeSystem.handle, string(queryBytes)) events := processHcsResult(ctx, resultJSON) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, events) } if propertiesJSON == "" { return nil, ErrUnexpectedValue } properties := &hcsschema.Properties{} if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } return properties, nil } // Pause pauses the execution of the computeSystem. This feature is not enabled in TP5. func (computeSystem *System) Pause(ctx context.Context) (err error) { operation := "hcsshim::System::Pause" // hcsPauseComputeSystemContext is an async peration. Start the outer span // here to measure the full pause time. ctx, span := trace.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() if computeSystem.handle == 0 { return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } resultJSON, err := vmcompute.HcsPauseComputeSystem(ctx, computeSystem.handle, "") events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause) if err != nil { return makeSystemError(computeSystem, operation, "", err, events) } return nil } // Resume resumes the execution of the computeSystem. This feature is not enabled in TP5. func (computeSystem *System) Resume(ctx context.Context) (err error) { operation := "hcsshim::System::Resume" // hcsResumeComputeSystemContext is an async operation. Start the outer span // here to measure the full restore time. ctx, span := trace.StartSpan(ctx, operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() if computeSystem.handle == 0 { return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } resultJSON, err := vmcompute.HcsResumeComputeSystem(ctx, computeSystem.handle, "") events, err := processAsyncHcsResult(ctx, err, resultJSON, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume) if err != nil { return makeSystemError(computeSystem, operation, "", err, events) } return nil } func (computeSystem *System) createProcess(ctx context.Context, operation string, c interface{}) (*Process, *vmcompute.HcsProcessInformation, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() if computeSystem.handle == 0 { return nil, nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } configurationb, err := json.Marshal(c) if err != nil { return nil, nil, makeSystemError(computeSystem, operation, "", err, nil) } configuration := string(configurationb) processInfo, processHandle, resultJSON, err := vmcompute.HcsCreateProcess(ctx, computeSystem.handle, configuration) events := processHcsResult(ctx, resultJSON) if err != nil { return nil, nil, makeSystemError(computeSystem, operation, configuration, err, events) } log.G(ctx).WithField("pid", processInfo.ProcessId).Debug("created process pid") return newProcess(processHandle, int(processInfo.ProcessId), computeSystem), &processInfo, nil } // CreateProcess launches a new process within the computeSystem. func (computeSystem *System) CreateProcess(ctx context.Context, c interface{}) (cow.Process, error) { operation := "hcsshim::System::CreateProcess" process, processInfo, err := computeSystem.createProcess(ctx, operation, c) if err != nil { return nil, err } defer func() { if err != nil { process.Close() } }() pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } process.stdin = pipes[0] process.stdout = pipes[1] process.stderr = pipes[2] process.hasCachedStdio = true if err = process.registerCallback(ctx); err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } go process.waitBackground() return process, nil } // OpenProcess gets an interface to an existing process within the computeSystem. func (computeSystem *System) OpenProcess(ctx context.Context, pid int) (*Process, error) { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() operation := "hcsshim::System::OpenProcess" if computeSystem.handle == 0 { return nil, makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } processHandle, resultJSON, err := vmcompute.HcsOpenProcess(ctx, computeSystem.handle, uint32(pid)) events := processHcsResult(ctx, resultJSON) if err != nil { return nil, makeSystemError(computeSystem, operation, "", err, events) } process := newProcess(processHandle, pid, computeSystem) if err = process.registerCallback(ctx); err != nil { return nil, makeSystemError(computeSystem, operation, "", err, nil) } go process.waitBackground() return process, nil } // Close cleans up any state associated with the compute system but does not terminate or wait for it. func (computeSystem *System) Close() (err error) { operation := "hcsshim::System::Close" ctx, span := trace.StartSpan(context.Background(), operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes(trace.StringAttribute("cid", computeSystem.id)) computeSystem.handleLock.Lock() defer computeSystem.handleLock.Unlock() // Don't double free this if computeSystem.handle == 0 { return nil } if err = computeSystem.unregisterCallback(ctx); err != nil { return makeSystemError(computeSystem, operation, "", err, nil) } err = vmcompute.HcsCloseComputeSystem(ctx, computeSystem.handle) if err != nil { return makeSystemError(computeSystem, operation, "", err, nil) } computeSystem.handle = 0 computeSystem.closedWaitOnce.Do(func() { computeSystem.waitError = ErrAlreadyClosed close(computeSystem.waitBlock) }) return nil } func (computeSystem *System) registerCallback(ctx context.Context) error { callbackContext := &notifcationWatcherContext{ channels: newSystemChannels(), systemID: computeSystem.id, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() callbackHandle, err := vmcompute.HcsRegisterComputeSystemCallback(ctx, computeSystem.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } callbackContext.handle = callbackHandle computeSystem.callbackNumber = callbackNumber return nil } func (computeSystem *System) unregisterCallback(ctx context.Context) error { callbackNumber := computeSystem.callbackNumber callbackMapLock.RLock() callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() if callbackContext == nil { return nil } handle := callbackContext.handle if handle == 0 { return nil } // hcsUnregisterComputeSystemCallback has its own syncronization // to wait for all callbacks to complete. We must NOT hold the callbackMapLock. err := vmcompute.HcsUnregisterComputeSystemCallback(ctx, handle) if err != nil { return err } closeChannels(callbackContext.channels) callbackMapLock.Lock() delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 return nil } // Modify the System by sending a request to HCS func (computeSystem *System) Modify(ctx context.Context, config interface{}) error { computeSystem.handleLock.RLock() defer computeSystem.handleLock.RUnlock() operation := "hcsshim::System::Modify" if computeSystem.handle == 0 { return makeSystemError(computeSystem, operation, "", ErrAlreadyClosed, nil) } requestBytes, err := json.Marshal(config) if err != nil { return err } requestJSON := string(requestBytes) resultJSON, err := vmcompute.HcsModifyComputeSystem(ctx, computeSystem.handle, requestJSON) events := processHcsResult(ctx, resultJSON) if err != nil { return makeSystemError(computeSystem, operation, requestJSON, err, events) } return nil }
9,880
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go
package hcs import ( "fmt" "sync" "syscall" "github.com/Microsoft/hcsshim/internal/interop" "github.com/Microsoft/hcsshim/internal/logfields" "github.com/Microsoft/hcsshim/internal/vmcompute" "github.com/sirupsen/logrus" ) var ( nextCallback uintptr callbackMap = map[uintptr]*notifcationWatcherContext{} callbackMapLock = sync.RWMutex{} notificationWatcherCallback = syscall.NewCallback(notificationWatcher) // Notifications for HCS_SYSTEM handles hcsNotificationSystemExited hcsNotification = 0x00000001 hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002 hcsNotificationSystemStartCompleted hcsNotification = 0x00000003 hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004 hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005 hcsNotificationSystemCrashReport hcsNotification = 0x00000006 hcsNotificationSystemSiloJobCreated hcsNotification = 0x00000007 hcsNotificationSystemSaveCompleted hcsNotification = 0x00000008 hcsNotificationSystemRdpEnhancedModeStateChanged hcsNotification = 0x00000009 hcsNotificationSystemShutdownFailed hcsNotification = 0x0000000A hcsNotificationSystemGetPropertiesCompleted hcsNotification = 0x0000000B hcsNotificationSystemModifyCompleted hcsNotification = 0x0000000C hcsNotificationSystemCrashInitiated hcsNotification = 0x0000000D hcsNotificationSystemGuestConnectionClosed hcsNotification = 0x0000000E // Notifications for HCS_PROCESS handles hcsNotificationProcessExited hcsNotification = 0x00010000 // Common notifications hcsNotificationInvalid hcsNotification = 0x00000000 hcsNotificationServiceDisconnect hcsNotification = 0x01000000 ) type hcsNotification uint32 func (hn hcsNotification) String() string { switch hn { case hcsNotificationSystemExited: return "SystemExited" case hcsNotificationSystemCreateCompleted: return "SystemCreateCompleted" case hcsNotificationSystemStartCompleted: return "SystemStartCompleted" case hcsNotificationSystemPauseCompleted: return "SystemPauseCompleted" case hcsNotificationSystemResumeCompleted: return "SystemResumeCompleted" case hcsNotificationSystemCrashReport: return "SystemCrashReport" case hcsNotificationSystemSiloJobCreated: return "SystemSiloJobCreated" case hcsNotificationSystemSaveCompleted: return "SystemSaveCompleted" case hcsNotificationSystemRdpEnhancedModeStateChanged: return "SystemRdpEnhancedModeStateChanged" case hcsNotificationSystemShutdownFailed: return "SystemShutdownFailed" case hcsNotificationSystemGetPropertiesCompleted: return "SystemGetPropertiesCompleted" case hcsNotificationSystemModifyCompleted: return "SystemModifyCompleted" case hcsNotificationSystemCrashInitiated: return "SystemCrashInitiated" case hcsNotificationSystemGuestConnectionClosed: return "SystemGuestConnectionClosed" case hcsNotificationProcessExited: return "ProcessExited" case hcsNotificationInvalid: return "Invalid" case hcsNotificationServiceDisconnect: return "ServiceDisconnect" default: return fmt.Sprintf("Unknown: %d", hn) } } type notificationChannel chan error type notifcationWatcherContext struct { channels notificationChannels handle vmcompute.HcsCallback systemID string processID int } type notificationChannels map[hcsNotification]notificationChannel func newSystemChannels() notificationChannels { channels := make(notificationChannels) for _, notif := range []hcsNotification{ hcsNotificationServiceDisconnect, hcsNotificationSystemExited, hcsNotificationSystemCreateCompleted, hcsNotificationSystemStartCompleted, hcsNotificationSystemPauseCompleted, hcsNotificationSystemResumeCompleted, } { channels[notif] = make(notificationChannel, 1) } return channels } func newProcessChannels() notificationChannels { channels := make(notificationChannels) for _, notif := range []hcsNotification{ hcsNotificationServiceDisconnect, hcsNotificationProcessExited, } { channels[notif] = make(notificationChannel, 1) } return channels } func closeChannels(channels notificationChannels) { for _, c := range channels { close(c) } } func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr { var result error if int32(notificationStatus) < 0 { result = interop.Win32FromHresult(notificationStatus) } callbackMapLock.RLock() context := callbackMap[callbackNumber] callbackMapLock.RUnlock() if context == nil { return 0 } log := logrus.WithFields(logrus.Fields{ "notification-type": notificationType.String(), "system-id": context.systemID, }) if context.processID != 0 { log.Data[logfields.ProcessID] = context.processID } log.Debug("HCS notification") if channel, ok := context.channels[notificationType]; ok { channel <- result } return 0 }
9,881
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/hcs/service.go
package hcs import ( "context" "encoding/json" hcsschema "github.com/Microsoft/hcsshim/internal/schema2" "github.com/Microsoft/hcsshim/internal/vmcompute" ) // GetServiceProperties returns properties of the host compute service. func GetServiceProperties(ctx context.Context, q hcsschema.PropertyQuery) (*hcsschema.ServiceProperties, error) { operation := "hcsshim::GetServiceProperties" queryb, err := json.Marshal(q) if err != nil { return nil, err } propertiesJSON, resultJSON, err := vmcompute.HcsGetServiceProperties(ctx, string(queryb)) events := processHcsResult(ctx, resultJSON) if err != nil { return nil, &HcsError{Op: operation, Err: err, Events: events} } if propertiesJSON == "" { return nil, ErrUnexpectedValue } properties := &hcsschema.ServiceProperties{} if err := json.Unmarshal([]byte(propertiesJSON), properties); err != nil { return nil, err } return properties, nil } // ModifyServiceSettings modifies settings of the host compute service. func ModifyServiceSettings(ctx context.Context, settings hcsschema.ModificationRequest) error { operation := "hcsshim::ModifyServiceSettings" settingsJSON, err := json.Marshal(settings) if err != nil { return err } resultJSON, err := vmcompute.HcsModifyServiceSettings(ctx, string(settingsJSON)) events := processHcsResult(ctx, resultJSON) if err != nil { return &HcsError{Op: operation, Err: err, Events: events} } return nil }
9,882
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go
package hcs import ( "context" "io" "syscall" "github.com/Microsoft/go-winio" diskutil "github.com/Microsoft/go-winio/vhd" "github.com/Microsoft/hcsshim/computestorage" "github.com/pkg/errors" "golang.org/x/sys/windows" ) // makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles // if there is an error. func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) { fs := make([]io.ReadWriteCloser, len(hs)) for i, h := range hs { if h != syscall.Handle(0) { if err == nil { fs[i], err = winio.MakeOpenFile(h) } if err != nil { syscall.Close(h) } } } if err != nil { for _, f := range fs { if f != nil { f.Close() } } return nil, err } return fs, nil } // CreateNTFSVHD creates a VHD formatted with NTFS of size `sizeGB` at the given `vhdPath`. func CreateNTFSVHD(ctx context.Context, vhdPath string, sizeGB uint32) (err error) { if err := diskutil.CreateVhdx(vhdPath, sizeGB, 1); err != nil { return errors.Wrap(err, "failed to create VHD") } vhd, err := diskutil.OpenVirtualDisk(vhdPath, diskutil.VirtualDiskAccessNone, diskutil.OpenVirtualDiskFlagNone) if err != nil { return errors.Wrap(err, "failed to open VHD") } defer func() { err2 := windows.CloseHandle(windows.Handle(vhd)) if err == nil { err = errors.Wrap(err2, "failed to close VHD") } }() if err := computestorage.FormatWritableLayerVhd(ctx, windows.Handle(vhd)); err != nil { return errors.Wrap(err, "failed to format VHD") } return nil }
9,883
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go
package hcs import ( "context" "encoding/json" "errors" "fmt" "net" "syscall" "github.com/Microsoft/hcsshim/internal/log" ) var ( // ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e) // ErrElementNotFound is an error encountered when the object being referenced does not exist ErrElementNotFound = syscall.Errno(0x490) // ErrElementNotFound is an error encountered when the object being referenced does not exist ErrNotSupported = syscall.Errno(0x32) // ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported // decimal -2147024883 / hex 0x8007000d ErrInvalidData = syscall.Errno(0xd) // ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed") // ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed") // ErrInvalidNotificationType is an error encountered when an invalid notification type is used ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type") // ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation") // ErrTimeout is an error encountered when waiting on a notification times out ErrTimeout = errors.New("hcsshim: timeout waiting for notification") // ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for // a different expected notification ErrUnexpectedContainerExit = errors.New("unexpected container exit") // ErrUnexpectedProcessAbort is the error encountered when communication with the compute service // is lost while waiting for a notification ErrUnexpectedProcessAbort = errors.New("lost communication with compute service") // ErrUnexpectedValue is an error encountered when hcs returns an invalid value ErrUnexpectedValue = errors.New("unexpected value returned from hcs") // ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110) // ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously ErrVmcomputeOperationPending = syscall.Errno(0xC0370103) // ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105) // ErrProcNotFound is an error encountered when the the process cannot be found ErrProcNotFound = syscall.Errno(0x7f) // ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2 // builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3. ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5) // ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d) // ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b) // ErrVmcomputeUnexpectedExit is an error encountered when the compute system terminates unexpectedly ErrVmcomputeUnexpectedExit = syscall.Errno(0xC0370106) // ErrNotSupported is an error encountered when hcs doesn't support the request ErrPlatformNotSupported = errors.New("unsupported platform request") ) type ErrorEvent struct { Message string `json:"Message,omitempty"` // Fully formated error message StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form Provider string `json:"Provider,omitempty"` EventID uint16 `json:"EventId,omitempty"` Flags uint32 `json:"Flags,omitempty"` Source string `json:"Source,omitempty"` //Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function) } type hcsResult struct { Error int32 ErrorMessage string ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"` } func (ev *ErrorEvent) String() string { evs := "[Event Detail: " + ev.Message if ev.StackTrace != "" { evs += " Stack Trace: " + ev.StackTrace } if ev.Provider != "" { evs += " Provider: " + ev.Provider } if ev.EventID != 0 { evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID) } if ev.Flags != 0 { evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags) } if ev.Source != "" { evs += " Source: " + ev.Source } evs += "]" return evs } func processHcsResult(ctx context.Context, resultJSON string) []ErrorEvent { if resultJSON != "" { result := &hcsResult{} if err := json.Unmarshal([]byte(resultJSON), result); err != nil { log.G(ctx).WithError(err).Warning("Could not unmarshal HCS result") return nil } return result.ErrorEvents } return nil } type HcsError struct { Op string Err error Events []ErrorEvent } var _ net.Error = &HcsError{} func (e *HcsError) Error() string { s := e.Op + ": " + e.Err.Error() for _, ev := range e.Events { s += "\n" + ev.String() } return s } func (e *HcsError) Temporary() bool { err, ok := e.Err.(net.Error) return ok && err.Temporary() } func (e *HcsError) Timeout() bool { err, ok := e.Err.(net.Error) return ok && err.Timeout() } // ProcessError is an error encountered in HCS during an operation on a Process object type ProcessError struct { SystemID string Pid int Op string Err error Events []ErrorEvent } var _ net.Error = &ProcessError{} // SystemError is an error encountered in HCS during an operation on a Container object type SystemError struct { ID string Op string Err error Extra string Events []ErrorEvent } var _ net.Error = &SystemError{} func (e *SystemError) Error() string { s := e.Op + " " + e.ID + ": " + e.Err.Error() for _, ev := range e.Events { s += "\n" + ev.String() } if e.Extra != "" { s += "\n(extra info: " + e.Extra + ")" } return s } func (e *SystemError) Temporary() bool { err, ok := e.Err.(net.Error) return ok && err.Temporary() } func (e *SystemError) Timeout() bool { err, ok := e.Err.(net.Error) return ok && err.Timeout() } func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*SystemError); ok { return err } return &SystemError{ ID: system.ID(), Op: op, Extra: extra, Err: err, Events: events, } } func (e *ProcessError) Error() string { s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error()) for _, ev := range e.Events { s += "\n" + ev.String() } return s } func (e *ProcessError) Temporary() bool { err, ok := e.Err.(net.Error) return ok && err.Temporary() } func (e *ProcessError) Timeout() bool { err, ok := e.Err.(net.Error) return ok && err.Timeout() } func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error { // Don't double wrap errors if _, ok := err.(*ProcessError); ok { return err } return &ProcessError{ Pid: process.Pid(), SystemID: process.SystemID(), Op: op, Err: err, Events: events, } } // IsNotExist checks if an error is caused by the Container or Process not existing. // Note: Currently, ErrElementNotFound can mean that a Process has either // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound or ErrProcNotFound. func IsNotExist(err error) bool { err = getInnerError(err) return err == ErrComputeSystemDoesNotExist || err == ErrElementNotFound || err == ErrProcNotFound } // IsAlreadyClosed checks if an error is caused by the Container or Process having been // already closed by a call to the Close() method. func IsAlreadyClosed(err error) bool { err = getInnerError(err) return err == ErrAlreadyClosed } // IsPending returns a boolean indicating whether the error is that // the requested operation is being completed in the background. func IsPending(err error) bool { err = getInnerError(err) return err == ErrVmcomputeOperationPending } // IsTimeout returns a boolean indicating whether the error is caused by // a timeout waiting for the operation to complete. func IsTimeout(err error) bool { if err, ok := err.(net.Error); ok && err.Timeout() { return true } err = getInnerError(err) return err == ErrTimeout } // IsAlreadyStopped returns a boolean indicating whether the error is caused by // a Container or Process being already stopped. // Note: Currently, ErrElementNotFound can mean that a Process has either // already exited, or does not exist. Both IsAlreadyStopped and IsNotExist // will currently return true when the error is ErrElementNotFound or ErrProcNotFound. func IsAlreadyStopped(err error) bool { err = getInnerError(err) return err == ErrVmcomputeAlreadyStopped || err == ErrElementNotFound || err == ErrProcNotFound } // IsNotSupported returns a boolean indicating whether the error is caused by // unsupported platform requests // Note: Currently Unsupported platform requests can be mean either // ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage // is thrown from the Platform func IsNotSupported(err error) bool { err = getInnerError(err) // If Platform doesn't recognize or support the request sent, below errors are seen return err == ErrVmcomputeInvalidJSON || err == ErrInvalidData || err == ErrNotSupported || err == ErrVmcomputeUnknownMessage } // IsOperationInvalidState returns true when err is caused by // `ErrVmcomputeOperationInvalidState`. func IsOperationInvalidState(err error) bool { err = getInnerError(err) return err == ErrVmcomputeOperationInvalidState } func getInnerError(err error) error { switch pe := err.(type) { case nil: return nil case *HcsError: err = pe.Err case *SystemError: err = pe.Err case *ProcessError: err = pe.Err } return err } func getOperationLogResult(err error) (string, error) { switch err { case nil: return "Success", nil default: return "Error", err } }
9,884
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go
package hcs import ( "context" "time" "github.com/Microsoft/hcsshim/internal/log" ) func processAsyncHcsResult(ctx context.Context, err error, resultJSON string, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) { events := processHcsResult(ctx, resultJSON) if IsPending(err) { return nil, waitForNotification(ctx, callbackNumber, expectedNotification, timeout) } return events, err } func waitForNotification(ctx context.Context, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error { callbackMapLock.RLock() if _, ok := callbackMap[callbackNumber]; !ok { callbackMapLock.RUnlock() log.G(ctx).WithField("callbackNumber", callbackNumber).Error("failed to waitForNotification: callbackNumber does not exist in callbackMap") return ErrHandleClose } channels := callbackMap[callbackNumber].channels callbackMapLock.RUnlock() expectedChannel := channels[expectedNotification] if expectedChannel == nil { log.G(ctx).WithField("type", expectedNotification).Error("unknown notification type in waitForNotification") return ErrInvalidNotificationType } var c <-chan time.Time if timeout != nil { timer := time.NewTimer(*timeout) c = timer.C defer timer.Stop() } select { case err, ok := <-expectedChannel: if !ok { return ErrHandleClose } return err case err, ok := <-channels[hcsNotificationSystemExited]: if !ok { return ErrHandleClose } // If the expected notification is hcsNotificationSystemExited which of the two selects // chosen is random. Return the raw error if hcsNotificationSystemExited is expected if channels[hcsNotificationSystemExited] == expectedChannel { return err } return ErrUnexpectedContainerExit case _, ok := <-channels[hcsNotificationServiceDisconnect]: if !ok { return ErrHandleClose } // hcsNotificationServiceDisconnect should never be an expected notification // it does not need the same handling as hcsNotificationSystemExited return ErrUnexpectedProcessAbort case <-c: return ErrTimeout } return nil }
9,885
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go
package hcs import ( "context" "encoding/json" "io" "sync" "syscall" "time" "github.com/Microsoft/hcsshim/internal/log" "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/vmcompute" "go.opencensus.io/trace" ) // ContainerError is an error encountered in HCS type Process struct { handleLock sync.RWMutex handle vmcompute.HcsProcess processID int system *System hasCachedStdio bool stdioLock sync.Mutex stdin io.WriteCloser stdout io.ReadCloser stderr io.ReadCloser callbackNumber uintptr closedWaitOnce sync.Once waitBlock chan struct{} exitCode int waitError error } func newProcess(process vmcompute.HcsProcess, processID int, computeSystem *System) *Process { return &Process{ handle: process, processID: processID, system: computeSystem, waitBlock: make(chan struct{}), } } type processModifyRequest struct { Operation string ConsoleSize *consoleSize `json:",omitempty"` CloseHandle *closeHandle `json:",omitempty"` } type consoleSize struct { Height uint16 Width uint16 } type closeHandle struct { Handle string } type processStatus struct { ProcessID uint32 Exited bool ExitCode uint32 LastWaitResult int32 } const ( stdIn string = "StdIn" stdOut string = "StdOut" stdErr string = "StdErr" ) const ( modifyConsoleSize string = "ConsoleSize" modifyCloseHandle string = "CloseHandle" ) // Pid returns the process ID of the process within the container. func (process *Process) Pid() int { return process.processID } // SystemID returns the ID of the process's compute system. func (process *Process) SystemID() string { return process.system.ID() } func (process *Process) processSignalResult(ctx context.Context, err error) (bool, error) { switch err { case nil: return true, nil case ErrVmcomputeOperationInvalidState, ErrComputeSystemDoesNotExist, ErrElementNotFound: select { case <-process.waitBlock: // The process exit notification has already arrived. default: // The process should be gone, but we have not received the notification. // After a second, force unblock the process wait to work around a possible // deadlock in the HCS. go func() { time.Sleep(time.Second) process.closedWaitOnce.Do(func() { log.G(ctx).WithError(err).Warn("force unblocking process waits") process.exitCode = -1 process.waitError = err close(process.waitBlock) }) }() } return false, nil default: return false, err } } // Signal signals the process with `options`. // // For LCOW `guestrequest.SignalProcessOptionsLCOW`. // // For WCOW `guestrequest.SignalProcessOptionsWCOW`. func (process *Process) Signal(ctx context.Context, options interface{}) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Signal" if process.handle == 0 { return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } optionsb, err := json.Marshal(options) if err != nil { return false, err } resultJSON, err := vmcompute.HcsSignalProcess(ctx, process.handle, string(optionsb)) events := processHcsResult(ctx, resultJSON) delivered, err := process.processSignalResult(ctx, err) if err != nil { err = makeProcessError(process, operation, err, events) } return delivered, err } // Kill signals the process to terminate but does not wait for it to finish terminating. func (process *Process) Kill(ctx context.Context) (bool, error) { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::Kill" if process.handle == 0 { return false, makeProcessError(process, operation, ErrAlreadyClosed, nil) } resultJSON, err := vmcompute.HcsTerminateProcess(ctx, process.handle) events := processHcsResult(ctx, resultJSON) delivered, err := process.processSignalResult(ctx, err) if err != nil { err = makeProcessError(process, operation, err, events) } return delivered, err } // waitBackground waits for the process exit notification. Once received sets // `process.waitError` (if any) and unblocks all `Wait` calls. // // This MUST be called exactly once per `process.handle` but `Wait` is safe to // call multiple times. func (process *Process) waitBackground() { operation := "hcsshim::Process::waitBackground" ctx, span := trace.StartSpan(context.Background(), operation) defer span.End() span.AddAttributes( trace.StringAttribute("cid", process.SystemID()), trace.Int64Attribute("pid", int64(process.processID))) var ( err error exitCode = -1 ) err = waitForNotification(ctx, process.callbackNumber, hcsNotificationProcessExited, nil) if err != nil { err = makeProcessError(process, operation, err, nil) log.G(ctx).WithError(err).Error("failed wait") } else { process.handleLock.RLock() defer process.handleLock.RUnlock() // Make sure we didnt race with Close() here if process.handle != 0 { propertiesJSON, resultJSON, err := vmcompute.HcsGetProcessProperties(ctx, process.handle) events := processHcsResult(ctx, resultJSON) if err != nil { err = makeProcessError(process, operation, err, events) } else { properties := &processStatus{} err = json.Unmarshal([]byte(propertiesJSON), properties) if err != nil { err = makeProcessError(process, operation, err, nil) } else { if properties.LastWaitResult != 0 { log.G(ctx).WithField("wait-result", properties.LastWaitResult).Warning("non-zero last wait result") } else { exitCode = int(properties.ExitCode) } } } } } log.G(ctx).WithField("exitCode", exitCode).Debug("process exited") process.closedWaitOnce.Do(func() { process.exitCode = exitCode process.waitError = err close(process.waitBlock) }) oc.SetSpanStatus(span, err) } // Wait waits for the process to exit. If the process has already exited returns // the pervious error (if any). func (process *Process) Wait() error { <-process.waitBlock return process.waitError } // ResizeConsole resizes the console of the process. func (process *Process) ResizeConsole(ctx context.Context, width, height uint16) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::ResizeConsole" if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) } modifyRequest := processModifyRequest{ Operation: modifyConsoleSize, ConsoleSize: &consoleSize{ Height: height, Width: width, }, } modifyRequestb, err := json.Marshal(modifyRequest) if err != nil { return err } resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } return nil } // ExitCode returns the exit code of the process. The process must have // already terminated. func (process *Process) ExitCode() (int, error) { select { case <-process.waitBlock: if process.waitError != nil { return -1, process.waitError } return process.exitCode, nil default: return -1, makeProcessError(process, "hcsshim::Process::ExitCode", ErrInvalidProcessState, nil) } } // StdioLegacy returns the stdin, stdout, and stderr pipes, respectively. Closing // these pipes does not close the underlying pipes. Once returned, these pipes // are the responsibility of the caller to close. func (process *Process) StdioLegacy() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) { operation := "hcsshim::Process::StdioLegacy" ctx, span := trace.StartSpan(context.Background(), operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( trace.StringAttribute("cid", process.SystemID()), trace.Int64Attribute("pid", int64(process.processID))) process.handleLock.RLock() defer process.handleLock.RUnlock() if process.handle == 0 { return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil) } process.stdioLock.Lock() defer process.stdioLock.Unlock() if process.hasCachedStdio { stdin, stdout, stderr := process.stdin, process.stdout, process.stderr process.stdin, process.stdout, process.stderr = nil, nil, nil process.hasCachedStdio = false return stdin, stdout, stderr, nil } processInfo, resultJSON, err := vmcompute.HcsGetProcessInfo(ctx, process.handle) events := processHcsResult(ctx, resultJSON) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, events) } pipes, err := makeOpenFiles([]syscall.Handle{processInfo.StdInput, processInfo.StdOutput, processInfo.StdError}) if err != nil { return nil, nil, nil, makeProcessError(process, operation, err, nil) } return pipes[0], pipes[1], pipes[2], nil } // Stdio returns the stdin, stdout, and stderr pipes, respectively. // To close them, close the process handle. func (process *Process) Stdio() (stdin io.Writer, stdout, stderr io.Reader) { process.stdioLock.Lock() defer process.stdioLock.Unlock() return process.stdin, process.stdout, process.stderr } // CloseStdin closes the write side of the stdin pipe so that the process is // notified on the read side that there is no more data in stdin. func (process *Process) CloseStdin(ctx context.Context) error { process.handleLock.RLock() defer process.handleLock.RUnlock() operation := "hcsshim::Process::CloseStdin" if process.handle == 0 { return makeProcessError(process, operation, ErrAlreadyClosed, nil) } modifyRequest := processModifyRequest{ Operation: modifyCloseHandle, CloseHandle: &closeHandle{ Handle: stdIn, }, } modifyRequestb, err := json.Marshal(modifyRequest) if err != nil { return err } resultJSON, err := vmcompute.HcsModifyProcess(ctx, process.handle, string(modifyRequestb)) events := processHcsResult(ctx, resultJSON) if err != nil { return makeProcessError(process, operation, err, events) } process.stdioLock.Lock() if process.stdin != nil { process.stdin.Close() process.stdin = nil } process.stdioLock.Unlock() return nil } // Close cleans up any state associated with the process but does not kill // or wait on it. func (process *Process) Close() (err error) { operation := "hcsshim::Process::Close" ctx, span := trace.StartSpan(context.Background(), operation) defer span.End() defer func() { oc.SetSpanStatus(span, err) }() span.AddAttributes( trace.StringAttribute("cid", process.SystemID()), trace.Int64Attribute("pid", int64(process.processID))) process.handleLock.Lock() defer process.handleLock.Unlock() // Don't double free this if process.handle == 0 { return nil } process.stdioLock.Lock() if process.stdin != nil { process.stdin.Close() process.stdin = nil } if process.stdout != nil { process.stdout.Close() process.stdout = nil } if process.stderr != nil { process.stderr.Close() process.stderr = nil } process.stdioLock.Unlock() if err = process.unregisterCallback(ctx); err != nil { return makeProcessError(process, operation, err, nil) } if err = vmcompute.HcsCloseProcess(ctx, process.handle); err != nil { return makeProcessError(process, operation, err, nil) } process.handle = 0 process.closedWaitOnce.Do(func() { process.exitCode = -1 process.waitError = ErrAlreadyClosed close(process.waitBlock) }) return nil } func (process *Process) registerCallback(ctx context.Context) error { callbackContext := &notifcationWatcherContext{ channels: newProcessChannels(), systemID: process.SystemID(), processID: process.processID, } callbackMapLock.Lock() callbackNumber := nextCallback nextCallback++ callbackMap[callbackNumber] = callbackContext callbackMapLock.Unlock() callbackHandle, err := vmcompute.HcsRegisterProcessCallback(ctx, process.handle, notificationWatcherCallback, callbackNumber) if err != nil { return err } callbackContext.handle = callbackHandle process.callbackNumber = callbackNumber return nil } func (process *Process) unregisterCallback(ctx context.Context) error { callbackNumber := process.callbackNumber callbackMapLock.RLock() callbackContext := callbackMap[callbackNumber] callbackMapLock.RUnlock() if callbackContext == nil { return nil } handle := callbackContext.handle if handle == 0 { return nil } // vmcompute.HcsUnregisterProcessCallback has its own synchronization to // wait for all callbacks to complete. We must NOT hold the callbackMapLock. err := vmcompute.HcsUnregisterProcessCallback(ctx, handle) if err != nil { return err } closeChannels(callbackContext.channels) callbackMapLock.Lock() delete(callbackMap, callbackNumber) callbackMapLock.Unlock() handle = 0 return nil }
9,886
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go
package safefile import ( "errors" "io" "os" "path/filepath" "strings" "syscall" "unicode/utf16" "unsafe" "github.com/Microsoft/hcsshim/internal/longpath" "github.com/Microsoft/hcsshim/internal/winapi" winio "github.com/Microsoft/go-winio" ) func OpenRoot(path string) (*os.File, error) { longpath, err := longpath.LongAbs(path) if err != nil { return nil, err } return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING) } func cleanGoStringRelativePath(path string) (string, error) { path = filepath.Clean(path) if strings.Contains(path, ":") { // Since alternate data streams must follow the file they // are attached to, finding one here (out of order) is invalid. return "", errors.New("path contains invalid character `:`") } fspath := filepath.FromSlash(path) if len(fspath) > 0 && fspath[0] == '\\' { return "", errors.New("expected relative path") } return fspath, nil } func ntRelativePath(path string) ([]uint16, error) { fspath, err := cleanGoStringRelativePath(path) if err != nil { return nil, err } path16 := utf16.Encode(([]rune)(fspath)) if len(path16) > 32767 { return nil, syscall.ENAMETOOLONG } return path16, nil } // openRelativeInternal opens a relative path from the given root, failing if // any of the intermediate path components are reparse points. func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { var ( h uintptr iosb winapi.IOStatusBlock oa winapi.ObjectAttributes ) cleanRelativePath, err := cleanGoStringRelativePath(path) if err != nil { return nil, err } if root == nil || root.Fd() == 0 { return nil, errors.New("missing root directory") } pathUnicode, err := winapi.NewUnicodeString(cleanRelativePath) if err != nil { return nil, err } oa.Length = unsafe.Sizeof(oa) oa.ObjectName = uintptr(unsafe.Pointer(pathUnicode)) oa.RootDirectory = uintptr(root.Fd()) oa.Attributes = winapi.OBJ_DONT_REPARSE status := winapi.NtCreateFile( &h, accessMask|syscall.SYNCHRONIZE, &oa, &iosb, nil, 0, shareFlags, createDisposition, winapi.FILE_OPEN_FOR_BACKUP_INTENT|winapi.FILE_SYNCHRONOUS_IO_NONALERT|flags, nil, 0, ) if status != 0 { return nil, winapi.RtlNtStatusToDosError(status) } fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path)) if err != nil { syscall.Close(syscall.Handle(h)) return nil, err } return os.NewFile(h, fullPath), nil } // OpenRelative opens a relative path from the given root, failing if // any of the intermediate path components are reparse points. func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) { f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags) if err != nil { err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err} } return f, err } // LinkRelative creates a hard link from oldname to newname (relative to oldroot // and newroot), failing if any of the intermediate path components are reparse // points. func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error { // Open the old file. oldf, err := openRelativeInternal( oldname, oldroot, syscall.FILE_WRITE_ATTRIBUTES, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, winapi.FILE_OPEN, 0, ) if err != nil { return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err} } defer oldf.Close() // Open the parent of the new file. var parent *os.File parentPath := filepath.Dir(newname) if parentPath != "." { parent, err = openRelativeInternal( parentPath, newroot, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, winapi.FILE_OPEN, winapi.FILE_DIRECTORY_FILE) if err != nil { return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err} } defer parent.Close() fi, err := winio.GetFileBasicInfo(parent) if err != nil { return err } if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 { return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: winapi.RtlNtStatusToDosError(winapi.STATUS_REPARSE_POINT_ENCOUNTERED)} } } else { parent = newroot } // Issue an NT call to create the link. This will be safe because NT will // not open any more directories to create the link, so it cannot walk any // more reparse points. newbase := filepath.Base(newname) newbase16, err := ntRelativePath(newbase) if err != nil { return err } size := int(unsafe.Offsetof(winapi.FileLinkInformation{}.FileName)) + len(newbase16)*2 linkinfoBuffer := winapi.LocalAlloc(0, size) defer winapi.LocalFree(linkinfoBuffer) linkinfo := (*winapi.FileLinkInformation)(unsafe.Pointer(linkinfoBuffer)) linkinfo.RootDirectory = parent.Fd() linkinfo.FileNameLength = uint32(len(newbase16) * 2) copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16) var iosb winapi.IOStatusBlock status := winapi.NtSetInformationFile( oldf.Fd(), &iosb, linkinfoBuffer, uint32(size), winapi.FileLinkInformationClass, ) if status != 0 { return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: winapi.RtlNtStatusToDosError(status)} } return nil } // deleteOnClose marks a file to be deleted when the handle is closed. func deleteOnClose(f *os.File) error { disposition := winapi.FileDispositionInformationEx{Flags: winapi.FILE_DISPOSITION_DELETE} var iosb winapi.IOStatusBlock status := winapi.NtSetInformationFile( f.Fd(), &iosb, uintptr(unsafe.Pointer(&disposition)), uint32(unsafe.Sizeof(disposition)), winapi.FileDispositionInformationExClass, ) if status != 0 { return winapi.RtlNtStatusToDosError(status) } return nil } // clearReadOnly clears the readonly attribute on a file. func clearReadOnly(f *os.File) error { bi, err := winio.GetFileBasicInfo(f) if err != nil { return err } if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 { return nil } sbi := winio.FileBasicInfo{ FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY, } if sbi.FileAttributes == 0 { sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL } return winio.SetFileBasicInfo(f, &sbi) } // RemoveRelative removes a file or directory relative to a root, failing if any // intermediate path components are reparse points. func RemoveRelative(path string, root *os.File) error { f, err := openRelativeInternal( path, root, winapi.FILE_READ_ATTRIBUTES|winapi.FILE_WRITE_ATTRIBUTES|winapi.DELETE, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, winapi.FILE_OPEN, winapi.FILE_OPEN_REPARSE_POINT) if err == nil { defer f.Close() err = deleteOnClose(f) if err == syscall.ERROR_ACCESS_DENIED { // Maybe the file is marked readonly. Clear the bit and retry. clearReadOnly(f) err = deleteOnClose(f) } } if err != nil { return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err} } return nil } // RemoveAllRelative removes a directory tree relative to a root, failing if any // intermediate path components are reparse points. func RemoveAllRelative(path string, root *os.File) error { fi, err := LstatRelative(path, root) if err != nil { if os.IsNotExist(err) { return nil } return err } fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 { // If this is a reparse point, it can't have children. Simple remove will do. err := RemoveRelative(path, root) if err == nil || os.IsNotExist(err) { return nil } return err } // It is necessary to use os.Open as Readdirnames does not work with // OpenRelative. This is safe because the above lstatrelative fails // if the target is outside the root, and we know this is not a // symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check. fd, err := os.Open(filepath.Join(root.Name(), path)) if err != nil { if os.IsNotExist(err) { // Race. It was deleted between the Lstat and Open. // Return nil per RemoveAll's docs. return nil } return err } // Remove contents & return first error. for { names, err1 := fd.Readdirnames(100) for _, name := range names { err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root) if err == nil { err = err1 } } if err1 == io.EOF { break } // If Readdirnames returned an error, use it. if err == nil { err = err1 } if len(names) == 0 { break } } fd.Close() // Remove directory. err1 := RemoveRelative(path, root) if err1 == nil || os.IsNotExist(err1) { return nil } if err == nil { err = err1 } return err } // MkdirRelative creates a directory relative to a root, failing if any // intermediate path components are reparse points. func MkdirRelative(path string, root *os.File) error { f, err := openRelativeInternal( path, root, 0, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, winapi.FILE_CREATE, winapi.FILE_DIRECTORY_FILE) if err == nil { f.Close() } else { err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err} } return err } // LstatRelative performs a stat operation on a file relative to a root, failing // if any intermediate path components are reparse points. func LstatRelative(path string, root *os.File) (os.FileInfo, error) { f, err := openRelativeInternal( path, root, winapi.FILE_READ_ATTRIBUTES, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, winapi.FILE_OPEN, winapi.FILE_OPEN_REPARSE_POINT) if err != nil { return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err} } defer f.Close() return f.Stat() } // EnsureNotReparsePointRelative validates that a given file (relative to a // root) and all intermediate path components are not a reparse points. func EnsureNotReparsePointRelative(path string, root *os.File) error { // Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT. f, err := OpenRelative( path, root, 0, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, winapi.FILE_OPEN, 0) if err != nil { return err } f.Close() return nil }
9,887
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/oc/span.go
package oc import ( "go.opencensus.io/trace" ) // SetSpanStatus sets `span.SetStatus` to the proper status depending on `err`. If // `err` is `nil` assumes `trace.StatusCodeOk`. func SetSpanStatus(span *trace.Span, err error) { status := trace.Status{} if err != nil { // TODO: JTERRY75 - Handle errors in a non-generic way status.Code = trace.StatusCodeUnknown status.Message = err.Error() } span.SetStatus(status) }
9,888
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/oc/exporter.go
package oc import ( "github.com/sirupsen/logrus" "go.opencensus.io/trace" ) var _ = (trace.Exporter)(&LogrusExporter{}) // LogrusExporter is an OpenCensus `trace.Exporter` that exports // `trace.SpanData` to logrus output. type LogrusExporter struct { } // ExportSpan exports `s` based on the the following rules: // // 1. All output will contain `s.Attributes`, `s.TraceID`, `s.SpanID`, // `s.ParentSpanID` for correlation // // 2. Any calls to .Annotate will not be supported. // // 3. The span itself will be written at `logrus.InfoLevel` unless // `s.Status.Code != 0` in which case it will be written at `logrus.ErrorLevel` // providing `s.Status.Message` as the error value. func (le *LogrusExporter) ExportSpan(s *trace.SpanData) { // Combine all span annotations with traceID, spanID, parentSpanID baseEntry := logrus.WithFields(logrus.Fields(s.Attributes)) baseEntry.Data["traceID"] = s.TraceID.String() baseEntry.Data["spanID"] = s.SpanID.String() baseEntry.Data["parentSpanID"] = s.ParentSpanID.String() baseEntry.Data["startTime"] = s.StartTime baseEntry.Data["endTime"] = s.EndTime baseEntry.Data["duration"] = s.EndTime.Sub(s.StartTime).String() baseEntry.Data["name"] = s.Name baseEntry.Time = s.StartTime level := logrus.InfoLevel if s.Status.Code != 0 { level = logrus.ErrorLevel baseEntry.Data[logrus.ErrorKey] = s.Status.Message } baseEntry.Log(level, "Span") }
9,889
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/cow/cow.go
package cow import ( "context" "io" "github.com/Microsoft/hcsshim/internal/schema1" hcsschema "github.com/Microsoft/hcsshim/internal/schema2" ) // Process is the interface for an OS process running in a container or utility VM. type Process interface { // Close releases resources associated with the process and closes the // writer and readers returned by Stdio. Depending on the implementation, // this may also terminate the process. Close() error // CloseStdin causes the process's stdin handle to receive EOF/EPIPE/whatever // is appropriate to indicate that no more data is available. CloseStdin(ctx context.Context) error // Pid returns the process ID. Pid() int // Stdio returns the stdio streams for a process. These may be nil if a stream // was not requested during CreateProcess. Stdio() (_ io.Writer, _ io.Reader, _ io.Reader) // ResizeConsole resizes the virtual terminal associated with the process. ResizeConsole(ctx context.Context, width, height uint16) error // Kill sends a SIGKILL or equivalent signal to the process and returns whether // the signal was delivered. It does not wait for the process to terminate. Kill(ctx context.Context) (bool, error) // Signal sends a signal to the process and returns whether the signal was // delivered. The input is OS specific (either // guestrequest.SignalProcessOptionsWCOW or // guestrequest.SignalProcessOptionsLCOW). It does not wait for the process // to terminate. Signal(ctx context.Context, options interface{}) (bool, error) // Wait waits for the process to complete, or for a connection to the process to be // terminated by some error condition (including calling Close). Wait() error // ExitCode returns the exit code of the process. Returns an error if the process is // not running. ExitCode() (int, error) } // ProcessHost is the interface for creating processes. type ProcessHost interface { // CreateProcess creates a process. The configuration is host specific // (either hcsschema.ProcessParameters or lcow.ProcessParameters). CreateProcess(ctx context.Context, config interface{}) (Process, error) // OS returns the host's operating system, "linux" or "windows". OS() string // IsOCI specifies whether this is an OCI-compliant process host. If true, // then the configuration passed to CreateProcess should have an OCI process // spec (or nil if this is the initial process in an OCI container). // Otherwise, it should have the HCS-specific process parameters. IsOCI() bool } // Container is the interface for container objects, either running on the host or // in a utility VM. type Container interface { ProcessHost // Close releases the resources associated with the container. Depending on // the implementation, this may also terminate the container. Close() error // ID returns the container ID. ID() string // Properties returns the requested container properties targeting a V1 schema container. Properties(ctx context.Context, types ...schema1.PropertyType) (*schema1.ContainerProperties, error) // PropertiesV2 returns the requested container properties targeting a V2 schema container. PropertiesV2(ctx context.Context, types ...hcsschema.PropertyType) (*hcsschema.Properties, error) // Start starts a container. Start(ctx context.Context) error // Shutdown sends a shutdown request to the container (but does not wait for // the shutdown to complete). Shutdown(ctx context.Context) error // Terminate sends a terminate request to the container (but does not wait // for the terminate to complete). Terminate(ctx context.Context) error // Wait waits for the container to terminate, or for the connection to the // container to be terminated by some error condition (including calling // Close). Wait() error }
9,890
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go
package mergemaps import "encoding/json" // Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values // in ToMap are overwritten. Values in fromMap are added to ToMap. // From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang func Merge(fromMap, ToMap interface{}) interface{} { switch fromMap := fromMap.(type) { case map[string]interface{}: ToMap, ok := ToMap.(map[string]interface{}) if !ok { return fromMap } for keyToMap, valueToMap := range ToMap { if valueFromMap, ok := fromMap[keyToMap]; ok { fromMap[keyToMap] = Merge(valueFromMap, valueToMap) } else { fromMap[keyToMap] = valueToMap } } case nil: // merge(nil, map[string]interface{...}) -> map[string]interface{...} ToMap, ok := ToMap.(map[string]interface{}) if ok { return ToMap } } return fromMap } // MergeJSON merges the contents of a JSON string into an object representation, // returning a new object suitable for translating to JSON. func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) { if len(additionalJSON) == 0 { return object, nil } objectJSON, err := json.Marshal(object) if err != nil { return nil, err } var objectMap, newMap map[string]interface{} err = json.Unmarshal(objectJSON, &objectMap) if err != nil { return nil, err } err = json.Unmarshal(additionalJSON, &newMap) if err != nil { return nil, err } return Merge(newMap, objectMap), nil }
9,891
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go
package hcserror import ( "fmt" "syscall" ) const ERROR_GEN_FAILURE = syscall.Errno(31) type HcsError struct { title string rest string Err error } func (e *HcsError) Error() string { s := e.title if len(s) > 0 && s[len(s)-1] != ' ' { s += " " } s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err)) if e.rest != "" { if e.rest[0] != ' ' { s += " " } s += e.rest } return s } func New(err error, title, rest string) error { // Pass through DLL errors directly since they do not originate from HCS. if _, ok := err.(*syscall.DLLError); ok { return err } return &HcsError{title, rest, err} } func Win32FromError(err error) uint32 { if herr, ok := err.(*HcsError); ok { return Win32FromError(herr.Err) } if code, ok := err.(syscall.Errno); ok { return uint32(code) } return uint32(ERROR_GEN_FAILURE) }
9,892
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/zsyscall_windows.go
// Code generated mksyscall_windows.exe DO NOT EDIT package vmcompute import ( "syscall" "unsafe" "golang.org/x/sys/windows" ) var _ unsafe.Pointer // Do the interface allocations only once for common // Errno values. const ( errnoERROR_IO_PENDING = 997 ) var ( errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING) ) // errnoErr returns common boxed Errno values, to prevent // allocations at runtime. func errnoErr(e syscall.Errno) error { switch e { case 0: return nil case errnoERROR_IO_PENDING: return errERROR_IO_PENDING } // TODO: add more here, after collecting data on the common // error values see on Windows. (perhaps when running // all.bat?) return e } var ( modvmcompute = windows.NewLazySystemDLL("vmcompute.dll") procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems") procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem") procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem") procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem") procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem") procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem") procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem") procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem") procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem") procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties") procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem") procHcsModifyServiceSettings = modvmcompute.NewProc("HcsModifyServiceSettings") procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback") procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback") procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess") procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess") procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess") procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess") procHcsSignalProcess = modvmcompute.NewProc("HcsSignalProcess") procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo") procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties") procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess") procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties") procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback") procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback") ) func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(query) if hr != nil { return } return _hcsEnumerateComputeSystems(_p0, computeSystems, result) } func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) { if hr = procHcsEnumerateComputeSystems.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } var _p1 *uint16 _p1, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { return } return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result) } func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsCreateComputeSystem.Find(); hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(id) if hr != nil { return } return _hcsOpenComputeSystem(_p0, computeSystem, result) } func _hcsOpenComputeSystem(id *uint16, computeSystem *HcsSystem, result **uint16) (hr error) { if hr = procHcsOpenComputeSystem.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) { if hr = procHcsCloseComputeSystem.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsStartComputeSystem(computeSystem, _p0, result) } func _hcsStartComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsStartComputeSystem.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsShutdownComputeSystem(computeSystem, _p0, result) } func _hcsShutdownComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsShutdownComputeSystem.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsTerminateComputeSystem(computeSystem, _p0, result) } func _hcsTerminateComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsTerminateComputeSystem.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsPauseComputeSystem(computeSystem, _p0, result) } func _hcsPauseComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsPauseComputeSystem.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsResumeComputeSystem(computeSystem, _p0, result) } func _hcsResumeComputeSystem(computeSystem HcsSystem, options *uint16, result **uint16) (hr error) { if hr = procHcsResumeComputeSystem.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { return } return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result) } func _hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetComputeSystemProperties.Find(); hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(configuration) if hr != nil { return } return _hcsModifyComputeSystem(computeSystem, _p0, result) } func _hcsModifyComputeSystem(computeSystem HcsSystem, configuration *uint16, result **uint16) (hr error) { if hr = procHcsModifyComputeSystem.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsModifyServiceSettings(settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } return _hcsModifyServiceSettings(_p0, result) } func _hcsModifyServiceSettings(settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyServiceSettings.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsModifyServiceSettings.Addr(), 2, uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(processParameters) if hr != nil { return } return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result) } func _hcsCreateProcess(computeSystem HcsSystem, processParameters *uint16, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsCreateProcess.Find(); hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) { if hr = procHcsOpenProcess.Find(); hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsCloseProcess(process HcsProcess) (hr error) { if hr = procHcsCloseProcess.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) { if hr = procHcsTerminateProcess.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(options) if hr != nil { return } return _hcsSignalProcess(process, _p0, result) } func _hcsSignalProcess(process HcsProcess, options *uint16, result **uint16) (hr error) { if hr = procHcsSignalProcess.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsSignalProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) { if hr = procHcsGetProcessInfo.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) { if hr = procHcsGetProcessProperties.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(settings) if hr != nil { return } return _hcsModifyProcess(process, _p0, result) } func _hcsModifyProcess(process HcsProcess, settings *uint16, result **uint16) (hr error) { if hr = procHcsModifyProcess.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) { var _p0 *uint16 _p0, hr = syscall.UTF16PtrFromString(propertyQuery) if hr != nil { return } return _hcsGetServiceProperties(_p0, properties, result) } func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) { if hr = procHcsGetServiceProperties.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result))) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) { if hr = procHcsRegisterProcessCallback.Find(); hr != nil { return } r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return } func hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) { if hr = procHcsUnregisterProcessCallback.Find(); hr != nil { return } r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0) if int32(r0) < 0 { if r0&0x1fff0000 == 0x00070000 { r0 &= 0xffff } hr = syscall.Errno(r0) } return }
9,893
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/vmcompute/vmcompute.go
package vmcompute import ( gcontext "context" "syscall" "time" "github.com/Microsoft/hcsshim/internal/interop" "github.com/Microsoft/hcsshim/internal/log" "github.com/Microsoft/hcsshim/internal/logfields" "github.com/Microsoft/hcsshim/internal/oc" "github.com/Microsoft/hcsshim/internal/timeout" "go.opencensus.io/trace" ) //go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go vmcompute.go //sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems? //sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem? //sys hcsOpenComputeSystem(id string, computeSystem *HcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem? //sys hcsCloseComputeSystem(computeSystem HcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem? //sys hcsStartComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem? //sys hcsShutdownComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem? //sys hcsTerminateComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem? //sys hcsPauseComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem? //sys hcsResumeComputeSystem(computeSystem HcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem? //sys hcsGetComputeSystemProperties(computeSystem HcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties? //sys hcsModifyComputeSystem(computeSystem HcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem? //sys hcsModifyServiceSettings(settings string, result **uint16) (hr error) = vmcompute.HcsModifyServiceSettings? //sys hcsRegisterComputeSystemCallback(computeSystem HcsSystem, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback? //sys hcsUnregisterComputeSystemCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback? //sys hcsCreateProcess(computeSystem HcsSystem, processParameters string, processInformation *HcsProcessInformation, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess? //sys hcsOpenProcess(computeSystem HcsSystem, pid uint32, process *HcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess? //sys hcsCloseProcess(process HcsProcess) (hr error) = vmcompute.HcsCloseProcess? //sys hcsTerminateProcess(process HcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess? //sys hcsSignalProcess(process HcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsSignalProcess? //sys hcsGetProcessInfo(process HcsProcess, processInformation *HcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo? //sys hcsGetProcessProperties(process HcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties? //sys hcsModifyProcess(process HcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess? //sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties? //sys hcsRegisterProcessCallback(process HcsProcess, callback uintptr, context uintptr, callbackHandle *HcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback? //sys hcsUnregisterProcessCallback(callbackHandle HcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback? // errVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously const errVmcomputeOperationPending = syscall.Errno(0xC0370103) // HcsSystem is the handle associated with a created compute system. type HcsSystem syscall.Handle // HcsProcess is the handle associated with a created process in a compute // system. type HcsProcess syscall.Handle // HcsCallback is the handle associated with the function to call when events // occur. type HcsCallback syscall.Handle // HcsProcessInformation is the structure used when creating or getting process // info. type HcsProcessInformation struct { // ProcessId is the pid of the created process. ProcessId uint32 reserved uint32 // StdInput is the handle associated with the stdin of the process. StdInput syscall.Handle // StdOutput is the handle associated with the stdout of the process. StdOutput syscall.Handle // StdError is the handle associated with the stderr of the process. StdError syscall.Handle } func execute(ctx gcontext.Context, timeout time.Duration, f func() error) error { if timeout > 0 { var cancel gcontext.CancelFunc ctx, cancel = gcontext.WithTimeout(ctx, timeout) defer cancel() } done := make(chan error, 1) go func() { done <- f() }() select { case <-ctx.Done(): if ctx.Err() == gcontext.DeadlineExceeded { log.G(ctx).WithField(logfields.Timeout, timeout). Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.") } return ctx.Err() case err := <-done: return err } } func HcsEnumerateComputeSystems(ctx gcontext.Context, query string) (computeSystems, result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsEnumerateComputeSystems") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() span.AddAttributes(trace.StringAttribute("query", query)) return computeSystems, result, execute(ctx, timeout.SyscallWatcher, func() error { var ( computeSystemsp *uint16 resultp *uint16 ) err := hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp) if computeSystemsp != nil { computeSystems = interop.ConvertAndFreeCoTaskMemString(computeSystemsp) } if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsCreateComputeSystem(ctx gcontext.Context, id string, configuration string, identity syscall.Handle) (computeSystem HcsSystem, result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsCreateComputeSystem") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } if hr != errVmcomputeOperationPending { oc.SetSpanStatus(span, hr) } }() span.AddAttributes( trace.StringAttribute("id", id), trace.StringAttribute("configuration", configuration)) return computeSystem, result, execute(ctx, timeout.SystemCreate, func() error { var resultp *uint16 err := hcsCreateComputeSystem(id, configuration, identity, &computeSystem, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsOpenComputeSystem(ctx gcontext.Context, id string) (computeSystem HcsSystem, result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsOpenComputeSystem") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() return computeSystem, result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsOpenComputeSystem(id, &computeSystem, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsCloseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem) (hr error) { ctx, span := trace.StartSpan(ctx, "HcsCloseComputeSystem") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() return execute(ctx, timeout.SyscallWatcher, func() error { return hcsCloseComputeSystem(computeSystem) }) } func HcsStartComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsStartComputeSystem") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } if hr != errVmcomputeOperationPending { oc.SetSpanStatus(span, hr) } }() span.AddAttributes(trace.StringAttribute("options", options)) return result, execute(ctx, timeout.SystemStart, func() error { var resultp *uint16 err := hcsStartComputeSystem(computeSystem, options, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsShutdownComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsShutdownComputeSystem") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } if hr != errVmcomputeOperationPending { oc.SetSpanStatus(span, hr) } }() span.AddAttributes(trace.StringAttribute("options", options)) return result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsShutdownComputeSystem(computeSystem, options, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsTerminateComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsTerminateComputeSystem") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } if hr != errVmcomputeOperationPending { oc.SetSpanStatus(span, hr) } }() span.AddAttributes(trace.StringAttribute("options", options)) return result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsTerminateComputeSystem(computeSystem, options, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsPauseComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsPauseComputeSystem") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } if hr != errVmcomputeOperationPending { oc.SetSpanStatus(span, hr) } }() span.AddAttributes(trace.StringAttribute("options", options)) return result, execute(ctx, timeout.SystemPause, func() error { var resultp *uint16 err := hcsPauseComputeSystem(computeSystem, options, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsResumeComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, options string) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsResumeComputeSystem") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } if hr != errVmcomputeOperationPending { oc.SetSpanStatus(span, hr) } }() span.AddAttributes(trace.StringAttribute("options", options)) return result, execute(ctx, timeout.SystemResume, func() error { var resultp *uint16 err := hcsResumeComputeSystem(computeSystem, options, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsGetComputeSystemProperties(ctx gcontext.Context, computeSystem HcsSystem, propertyQuery string) (properties, result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsGetComputeSystemProperties") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { var ( propertiesp *uint16 resultp *uint16 ) err := hcsGetComputeSystemProperties(computeSystem, propertyQuery, &propertiesp, &resultp) if propertiesp != nil { properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) } if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsModifyComputeSystem(ctx gcontext.Context, computeSystem HcsSystem, configuration string) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsModifyComputeSystem") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() span.AddAttributes(trace.StringAttribute("configuration", configuration)) return result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsModifyComputeSystem(computeSystem, configuration, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsModifyServiceSettings(ctx gcontext.Context, settings string) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsModifyServiceSettings") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() span.AddAttributes(trace.StringAttribute("settings", settings)) return result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsModifyServiceSettings(settings, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsRegisterComputeSystemCallback(ctx gcontext.Context, computeSystem HcsSystem, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { ctx, span := trace.StartSpan(ctx, "HcsRegisterComputeSystemCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { return hcsRegisterComputeSystemCallback(computeSystem, callback, context, &callbackHandle) }) } func HcsUnregisterComputeSystemCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { ctx, span := trace.StartSpan(ctx, "HcsUnregisterComputeSystemCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() return execute(ctx, timeout.SyscallWatcher, func() error { return hcsUnregisterComputeSystemCallback(callbackHandle) }) } func HcsCreateProcess(ctx gcontext.Context, computeSystem HcsSystem, processParameters string) (processInformation HcsProcessInformation, process HcsProcess, result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsCreateProcess") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() span.AddAttributes(trace.StringAttribute("processParameters", processParameters)) return processInformation, process, result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsCreateProcess(computeSystem, processParameters, &processInformation, &process, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsOpenProcess(ctx gcontext.Context, computeSystem HcsSystem, pid uint32) (process HcsProcess, result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsOpenProcess") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() span.AddAttributes(trace.Int64Attribute("pid", int64(pid))) return process, result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsOpenProcess(computeSystem, pid, &process, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsCloseProcess(ctx gcontext.Context, process HcsProcess) (hr error) { ctx, span := trace.StartSpan(ctx, "HcsCloseProcess") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() return execute(ctx, timeout.SyscallWatcher, func() error { return hcsCloseProcess(process) }) } func HcsTerminateProcess(ctx gcontext.Context, process HcsProcess) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsTerminateProcess") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() return result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsTerminateProcess(process, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsSignalProcess(ctx gcontext.Context, process HcsProcess, options string) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsSignalProcess") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() span.AddAttributes(trace.StringAttribute("options", options)) return result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsSignalProcess(process, options, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsGetProcessInfo(ctx gcontext.Context, process HcsProcess) (processInformation HcsProcessInformation, result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsGetProcessInfo") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() return processInformation, result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsGetProcessInfo(process, &processInformation, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsGetProcessProperties(ctx gcontext.Context, process HcsProcess) (processProperties, result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsGetProcessProperties") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() return processProperties, result, execute(ctx, timeout.SyscallWatcher, func() error { var ( processPropertiesp *uint16 resultp *uint16 ) err := hcsGetProcessProperties(process, &processPropertiesp, &resultp) if processPropertiesp != nil { processProperties = interop.ConvertAndFreeCoTaskMemString(processPropertiesp) } if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsModifyProcess(ctx gcontext.Context, process HcsProcess, settings string) (result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsModifyProcess") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() span.AddAttributes(trace.StringAttribute("settings", settings)) return result, execute(ctx, timeout.SyscallWatcher, func() error { var resultp *uint16 err := hcsModifyProcess(process, settings, &resultp) if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsGetServiceProperties(ctx gcontext.Context, propertyQuery string) (properties, result string, hr error) { ctx, span := trace.StartSpan(ctx, "HcsGetServiceProperties") defer span.End() defer func() { if result != "" { span.AddAttributes(trace.StringAttribute("result", result)) } oc.SetSpanStatus(span, hr) }() span.AddAttributes(trace.StringAttribute("propertyQuery", propertyQuery)) return properties, result, execute(ctx, timeout.SyscallWatcher, func() error { var ( propertiesp *uint16 resultp *uint16 ) err := hcsGetServiceProperties(propertyQuery, &propertiesp, &resultp) if propertiesp != nil { properties = interop.ConvertAndFreeCoTaskMemString(propertiesp) } if resultp != nil { result = interop.ConvertAndFreeCoTaskMemString(resultp) } return err }) } func HcsRegisterProcessCallback(ctx gcontext.Context, process HcsProcess, callback uintptr, context uintptr) (callbackHandle HcsCallback, hr error) { ctx, span := trace.StartSpan(ctx, "HcsRegisterProcessCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() return callbackHandle, execute(ctx, timeout.SyscallWatcher, func() error { return hcsRegisterProcessCallback(process, callback, context, &callbackHandle) }) } func HcsUnregisterProcessCallback(ctx gcontext.Context, callbackHandle HcsCallback) (hr error) { ctx, span := trace.StartSpan(ctx, "HcsUnregisterProcessCallback") defer span.End() defer func() { oc.SetSpanStatus(span, hr) }() return execute(ctx, timeout.SyscallWatcher, func() error { return hcsUnregisterProcessCallback(callbackHandle) }) }
9,894
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go
/* * HCS API * * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) * * API version: 2.1 * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) */ package hcsschema type GuestCrashReporting struct { WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"` }
9,895
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go
/* * HCS API * * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) * * API version: 2.1 * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) */ package hcsschema type GuestState struct { // The path to an existing file uses for persistent guest state storage. An empty string indicates the system should initialize new transient, in-memory guest state. GuestStateFilePath string `json:"GuestStateFilePath,omitempty"` // The path to an existing file for persistent runtime state storage. An empty string indicates the system should initialize new transient, in-memory runtime state. RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"` // If true, the guest state and runtime state files will be used as templates to populate transient, in-memory state instead of using the files as persistent backing store. ForceTransientState bool `json:"ForceTransientState,omitempty"` }
9,896
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go
/* * HCS API * * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) * * API version: 2.1 * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) */ package hcsschema // Silo job information type SiloProperties struct { Enabled bool `json:"Enabled,omitempty"` JobName string `json:"JobName,omitempty"` }
9,897
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go
/* * HCS API * * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) * * API version: 2.1 * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) */ package hcsschema type HvSocket struct { Config *HvSocketSystemConfig `json:"Config,omitempty"` EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"` }
9,898
0
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal
kubeflow_public_repos/fate-operator/vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go
/* * HCS API * * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) * * API version: 2.1 * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git) */ package hcsschema // Passed to HcsRpc_ModifyProcess type ProcessModifyRequest struct { Operation string `json:"Operation,omitempty"` ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"` CloseHandle *CloseHandle `json:"CloseHandle,omitempty"` }
9,899