Spaces:
Running
on
Zero
Running
on
Zero
Upload 51 files
Browse filesThis view is limited to 50 files because it contains too many changes.
See raw diff
- .gitattributes +3 -0
- CITATION.cff +66 -0
- LICENSE +201 -0
- README.md +207 -16
- app.py +78 -0
- docs/adding_tokens.ipynb +129 -0
- docs/assets/ether0_logo.svg +13 -0
- docs/assets/training_info.png +3 -0
- docs/assets/valid_molecule.svg +211 -0
- docs/updated_mistral_chat_template.jinja +22 -0
- gradio_test.py +12 -0
- packages/remotes/.DS_Store +0 -0
- packages/remotes/.gitignore +2 -0
- packages/remotes/LICENSE +201 -0
- packages/remotes/README.md +38 -0
- packages/remotes/pyproject.toml +59 -0
- packages/remotes/src/ether0.remotes.egg-info/PKG-INFO +274 -0
- packages/remotes/src/ether0.remotes.egg-info/SOURCES.txt +14 -0
- packages/remotes/src/ether0.remotes.egg-info/dependency_links.txt +1 -0
- packages/remotes/src/ether0.remotes.egg-info/entry_points.txt +2 -0
- packages/remotes/src/ether0.remotes.egg-info/requires.txt +16 -0
- packages/remotes/src/ether0.remotes.egg-info/top_level.txt +1 -0
- packages/remotes/src/ether0/server.py +316 -0
- packages/remotes/tests/conftest.py +29 -0
- packages/remotes/tests/test_clients.py +91 -0
- packages/remotes/tests/test_rewards.py +108 -0
- pyproject.toml +546 -0
- src/.DS_Store +0 -0
- src/ether0.egg-info/PKG-INFO +467 -0
- src/ether0.egg-info/SOURCES.txt +46 -0
- src/ether0.egg-info/dependency_links.txt +1 -0
- src/ether0.egg-info/requires.txt +40 -0
- src/ether0.egg-info/top_level.txt +1 -0
- src/ether0/chat.py +177 -0
- src/ether0/clients.py +163 -0
- src/ether0/data.py +225 -0
- src/ether0/fingerprints.bloom +3 -0
- src/ether0/model_prompts.py +142 -0
- src/ether0/models.py +173 -0
- src/ether0/problem_prompts.py +196 -0
- src/ether0/py.typed +0 -0
- src/ether0/rewards.py +753 -0
- src/ether0/rings.bloom +3 -0
- src/ether0/utils.py +108 -0
- tests/conftest.py +12 -0
- tests/test_chat.py +61 -0
- tests/test_data.py +158 -0
- tests/test_model_prompts.py +424 -0
- tests/test_models.py +81 -0
- tests/test_rewards.py +489 -0
.gitattributes
CHANGED
|
@@ -33,3 +33,6 @@ saved_model/**/* filter=lfs diff=lfs merge=lfs -text
|
|
| 33 |
*.zip filter=lfs diff=lfs merge=lfs -text
|
| 34 |
*.zst filter=lfs diff=lfs merge=lfs -text
|
| 35 |
*tfevents* filter=lfs diff=lfs merge=lfs -text
|
|
|
|
|
|
|
|
|
|
|
|
| 33 |
*.zip filter=lfs diff=lfs merge=lfs -text
|
| 34 |
*.zst filter=lfs diff=lfs merge=lfs -text
|
| 35 |
*tfevents* filter=lfs diff=lfs merge=lfs -text
|
| 36 |
+
docs/assets/training_info.png filter=lfs diff=lfs merge=lfs -text
|
| 37 |
+
src/ether0/fingerprints.bloom filter=lfs diff=lfs merge=lfs -text
|
| 38 |
+
src/ether0/rings.bloom filter=lfs diff=lfs merge=lfs -text
|
CITATION.cff
ADDED
|
@@ -0,0 +1,66 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
---
|
| 2 |
+
cff-version: 1.2.0
|
| 3 |
+
title: "Training a Scientific Reasoning Model for Chemistry"
|
| 4 |
+
message: >-
|
| 5 |
+
If you use this software, please cite it using the
|
| 6 |
+
metadata from this file.
|
| 7 |
+
authors:
|
| 8 |
+
- given-names: Siddharth M.
|
| 9 |
+
family-names: Narayanan
|
| 10 |
+
- given-names: James D.
|
| 11 |
+
family-names: Braza
|
| 12 |
+
- given-names: Ryan-Rhys
|
| 13 |
+
family-names: Griffiths
|
| 14 |
+
- given-names: Albert
|
| 15 |
+
family-names: Bou
|
| 16 |
+
- given-names: Geemi P.
|
| 17 |
+
family-names: Wellawatte
|
| 18 |
+
- given-names: Mayk
|
| 19 |
+
family-names: Caldas Ramos
|
| 20 |
+
- given-names: Ludovico
|
| 21 |
+
family-names: Mitchener
|
| 22 |
+
- given-names: Samuel G.
|
| 23 |
+
family-names: Rodriques
|
| 24 |
+
- given-names: Andrew D.
|
| 25 |
+
family-names: White
|
| 26 |
+
identifiers:
|
| 27 |
+
- type: doi
|
| 28 |
+
value: 10.48550/arXiv.2506.17238
|
| 29 |
+
description: ArXiv DOI
|
| 30 |
+
- type: url
|
| 31 |
+
value: https://arxiv.org/abs/2506.17238
|
| 32 |
+
description: ArXiv abstract
|
| 33 |
+
repository-code: https://github.com/Future-House/ether0
|
| 34 |
+
keywords:
|
| 35 |
+
- Artificial Intelligence
|
| 36 |
+
- Chemistry
|
| 37 |
+
- Computation and Language
|
| 38 |
+
- Machine Learning
|
| 39 |
+
- Reasoning Model
|
| 40 |
+
license: Apache-2.0
|
| 41 |
+
preferred-citation:
|
| 42 |
+
authors:
|
| 43 |
+
- given-names: Siddharth M.
|
| 44 |
+
family-names: Narayanan
|
| 45 |
+
- given-names: James D.
|
| 46 |
+
family-names: Braza
|
| 47 |
+
- given-names: Ryan-Rhys
|
| 48 |
+
family-names: Griffiths
|
| 49 |
+
- given-names: Albert
|
| 50 |
+
family-names: Bou
|
| 51 |
+
- given-names: Geemi P.
|
| 52 |
+
family-names: Wellawatte
|
| 53 |
+
- given-names: Mayk
|
| 54 |
+
family-names: Caldas Ramos
|
| 55 |
+
- given-names: Ludovico
|
| 56 |
+
family-names: Mitchener
|
| 57 |
+
- given-names: Samuel G.
|
| 58 |
+
family-names: Rodriques
|
| 59 |
+
- given-names: Andrew D.
|
| 60 |
+
family-names: White
|
| 61 |
+
date-published: 2025-06-04
|
| 62 |
+
doi: 10.48550/arXiv.2506.17238
|
| 63 |
+
journal: preprint
|
| 64 |
+
title: "Training a Scientific Reasoning Model for Chemistry"
|
| 65 |
+
type: article
|
| 66 |
+
url: https://arxiv.org/abs/2506.17238
|
LICENSE
ADDED
|
@@ -0,0 +1,201 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
Apache License
|
| 2 |
+
Version 2.0, January 2004
|
| 3 |
+
http://www.apache.org/licenses/
|
| 4 |
+
|
| 5 |
+
TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
|
| 6 |
+
|
| 7 |
+
1. Definitions.
|
| 8 |
+
|
| 9 |
+
"License" shall mean the terms and conditions for use, reproduction,
|
| 10 |
+
and distribution as defined by Sections 1 through 9 of this document.
|
| 11 |
+
|
| 12 |
+
"Licensor" shall mean the copyright owner or entity authorized by
|
| 13 |
+
the copyright owner that is granting the License.
|
| 14 |
+
|
| 15 |
+
"Legal Entity" shall mean the union of the acting entity and all
|
| 16 |
+
other entities that control, are controlled by, or are under common
|
| 17 |
+
control with that entity. For the purposes of this definition,
|
| 18 |
+
"control" means (i) the power, direct or indirect, to cause the
|
| 19 |
+
direction or management of such entity, whether by contract or
|
| 20 |
+
otherwise, or (ii) ownership of fifty percent (50%) or more of the
|
| 21 |
+
outstanding shares, or (iii) beneficial ownership of such entity.
|
| 22 |
+
|
| 23 |
+
"You" (or "Your") shall mean an individual or Legal Entity
|
| 24 |
+
exercising permissions granted by this License.
|
| 25 |
+
|
| 26 |
+
"Source" form shall mean the preferred form for making modifications,
|
| 27 |
+
including but not limited to software source code, documentation
|
| 28 |
+
source, and configuration files.
|
| 29 |
+
|
| 30 |
+
"Object" form shall mean any form resulting from mechanical
|
| 31 |
+
transformation or translation of a Source form, including but
|
| 32 |
+
not limited to compiled object code, generated documentation,
|
| 33 |
+
and conversions to other media types.
|
| 34 |
+
|
| 35 |
+
"Work" shall mean the work of authorship, whether in Source or
|
| 36 |
+
Object form, made available under the License, as indicated by a
|
| 37 |
+
copyright notice that is included in or attached to the work
|
| 38 |
+
(an example is provided in the Appendix below).
|
| 39 |
+
|
| 40 |
+
"Derivative Works" shall mean any work, whether in Source or Object
|
| 41 |
+
form, that is based on (or derived from) the Work and for which the
|
| 42 |
+
editorial revisions, annotations, elaborations, or other modifications
|
| 43 |
+
represent, as a whole, an original work of authorship. For the purposes
|
| 44 |
+
of this License, Derivative Works shall not include works that remain
|
| 45 |
+
separable from, or merely link (or bind by name) to the interfaces of,
|
| 46 |
+
the Work and Derivative Works thereof.
|
| 47 |
+
|
| 48 |
+
"Contribution" shall mean any work of authorship, including
|
| 49 |
+
the original version of the Work and any modifications or additions
|
| 50 |
+
to that Work or Derivative Works thereof, that is intentionally
|
| 51 |
+
submitted to Licensor for inclusion in the Work by the copyright owner
|
| 52 |
+
or by an individual or Legal Entity authorized to submit on behalf of
|
| 53 |
+
the copyright owner. For the purposes of this definition, "submitted"
|
| 54 |
+
means any form of electronic, verbal, or written communication sent
|
| 55 |
+
to the Licensor or its representatives, including but not limited to
|
| 56 |
+
communication on electronic mailing lists, source code control systems,
|
| 57 |
+
and issue tracking systems that are managed by, or on behalf of, the
|
| 58 |
+
Licensor for the purpose of discussing and improving the Work, but
|
| 59 |
+
excluding communication that is conspicuously marked or otherwise
|
| 60 |
+
designated in writing by the copyright owner as "Not a Contribution."
|
| 61 |
+
|
| 62 |
+
"Contributor" shall mean Licensor and any individual or Legal Entity
|
| 63 |
+
on behalf of whom a Contribution has been received by Licensor and
|
| 64 |
+
subsequently incorporated within the Work.
|
| 65 |
+
|
| 66 |
+
2. Grant of Copyright License. Subject to the terms and conditions of
|
| 67 |
+
this License, each Contributor hereby grants to You a perpetual,
|
| 68 |
+
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
| 69 |
+
copyright license to reproduce, prepare Derivative Works of,
|
| 70 |
+
publicly display, publicly perform, sublicense, and distribute the
|
| 71 |
+
Work and such Derivative Works in Source or Object form.
|
| 72 |
+
|
| 73 |
+
3. Grant of Patent License. Subject to the terms and conditions of
|
| 74 |
+
this License, each Contributor hereby grants to You a perpetual,
|
| 75 |
+
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
| 76 |
+
(except as stated in this section) patent license to make, have made,
|
| 77 |
+
use, offer to sell, sell, import, and otherwise transfer the Work,
|
| 78 |
+
where such license applies only to those patent claims licensable
|
| 79 |
+
by such Contributor that are necessarily infringed by their
|
| 80 |
+
Contribution(s) alone or by combination of their Contribution(s)
|
| 81 |
+
with the Work to which such Contribution(s) was submitted. If You
|
| 82 |
+
institute patent litigation against any entity (including a
|
| 83 |
+
cross-claim or counterclaim in a lawsuit) alleging that the Work
|
| 84 |
+
or a Contribution incorporated within the Work constitutes direct
|
| 85 |
+
or contributory patent infringement, then any patent licenses
|
| 86 |
+
granted to You under this License for that Work shall terminate
|
| 87 |
+
as of the date such litigation is filed.
|
| 88 |
+
|
| 89 |
+
4. Redistribution. You may reproduce and distribute copies of the
|
| 90 |
+
Work or Derivative Works thereof in any medium, with or without
|
| 91 |
+
modifications, and in Source or Object form, provided that You
|
| 92 |
+
meet the following conditions:
|
| 93 |
+
|
| 94 |
+
(a) You must give any other recipients of the Work or
|
| 95 |
+
Derivative Works a copy of this License; and
|
| 96 |
+
|
| 97 |
+
(b) You must cause any modified files to carry prominent notices
|
| 98 |
+
stating that You changed the files; and
|
| 99 |
+
|
| 100 |
+
(c) You must retain, in the Source form of any Derivative Works
|
| 101 |
+
that You distribute, all copyright, patent, trademark, and
|
| 102 |
+
attribution notices from the Source form of the Work,
|
| 103 |
+
excluding those notices that do not pertain to any part of
|
| 104 |
+
the Derivative Works; and
|
| 105 |
+
|
| 106 |
+
(d) If the Work includes a "NOTICE" text file as part of its
|
| 107 |
+
distribution, then any Derivative Works that You distribute must
|
| 108 |
+
include a readable copy of the attribution notices contained
|
| 109 |
+
within such NOTICE file, excluding those notices that do not
|
| 110 |
+
pertain to any part of the Derivative Works, in at least one
|
| 111 |
+
of the following places: within a NOTICE text file distributed
|
| 112 |
+
as part of the Derivative Works; within the Source form or
|
| 113 |
+
documentation, if provided along with the Derivative Works; or,
|
| 114 |
+
within a display generated by the Derivative Works, if and
|
| 115 |
+
wherever such third-party notices normally appear. The contents
|
| 116 |
+
of the NOTICE file are for informational purposes only and
|
| 117 |
+
do not modify the License. You may add Your own attribution
|
| 118 |
+
notices within Derivative Works that You distribute, alongside
|
| 119 |
+
or as an addendum to the NOTICE text from the Work, provided
|
| 120 |
+
that such additional attribution notices cannot be construed
|
| 121 |
+
as modifying the License.
|
| 122 |
+
|
| 123 |
+
You may add Your own copyright statement to Your modifications and
|
| 124 |
+
may provide additional or different license terms and conditions
|
| 125 |
+
for use, reproduction, or distribution of Your modifications, or
|
| 126 |
+
for any such Derivative Works as a whole, provided Your use,
|
| 127 |
+
reproduction, and distribution of the Work otherwise complies with
|
| 128 |
+
the conditions stated in this License.
|
| 129 |
+
|
| 130 |
+
5. Submission of Contributions. Unless You explicitly state otherwise,
|
| 131 |
+
any Contribution intentionally submitted for inclusion in the Work
|
| 132 |
+
by You to the Licensor shall be under the terms and conditions of
|
| 133 |
+
this License, without any additional terms or conditions.
|
| 134 |
+
Notwithstanding the above, nothing herein shall supersede or modify
|
| 135 |
+
the terms of any separate license agreement you may have executed
|
| 136 |
+
with Licensor regarding such Contributions.
|
| 137 |
+
|
| 138 |
+
6. Trademarks. This License does not grant permission to use the trade
|
| 139 |
+
names, trademarks, service marks, or product names of the Licensor,
|
| 140 |
+
except as required for reasonable and customary use in describing the
|
| 141 |
+
origin of the Work and reproducing the content of the NOTICE file.
|
| 142 |
+
|
| 143 |
+
7. Disclaimer of Warranty. Unless required by applicable law or
|
| 144 |
+
agreed to in writing, Licensor provides the Work (and each
|
| 145 |
+
Contributor provides its Contributions) on an "AS IS" BASIS,
|
| 146 |
+
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
|
| 147 |
+
implied, including, without limitation, any warranties or conditions
|
| 148 |
+
of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
|
| 149 |
+
PARTICULAR PURPOSE. You are solely responsible for determining the
|
| 150 |
+
appropriateness of using or redistributing the Work and assume any
|
| 151 |
+
risks associated with Your exercise of permissions under this License.
|
| 152 |
+
|
| 153 |
+
8. Limitation of Liability. In no event and under no legal theory,
|
| 154 |
+
whether in tort (including negligence), contract, or otherwise,
|
| 155 |
+
unless required by applicable law (such as deliberate and grossly
|
| 156 |
+
negligent acts) or agreed to in writing, shall any Contributor be
|
| 157 |
+
liable to You for damages, including any direct, indirect, special,
|
| 158 |
+
incidental, or consequential damages of any character arising as a
|
| 159 |
+
result of this License or out of the use or inability to use the
|
| 160 |
+
Work (including but not limited to damages for loss of goodwill,
|
| 161 |
+
work stoppage, computer failure or malfunction, or any and all
|
| 162 |
+
other commercial damages or losses), even if such Contributor
|
| 163 |
+
has been advised of the possibility of such damages.
|
| 164 |
+
|
| 165 |
+
9. Accepting Warranty or Additional Liability. While redistributing
|
| 166 |
+
the Work or Derivative Works thereof, You may choose to offer,
|
| 167 |
+
and charge a fee for, acceptance of support, warranty, indemnity,
|
| 168 |
+
or other liability obligations and/or rights consistent with this
|
| 169 |
+
License. However, in accepting such obligations, You may act only
|
| 170 |
+
on Your own behalf and on Your sole responsibility, not on behalf
|
| 171 |
+
of any other Contributor, and only if You agree to indemnify,
|
| 172 |
+
defend, and hold each Contributor harmless for any liability
|
| 173 |
+
incurred by, or claims asserted against, such Contributor by reason
|
| 174 |
+
of your accepting any such warranty or additional liability.
|
| 175 |
+
|
| 176 |
+
END OF TERMS AND CONDITIONS
|
| 177 |
+
|
| 178 |
+
APPENDIX: How to apply the Apache License to your work.
|
| 179 |
+
|
| 180 |
+
To apply the Apache License to your work, attach the following
|
| 181 |
+
boilerplate notice, with the fields enclosed by brackets "[]"
|
| 182 |
+
replaced with your own identifying information. (Don't include
|
| 183 |
+
the brackets!) The text should be enclosed in the appropriate
|
| 184 |
+
comment syntax for the file format. We also recommend that a
|
| 185 |
+
file or class name and description of purpose be included on the
|
| 186 |
+
same "printed page" as the copyright notice for easier
|
| 187 |
+
identification within third-party archives.
|
| 188 |
+
|
| 189 |
+
Copyright 2025 FutureHouse
|
| 190 |
+
|
| 191 |
+
Licensed under the Apache License, Version 2.0 (the "License");
|
| 192 |
+
you may not use this file except in compliance with the License.
|
| 193 |
+
You may obtain a copy of the License at
|
| 194 |
+
|
| 195 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 196 |
+
|
| 197 |
+
Unless required by applicable law or agreed to in writing, software
|
| 198 |
+
distributed under the License is distributed on an "AS IS" BASIS,
|
| 199 |
+
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 200 |
+
See the License for the specific language governing permissions and
|
| 201 |
+
limitations under the License.
|
README.md
CHANGED
|
@@ -1,16 +1,207 @@
|
|
| 1 |
-
|
| 2 |
-
|
| 3 |
-
|
| 4 |
-
|
| 5 |
-
|
| 6 |
-
|
| 7 |
-
|
| 8 |
-
|
| 9 |
-
|
| 10 |
-
|
| 11 |
-
|
| 12 |
-
|
| 13 |
-
|
| 14 |
-
|
| 15 |
-
|
| 16 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# ether0 Reward Model
|
| 2 |
+
|
| 3 |
+
[](https://github.com/Future-House/ether0)
|
| 4 |
+
[](https://arxiv.org/abs/2506.17238)
|
| 5 |
+
[](https://www.repostatus.org/#active)
|
| 6 |
+

|
| 7 |
+
|
| 8 |
+
[](https://github.com/Future-House/ether0/actions)
|
| 9 |
+
[](https://github.com/psf/black)
|
| 10 |
+
[](https://www.python.org)
|
| 11 |
+
[](https://huggingface.co/futurehouse/ether0)
|
| 12 |
+
[](https://huggingface.co/datasets/futurehouse/ether0-benchmark)
|
| 13 |
+
|
| 14 |
+

|
| 15 |
+
|
| 16 |
+
_ether0: a scientific reasoning model, dataset, and reward functions for chemistry._
|
| 17 |
+
|
| 18 |
+
This repo contains the reward model for evaluating ether0 and similar models,
|
| 19 |
+
along with utilities for working with the verifiable rewards in
|
| 20 |
+
[our benchmark](https://huggingface.co/datasets/futurehouse/ether0-benchmark).
|
| 21 |
+
|
| 22 |
+
## Overview
|
| 23 |
+
|
| 24 |
+
ether0 is a reasoning language model post-trained through a loop of:
|
| 25 |
+
|
| 26 |
+
1. Supervised fine-tuning (SFT) on long chain-of-thought reasoning traces,
|
| 27 |
+
to elicit reasoning from a base model.
|
| 28 |
+
2. Reinforcement learning with verifiable rewards (RLVR)
|
| 29 |
+
to improve reasoning on focused task groups, at their own pace.
|
| 30 |
+
These multitask learned models are referred to as 'specialists'.
|
| 31 |
+
3. Rejection sampling to filter specialists' reasoning
|
| 32 |
+
for correctness and quality.
|
| 33 |
+
4. SFT on the base model again to make a 'generalist' reasoning model.
|
| 34 |
+
5. RLVR to recover any lost performance and push further in an all-task setting.
|
| 35 |
+
|
| 36 |
+

|
| 37 |
+
|
| 38 |
+
### Repo Structure
|
| 39 |
+
|
| 40 |
+
This repo contains several packages:
|
| 41 |
+
|
| 42 |
+
- `ether0`: reward functions, `rdkit` data utilities,
|
| 43 |
+
dataset generation prompts, dataset data models,
|
| 44 |
+
language model training prompts, and data models.
|
| 45 |
+
- `ether0.remotes`: server code for ether0 reward functions involving
|
| 46 |
+
exotic packages and/or third party models.
|
| 47 |
+
|
| 48 |
+
> [!NOTE]
|
| 49 |
+
> This repo does not contain training code,
|
| 50 |
+
> although you can find open source repositories like [NeMo-RL](https://github.com/NVIDIA/NeMo-RL)
|
| 51 |
+
> or [Hugging Face TRL](https://github.com/huggingface/trl)
|
| 52 |
+
> that can do the SFT and RL phases of training.
|
| 53 |
+
|
| 54 |
+
### Open Weights
|
| 55 |
+
|
| 56 |
+
Please see our open-source weights on Hugging Face:
|
| 57 |
+
<https://huggingface.co/futurehouse/ether0>
|
| 58 |
+
|
| 59 |
+
```python
|
| 60 |
+
from transformers import AutoModelForCausalLM, AutoTokenizer
|
| 61 |
+
|
| 62 |
+
model = AutoModelForCausalLM.from_pretrained("futurehouse/ether0")
|
| 63 |
+
tokenizer = AutoTokenizer.from_pretrained("futurehouse/ether0")
|
| 64 |
+
```
|
| 65 |
+
|
| 66 |
+
### Open Test Set
|
| 67 |
+
|
| 68 |
+
Please see our open-source benchmark (test set) on Hugging Face:
|
| 69 |
+
<https://huggingface.co/datasets/futurehouse/ether0-benchmark>
|
| 70 |
+
|
| 71 |
+
```python
|
| 72 |
+
from datasets import load_dataset
|
| 73 |
+
|
| 74 |
+
test_ds = load_dataset("futurehouse/ether0-benchmark", split="test")
|
| 75 |
+
```
|
| 76 |
+
|
| 77 |
+
## Usage
|
| 78 |
+
|
| 79 |
+
### Installation
|
| 80 |
+
|
| 81 |
+
The easiest way to get started is a `pip install` from GitHub:
|
| 82 |
+
|
| 83 |
+
```bash
|
| 84 |
+
pip install git+https://github.com/Future-House/ether0.git
|
| 85 |
+
```
|
| 86 |
+
|
| 87 |
+
Or if you want the full set up, clone the repo and use `uv`:
|
| 88 |
+
|
| 89 |
+
```bash
|
| 90 |
+
git clone https://github.com/Future-House/ether0.git
|
| 91 |
+
cd ether0
|
| 92 |
+
uv sync
|
| 93 |
+
```
|
| 94 |
+
|
| 95 |
+
### Reward Functions
|
| 96 |
+
|
| 97 |
+
Here is a basic example of how to use the reward functions:
|
| 98 |
+
|
| 99 |
+
```python
|
| 100 |
+
from ether0.rewards import valid_mol_eval
|
| 101 |
+
|
| 102 |
+
# Task: provide a valid completion of this molecule
|
| 103 |
+
partial_smiles = "O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14"
|
| 104 |
+
|
| 105 |
+
# Here's two model-proposed SMILES completions
|
| 106 |
+
invalid_completion_smiles = "CCC"
|
| 107 |
+
valid_completion_smiles = ")C=6C=CC=CC6"
|
| 108 |
+
|
| 109 |
+
# Evaluate the completions
|
| 110 |
+
assert not valid_mol_eval(invalid_completion_smiles, partial_smiles)
|
| 111 |
+
assert valid_mol_eval(valid_completion_smiles, partial_smiles)
|
| 112 |
+
```
|
| 113 |
+
|
| 114 |
+
### Visualization
|
| 115 |
+
|
| 116 |
+
If it helps, you can visualize the molecules:
|
| 117 |
+
|
| 118 |
+
```python
|
| 119 |
+
from ether0.data import draw_molecule
|
| 120 |
+
|
| 121 |
+
# See above reward functions demo for where these came from
|
| 122 |
+
partial_smiles = "O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14"
|
| 123 |
+
invalid_completion_smiles = "CCC"
|
| 124 |
+
valid_completion_smiles = ")C=6C=CC=CC6"
|
| 125 |
+
|
| 126 |
+
valid_mol_text = draw_molecule(partial_smiles + valid_completion_smiles)
|
| 127 |
+
with open("valid_molecule.svg", "w") as f:
|
| 128 |
+
f.write(valid_mol_text)
|
| 129 |
+
```
|
| 130 |
+
|
| 131 |
+
The output of `draw_molecule` can also be easily visualized using `IPython.display`,
|
| 132 |
+
or in your terminal via `chafa valid_molecule.svg`
|
| 133 |
+
([chafa docs](https://hpjansson.org/chafa/)).
|
| 134 |
+
|
| 135 |
+

|
| 136 |
+
|
| 137 |
+
### Benchmark
|
| 138 |
+
|
| 139 |
+
Here is a sample baseline of
|
| 140 |
+
[`ether0-benchmark`](https://huggingface.co/datasets/futurehouse/ether0-benchmark)
|
| 141 |
+
on `gpt-4o` using [`lmi`](https://github.com/Future-House/ldp/tree/main/packages/lmi).
|
| 142 |
+
To install `lmi`, please install `ether0` with the `baselines` extra
|
| 143 |
+
(for example `uv sync --extra baselines`).
|
| 144 |
+
|
| 145 |
+
We also need to run our remote rewards server via `ether0-serve`
|
| 146 |
+
(for more information, see [`ether0.remotes` docs](packages/remotes/README.md)):
|
| 147 |
+
|
| 148 |
+
```bash
|
| 149 |
+
ETHER0_REMOTES_API_TOKEN=abc123 ether0-serve
|
| 150 |
+
```
|
| 151 |
+
|
| 152 |
+
Next, start `ipython` with the relevant environment variables set:
|
| 153 |
+
|
| 154 |
+
```bash
|
| 155 |
+
ETHER0_REMOTES_API_BASE_URL="http://127.0.0.1:8000" ETHER0_REMOTES_API_TOKEN=abc123 \
|
| 156 |
+
ipython
|
| 157 |
+
```
|
| 158 |
+
|
| 159 |
+
And run the following Python code:
|
| 160 |
+
|
| 161 |
+
```python
|
| 162 |
+
import itertools
|
| 163 |
+
import statistics
|
| 164 |
+
from collections import defaultdict
|
| 165 |
+
|
| 166 |
+
from aviary.core import Message
|
| 167 |
+
from datasets import load_dataset
|
| 168 |
+
from lmi import LiteLLMModel
|
| 169 |
+
from tqdm.asyncio import tqdm_asyncio as asyncio
|
| 170 |
+
|
| 171 |
+
from ether0.data import get_problem_category
|
| 172 |
+
from ether0.model_prompts import LOOSE_XML_ANSWER_USER_PROMPT, extract_answer_loose
|
| 173 |
+
from ether0.models import RewardFunctionInfo
|
| 174 |
+
from ether0.rewards import EVAL_FUNCTIONS
|
| 175 |
+
|
| 176 |
+
# Add LLM prompt of your making to the dataset
|
| 177 |
+
test_ds = load_dataset("futurehouse/ether0-benchmark", split="test").map(
|
| 178 |
+
lambda x: {"prompt": "\n\n".join((LOOSE_XML_ANSWER_USER_PROMPT, x["problem"]))}
|
| 179 |
+
)
|
| 180 |
+
|
| 181 |
+
# Prompt to LLM
|
| 182 |
+
model = LiteLLMModel(name="gpt-4o")
|
| 183 |
+
results = await asyncio.gather(
|
| 184 |
+
*(model.acompletion([Message(content=row["prompt"])]) for row in test_ds),
|
| 185 |
+
desc="Running evaluation",
|
| 186 |
+
)
|
| 187 |
+
|
| 188 |
+
# Compute rewards
|
| 189 |
+
per_category_rewards = defaultdict(list)
|
| 190 |
+
for row, result in zip(test_ds, results, strict=True):
|
| 191 |
+
# NOTE: you can also use `ether0.rewards.accuracy_reward`,
|
| 192 |
+
# but we decided to go a bit "lower level" for this demo
|
| 193 |
+
reward_info = RewardFunctionInfo.model_validate(row["solution"])
|
| 194 |
+
yhat = extract_answer_loose(result[0].text)
|
| 195 |
+
reward = EVAL_FUNCTIONS[reward_info.fxn_name](
|
| 196 |
+
yhat=yhat, y=reward_info.answer_info, test=True
|
| 197 |
+
)
|
| 198 |
+
per_category_rewards[get_problem_category(reward_info.problem_type)].append(reward)
|
| 199 |
+
|
| 200 |
+
for category, rewards in sorted(per_category_rewards.items()):
|
| 201 |
+
print(
|
| 202 |
+
f"In category {category!r} of {len(rewards)} questions,"
|
| 203 |
+
f" average reward was {statistics.mean(rewards):.3f}."
|
| 204 |
+
)
|
| 205 |
+
accuracy = statistics.mean(itertools.chain.from_iterable(per_category_rewards.values()))
|
| 206 |
+
print(f"Cumulative average reward across {len(test_ds)} questions was {accuracy:.3f}.")
|
| 207 |
+
```
|
app.py
ADDED
|
@@ -0,0 +1,78 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import os
|
| 2 |
+
import gradio as gr
|
| 3 |
+
import spaces
|
| 4 |
+
import torch
|
| 5 |
+
import logging
|
| 6 |
+
import time
|
| 7 |
+
|
| 8 |
+
from transformers import AutoTokenizer, AutoModelForCausalLM
|
| 9 |
+
from transformers.utils import logging as hf_logging
|
| 10 |
+
|
| 11 |
+
logging.basicConfig(
|
| 12 |
+
filename="/tmp/app.log",
|
| 13 |
+
level=logging.DEBUG,
|
| 14 |
+
format="%(asctime)s %(levelname)s: %(message)s"
|
| 15 |
+
)
|
| 16 |
+
|
| 17 |
+
logging.info("Starting app.py logging")
|
| 18 |
+
hf_logging.set_verbosity_debug()
|
| 19 |
+
hf_logging.set_verbosity_info()
|
| 20 |
+
hf_logging.enable_default_handler()
|
| 21 |
+
hf_logging.enable_explicit_format()
|
| 22 |
+
hf_logging.add_handler(logging.FileHandler("/tmp/transformers.log"))
|
| 23 |
+
|
| 24 |
+
|
| 25 |
+
model_id = "futurehouse/ether0"
|
| 26 |
+
|
| 27 |
+
tokenizer = AutoTokenizer.from_pretrained(model_id)
|
| 28 |
+
model = AutoModelForCausalLM.from_pretrained(
|
| 29 |
+
model_id,
|
| 30 |
+
device_map="auto",
|
| 31 |
+
torch_dtype=torch.float16
|
| 32 |
+
)
|
| 33 |
+
|
| 34 |
+
@spaces.GPU
|
| 35 |
+
def chat_fn(prompt, max_tokens=512):
|
| 36 |
+
t0 = time.time()
|
| 37 |
+
max_tokens = min(int(max_tokens), 32_000)
|
| 38 |
+
|
| 39 |
+
try:
|
| 40 |
+
messages = [{"role": "user", "content": prompt}]
|
| 41 |
+
chat_prompt = tokenizer.apply_chat_template(messages, tokenize=False, add_generation_prompt=True)
|
| 42 |
+
|
| 43 |
+
inputs = tokenizer(chat_prompt, return_tensors="pt").to(model.device)
|
| 44 |
+
t1 = time.time()
|
| 45 |
+
logging.info(f"🧠 Tokenization complete in {t1 - t0:.2f}s")
|
| 46 |
+
|
| 47 |
+
outputs = model.generate(
|
| 48 |
+
**inputs,
|
| 49 |
+
max_new_tokens=max_tokens,
|
| 50 |
+
do_sample=True,
|
| 51 |
+
temperature=0.1,
|
| 52 |
+
pad_token_id=tokenizer.eos_token_id
|
| 53 |
+
)
|
| 54 |
+
t2 = time.time()
|
| 55 |
+
logging.info(f"⚡️ Generation complete in {t2 - t1:.2f}s (max_tokens={max_tokens})")
|
| 56 |
+
|
| 57 |
+
generated_text = tokenizer.decode(
|
| 58 |
+
outputs[0][inputs['input_ids'].shape[1]:],
|
| 59 |
+
skip_special_tokens=True
|
| 60 |
+
)
|
| 61 |
+
t3 = time.time()
|
| 62 |
+
logging.info(f"🔓 Decoding complete in {t3 - t2:.2f}s (output length: {len(generated_text)})")
|
| 63 |
+
|
| 64 |
+
return generated_text
|
| 65 |
+
|
| 66 |
+
except Exception:
|
| 67 |
+
logging.exception("❌ Exception during generation")
|
| 68 |
+
return "⚠️ Generation failed"
|
| 69 |
+
|
| 70 |
+
gr.Interface(
|
| 71 |
+
fn=chat_fn,
|
| 72 |
+
inputs=[
|
| 73 |
+
gr.Textbox(label="prompt"),
|
| 74 |
+
gr.Number(label="max_tokens", value=512, precision=0)
|
| 75 |
+
],
|
| 76 |
+
outputs="text",
|
| 77 |
+
title="Ether0"
|
| 78 |
+
).launch(ssr_mode=False)
|
docs/adding_tokens.ipynb
ADDED
|
@@ -0,0 +1,129 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"cells": [
|
| 3 |
+
{
|
| 4 |
+
"cell_type": "markdown",
|
| 5 |
+
"id": "072120f9",
|
| 6 |
+
"metadata": {},
|
| 7 |
+
"source": [
|
| 8 |
+
"If you would like to modify a base model to add our custom reasoning tokens,\n",
|
| 9 |
+
"here's how to do it.\n",
|
| 10 |
+
"\n",
|
| 11 |
+
"Firstly, please install the `add-tokens` extra via\n",
|
| 12 |
+
"`pip install ether0[add-tokens]` for the `transformers` package.\n",
|
| 13 |
+
"\n",
|
| 14 |
+
"Then, configure the following inputs."
|
| 15 |
+
]
|
| 16 |
+
},
|
| 17 |
+
{
|
| 18 |
+
"cell_type": "code",
|
| 19 |
+
"execution_count": null,
|
| 20 |
+
"id": "a2fb6296",
|
| 21 |
+
"metadata": {},
|
| 22 |
+
"outputs": [],
|
| 23 |
+
"source": [
|
| 24 |
+
"# Model name/revisions for Hugging Face Hub\n",
|
| 25 |
+
"input_model_name = \"mistralai/Mistral-Small-24B-Instruct-2501\"\n",
|
| 26 |
+
"input_model_revision: str | None = None\n",
|
| 27 |
+
"output_model_name = \"FILL ME IN\"\n",
|
| 28 |
+
"output_model_revision: str | None = None\n",
|
| 29 |
+
"output_model_is_private = True\n",
|
| 30 |
+
"tokenizer_only = False # Set True to only update the tokenizer\n",
|
| 31 |
+
"push_to_hf = False # Set True to push to Hugging Face Hub\n",
|
| 32 |
+
"\n",
|
| 33 |
+
"# Chat template file that uses the new tokens\n",
|
| 34 |
+
"chat_template_path = \"updated_mistral_chat_template.jinja\""
|
| 35 |
+
]
|
| 36 |
+
},
|
| 37 |
+
{
|
| 38 |
+
"cell_type": "code",
|
| 39 |
+
"execution_count": null,
|
| 40 |
+
"id": "99927d80",
|
| 41 |
+
"metadata": {},
|
| 42 |
+
"outputs": [
|
| 43 |
+
{
|
| 44 |
+
"data": {
|
| 45 |
+
"application/vnd.jupyter.widget-view+json": {
|
| 46 |
+
"model_id": "8e15d3fb5e864e1286cf94fc588e504d",
|
| 47 |
+
"version_major": 2,
|
| 48 |
+
"version_minor": 0
|
| 49 |
+
},
|
| 50 |
+
"text/plain": [
|
| 51 |
+
"Loading checkpoint shards: 0%| | 0/10 [00:00<?, ?it/s]"
|
| 52 |
+
]
|
| 53 |
+
},
|
| 54 |
+
"metadata": {},
|
| 55 |
+
"output_type": "display_data"
|
| 56 |
+
},
|
| 57 |
+
{
|
| 58 |
+
"name": "stderr",
|
| 59 |
+
"output_type": "stream",
|
| 60 |
+
"text": [
|
| 61 |
+
"The new embeddings will be initialized from a multivariate normal distribution that has old embeddings' mean and covariance. As described in this article: https://nlp.stanford.edu/~johnhew/vocab-expansion.html. To disable this, use `mean_resizing=False`\n",
|
| 62 |
+
"The new lm_head weights will be initialized from a multivariate normal distribution that has old embeddings' mean and covariance. As described in this article: https://nlp.stanford.edu/~johnhew/vocab-expansion.html. To disable this, use `mean_resizing=False`\n"
|
| 63 |
+
]
|
| 64 |
+
}
|
| 65 |
+
],
|
| 66 |
+
"source": [
|
| 67 |
+
"from pathlib import Path\n",
|
| 68 |
+
"\n",
|
| 69 |
+
"from transformers import AutoModelForCausalLM, AutoTokenizer\n",
|
| 70 |
+
"\n",
|
| 71 |
+
"from ether0.model_prompts import ANSWER_END, ANSWER_START, THINK_END, THINK_START\n",
|
| 72 |
+
"\n",
|
| 73 |
+
"REASONING_TOKENS_TO_ADD = [\n",
|
| 74 |
+
" THINK_START,\n",
|
| 75 |
+
" THINK_END,\n",
|
| 76 |
+
" ANSWER_START,\n",
|
| 77 |
+
" ANSWER_END,\n",
|
| 78 |
+
"]\n",
|
| 79 |
+
"\n",
|
| 80 |
+
"tokenizer = AutoTokenizer.from_pretrained(\n",
|
| 81 |
+
" input_model_name, revision=input_model_revision\n",
|
| 82 |
+
")\n",
|
| 83 |
+
"# NOTE: reasoning tokens are normal (not special) tokens so they aren't\n",
|
| 84 |
+
"# removed when passing skip_special_tokens=True to a tokenizer\n",
|
| 85 |
+
"tokenizer.add_tokens(REASONING_TOKENS_TO_ADD)\n",
|
| 86 |
+
"tokenizer.chat_template = Path(chat_template_path).read_text(encoding=\"utf-8\")\n",
|
| 87 |
+
"if push_to_hf:\n",
|
| 88 |
+
" tokenizer.push_to_hub(\n",
|
| 89 |
+
" output_model_name,\n",
|
| 90 |
+
" revision=output_model_revision,\n",
|
| 91 |
+
" private=output_model_is_private,\n",
|
| 92 |
+
" )\n",
|
| 93 |
+
"\n",
|
| 94 |
+
"if not tokenizer_only:\n",
|
| 95 |
+
" model = AutoModelForCausalLM.from_pretrained(\n",
|
| 96 |
+
" input_model_name, revision=input_model_revision\n",
|
| 97 |
+
" )\n",
|
| 98 |
+
" # SEE: https://www.thonking.ai/p/what-shapes-do-matrix-multiplications\n",
|
| 99 |
+
" model.resize_token_embeddings(len(tokenizer), pad_to_multiple_of=64)\n",
|
| 100 |
+
" if push_to_hf:\n",
|
| 101 |
+
" model.push_to_hub(\n",
|
| 102 |
+
" output_model_name,\n",
|
| 103 |
+
" revision=output_model_revision,\n",
|
| 104 |
+
" private=output_model_is_private,\n",
|
| 105 |
+
" )"
|
| 106 |
+
]
|
| 107 |
+
}
|
| 108 |
+
],
|
| 109 |
+
"metadata": {
|
| 110 |
+
"kernelspec": {
|
| 111 |
+
"display_name": ".venv",
|
| 112 |
+
"language": "python",
|
| 113 |
+
"name": "python3"
|
| 114 |
+
},
|
| 115 |
+
"language_info": {
|
| 116 |
+
"codemirror_mode": {
|
| 117 |
+
"name": "ipython",
|
| 118 |
+
"version": 3
|
| 119 |
+
},
|
| 120 |
+
"file_extension": ".py",
|
| 121 |
+
"mimetype": "text/x-python",
|
| 122 |
+
"name": "python",
|
| 123 |
+
"nbconvert_exporter": "python",
|
| 124 |
+
"pygments_lexer": "ipython3"
|
| 125 |
+
}
|
| 126 |
+
},
|
| 127 |
+
"nbformat": 4,
|
| 128 |
+
"nbformat_minor": 5
|
| 129 |
+
}
|
docs/assets/ether0_logo.svg
ADDED
|
|
docs/assets/training_info.png
ADDED
|
Git LFS Details
|
docs/assets/valid_molecule.svg
ADDED
|
|
docs/updated_mistral_chat_template.jinja
ADDED
|
@@ -0,0 +1,22 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{%- set default_system_message = "You are a scientific reasoning AI assistant." %}
|
| 2 |
+
{{- bos_token }}
|
| 3 |
+
{%- if messages[0]['role'] == 'system' %}
|
| 4 |
+
{%- set system_message = messages[0]['content'] %}
|
| 5 |
+
{%- set loop_messages = messages[1:] %}
|
| 6 |
+
{%- else %}
|
| 7 |
+
{%- set system_message = default_system_message %}
|
| 8 |
+
{%- set loop_messages = messages %}
|
| 9 |
+
{%- endif %}
|
| 10 |
+
{{- '[SYSTEM_PROMPT]' + system_message + '[/SYSTEM_PROMPT]' }}
|
| 11 |
+
|
| 12 |
+
{%- for message in loop_messages %}
|
| 13 |
+
{%- if message['role'] == 'user' %}
|
| 14 |
+
{{- '[INST]' + message['content'] + '[/INST]' }}
|
| 15 |
+
{%- elif message['role'] == 'system' %}
|
| 16 |
+
{{- '[SYSTEM_PROMPT]' + message['content'] + '[/SYSTEM_PROMPT]' }}
|
| 17 |
+
{%- elif message['role'] == 'assistant' %}
|
| 18 |
+
{{- message['content'] + eos_token }}
|
| 19 |
+
{%- else %}
|
| 20 |
+
{{- raise_exception("Only user, system and assistant roles are supported!") }}
|
| 21 |
+
{%- endif %}
|
| 22 |
+
{%- endfor %}
|
gradio_test.py
ADDED
|
@@ -0,0 +1,12 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import gradio as gr
|
| 2 |
+
|
| 3 |
+
def greet(name, intensity):
|
| 4 |
+
return "Hello, " + name + "!" * int(intensity)
|
| 5 |
+
|
| 6 |
+
demo = gr.Interface(
|
| 7 |
+
fn=greet,
|
| 8 |
+
inputs=["text", "slider"],
|
| 9 |
+
outputs=["text"],
|
| 10 |
+
)
|
| 11 |
+
|
| 12 |
+
demo.launch()
|
packages/remotes/.DS_Store
ADDED
|
Binary file (6.15 kB). View file
|
|
|
packages/remotes/.gitignore
ADDED
|
@@ -0,0 +1,2 @@
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Ignore any downloaded PyTorch model (e.g. a MolTrans model)
|
| 2 |
+
src/ether0/*.pt
|
packages/remotes/LICENSE
ADDED
|
@@ -0,0 +1,201 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
Apache License
|
| 2 |
+
Version 2.0, January 2004
|
| 3 |
+
http://www.apache.org/licenses/
|
| 4 |
+
|
| 5 |
+
TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
|
| 6 |
+
|
| 7 |
+
1. Definitions.
|
| 8 |
+
|
| 9 |
+
"License" shall mean the terms and conditions for use, reproduction,
|
| 10 |
+
and distribution as defined by Sections 1 through 9 of this document.
|
| 11 |
+
|
| 12 |
+
"Licensor" shall mean the copyright owner or entity authorized by
|
| 13 |
+
the copyright owner that is granting the License.
|
| 14 |
+
|
| 15 |
+
"Legal Entity" shall mean the union of the acting entity and all
|
| 16 |
+
other entities that control, are controlled by, or are under common
|
| 17 |
+
control with that entity. For the purposes of this definition,
|
| 18 |
+
"control" means (i) the power, direct or indirect, to cause the
|
| 19 |
+
direction or management of such entity, whether by contract or
|
| 20 |
+
otherwise, or (ii) ownership of fifty percent (50%) or more of the
|
| 21 |
+
outstanding shares, or (iii) beneficial ownership of such entity.
|
| 22 |
+
|
| 23 |
+
"You" (or "Your") shall mean an individual or Legal Entity
|
| 24 |
+
exercising permissions granted by this License.
|
| 25 |
+
|
| 26 |
+
"Source" form shall mean the preferred form for making modifications,
|
| 27 |
+
including but not limited to software source code, documentation
|
| 28 |
+
source, and configuration files.
|
| 29 |
+
|
| 30 |
+
"Object" form shall mean any form resulting from mechanical
|
| 31 |
+
transformation or translation of a Source form, including but
|
| 32 |
+
not limited to compiled object code, generated documentation,
|
| 33 |
+
and conversions to other media types.
|
| 34 |
+
|
| 35 |
+
"Work" shall mean the work of authorship, whether in Source or
|
| 36 |
+
Object form, made available under the License, as indicated by a
|
| 37 |
+
copyright notice that is included in or attached to the work
|
| 38 |
+
(an example is provided in the Appendix below).
|
| 39 |
+
|
| 40 |
+
"Derivative Works" shall mean any work, whether in Source or Object
|
| 41 |
+
form, that is based on (or derived from) the Work and for which the
|
| 42 |
+
editorial revisions, annotations, elaborations, or other modifications
|
| 43 |
+
represent, as a whole, an original work of authorship. For the purposes
|
| 44 |
+
of this License, Derivative Works shall not include works that remain
|
| 45 |
+
separable from, or merely link (or bind by name) to the interfaces of,
|
| 46 |
+
the Work and Derivative Works thereof.
|
| 47 |
+
|
| 48 |
+
"Contribution" shall mean any work of authorship, including
|
| 49 |
+
the original version of the Work and any modifications or additions
|
| 50 |
+
to that Work or Derivative Works thereof, that is intentionally
|
| 51 |
+
submitted to Licensor for inclusion in the Work by the copyright owner
|
| 52 |
+
or by an individual or Legal Entity authorized to submit on behalf of
|
| 53 |
+
the copyright owner. For the purposes of this definition, "submitted"
|
| 54 |
+
means any form of electronic, verbal, or written communication sent
|
| 55 |
+
to the Licensor or its representatives, including but not limited to
|
| 56 |
+
communication on electronic mailing lists, source code control systems,
|
| 57 |
+
and issue tracking systems that are managed by, or on behalf of, the
|
| 58 |
+
Licensor for the purpose of discussing and improving the Work, but
|
| 59 |
+
excluding communication that is conspicuously marked or otherwise
|
| 60 |
+
designated in writing by the copyright owner as "Not a Contribution."
|
| 61 |
+
|
| 62 |
+
"Contributor" shall mean Licensor and any individual or Legal Entity
|
| 63 |
+
on behalf of whom a Contribution has been received by Licensor and
|
| 64 |
+
subsequently incorporated within the Work.
|
| 65 |
+
|
| 66 |
+
2. Grant of Copyright License. Subject to the terms and conditions of
|
| 67 |
+
this License, each Contributor hereby grants to You a perpetual,
|
| 68 |
+
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
| 69 |
+
copyright license to reproduce, prepare Derivative Works of,
|
| 70 |
+
publicly display, publicly perform, sublicense, and distribute the
|
| 71 |
+
Work and such Derivative Works in Source or Object form.
|
| 72 |
+
|
| 73 |
+
3. Grant of Patent License. Subject to the terms and conditions of
|
| 74 |
+
this License, each Contributor hereby grants to You a perpetual,
|
| 75 |
+
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
| 76 |
+
(except as stated in this section) patent license to make, have made,
|
| 77 |
+
use, offer to sell, sell, import, and otherwise transfer the Work,
|
| 78 |
+
where such license applies only to those patent claims licensable
|
| 79 |
+
by such Contributor that are necessarily infringed by their
|
| 80 |
+
Contribution(s) alone or by combination of their Contribution(s)
|
| 81 |
+
with the Work to which such Contribution(s) was submitted. If You
|
| 82 |
+
institute patent litigation against any entity (including a
|
| 83 |
+
cross-claim or counterclaim in a lawsuit) alleging that the Work
|
| 84 |
+
or a Contribution incorporated within the Work constitutes direct
|
| 85 |
+
or contributory patent infringement, then any patent licenses
|
| 86 |
+
granted to You under this License for that Work shall terminate
|
| 87 |
+
as of the date such litigation is filed.
|
| 88 |
+
|
| 89 |
+
4. Redistribution. You may reproduce and distribute copies of the
|
| 90 |
+
Work or Derivative Works thereof in any medium, with or without
|
| 91 |
+
modifications, and in Source or Object form, provided that You
|
| 92 |
+
meet the following conditions:
|
| 93 |
+
|
| 94 |
+
(a) You must give any other recipients of the Work or
|
| 95 |
+
Derivative Works a copy of this License; and
|
| 96 |
+
|
| 97 |
+
(b) You must cause any modified files to carry prominent notices
|
| 98 |
+
stating that You changed the files; and
|
| 99 |
+
|
| 100 |
+
(c) You must retain, in the Source form of any Derivative Works
|
| 101 |
+
that You distribute, all copyright, patent, trademark, and
|
| 102 |
+
attribution notices from the Source form of the Work,
|
| 103 |
+
excluding those notices that do not pertain to any part of
|
| 104 |
+
the Derivative Works; and
|
| 105 |
+
|
| 106 |
+
(d) If the Work includes a "NOTICE" text file as part of its
|
| 107 |
+
distribution, then any Derivative Works that You distribute must
|
| 108 |
+
include a readable copy of the attribution notices contained
|
| 109 |
+
within such NOTICE file, excluding those notices that do not
|
| 110 |
+
pertain to any part of the Derivative Works, in at least one
|
| 111 |
+
of the following places: within a NOTICE text file distributed
|
| 112 |
+
as part of the Derivative Works; within the Source form or
|
| 113 |
+
documentation, if provided along with the Derivative Works; or,
|
| 114 |
+
within a display generated by the Derivative Works, if and
|
| 115 |
+
wherever such third-party notices normally appear. The contents
|
| 116 |
+
of the NOTICE file are for informational purposes only and
|
| 117 |
+
do not modify the License. You may add Your own attribution
|
| 118 |
+
notices within Derivative Works that You distribute, alongside
|
| 119 |
+
or as an addendum to the NOTICE text from the Work, provided
|
| 120 |
+
that such additional attribution notices cannot be construed
|
| 121 |
+
as modifying the License.
|
| 122 |
+
|
| 123 |
+
You may add Your own copyright statement to Your modifications and
|
| 124 |
+
may provide additional or different license terms and conditions
|
| 125 |
+
for use, reproduction, or distribution of Your modifications, or
|
| 126 |
+
for any such Derivative Works as a whole, provided Your use,
|
| 127 |
+
reproduction, and distribution of the Work otherwise complies with
|
| 128 |
+
the conditions stated in this License.
|
| 129 |
+
|
| 130 |
+
5. Submission of Contributions. Unless You explicitly state otherwise,
|
| 131 |
+
any Contribution intentionally submitted for inclusion in the Work
|
| 132 |
+
by You to the Licensor shall be under the terms and conditions of
|
| 133 |
+
this License, without any additional terms or conditions.
|
| 134 |
+
Notwithstanding the above, nothing herein shall supersede or modify
|
| 135 |
+
the terms of any separate license agreement you may have executed
|
| 136 |
+
with Licensor regarding such Contributions.
|
| 137 |
+
|
| 138 |
+
6. Trademarks. This License does not grant permission to use the trade
|
| 139 |
+
names, trademarks, service marks, or product names of the Licensor,
|
| 140 |
+
except as required for reasonable and customary use in describing the
|
| 141 |
+
origin of the Work and reproducing the content of the NOTICE file.
|
| 142 |
+
|
| 143 |
+
7. Disclaimer of Warranty. Unless required by applicable law or
|
| 144 |
+
agreed to in writing, Licensor provides the Work (and each
|
| 145 |
+
Contributor provides its Contributions) on an "AS IS" BASIS,
|
| 146 |
+
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
|
| 147 |
+
implied, including, without limitation, any warranties or conditions
|
| 148 |
+
of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
|
| 149 |
+
PARTICULAR PURPOSE. You are solely responsible for determining the
|
| 150 |
+
appropriateness of using or redistributing the Work and assume any
|
| 151 |
+
risks associated with Your exercise of permissions under this License.
|
| 152 |
+
|
| 153 |
+
8. Limitation of Liability. In no event and under no legal theory,
|
| 154 |
+
whether in tort (including negligence), contract, or otherwise,
|
| 155 |
+
unless required by applicable law (such as deliberate and grossly
|
| 156 |
+
negligent acts) or agreed to in writing, shall any Contributor be
|
| 157 |
+
liable to You for damages, including any direct, indirect, special,
|
| 158 |
+
incidental, or consequential damages of any character arising as a
|
| 159 |
+
result of this License or out of the use or inability to use the
|
| 160 |
+
Work (including but not limited to damages for loss of goodwill,
|
| 161 |
+
work stoppage, computer failure or malfunction, or any and all
|
| 162 |
+
other commercial damages or losses), even if such Contributor
|
| 163 |
+
has been advised of the possibility of such damages.
|
| 164 |
+
|
| 165 |
+
9. Accepting Warranty or Additional Liability. While redistributing
|
| 166 |
+
the Work or Derivative Works thereof, You may choose to offer,
|
| 167 |
+
and charge a fee for, acceptance of support, warranty, indemnity,
|
| 168 |
+
or other liability obligations and/or rights consistent with this
|
| 169 |
+
License. However, in accepting such obligations, You may act only
|
| 170 |
+
on Your own behalf and on Your sole responsibility, not on behalf
|
| 171 |
+
of any other Contributor, and only if You agree to indemnify,
|
| 172 |
+
defend, and hold each Contributor harmless for any liability
|
| 173 |
+
incurred by, or claims asserted against, such Contributor by reason
|
| 174 |
+
of your accepting any such warranty or additional liability.
|
| 175 |
+
|
| 176 |
+
END OF TERMS AND CONDITIONS
|
| 177 |
+
|
| 178 |
+
APPENDIX: How to apply the Apache License to your work.
|
| 179 |
+
|
| 180 |
+
To apply the Apache License to your work, attach the following
|
| 181 |
+
boilerplate notice, with the fields enclosed by brackets "[]"
|
| 182 |
+
replaced with your own identifying information. (Don't include
|
| 183 |
+
the brackets!) The text should be enclosed in the appropriate
|
| 184 |
+
comment syntax for the file format. We also recommend that a
|
| 185 |
+
file or class name and description of purpose be included on the
|
| 186 |
+
same "printed page" as the copyright notice for easier
|
| 187 |
+
identification within third-party archives.
|
| 188 |
+
|
| 189 |
+
Copyright 2025 FutureHouse
|
| 190 |
+
|
| 191 |
+
Licensed under the Apache License, Version 2.0 (the "License");
|
| 192 |
+
you may not use this file except in compliance with the License.
|
| 193 |
+
You may obtain a copy of the License at
|
| 194 |
+
|
| 195 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 196 |
+
|
| 197 |
+
Unless required by applicable law or agreed to in writing, software
|
| 198 |
+
distributed under the License is distributed on an "AS IS" BASIS,
|
| 199 |
+
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 200 |
+
See the License for the specific language governing permissions and
|
| 201 |
+
limitations under the License.
|
packages/remotes/README.md
ADDED
|
@@ -0,0 +1,38 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# ether0.remotes
|
| 2 |
+
|
| 3 |
+
Server code for ether0 reward functions.
|
| 4 |
+
|
| 5 |
+
## Molecular Transformer (MolTrans) Model
|
| 6 |
+
|
| 7 |
+
To run the `/translate` endpoint, you need a pre-trained MolTrans PyTorch model.
|
| 8 |
+
This can be acquired from Future House's Google Drive via the following command:
|
| 9 |
+
|
| 10 |
+
```bash
|
| 11 |
+
curl --location --output src/ether0/USPTO480k_model_step_400000.pt \
|
| 12 |
+
"https://drive.usercontent.google.com/download?id=1Rjd3wXg2oLeCpNUofFRvVvQoOcgWd6vf&export=download&confirm=t"
|
| 13 |
+
```
|
| 14 |
+
|
| 15 |
+
Or more manually:
|
| 16 |
+
|
| 17 |
+
1. Go to [this notebook][1]
|
| 18 |
+
2. Download the `USPTO480k_model_step_400000.pt`
|
| 19 |
+
linked in the `trained_model_url` variable's linked Google Drive file:
|
| 20 |
+
<https://drive.google.com/uc?id=1ywJCJHunoPTB5wr6KdZ8aLv7tMFMBHNy>
|
| 21 |
+
3. Set the environment variable `ETHER0_REMOTES_MOLTRANS_MODEL_PATH`
|
| 22 |
+
to the downloaded PyTorch model's location,
|
| 23 |
+
or place the model in the default checked `ether0` source code folder (`src/ether0`).
|
| 24 |
+
|
| 25 |
+
[1]: https://github.com/schwallergroup/ai4chem_course/blob/main/notebooks/07%20-%20Reaction%20Prediction/template_free.ipynb
|
| 26 |
+
|
| 27 |
+
## Serving
|
| 28 |
+
|
| 29 |
+
To run the server:
|
| 30 |
+
|
| 31 |
+
1. `pip install` with the `serve` extra: `pip install ether0.remotes[serve]`
|
| 32 |
+
2. Then run the following command:
|
| 33 |
+
|
| 34 |
+
```bash
|
| 35 |
+
ETHER0_REMOTES_API_TOKEN="abc123" \
|
| 36 |
+
ETHER0_REMOTES_MOLTRANS_MODEL_PATH="/path/to/USPTO480k_model_step_400000.pt" \
|
| 37 |
+
ether0-serve
|
| 38 |
+
```
|
packages/remotes/pyproject.toml
ADDED
|
@@ -0,0 +1,59 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
[build-system]
|
| 2 |
+
build-backend = "setuptools.build_meta"
|
| 3 |
+
requires = ["setuptools>=64", "setuptools_scm>=8"]
|
| 4 |
+
|
| 5 |
+
[dependency-groups]
|
| 6 |
+
dev = ["ether0.remotes[dev]"]
|
| 7 |
+
|
| 8 |
+
[project]
|
| 9 |
+
authors = [
|
| 10 |
+
{email = "[email protected]", name = "FutureHouse technical staff"},
|
| 11 |
+
]
|
| 12 |
+
classifiers = [
|
| 13 |
+
"Intended Audience :: Developers",
|
| 14 |
+
"License :: OSI Approved :: Apache Software License",
|
| 15 |
+
"Operating System :: POSIX",
|
| 16 |
+
"Programming Language :: Python :: 3 :: Only",
|
| 17 |
+
"Programming Language :: Python :: 3.11",
|
| 18 |
+
"Programming Language :: Python :: 3.12",
|
| 19 |
+
"Programming Language :: Python :: 3.13",
|
| 20 |
+
"Programming Language :: Python",
|
| 21 |
+
"Topic :: Scientific/Engineering :: Artificial Intelligence",
|
| 22 |
+
"Topic :: Scientific/Engineering :: Chemistry",
|
| 23 |
+
]
|
| 24 |
+
dependencies = [
|
| 25 |
+
"OpenNMT-py==2.3.0", # Match MolecularTransformer version
|
| 26 |
+
"fastapi",
|
| 27 |
+
"molbloom>=2.3.4", # For nested zinc20 catalog",
|
| 28 |
+
"molsol>=0.0.3",
|
| 29 |
+
"numpy>=1.20", # Pin for numpy typing
|
| 30 |
+
"pydantic>=2", # Pin to keep recent
|
| 31 |
+
"rdkit",
|
| 32 |
+
"torch<2.6", # Downpin for weights_only introduction breaking model_builder's load_test_model
|
| 33 |
+
]
|
| 34 |
+
description = "Server code for remotes of ether0"
|
| 35 |
+
dynamic = ["version"]
|
| 36 |
+
license = {file = "LICENSE"}
|
| 37 |
+
name = "ether0.remotes"
|
| 38 |
+
readme = "README.md"
|
| 39 |
+
requires-python = ">=3.11"
|
| 40 |
+
|
| 41 |
+
[project.optional-dependencies]
|
| 42 |
+
dev = [
|
| 43 |
+
"ether0",
|
| 44 |
+
"ether0.remotes[serve]",
|
| 45 |
+
"tensorboard>=2.19", # Indirect dependency we pin to keep recent
|
| 46 |
+
]
|
| 47 |
+
serve = ["uvicorn"]
|
| 48 |
+
|
| 49 |
+
[project.scripts]
|
| 50 |
+
ether0-serve = "ether0.server:main"
|
| 51 |
+
|
| 52 |
+
[tool.ruff]
|
| 53 |
+
extend = "../../pyproject.toml"
|
| 54 |
+
|
| 55 |
+
[tool.setuptools.packages.find]
|
| 56 |
+
where = ["src"]
|
| 57 |
+
|
| 58 |
+
[tool.setuptools_scm]
|
| 59 |
+
root = "../.."
|
packages/remotes/src/ether0.remotes.egg-info/PKG-INFO
ADDED
|
@@ -0,0 +1,274 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
Metadata-Version: 2.4
|
| 2 |
+
Name: ether0.remotes
|
| 3 |
+
Version: 0.1.dev19+g97db23388
|
| 4 |
+
Summary: Server code for remotes of ether0
|
| 5 |
+
Author-email: FutureHouse technical staff <[email protected]>
|
| 6 |
+
License: Apache License
|
| 7 |
+
Version 2.0, January 2004
|
| 8 |
+
http://www.apache.org/licenses/
|
| 9 |
+
|
| 10 |
+
TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
|
| 11 |
+
|
| 12 |
+
1. Definitions.
|
| 13 |
+
|
| 14 |
+
"License" shall mean the terms and conditions for use, reproduction,
|
| 15 |
+
and distribution as defined by Sections 1 through 9 of this document.
|
| 16 |
+
|
| 17 |
+
"Licensor" shall mean the copyright owner or entity authorized by
|
| 18 |
+
the copyright owner that is granting the License.
|
| 19 |
+
|
| 20 |
+
"Legal Entity" shall mean the union of the acting entity and all
|
| 21 |
+
other entities that control, are controlled by, or are under common
|
| 22 |
+
control with that entity. For the purposes of this definition,
|
| 23 |
+
"control" means (i) the power, direct or indirect, to cause the
|
| 24 |
+
direction or management of such entity, whether by contract or
|
| 25 |
+
otherwise, or (ii) ownership of fifty percent (50%) or more of the
|
| 26 |
+
outstanding shares, or (iii) beneficial ownership of such entity.
|
| 27 |
+
|
| 28 |
+
"You" (or "Your") shall mean an individual or Legal Entity
|
| 29 |
+
exercising permissions granted by this License.
|
| 30 |
+
|
| 31 |
+
"Source" form shall mean the preferred form for making modifications,
|
| 32 |
+
including but not limited to software source code, documentation
|
| 33 |
+
source, and configuration files.
|
| 34 |
+
|
| 35 |
+
"Object" form shall mean any form resulting from mechanical
|
| 36 |
+
transformation or translation of a Source form, including but
|
| 37 |
+
not limited to compiled object code, generated documentation,
|
| 38 |
+
and conversions to other media types.
|
| 39 |
+
|
| 40 |
+
"Work" shall mean the work of authorship, whether in Source or
|
| 41 |
+
Object form, made available under the License, as indicated by a
|
| 42 |
+
copyright notice that is included in or attached to the work
|
| 43 |
+
(an example is provided in the Appendix below).
|
| 44 |
+
|
| 45 |
+
"Derivative Works" shall mean any work, whether in Source or Object
|
| 46 |
+
form, that is based on (or derived from) the Work and for which the
|
| 47 |
+
editorial revisions, annotations, elaborations, or other modifications
|
| 48 |
+
represent, as a whole, an original work of authorship. For the purposes
|
| 49 |
+
of this License, Derivative Works shall not include works that remain
|
| 50 |
+
separable from, or merely link (or bind by name) to the interfaces of,
|
| 51 |
+
the Work and Derivative Works thereof.
|
| 52 |
+
|
| 53 |
+
"Contribution" shall mean any work of authorship, including
|
| 54 |
+
the original version of the Work and any modifications or additions
|
| 55 |
+
to that Work or Derivative Works thereof, that is intentionally
|
| 56 |
+
submitted to Licensor for inclusion in the Work by the copyright owner
|
| 57 |
+
or by an individual or Legal Entity authorized to submit on behalf of
|
| 58 |
+
the copyright owner. For the purposes of this definition, "submitted"
|
| 59 |
+
means any form of electronic, verbal, or written communication sent
|
| 60 |
+
to the Licensor or its representatives, including but not limited to
|
| 61 |
+
communication on electronic mailing lists, source code control systems,
|
| 62 |
+
and issue tracking systems that are managed by, or on behalf of, the
|
| 63 |
+
Licensor for the purpose of discussing and improving the Work, but
|
| 64 |
+
excluding communication that is conspicuously marked or otherwise
|
| 65 |
+
designated in writing by the copyright owner as "Not a Contribution."
|
| 66 |
+
|
| 67 |
+
"Contributor" shall mean Licensor and any individual or Legal Entity
|
| 68 |
+
on behalf of whom a Contribution has been received by Licensor and
|
| 69 |
+
subsequently incorporated within the Work.
|
| 70 |
+
|
| 71 |
+
2. Grant of Copyright License. Subject to the terms and conditions of
|
| 72 |
+
this License, each Contributor hereby grants to You a perpetual,
|
| 73 |
+
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
| 74 |
+
copyright license to reproduce, prepare Derivative Works of,
|
| 75 |
+
publicly display, publicly perform, sublicense, and distribute the
|
| 76 |
+
Work and such Derivative Works in Source or Object form.
|
| 77 |
+
|
| 78 |
+
3. Grant of Patent License. Subject to the terms and conditions of
|
| 79 |
+
this License, each Contributor hereby grants to You a perpetual,
|
| 80 |
+
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
| 81 |
+
(except as stated in this section) patent license to make, have made,
|
| 82 |
+
use, offer to sell, sell, import, and otherwise transfer the Work,
|
| 83 |
+
where such license applies only to those patent claims licensable
|
| 84 |
+
by such Contributor that are necessarily infringed by their
|
| 85 |
+
Contribution(s) alone or by combination of their Contribution(s)
|
| 86 |
+
with the Work to which such Contribution(s) was submitted. If You
|
| 87 |
+
institute patent litigation against any entity (including a
|
| 88 |
+
cross-claim or counterclaim in a lawsuit) alleging that the Work
|
| 89 |
+
or a Contribution incorporated within the Work constitutes direct
|
| 90 |
+
or contributory patent infringement, then any patent licenses
|
| 91 |
+
granted to You under this License for that Work shall terminate
|
| 92 |
+
as of the date such litigation is filed.
|
| 93 |
+
|
| 94 |
+
4. Redistribution. You may reproduce and distribute copies of the
|
| 95 |
+
Work or Derivative Works thereof in any medium, with or without
|
| 96 |
+
modifications, and in Source or Object form, provided that You
|
| 97 |
+
meet the following conditions:
|
| 98 |
+
|
| 99 |
+
(a) You must give any other recipients of the Work or
|
| 100 |
+
Derivative Works a copy of this License; and
|
| 101 |
+
|
| 102 |
+
(b) You must cause any modified files to carry prominent notices
|
| 103 |
+
stating that You changed the files; and
|
| 104 |
+
|
| 105 |
+
(c) You must retain, in the Source form of any Derivative Works
|
| 106 |
+
that You distribute, all copyright, patent, trademark, and
|
| 107 |
+
attribution notices from the Source form of the Work,
|
| 108 |
+
excluding those notices that do not pertain to any part of
|
| 109 |
+
the Derivative Works; and
|
| 110 |
+
|
| 111 |
+
(d) If the Work includes a "NOTICE" text file as part of its
|
| 112 |
+
distribution, then any Derivative Works that You distribute must
|
| 113 |
+
include a readable copy of the attribution notices contained
|
| 114 |
+
within such NOTICE file, excluding those notices that do not
|
| 115 |
+
pertain to any part of the Derivative Works, in at least one
|
| 116 |
+
of the following places: within a NOTICE text file distributed
|
| 117 |
+
as part of the Derivative Works; within the Source form or
|
| 118 |
+
documentation, if provided along with the Derivative Works; or,
|
| 119 |
+
within a display generated by the Derivative Works, if and
|
| 120 |
+
wherever such third-party notices normally appear. The contents
|
| 121 |
+
of the NOTICE file are for informational purposes only and
|
| 122 |
+
do not modify the License. You may add Your own attribution
|
| 123 |
+
notices within Derivative Works that You distribute, alongside
|
| 124 |
+
or as an addendum to the NOTICE text from the Work, provided
|
| 125 |
+
that such additional attribution notices cannot be construed
|
| 126 |
+
as modifying the License.
|
| 127 |
+
|
| 128 |
+
You may add Your own copyright statement to Your modifications and
|
| 129 |
+
may provide additional or different license terms and conditions
|
| 130 |
+
for use, reproduction, or distribution of Your modifications, or
|
| 131 |
+
for any such Derivative Works as a whole, provided Your use,
|
| 132 |
+
reproduction, and distribution of the Work otherwise complies with
|
| 133 |
+
the conditions stated in this License.
|
| 134 |
+
|
| 135 |
+
5. Submission of Contributions. Unless You explicitly state otherwise,
|
| 136 |
+
any Contribution intentionally submitted for inclusion in the Work
|
| 137 |
+
by You to the Licensor shall be under the terms and conditions of
|
| 138 |
+
this License, without any additional terms or conditions.
|
| 139 |
+
Notwithstanding the above, nothing herein shall supersede or modify
|
| 140 |
+
the terms of any separate license agreement you may have executed
|
| 141 |
+
with Licensor regarding such Contributions.
|
| 142 |
+
|
| 143 |
+
6. Trademarks. This License does not grant permission to use the trade
|
| 144 |
+
names, trademarks, service marks, or product names of the Licensor,
|
| 145 |
+
except as required for reasonable and customary use in describing the
|
| 146 |
+
origin of the Work and reproducing the content of the NOTICE file.
|
| 147 |
+
|
| 148 |
+
7. Disclaimer of Warranty. Unless required by applicable law or
|
| 149 |
+
agreed to in writing, Licensor provides the Work (and each
|
| 150 |
+
Contributor provides its Contributions) on an "AS IS" BASIS,
|
| 151 |
+
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
|
| 152 |
+
implied, including, without limitation, any warranties or conditions
|
| 153 |
+
of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
|
| 154 |
+
PARTICULAR PURPOSE. You are solely responsible for determining the
|
| 155 |
+
appropriateness of using or redistributing the Work and assume any
|
| 156 |
+
risks associated with Your exercise of permissions under this License.
|
| 157 |
+
|
| 158 |
+
8. Limitation of Liability. In no event and under no legal theory,
|
| 159 |
+
whether in tort (including negligence), contract, or otherwise,
|
| 160 |
+
unless required by applicable law (such as deliberate and grossly
|
| 161 |
+
negligent acts) or agreed to in writing, shall any Contributor be
|
| 162 |
+
liable to You for damages, including any direct, indirect, special,
|
| 163 |
+
incidental, or consequential damages of any character arising as a
|
| 164 |
+
result of this License or out of the use or inability to use the
|
| 165 |
+
Work (including but not limited to damages for loss of goodwill,
|
| 166 |
+
work stoppage, computer failure or malfunction, or any and all
|
| 167 |
+
other commercial damages or losses), even if such Contributor
|
| 168 |
+
has been advised of the possibility of such damages.
|
| 169 |
+
|
| 170 |
+
9. Accepting Warranty or Additional Liability. While redistributing
|
| 171 |
+
the Work or Derivative Works thereof, You may choose to offer,
|
| 172 |
+
and charge a fee for, acceptance of support, warranty, indemnity,
|
| 173 |
+
or other liability obligations and/or rights consistent with this
|
| 174 |
+
License. However, in accepting such obligations, You may act only
|
| 175 |
+
on Your own behalf and on Your sole responsibility, not on behalf
|
| 176 |
+
of any other Contributor, and only if You agree to indemnify,
|
| 177 |
+
defend, and hold each Contributor harmless for any liability
|
| 178 |
+
incurred by, or claims asserted against, such Contributor by reason
|
| 179 |
+
of your accepting any such warranty or additional liability.
|
| 180 |
+
|
| 181 |
+
END OF TERMS AND CONDITIONS
|
| 182 |
+
|
| 183 |
+
APPENDIX: How to apply the Apache License to your work.
|
| 184 |
+
|
| 185 |
+
To apply the Apache License to your work, attach the following
|
| 186 |
+
boilerplate notice, with the fields enclosed by brackets "[]"
|
| 187 |
+
replaced with your own identifying information. (Don't include
|
| 188 |
+
the brackets!) The text should be enclosed in the appropriate
|
| 189 |
+
comment syntax for the file format. We also recommend that a
|
| 190 |
+
file or class name and description of purpose be included on the
|
| 191 |
+
same "printed page" as the copyright notice for easier
|
| 192 |
+
identification within third-party archives.
|
| 193 |
+
|
| 194 |
+
Copyright 2025 FutureHouse
|
| 195 |
+
|
| 196 |
+
Licensed under the Apache License, Version 2.0 (the "License");
|
| 197 |
+
you may not use this file except in compliance with the License.
|
| 198 |
+
You may obtain a copy of the License at
|
| 199 |
+
|
| 200 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 201 |
+
|
| 202 |
+
Unless required by applicable law or agreed to in writing, software
|
| 203 |
+
distributed under the License is distributed on an "AS IS" BASIS,
|
| 204 |
+
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 205 |
+
See the License for the specific language governing permissions and
|
| 206 |
+
limitations under the License.
|
| 207 |
+
|
| 208 |
+
Classifier: Intended Audience :: Developers
|
| 209 |
+
Classifier: License :: OSI Approved :: Apache Software License
|
| 210 |
+
Classifier: Operating System :: POSIX
|
| 211 |
+
Classifier: Programming Language :: Python :: 3 :: Only
|
| 212 |
+
Classifier: Programming Language :: Python :: 3.11
|
| 213 |
+
Classifier: Programming Language :: Python :: 3.12
|
| 214 |
+
Classifier: Programming Language :: Python :: 3.13
|
| 215 |
+
Classifier: Programming Language :: Python
|
| 216 |
+
Classifier: Topic :: Scientific/Engineering :: Artificial Intelligence
|
| 217 |
+
Classifier: Topic :: Scientific/Engineering :: Chemistry
|
| 218 |
+
Requires-Python: >=3.11
|
| 219 |
+
Description-Content-Type: text/markdown
|
| 220 |
+
License-File: LICENSE
|
| 221 |
+
Requires-Dist: OpenNMT-py==2.3.0
|
| 222 |
+
Requires-Dist: fastapi
|
| 223 |
+
Requires-Dist: molbloom>=2.3.4
|
| 224 |
+
Requires-Dist: molsol>=0.0.3
|
| 225 |
+
Requires-Dist: numpy>=1.20
|
| 226 |
+
Requires-Dist: pydantic>=2
|
| 227 |
+
Requires-Dist: rdkit
|
| 228 |
+
Requires-Dist: torch<2.6
|
| 229 |
+
Provides-Extra: dev
|
| 230 |
+
Requires-Dist: ether0; extra == "dev"
|
| 231 |
+
Requires-Dist: ether0.remotes[serve]; extra == "dev"
|
| 232 |
+
Requires-Dist: tensorboard>=2.19; extra == "dev"
|
| 233 |
+
Provides-Extra: serve
|
| 234 |
+
Requires-Dist: uvicorn; extra == "serve"
|
| 235 |
+
Dynamic: license-file
|
| 236 |
+
|
| 237 |
+
# ether0.remotes
|
| 238 |
+
|
| 239 |
+
Server code for ether0 reward functions.
|
| 240 |
+
|
| 241 |
+
## Molecular Transformer (MolTrans) Model
|
| 242 |
+
|
| 243 |
+
To run the `/translate` endpoint, you need a pre-trained MolTrans PyTorch model.
|
| 244 |
+
This can be acquired from Future House's Google Drive via the following command:
|
| 245 |
+
|
| 246 |
+
```bash
|
| 247 |
+
curl --location --output src/ether0/USPTO480k_model_step_400000.pt \
|
| 248 |
+
"https://drive.usercontent.google.com/download?id=1Rjd3wXg2oLeCpNUofFRvVvQoOcgWd6vf&export=download&confirm=t"
|
| 249 |
+
```
|
| 250 |
+
|
| 251 |
+
Or more manually:
|
| 252 |
+
|
| 253 |
+
1. Go to [this notebook][1]
|
| 254 |
+
2. Download the `USPTO480k_model_step_400000.pt`
|
| 255 |
+
linked in the `trained_model_url` variable's linked Google Drive file:
|
| 256 |
+
<https://drive.google.com/uc?id=1ywJCJHunoPTB5wr6KdZ8aLv7tMFMBHNy>
|
| 257 |
+
3. Set the environment variable `ETHER0_REMOTES_MOLTRANS_MODEL_PATH`
|
| 258 |
+
to the downloaded PyTorch model's location,
|
| 259 |
+
or place the model in the default checked `ether0` source code folder (`src/ether0`).
|
| 260 |
+
|
| 261 |
+
[1]: https://github.com/schwallergroup/ai4chem_course/blob/main/notebooks/07%20-%20Reaction%20Prediction/template_free.ipynb
|
| 262 |
+
|
| 263 |
+
## Serving
|
| 264 |
+
|
| 265 |
+
To run the server:
|
| 266 |
+
|
| 267 |
+
1. `pip install` with the `serve` extra: `pip install ether0.remotes[serve]`
|
| 268 |
+
2. Then run the following command:
|
| 269 |
+
|
| 270 |
+
```bash
|
| 271 |
+
ETHER0_REMOTES_API_TOKEN="abc123" \
|
| 272 |
+
ETHER0_REMOTES_MOLTRANS_MODEL_PATH="/path/to/USPTO480k_model_step_400000.pt" \
|
| 273 |
+
ether0-serve
|
| 274 |
+
```
|
packages/remotes/src/ether0.remotes.egg-info/SOURCES.txt
ADDED
|
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.gitignore
|
| 2 |
+
LICENSE
|
| 3 |
+
README.md
|
| 4 |
+
pyproject.toml
|
| 5 |
+
src/ether0/server.py
|
| 6 |
+
src/ether0.remotes.egg-info/PKG-INFO
|
| 7 |
+
src/ether0.remotes.egg-info/SOURCES.txt
|
| 8 |
+
src/ether0.remotes.egg-info/dependency_links.txt
|
| 9 |
+
src/ether0.remotes.egg-info/entry_points.txt
|
| 10 |
+
src/ether0.remotes.egg-info/requires.txt
|
| 11 |
+
src/ether0.remotes.egg-info/top_level.txt
|
| 12 |
+
tests/conftest.py
|
| 13 |
+
tests/test_clients.py
|
| 14 |
+
tests/test_rewards.py
|
packages/remotes/src/ether0.remotes.egg-info/dependency_links.txt
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
packages/remotes/src/ether0.remotes.egg-info/entry_points.txt
ADDED
|
@@ -0,0 +1,2 @@
|
|
|
|
|
|
|
|
|
|
| 1 |
+
[console_scripts]
|
| 2 |
+
ether0-serve = ether0.server:main
|
packages/remotes/src/ether0.remotes.egg-info/requires.txt
ADDED
|
@@ -0,0 +1,16 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
OpenNMT-py==2.3.0
|
| 2 |
+
fastapi
|
| 3 |
+
molbloom>=2.3.4
|
| 4 |
+
molsol>=0.0.3
|
| 5 |
+
numpy>=1.20
|
| 6 |
+
pydantic>=2
|
| 7 |
+
rdkit
|
| 8 |
+
torch<2.6
|
| 9 |
+
|
| 10 |
+
[dev]
|
| 11 |
+
ether0
|
| 12 |
+
ether0.remotes[serve]
|
| 13 |
+
tensorboard>=2.19
|
| 14 |
+
|
| 15 |
+
[serve]
|
| 16 |
+
uvicorn
|
packages/remotes/src/ether0.remotes.egg-info/top_level.txt
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
ether0
|
packages/remotes/src/ether0/server.py
ADDED
|
@@ -0,0 +1,316 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import argparse
|
| 2 |
+
import os
|
| 3 |
+
import re
|
| 4 |
+
import secrets
|
| 5 |
+
import tempfile
|
| 6 |
+
import uuid
|
| 7 |
+
from collections import defaultdict
|
| 8 |
+
from pathlib import Path
|
| 9 |
+
from typing import ClassVar, Literal
|
| 10 |
+
|
| 11 |
+
import numpy as np
|
| 12 |
+
import numpy.typing as npt
|
| 13 |
+
from fastapi import Depends, FastAPI, HTTPException, status
|
| 14 |
+
from fastapi.security import HTTPAuthorizationCredentials, HTTPBearer
|
| 15 |
+
from molbloom import buy
|
| 16 |
+
from molsol import KDESol
|
| 17 |
+
from onmt import opts
|
| 18 |
+
from onmt.translate.translator import build_translator
|
| 19 |
+
from onmt.utils.logging import init_logger
|
| 20 |
+
from onmt.utils.misc import split_corpus
|
| 21 |
+
from onmt.utils.parse import ArgumentParser
|
| 22 |
+
from pydantic import BaseModel
|
| 23 |
+
from rdkit import Chem
|
| 24 |
+
|
| 25 |
+
ETHER0_DIR = Path(__file__).parent
|
| 26 |
+
|
| 27 |
+
auth_scheme = HTTPBearer()
|
| 28 |
+
|
| 29 |
+
|
| 30 |
+
def validate_token(
|
| 31 |
+
credentials: HTTPAuthorizationCredentials = Depends(auth_scheme), # noqa: B008
|
| 32 |
+
) -> str:
|
| 33 |
+
# NOTE: don't use os.environ.get() to avoid possible empty string matches, and
|
| 34 |
+
# to have clearer server failures if the AUTH_TOKEN env var isn't present
|
| 35 |
+
if not secrets.compare_digest(
|
| 36 |
+
credentials.credentials, os.environ["ETHER0_REMOTES_API_TOKEN"]
|
| 37 |
+
):
|
| 38 |
+
raise HTTPException(
|
| 39 |
+
status_code=status.HTTP_401_UNAUTHORIZED,
|
| 40 |
+
detail="Incorrect bearer token",
|
| 41 |
+
headers={"WWW-Authenticate": "Bearer"},
|
| 42 |
+
)
|
| 43 |
+
return credentials.credentials
|
| 44 |
+
|
| 45 |
+
|
| 46 |
+
app = FastAPI(title="ether0 remotes server", dependencies=[Depends(validate_token)])
|
| 47 |
+
|
| 48 |
+
|
| 49 |
+
class MolecularTransformer:
|
| 50 |
+
"""Uses code from https://doi.org/10.1021/acscentsci.9b00576."""
|
| 51 |
+
|
| 52 |
+
DEFAULT_MOLTRANS_MODEL_PATH: ClassVar[Path] = (
|
| 53 |
+
ETHER0_DIR / "USPTO480k_model_step_400000.pt"
|
| 54 |
+
)
|
| 55 |
+
|
| 56 |
+
def __init__(self):
|
| 57 |
+
# Use `or None` to deny setting empty string to the environment variable
|
| 58 |
+
os_environ_model_path = (
|
| 59 |
+
os.environ.get("ETHER0_REMOTES_MOLTRANS_MODEL_PATH") or None
|
| 60 |
+
)
|
| 61 |
+
self.model_path = os_environ_model_path or str(self.DEFAULT_MOLTRANS_MODEL_PATH)
|
| 62 |
+
if not Path(self.model_path).exists():
|
| 63 |
+
raise FileNotFoundError(
|
| 64 |
+
f"MolTrans model not found"
|
| 65 |
+
f"{f', did you misconfigure the path {os_environ_model_path}?' if os_environ_model_path else '.'}" # noqa: E501
|
| 66 |
+
" Please properly configure the environment variable"
|
| 67 |
+
" 'ETHER0_REMOTES_MOLTRANS_MODEL_PATH',"
|
| 68 |
+
f" or the default path checked is {self.DEFAULT_MOLTRANS_MODEL_PATH}."
|
| 69 |
+
)
|
| 70 |
+
|
| 71 |
+
@staticmethod
|
| 72 |
+
def translate(opt: argparse.Namespace) -> None:
|
| 73 |
+
ArgumentParser.validate_translate_opts(opt)
|
| 74 |
+
logger = init_logger(opt.log_file)
|
| 75 |
+
|
| 76 |
+
translator = build_translator(opt, logger=logger, report_score=True)
|
| 77 |
+
src_shards = split_corpus(opt.src, opt.shard_size)
|
| 78 |
+
tgt_shards = split_corpus(opt.tgt, opt.shard_size)
|
| 79 |
+
features_shards = []
|
| 80 |
+
features_names = []
|
| 81 |
+
for feat_name, feat_path in opt.src_feats.items():
|
| 82 |
+
features_shards.append(split_corpus(feat_path, opt.shard_size))
|
| 83 |
+
features_names.append(feat_name)
|
| 84 |
+
shard_pairs = zip(src_shards, tgt_shards, *features_shards) # noqa: B905
|
| 85 |
+
|
| 86 |
+
for (src_shard, tgt_shard, *features_shard) in shard_pairs:
|
| 87 |
+
features_shard_ = defaultdict(list)
|
| 88 |
+
for j, x in enumerate(features_shard):
|
| 89 |
+
features_shard_[features_names[j]] = x
|
| 90 |
+
translator.translate(
|
| 91 |
+
src=src_shard,
|
| 92 |
+
src_feats=features_shard_,
|
| 93 |
+
tgt=tgt_shard,
|
| 94 |
+
batch_size=opt.batch_size,
|
| 95 |
+
batch_type=opt.batch_type,
|
| 96 |
+
attn_debug=opt.attn_debug,
|
| 97 |
+
align_debug=opt.align_debug,
|
| 98 |
+
)
|
| 99 |
+
|
| 100 |
+
@staticmethod
|
| 101 |
+
def smiles_tokenizer(smiles: str) -> str:
|
| 102 |
+
smiles_regex = re.compile(
|
| 103 |
+
r"(\%\([0-9]{3}\)|\[[^\]]+]|Br?|Cl?|N|O|S|P|F|I|b|c|n|o|s|p|\||\(|\)|\.|=|#|-|\+|\\|\/|:|~|@|\?|>>?|\*|\$|\%[0-9]{2}|[0-9])"
|
| 104 |
+
)
|
| 105 |
+
tokens = list(smiles_regex.findall(smiles))
|
| 106 |
+
return " ".join(tokens)
|
| 107 |
+
|
| 108 |
+
@staticmethod
|
| 109 |
+
def canonicalize_smiles(smiles: str) -> str:
|
| 110 |
+
# Try to use canonical smiles because original uspto is distributed in canonical form.
|
| 111 |
+
# If fails, we trust the augmentation and use the original smiles.
|
| 112 |
+
try:
|
| 113 |
+
return Chem.MolToSmiles(
|
| 114 |
+
Chem.MolFromSmiles(smiles), isomericSmiles=True, canonical=True
|
| 115 |
+
)
|
| 116 |
+
except Exception as err:
|
| 117 |
+
# If rdkit failed, it means some molecule is invalid.
|
| 118 |
+
# Here we catch which ones are invalid so we inform what's wrong
|
| 119 |
+
# on the error message.
|
| 120 |
+
invalid_smiles = []
|
| 121 |
+
for mol in smiles.split("."):
|
| 122 |
+
try:
|
| 123 |
+
Chem.MolToSmiles(
|
| 124 |
+
Chem.MolFromSmiles(mol), isomericSmiles=True, canonical=True
|
| 125 |
+
)
|
| 126 |
+
except: # noqa: E722
|
| 127 |
+
invalid_smiles.append(mol)
|
| 128 |
+
raise HTTPException(
|
| 129 |
+
status_code=status.HTTP_400_BAD_REQUEST,
|
| 130 |
+
detail=(
|
| 131 |
+
"The reaction could not be parsed by RDKit. The following"
|
| 132 |
+
f" SMILES were invalid: {', '.join(invalid_smiles)}"
|
| 133 |
+
),
|
| 134 |
+
) from err
|
| 135 |
+
|
| 136 |
+
def run(self, reaction: str) -> tuple[str, uuid.UUID]:
|
| 137 |
+
"""Translates SMILES reaction strings using MolTrans model.
|
| 138 |
+
|
| 139 |
+
Args:
|
| 140 |
+
reaction: SMILES representation of a chemical reaction
|
| 141 |
+
|
| 142 |
+
Returns:
|
| 143 |
+
SMILES representation of the predicted product and a job ID
|
| 144 |
+
"""
|
| 145 |
+
# Create a unique ID for the request
|
| 146 |
+
job_id = uuid.uuid4()
|
| 147 |
+
|
| 148 |
+
# Create temporary files for use in mol moltransformer
|
| 149 |
+
with (
|
| 150 |
+
tempfile.NamedTemporaryFile(
|
| 151 |
+
mode="w+", delete=False, encoding="utf-8"
|
| 152 |
+
) as precursor_file,
|
| 153 |
+
tempfile.NamedTemporaryFile(
|
| 154 |
+
mode="w+", delete=False, encoding="utf-8"
|
| 155 |
+
) as output_file,
|
| 156 |
+
):
|
| 157 |
+
|
| 158 |
+
# Write tokenized reaction to the precursor file
|
| 159 |
+
precursor_file.write(MolecularTransformer.smiles_tokenizer(reaction))
|
| 160 |
+
precursor_file.flush()
|
| 161 |
+
|
| 162 |
+
# OpenNMT expects to receive a list of arguments to translate
|
| 163 |
+
parser = ArgumentParser()
|
| 164 |
+
opts.config_opts(parser)
|
| 165 |
+
opts.translate_opts(parser)
|
| 166 |
+
|
| 167 |
+
args_dict = {
|
| 168 |
+
"model": self.model_path,
|
| 169 |
+
"src": precursor_file.name,
|
| 170 |
+
"output": output_file.name,
|
| 171 |
+
"batch_size": "64",
|
| 172 |
+
"beam_size": "50",
|
| 173 |
+
"max_length": "300",
|
| 174 |
+
}
|
| 175 |
+
args_list = [f"--{k}={v}" for k, v in args_dict.items()]
|
| 176 |
+
opt = parser.parse_args(args_list)
|
| 177 |
+
|
| 178 |
+
MolecularTransformer.translate(opt)
|
| 179 |
+
|
| 180 |
+
output_file.close()
|
| 181 |
+
prediction = Path(output_file.name).read_text(encoding="utf-8")
|
| 182 |
+
|
| 183 |
+
# Clean up temporary files
|
| 184 |
+
# we don't care if a failure leaves them dangling,
|
| 185 |
+
# since they are in a temp dir
|
| 186 |
+
os.unlink(precursor_file.name)
|
| 187 |
+
os.unlink(output_file.name)
|
| 188 |
+
|
| 189 |
+
return prediction.replace(" ", "").strip(), job_id
|
| 190 |
+
|
| 191 |
+
|
| 192 |
+
class MolBloom:
|
| 193 |
+
"""Uses code from https://doi.org/10.1186/s13321-023-00765-1."""
|
| 194 |
+
|
| 195 |
+
def __init__(self) -> None:
|
| 196 |
+
# trigger eager loading of the bloom filter
|
| 197 |
+
buy("C1=CC=CC=C1", catalog="zinc20")
|
| 198 |
+
self.bloom = buy
|
| 199 |
+
|
| 200 |
+
def run(self, smiles: str) -> bool:
|
| 201 |
+
"""Checks if a molecule is purchasable using MolBloom.
|
| 202 |
+
|
| 203 |
+
Args:
|
| 204 |
+
smiles: SMILES representation of a molecule
|
| 205 |
+
|
| 206 |
+
Returns:
|
| 207 |
+
True if the molecule is purchasable, False otherwise
|
| 208 |
+
"""
|
| 209 |
+
return self.bloom(smiles, canonicalize=True, catalog="zinc20")
|
| 210 |
+
|
| 211 |
+
|
| 212 |
+
class Solubility:
|
| 213 |
+
"""Uses code from https://doi.org/10.1039/D3DD00217A."""
|
| 214 |
+
|
| 215 |
+
def __init__(self) -> None:
|
| 216 |
+
self.sol = KDESol()
|
| 217 |
+
|
| 218 |
+
def run(self, smiles: str) -> npt.NDArray[np.float32] | Literal[False]:
|
| 219 |
+
"""Computes solubility prediction for a molecule using KDESol.
|
| 220 |
+
|
| 221 |
+
Args:
|
| 222 |
+
smiles: SMILES representation of a molecule.
|
| 223 |
+
|
| 224 |
+
Returns:
|
| 225 |
+
Numpy array containing the mean predicted solubility,
|
| 226 |
+
aleatoric uncertainty (au), and epistemic uncertainty (eu).
|
| 227 |
+
"""
|
| 228 |
+
m = Chem.MolFromSmiles(smiles)
|
| 229 |
+
if m is None:
|
| 230 |
+
return False # type: ignore[unreachable]
|
| 231 |
+
prediction = self.sol(Chem.MolToSmiles(m, canonical=True, isomericSmiles=False))
|
| 232 |
+
if prediction is None:
|
| 233 |
+
# Try without canonicalization.
|
| 234 |
+
# The model is an LSTM that uses tokens generated from SELFIES tokens.
|
| 235 |
+
# Depending on the SMILES notation, the model might not have the necessary tokens
|
| 236 |
+
# in its vocabulary to describe the molecule.
|
| 237 |
+
prediction = self.sol(smiles)
|
| 238 |
+
return prediction if prediction is not None else False
|
| 239 |
+
|
| 240 |
+
|
| 241 |
+
class MolTransRequest(BaseModel):
|
| 242 |
+
reaction: str
|
| 243 |
+
|
| 244 |
+
|
| 245 |
+
@app.post("/translate")
|
| 246 |
+
def translate_endpoint(request: MolTransRequest) -> dict[str, str | uuid.UUID]:
|
| 247 |
+
reaction = request.reaction.replace(" ", "")
|
| 248 |
+
if not reaction.count(">") == 2: # noqa: PLR2004
|
| 249 |
+
raise HTTPException(
|
| 250 |
+
status_code=status.HTTP_400_BAD_REQUEST,
|
| 251 |
+
detail=(
|
| 252 |
+
f"Syntax error in the reaction SMILES: {reaction}\n"
|
| 253 |
+
"The reaction should have two '>' characters, and no spaces."
|
| 254 |
+
),
|
| 255 |
+
)
|
| 256 |
+
rxn = reaction.split(">")[:-1]
|
| 257 |
+
query_reaction = MolecularTransformer.canonicalize_smiles(
|
| 258 |
+
".".join([r for r in rxn if r])
|
| 259 |
+
)
|
| 260 |
+
|
| 261 |
+
product, job_id = MolecularTransformer().run(query_reaction)
|
| 262 |
+
return {
|
| 263 |
+
"product": product,
|
| 264 |
+
"id": job_id,
|
| 265 |
+
"reaction": query_reaction + ">>" + product,
|
| 266 |
+
}
|
| 267 |
+
|
| 268 |
+
|
| 269 |
+
class MolBloomRequest(BaseModel):
|
| 270 |
+
smiles: list[str] | str
|
| 271 |
+
|
| 272 |
+
|
| 273 |
+
@app.post("/is_purchasable")
|
| 274 |
+
def is_purchasable_endpoint(request: MolBloomRequest) -> dict[str, bool]:
|
| 275 |
+
is_purchasable = MolBloom().run
|
| 276 |
+
smiles = request.smiles
|
| 277 |
+
if isinstance(smiles, str):
|
| 278 |
+
smiles = [smiles]
|
| 279 |
+
return {s: is_purchasable(s) for s in smiles}
|
| 280 |
+
|
| 281 |
+
|
| 282 |
+
class SmilesRequest(BaseModel):
|
| 283 |
+
smiles: str
|
| 284 |
+
|
| 285 |
+
|
| 286 |
+
@app.post("/compute_solubility")
|
| 287 |
+
def compute_solubility_endpoint(
|
| 288 |
+
request: SmilesRequest,
|
| 289 |
+
) -> dict[str, float] | dict[str, str]:
|
| 290 |
+
if "." in request.smiles:
|
| 291 |
+
raise HTTPException(
|
| 292 |
+
status_code=status.HTTP_400_BAD_REQUEST,
|
| 293 |
+
detail="Only single molecules are supported",
|
| 294 |
+
)
|
| 295 |
+
prediction = Solubility().run(smiles=request.smiles)
|
| 296 |
+
if prediction is False:
|
| 297 |
+
return {"error": "Solubility prediction failed."}
|
| 298 |
+
mean, au, eu = prediction.tolist()
|
| 299 |
+
return {"mean": mean, "au": au, "eu": eu}
|
| 300 |
+
|
| 301 |
+
|
| 302 |
+
def main() -> None:
|
| 303 |
+
"""Run uvicorn to serve the FastAPI app."""
|
| 304 |
+
try:
|
| 305 |
+
import uvicorn # noqa: PLC0415
|
| 306 |
+
except ImportError as exc:
|
| 307 |
+
raise ImportError(
|
| 308 |
+
"Serving requires the 'serve' extra for the `uvicorn` package. Please:"
|
| 309 |
+
" `pip install ether0.remotes[serve]`."
|
| 310 |
+
) from exc
|
| 311 |
+
|
| 312 |
+
uvicorn.run("ether0.server:app")
|
| 313 |
+
|
| 314 |
+
|
| 315 |
+
if __name__ == "__main__":
|
| 316 |
+
main()
|
packages/remotes/tests/conftest.py
ADDED
|
@@ -0,0 +1,29 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import importlib
|
| 2 |
+
import os
|
| 3 |
+
from collections.abc import Iterator
|
| 4 |
+
from unittest.mock import patch
|
| 5 |
+
|
| 6 |
+
import pytest
|
| 7 |
+
from fastapi.testclient import TestClient
|
| 8 |
+
|
| 9 |
+
|
| 10 |
+
@pytest.fixture(name="test_client", scope="session")
|
| 11 |
+
def fixture_test_client() -> Iterator[TestClient]:
|
| 12 |
+
# Lazily import from aviary so typeguard doesn't throw:
|
| 13 |
+
# > /path/to/.venv/lib/python3.11/site-packages/typeguard/_pytest_plugin.py:93:
|
| 14 |
+
# > InstrumentationWarning: typeguard cannot check these packages
|
| 15 |
+
# > because they are already imported: ether0
|
| 16 |
+
import ether0.clients # noqa: PLC0415
|
| 17 |
+
|
| 18 |
+
from ether0.server import app # noqa: PLC0415
|
| 19 |
+
|
| 20 |
+
client = TestClient(app)
|
| 21 |
+
with patch.dict(
|
| 22 |
+
os.environ,
|
| 23 |
+
{
|
| 24 |
+
"ETHER0_REMOTES_API_BASE_URL": str(client.base_url),
|
| 25 |
+
"ETHER0_REMOTES_API_TOKEN": "test_stub",
|
| 26 |
+
},
|
| 27 |
+
):
|
| 28 |
+
importlib.reload(ether0.clients) # Pull in updated environment variables
|
| 29 |
+
yield client
|
packages/remotes/tests/test_clients.py
ADDED
|
@@ -0,0 +1,91 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import os
|
| 2 |
+
from typing import TYPE_CHECKING
|
| 3 |
+
from unittest.mock import patch
|
| 4 |
+
|
| 5 |
+
import httpx
|
| 6 |
+
import pytest
|
| 7 |
+
from ether0.clients import fetch_forward_rxn, fetch_purchasable, fetch_solubility
|
| 8 |
+
|
| 9 |
+
if TYPE_CHECKING:
|
| 10 |
+
from fastapi.testclient import TestClient
|
| 11 |
+
|
| 12 |
+
IN_GITHUB_ACTIONS: bool = os.getenv("GITHUB_ACTIONS") == "true"
|
| 13 |
+
|
| 14 |
+
|
| 15 |
+
@pytest.mark.parametrize(
|
| 16 |
+
("smiles", "purchasable"),
|
| 17 |
+
[
|
| 18 |
+
("CC(=O)OC1=CC=CC=C1C(=O)O", True),
|
| 19 |
+
("CCO", True),
|
| 20 |
+
("C1=CC=C(C=C1)C(=O)O", True),
|
| 21 |
+
("OCN1C=CC=C1C(=O)O", False),
|
| 22 |
+
],
|
| 23 |
+
)
|
| 24 |
+
def test_fetch_purchasable(
|
| 25 |
+
test_client: "TestClient", smiles: str, purchasable: bool
|
| 26 |
+
) -> None:
|
| 27 |
+
with patch.object(httpx, "post", test_client.post):
|
| 28 |
+
assert fetch_purchasable(smiles)[smiles] == purchasable
|
| 29 |
+
|
| 30 |
+
|
| 31 |
+
@pytest.mark.parametrize(
|
| 32 |
+
("smiles", "solubility"),
|
| 33 |
+
[
|
| 34 |
+
("CC(=O)OC1=CC=CC=C1C(=O)O", -2.5),
|
| 35 |
+
("O=C(NC1CCCC1)C(C1CC1)S1C(=N)C(C2=CC=NC3=CC=CC=C23)N=C1", -5.9),
|
| 36 |
+
],
|
| 37 |
+
)
|
| 38 |
+
def test_fetch_solubility(
|
| 39 |
+
test_client: "TestClient", smiles: str, solubility: float
|
| 40 |
+
) -> None:
|
| 41 |
+
with patch.object(httpx, "post", test_client.post):
|
| 42 |
+
result = fetch_solubility(smiles)
|
| 43 |
+
assert "solubility" in result
|
| 44 |
+
assert pytest.approx(result["solubility"], abs=0.1) == solubility
|
| 45 |
+
|
| 46 |
+
|
| 47 |
+
@pytest.mark.skipif(
|
| 48 |
+
IN_GITHUB_ACTIONS, reason="Requires loading MolTrans model, too large for CI"
|
| 49 |
+
)
|
| 50 |
+
@pytest.mark.parametrize(
|
| 51 |
+
("precursor", "product", "correct"),
|
| 52 |
+
[
|
| 53 |
+
pytest.param("CC=O.O=C1CCC1Cl>[Mg].CCOCC>", "CC(O)C1(O)CCC1Cl", True),
|
| 54 |
+
pytest.param(
|
| 55 |
+
"CCC=O.CC1(C)CC(N)C(=O)N1>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O>",
|
| 56 |
+
"CCCN(C)C1CC(C)(C)NC1=O",
|
| 57 |
+
True,
|
| 58 |
+
),
|
| 59 |
+
pytest.param("CCCC=O.O=C1CC=C(Br)S1>[Mg].CCOCC>", "CCCC(O)C1=CCC(=O)S1", True),
|
| 60 |
+
pytest.param("CCCC=O.COC(=O)C1CC1Br>[Mg].CCOCC>", "CCCC(O)C1CC1C(=O)OC", True),
|
| 61 |
+
pytest.param(
|
| 62 |
+
"CCCC=O.NC1CCCNC1=O>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O>",
|
| 63 |
+
"O=C1NCCCC1N1CNCCCC1=O",
|
| 64 |
+
True,
|
| 65 |
+
),
|
| 66 |
+
pytest.param("CC=O.O=C1CCC1Cl.[Mg].CCOCC", None, False, id="missing_arrow"),
|
| 67 |
+
pytest.param(
|
| 68 |
+
"CC=O.O=C1CCC1Cl > [Mg].CCOCC", None, False, id="space_in_reaction"
|
| 69 |
+
),
|
| 70 |
+
pytest.param("not a > reaction", None, False, id="invalid_reaction"),
|
| 71 |
+
pytest.param(
|
| 72 |
+
"CCCC=O.COC(=O)C1CC1Br>[Mg].CCOCC", None, False, id="trailing_arrow"
|
| 73 |
+
),
|
| 74 |
+
],
|
| 75 |
+
)
|
| 76 |
+
def test_fetch_forward_rxn(
|
| 77 |
+
test_client: "TestClient", precursor: str, product: str | None, correct: bool
|
| 78 |
+
) -> None:
|
| 79 |
+
with patch.object(httpx, "post", test_client.post):
|
| 80 |
+
result = fetch_forward_rxn(precursor)
|
| 81 |
+
if correct:
|
| 82 |
+
assert (
|
| 83 |
+
result.get("product") == product
|
| 84 |
+
), f"Failed to get expected {product=} in {result=}."
|
| 85 |
+
assert "error" not in result
|
| 86 |
+
else:
|
| 87 |
+
assert result.get(
|
| 88 |
+
"error"
|
| 89 |
+
), f"Expected an error given {precursor=} and {correct=}"
|
| 90 |
+
assert "syntax error" in result["error"].lower()
|
| 91 |
+
assert "product" not in result
|
packages/remotes/tests/test_rewards.py
ADDED
|
@@ -0,0 +1,108 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
from typing import TYPE_CHECKING
|
| 2 |
+
from unittest.mock import patch
|
| 3 |
+
|
| 4 |
+
import httpx
|
| 5 |
+
import pytest
|
| 6 |
+
from ether0.rewards import oracle_solubility_eval
|
| 7 |
+
from pydantic import JsonValue
|
| 8 |
+
|
| 9 |
+
if TYPE_CHECKING:
|
| 10 |
+
from fastapi.testclient import TestClient
|
| 11 |
+
|
| 12 |
+
|
| 13 |
+
@pytest.mark.parametrize(
|
| 14 |
+
("yhat", "y", "expected"),
|
| 15 |
+
[
|
| 16 |
+
pytest.param(
|
| 17 |
+
"c1c(O)nc2ccc(CN)cc2c1OC1CCCC1",
|
| 18 |
+
'("scaffold", "c1ccc2c(OC3CCCC3)ccnc2c1", -3.844724178314209, "increase")',
|
| 19 |
+
1.0,
|
| 20 |
+
id="match-scaffold",
|
| 21 |
+
),
|
| 22 |
+
pytest.param(
|
| 23 |
+
"Oc1c(O)nc2ccc(C[NH3])cc2c1OC1CCCC1O",
|
| 24 |
+
'("scaffold", "c1ccc2c(OC3CCCC3)ccnc2c1", -3.844724178314209, "decrease")',
|
| 25 |
+
0.0,
|
| 26 |
+
id="match-scaffold-bad-solubility",
|
| 27 |
+
),
|
| 28 |
+
pytest.param(
|
| 29 |
+
"CCCCCC=CCCCN(C)CCC",
|
| 30 |
+
'("groups", ["cis double bond", "hetero N basic H"], -4.693881511688232, "decrease")', # noqa: E501
|
| 31 |
+
1.0,
|
| 32 |
+
id="match-groups",
|
| 33 |
+
),
|
| 34 |
+
pytest.param(
|
| 35 |
+
"CCCCCCCCCCN(C)N[NH]CNCC",
|
| 36 |
+
'("groups", ["cis double bond", "hetero N basic H"], -1.9085578918457031, "decrease")', # noqa: E501
|
| 37 |
+
0.0,
|
| 38 |
+
id="match-groups-bad-groups",
|
| 39 |
+
),
|
| 40 |
+
pytest.param(
|
| 41 |
+
"CCCCN(CCCC)C(=O)C1c2ccccc2Oc2ccccc21",
|
| 42 |
+
'("tanimoto", "CCCN(CCC)C(=O)C1c2ccccc2Oc2ccccc21", -5.273194313049316, "decrease")',
|
| 43 |
+
1.0,
|
| 44 |
+
id="match-tanimoto",
|
| 45 |
+
),
|
| 46 |
+
pytest.param(
|
| 47 |
+
"CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCN(CCCC)C(=O)C1c2ccccc2Oc2ccccc21",
|
| 48 |
+
'("tanimoto", "CCCN(CCC)C(=O)C1c2ccccc2Oc2ccccc21", -5.273194313049316, "decrease")',
|
| 49 |
+
0.0,
|
| 50 |
+
id="match-tanimoto-too-far",
|
| 51 |
+
),
|
| 52 |
+
pytest.param(
|
| 53 |
+
"CCCCCCCCCCCCCCCCCCCCCCN(CCC)C(=O)C1c2ccccc2Oc2ccccc21",
|
| 54 |
+
'("tanimoto", "CCCN(CCC)C(=O)C1c2ccccc2Oc2ccccc21", -7.45, "decrease")',
|
| 55 |
+
0.0,
|
| 56 |
+
id="match-tanimoto-hacked-dist",
|
| 57 |
+
),
|
| 58 |
+
pytest.param(
|
| 59 |
+
"CN(C)C(=O)C1c2ccccc2Oc2ccccc21",
|
| 60 |
+
'("tanimoto", "CCCN(CCC)C(=O)C1c2ccccc2Oc2ccccc21", -4.273194313049316, "decrease")',
|
| 61 |
+
0.0,
|
| 62 |
+
id="match-tanimoto-bad-solubility",
|
| 63 |
+
),
|
| 64 |
+
pytest.param(
|
| 65 |
+
"CN1CCN(CCCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)CC1.CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCC",
|
| 66 |
+
'("tanimoto", "CN1CCN(CCCCNc2ncc3cc(-c4c(Cl)cccc4Cl)c(=O)n(C)c3n2)CC1", -4.273194313049316, "decrease")', # noqa: E501
|
| 67 |
+
0.0,
|
| 68 |
+
id="match-tanimoto-bad-structure",
|
| 69 |
+
),
|
| 70 |
+
pytest.param(
|
| 71 |
+
"C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(C[C@H]([C@@H]([C@@]5(C)CO)O)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@@H]([C@H]([C@@H](O8)C)O)O)O)O)O)O)O)O",
|
| 72 |
+
'("groups", ["secondary alcohol", "primary alcohol", "hydroxylated heteroatom substituted glycosidic ring"], -5.921097755432129, "increase")', # noqa: E501
|
| 73 |
+
1.0,
|
| 74 |
+
id="problematic-groups",
|
| 75 |
+
),
|
| 76 |
+
pytest.param(
|
| 77 |
+
"COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1-c1ccc(C#CCCCC(=O)NO)o1",
|
| 78 |
+
'("tanimoto", "CCCC", -6.25, "increase")',
|
| 79 |
+
0.0,
|
| 80 |
+
id="identical-increase",
|
| 81 |
+
),
|
| 82 |
+
pytest.param(
|
| 83 |
+
"COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1-c1ccc(C#CCCCC(=O)NO)o1",
|
| 84 |
+
'("tanimoto", "CCCC", -7.25, "decrease")',
|
| 85 |
+
0.0,
|
| 86 |
+
id="identical-decrease",
|
| 87 |
+
),
|
| 88 |
+
pytest.param(
|
| 89 |
+
"OOCCCN(CCC)C(=O)C1c2ccccc2Oc2ccccc21",
|
| 90 |
+
'("tanimoto", "OCCCN(CCC)C(=O)C1c2ccccc2Oc2ccccc21", -5.273194313049316, "decrease")', # noqa: E501
|
| 91 |
+
0.0,
|
| 92 |
+
id="unreasonable-molecule-failure",
|
| 93 |
+
),
|
| 94 |
+
pytest.param(
|
| 95 |
+
"CC(C)(C)Cc1nc(Br)c(S(C)(=O)=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1",
|
| 96 |
+
"('scaffold', 'c1ccc(-c2nn[nH]n2)c(-c2ccc(Cn3ccnc3)cc2)c1', '-7.790801048278809', 'decrease')", # noqa: E501
|
| 97 |
+
0.0,
|
| 98 |
+
id="eval-has-str-value",
|
| 99 |
+
),
|
| 100 |
+
],
|
| 101 |
+
)
|
| 102 |
+
def test_oracle_solubility_eval(
|
| 103 |
+
test_client: "TestClient", yhat: str, y: str, expected: float
|
| 104 |
+
) -> None:
|
| 105 |
+
expl: dict[str, JsonValue] = {}
|
| 106 |
+
with patch.object(httpx, "post", test_client.post):
|
| 107 |
+
result = oracle_solubility_eval(yhat, y, metadata=expl)
|
| 108 |
+
assert result == expected, f"Expected {expected}, got {result}. Explanation: {expl}"
|
pyproject.toml
ADDED
|
@@ -0,0 +1,546 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
[build-system]
|
| 2 |
+
build-backend = "setuptools.build_meta"
|
| 3 |
+
# SEE: https://github.com/pypa/setuptools_scm#pyprojecttoml-usage
|
| 4 |
+
requires = ["setuptools>=64", "setuptools_scm>=8"]
|
| 5 |
+
|
| 6 |
+
[dependency-groups]
|
| 7 |
+
dev = ["ether0.remotes[dev]", "ether0[dev]"]
|
| 8 |
+
|
| 9 |
+
[project]
|
| 10 |
+
authors = [
|
| 11 |
+
{email = "[email protected]", name = "FutureHouse technical staff"},
|
| 12 |
+
]
|
| 13 |
+
# Full list: https://pypi.python.org/pypi?%3Aaction=list_classifiers
|
| 14 |
+
classifiers = [
|
| 15 |
+
"Intended Audience :: Developers",
|
| 16 |
+
"License :: OSI Approved :: Apache Software License",
|
| 17 |
+
"Operating System :: OS Independent",
|
| 18 |
+
"Programming Language :: Python :: 3 :: Only",
|
| 19 |
+
"Programming Language :: Python :: 3.11",
|
| 20 |
+
"Programming Language :: Python :: 3.12",
|
| 21 |
+
"Programming Language :: Python :: 3.13",
|
| 22 |
+
"Programming Language :: Python",
|
| 23 |
+
"Topic :: Scientific/Engineering :: Artificial Intelligence",
|
| 24 |
+
"Topic :: Scientific/Engineering :: Chemistry",
|
| 25 |
+
]
|
| 26 |
+
dependencies = [
|
| 27 |
+
"accelerate>=1.10.1",
|
| 28 |
+
"datasets",
|
| 29 |
+
"exmol>=3.3.0", # to get fixed functional group names and py.typed
|
| 30 |
+
"gradio>=5.44.0",
|
| 31 |
+
"httpx",
|
| 32 |
+
"huggingface-hub",
|
| 33 |
+
"molbloom==2.3.4", # exact pin to be compatible with rings.bloom
|
| 34 |
+
"pydantic>=2", # Pin to keep recent
|
| 35 |
+
"rdkit",
|
| 36 |
+
"regex", # For unicode property \p
|
| 37 |
+
"spaces>=0.40.1",
|
| 38 |
+
"tenacity",
|
| 39 |
+
]
|
| 40 |
+
description = "Data models, rewards, and utility functions for ether0."
|
| 41 |
+
dynamic = [
|
| 42 |
+
"version", # Required for setuptools_scm
|
| 43 |
+
]
|
| 44 |
+
license = {file = "LICENSE"}
|
| 45 |
+
name = "ether0"
|
| 46 |
+
readme = "README.md"
|
| 47 |
+
requires-python = ">=3.11"
|
| 48 |
+
|
| 49 |
+
[project.optional-dependencies]
|
| 50 |
+
add-tokens = [
|
| 51 |
+
"ipykernel", # For Jupyter notebook support
|
| 52 |
+
"ipywidgets>=8", # For Jupyter notebook support, and pin to keep recent
|
| 53 |
+
"transformers>=4.49", # Pin to keep recent
|
| 54 |
+
]
|
| 55 |
+
baselines = [
|
| 56 |
+
"fhaviary>=0.19", # Pin for Python 3.13 compatibility
|
| 57 |
+
"fhlmi>=0.26", # Pin for Python 3.13 compatibility
|
| 58 |
+
"ipython",
|
| 59 |
+
]
|
| 60 |
+
dev = [
|
| 61 |
+
"ether0[add-tokens,typing]",
|
| 62 |
+
"huggingface-hub[cli]", # For login inside of CI
|
| 63 |
+
"ipython>=8", # Pin to keep recent
|
| 64 |
+
"mypy>=1.8", # For addition of mutable-override
|
| 65 |
+
"pre-commit>=3.4", # Pin to keep recent
|
| 66 |
+
"pylint>=3", # Pin to keep recent
|
| 67 |
+
"pytest",
|
| 68 |
+
"pytest-subtests",
|
| 69 |
+
"pytest-sugar",
|
| 70 |
+
"pytest-timer[colorama]",
|
| 71 |
+
"pytest-xdist",
|
| 72 |
+
"refurb>=2", # Pin to keep recent
|
| 73 |
+
"typeguard",
|
| 74 |
+
]
|
| 75 |
+
typing = [
|
| 76 |
+
"types-regex",
|
| 77 |
+
]
|
| 78 |
+
|
| 79 |
+
[project.urls]
|
| 80 |
+
issues = "https://github.com/Future-House/ether0/issues"
|
| 81 |
+
repository = "https://github.com/Future-House/ether0"
|
| 82 |
+
|
| 83 |
+
[tool.black]
|
| 84 |
+
enable-unstable-feature = [
|
| 85 |
+
"hug_parens_with_braces_and_square_brackets", # TODO: remove after https://github.com/psf/black/issues/4036 resolution
|
| 86 |
+
]
|
| 87 |
+
preview = true
|
| 88 |
+
|
| 89 |
+
[tool.codespell]
|
| 90 |
+
check-filenames = true
|
| 91 |
+
check-hidden = true
|
| 92 |
+
ignore-words-list = "amination,astroid,ser"
|
| 93 |
+
|
| 94 |
+
[tool.coverage]
|
| 95 |
+
|
| 96 |
+
[tool.coverage.report]
|
| 97 |
+
exclude_also = [
|
| 98 |
+
"@overload", # SEE: https://github.com/nedbat/coveragepy/issues/970
|
| 99 |
+
"if TYPE_CHECKING:",
|
| 100 |
+
]
|
| 101 |
+
# Number of digits after the decimal point to display for reported coverage percentages
|
| 102 |
+
precision = 2
|
| 103 |
+
|
| 104 |
+
[tool.coverage.run]
|
| 105 |
+
# Measure branch coverage
|
| 106 |
+
branch = true
|
| 107 |
+
# This will be used if you run `coverage run` with no further arguments
|
| 108 |
+
# This is designed to be invoked from within the test directory
|
| 109 |
+
command_line = "-m pytest"
|
| 110 |
+
|
| 111 |
+
[tool.markdownlint]
|
| 112 |
+
no-inline-html = false
|
| 113 |
+
|
| 114 |
+
[tool.markdownlint.line-length]
|
| 115 |
+
code_block_line_length = 88 # Match ruff line-length
|
| 116 |
+
line_length = 120 # Match ruff max-doc-length
|
| 117 |
+
stern = true
|
| 118 |
+
tables = false
|
| 119 |
+
|
| 120 |
+
[tool.mypy]
|
| 121 |
+
# Type-checks the interior of functions without type annotations.
|
| 122 |
+
check_untyped_defs = true
|
| 123 |
+
# Allows enabling one or multiple error codes globally. Note: This option will
|
| 124 |
+
# override disabled error codes from the disable_error_code option.
|
| 125 |
+
enable_error_code = [
|
| 126 |
+
"ignore-without-code",
|
| 127 |
+
"mutable-override",
|
| 128 |
+
"redundant-cast",
|
| 129 |
+
"redundant-expr",
|
| 130 |
+
"redundant-self",
|
| 131 |
+
"truthy-bool",
|
| 132 |
+
"truthy-iterable",
|
| 133 |
+
"unimported-reveal",
|
| 134 |
+
"unreachable",
|
| 135 |
+
"unused-awaitable",
|
| 136 |
+
"unused-ignore",
|
| 137 |
+
]
|
| 138 |
+
# Shows a short summary line after error messages.
|
| 139 |
+
error_summary = false
|
| 140 |
+
# A regular expression that matches file names, directory names and paths which mypy
|
| 141 |
+
# should ignore while recursively discovering files to check. Use forward slashes (/) as
|
| 142 |
+
# directory separators on all platforms.
|
| 143 |
+
exclude = [
|
| 144 |
+
"^\\.?venv", # SEE: https://regex101.com/r/0rp5Br/1
|
| 145 |
+
]
|
| 146 |
+
# This flag tells mypy that top-level packages will be based in either the current
|
| 147 |
+
# directory, or a member of the MYPYPATH environment variable or mypy_path config
|
| 148 |
+
# option. This option is only useful in the absence of __init__.py. See Mapping file
|
| 149 |
+
# paths to modules for details.
|
| 150 |
+
explicit_package_bases = true
|
| 151 |
+
# Specifies the paths to use, after trying the paths from MYPYPATH environment variable.
|
| 152 |
+
# Useful if you'd like to keep stubs in your repo, along with the config file.
|
| 153 |
+
# Multiple paths are always separated with a : or , regardless of the platform.
|
| 154 |
+
# User home directory and environment variables will be expanded.
|
| 155 |
+
mypy_path = "$MYPY_CONFIG_FILE_DIR/src,$MYPY_CONFIG_FILE_DIR/packages/remotes/src"
|
| 156 |
+
# Comma-separated list of mypy plugins.
|
| 157 |
+
plugins = ["pydantic.mypy"]
|
| 158 |
+
# Use visually nicer output in error messages: use soft word wrap, show source
|
| 159 |
+
# code snippets, and show error location markers.
|
| 160 |
+
pretty = true
|
| 161 |
+
# Shows column numbers in error messages.
|
| 162 |
+
show_column_numbers = true
|
| 163 |
+
# Shows error codes in error messages.
|
| 164 |
+
# SEE: https://mypy.readthedocs.io/en/stable/error_codes.html#error-codes
|
| 165 |
+
show_error_codes = true
|
| 166 |
+
# Prefixes each error with the relevant context.
|
| 167 |
+
show_error_context = true
|
| 168 |
+
# Warns about casting an expression to its inferred type.
|
| 169 |
+
warn_redundant_casts = true
|
| 170 |
+
# Shows a warning when encountering any code inferred to be unreachable or
|
| 171 |
+
# redundant after performing type analysis.
|
| 172 |
+
warn_unreachable = true
|
| 173 |
+
# Warns about per-module sections in the config file that do not match any
|
| 174 |
+
# files processed when invoking mypy.
|
| 175 |
+
warn_unused_configs = true
|
| 176 |
+
# Warns about unneeded `# type: ignore` comments.
|
| 177 |
+
warn_unused_ignores = true
|
| 178 |
+
|
| 179 |
+
[[tool.mypy.overrides]]
|
| 180 |
+
# Suppresses error messages about imports that cannot be resolved.
|
| 181 |
+
ignore_missing_imports = true
|
| 182 |
+
# Per-module configuration options
|
| 183 |
+
module = [
|
| 184 |
+
"datasets.*", # SEE: https://github.com/huggingface/datasets/issues/3841
|
| 185 |
+
"huggingface_hub.*", # SEE: https://github.com/huggingface/huggingface_hub/issues/1662
|
| 186 |
+
"molbloom", # SEE: https://github.com/whitead/molbloom/issues/29
|
| 187 |
+
"molsol", # SEE: https://github.com/maykcaldas/molsol/issues/6
|
| 188 |
+
"onmt.*",
|
| 189 |
+
"setuptools_scm", # SEE: https://github.com/pypa/setuptools_scm/issues/501
|
| 190 |
+
"transformers.*", # SEE: https://github.com/huggingface/transformers/pull/18485
|
| 191 |
+
]
|
| 192 |
+
|
| 193 |
+
[tool.pylint]
|
| 194 |
+
|
| 195 |
+
[tool.pylint.design]
|
| 196 |
+
# Maximum number of attributes for a class (see R0902).
|
| 197 |
+
max-attributes = 12
|
| 198 |
+
|
| 199 |
+
[tool.pylint.format]
|
| 200 |
+
# Maximum number of characters on a single line.
|
| 201 |
+
max-line-length = 97 # Match ruff line-length
|
| 202 |
+
|
| 203 |
+
[tool.pylint.main]
|
| 204 |
+
# Use multiple processes to speed up Pylint. Specifying 0 will auto-detect the
|
| 205 |
+
# number of processors available to use, and will cap the count on Windows to
|
| 206 |
+
# avoid hangs.
|
| 207 |
+
jobs = 0
|
| 208 |
+
|
| 209 |
+
[tool.pylint.messages_control]
|
| 210 |
+
# Disable the message, report, category or checker with the given id(s).
|
| 211 |
+
disable = [
|
| 212 |
+
"bare-except", # Rely on ruff E722 for this
|
| 213 |
+
"broad-exception-caught", # Rely on ruff BLE001 for this
|
| 214 |
+
"broad-exception-raised", # Rely on ruff TRY002 for this
|
| 215 |
+
"dangerous-default-value", # Rely on ruff W0102 for this
|
| 216 |
+
"empty-docstring", # Let pep257 take care of docstrings
|
| 217 |
+
"expression-not-assigned", # Rely on mypy func-returns-value for this
|
| 218 |
+
"fixme", # codetags are useful
|
| 219 |
+
"function-redefined", # Rely on mypy no-redef for this
|
| 220 |
+
"global-statement", # Rely on ruff PLW0603 for this
|
| 221 |
+
"global-variable-not-assigned", # Rely on ruff PLW0602 for this
|
| 222 |
+
"import-outside-toplevel", # Rely on ruff PLC0415 for this
|
| 223 |
+
"keyword-arg-before-vararg", # Rely on ruff B026 for this
|
| 224 |
+
"line-too-long", # Rely on ruff E501 for this
|
| 225 |
+
"logging-fstring-interpolation", # f-strings are convenient
|
| 226 |
+
"logging-too-many-args", # Rely on ruff PLE1205 for this
|
| 227 |
+
"missing-docstring", # Let docformatter and ruff take care of docstrings
|
| 228 |
+
"missing-final-newline", # Rely on ruff W292 for this
|
| 229 |
+
"no-else-return", # Rely on ruff RET506 for this
|
| 230 |
+
"no-member", # Buggy, SEE: https://github.com/pylint-dev/pylint/issues/8138
|
| 231 |
+
"no-value-for-parameter", # Rely on mypy call-arg for this
|
| 232 |
+
"protected-access", # Don't care to enforce this in testing
|
| 233 |
+
"raise-missing-from", # Rely on ruff B904 for this
|
| 234 |
+
"redefined-builtin", # Rely on ruff A002 for this
|
| 235 |
+
"too-few-public-methods", # Don't care to enforce this
|
| 236 |
+
"too-many-arguments", # Don't care to enforce this
|
| 237 |
+
"too-many-boolean-expressions", # Rely on ruff PLR0916 for this
|
| 238 |
+
"too-many-branches", # Rely on ruff PLR0912 for this
|
| 239 |
+
"too-many-locals", # Rely on ruff PLR0914 for this
|
| 240 |
+
"too-many-positional-arguments", # Rely on ruff PLR0917 for this
|
| 241 |
+
"too-many-public-methods", # Rely on ruff PLR0904 for this
|
| 242 |
+
"too-many-return-statements", # Rely on ruff PLR0911 for this
|
| 243 |
+
"too-many-statements", # Rely on ruff PLR0915 for this
|
| 244 |
+
"ungrouped-imports", # Rely on ruff I001 for this
|
| 245 |
+
"unidiomatic-typecheck", # Rely on ruff E721 for this
|
| 246 |
+
"unnecessary-dict-index-lookup", # Rely on ruff PLR1733 for this
|
| 247 |
+
"unreachable", # Rely on mypy unreachable for this
|
| 248 |
+
"unspecified-encoding", # Rely on ruff PLW1514 for this
|
| 249 |
+
"unsubscriptable-object", # Buggy, SEE: https://github.com/pylint-dev/pylint/issues/3637
|
| 250 |
+
"unsupported-membership-test", # Buggy, SEE: https://github.com/pylint-dev/pylint/issues/3045
|
| 251 |
+
"unused-argument", # Rely on ruff ARG002 for this
|
| 252 |
+
"unused-import", # Rely on ruff F401 for this
|
| 253 |
+
"unused-variable", # Rely on ruff F841 for this
|
| 254 |
+
"unused-wildcard-import", # Wildcard imports are convenient
|
| 255 |
+
"use-sequence-for-iteration", # Rely on ruff C0208 for this
|
| 256 |
+
"wildcard-import", # Wildcard imports are convenient
|
| 257 |
+
"wrong-import-order", # Rely on ruff I001 for this
|
| 258 |
+
"wrong-import-position", # Rely on ruff E402 for this
|
| 259 |
+
]
|
| 260 |
+
# Enable the message, report, category or checker with the given id(s).
|
| 261 |
+
enable = [
|
| 262 |
+
"useless-suppression", # Print unused `pylint: disable` comments
|
| 263 |
+
]
|
| 264 |
+
|
| 265 |
+
[tool.pylint.reports]
|
| 266 |
+
# Set true to activate the evaluation score.
|
| 267 |
+
score = false
|
| 268 |
+
|
| 269 |
+
[tool.pylint.similarities]
|
| 270 |
+
# Minimum lines number of a similarity.
|
| 271 |
+
min-similarity-lines = 10
|
| 272 |
+
|
| 273 |
+
[tool.pytest.ini_options]
|
| 274 |
+
# Add the specified `OPTS` to the set of command line arguments as if they had
|
| 275 |
+
# been specified by the user.
|
| 276 |
+
addopts = "--typeguard-packages=ether0 --doctest-modules"
|
| 277 |
+
# List of directories that should be searched for tests when no specific directories,
|
| 278 |
+
# files or test ids are given in the command line when executing pytest from the rootdir
|
| 279 |
+
# directory. File system paths may use shell-style wildcards, including the recursive **
|
| 280 |
+
# pattern.
|
| 281 |
+
testpaths = ["packages/remotes", "src", "tests"]
|
| 282 |
+
|
| 283 |
+
[tool.refurb]
|
| 284 |
+
enable_all = true
|
| 285 |
+
ignore = [
|
| 286 |
+
"FURB101", # Rely on ruff FURB101 for this
|
| 287 |
+
"FURB103", # Rely on ruff FURB103 for this
|
| 288 |
+
"FURB141", # Rely on ruff PTH110 for this
|
| 289 |
+
"FURB144", # Rely on ruff PTH107 for this
|
| 290 |
+
"FURB146", # Rely on ruff PTH113 for this
|
| 291 |
+
"FURB147", # Rely on ruff PTH118 for this
|
| 292 |
+
"FURB150", # Rely on ruff PTH102 for this
|
| 293 |
+
"FURB155", # Rely on ruff PTH202 for this
|
| 294 |
+
]
|
| 295 |
+
|
| 296 |
+
[tool.ruff]
|
| 297 |
+
# Line length to use when enforcing long-lines violations (like `E501`).
|
| 298 |
+
line-length = 97 # ceil(1.1 * 88) makes `E501` equivalent to `B950`
|
| 299 |
+
# Enable application of unsafe fixes.
|
| 300 |
+
unsafe-fixes = true
|
| 301 |
+
|
| 302 |
+
[tool.ruff.format]
|
| 303 |
+
# Enable reformatting of code snippets in docstrings.
|
| 304 |
+
docstring-code-format = true
|
| 305 |
+
# Enable preview style formatting.
|
| 306 |
+
preview = true
|
| 307 |
+
|
| 308 |
+
[tool.ruff.lint]
|
| 309 |
+
explicit-preview-rules = true
|
| 310 |
+
extend-select = [
|
| 311 |
+
"AIR002",
|
| 312 |
+
"AIR301",
|
| 313 |
+
"AIR302",
|
| 314 |
+
"AIR311",
|
| 315 |
+
"AIR312",
|
| 316 |
+
"ASYNC116",
|
| 317 |
+
"B901",
|
| 318 |
+
"B903",
|
| 319 |
+
"B909",
|
| 320 |
+
"CPY001",
|
| 321 |
+
"DOC201",
|
| 322 |
+
"DOC202",
|
| 323 |
+
"DOC402",
|
| 324 |
+
"DOC403",
|
| 325 |
+
"DOC501",
|
| 326 |
+
"DOC502",
|
| 327 |
+
"E111",
|
| 328 |
+
"E112",
|
| 329 |
+
"E113",
|
| 330 |
+
"E114",
|
| 331 |
+
"E115",
|
| 332 |
+
"E116",
|
| 333 |
+
"E117",
|
| 334 |
+
"E201",
|
| 335 |
+
"E202",
|
| 336 |
+
"E203",
|
| 337 |
+
"E204",
|
| 338 |
+
"E211",
|
| 339 |
+
"E221",
|
| 340 |
+
"E222",
|
| 341 |
+
"E223",
|
| 342 |
+
"E224",
|
| 343 |
+
"E225",
|
| 344 |
+
"E226",
|
| 345 |
+
"E227",
|
| 346 |
+
"E228",
|
| 347 |
+
"E231",
|
| 348 |
+
"E241",
|
| 349 |
+
"E242",
|
| 350 |
+
"E251",
|
| 351 |
+
"E252",
|
| 352 |
+
"E261",
|
| 353 |
+
"E262",
|
| 354 |
+
"E265",
|
| 355 |
+
"E266",
|
| 356 |
+
"E271",
|
| 357 |
+
"E272",
|
| 358 |
+
"E273",
|
| 359 |
+
"E274",
|
| 360 |
+
"E275",
|
| 361 |
+
"E301",
|
| 362 |
+
"E302",
|
| 363 |
+
"E303",
|
| 364 |
+
"E304",
|
| 365 |
+
"E305",
|
| 366 |
+
"E306",
|
| 367 |
+
"E502",
|
| 368 |
+
"FURB101",
|
| 369 |
+
"FURB103",
|
| 370 |
+
"FURB110",
|
| 371 |
+
"FURB113",
|
| 372 |
+
"FURB116",
|
| 373 |
+
"FURB118",
|
| 374 |
+
"FURB122",
|
| 375 |
+
"FURB131",
|
| 376 |
+
"FURB132",
|
| 377 |
+
"FURB140",
|
| 378 |
+
"FURB142",
|
| 379 |
+
"FURB145",
|
| 380 |
+
"FURB148",
|
| 381 |
+
"FURB152",
|
| 382 |
+
"FURB154",
|
| 383 |
+
"FURB156",
|
| 384 |
+
"FURB157",
|
| 385 |
+
"FURB162",
|
| 386 |
+
"FURB164",
|
| 387 |
+
"FURB166",
|
| 388 |
+
"FURB171",
|
| 389 |
+
"FURB180",
|
| 390 |
+
"FURB189",
|
| 391 |
+
"FURB192",
|
| 392 |
+
"LOG004",
|
| 393 |
+
"LOG014",
|
| 394 |
+
"PLC0415",
|
| 395 |
+
"PLC1901",
|
| 396 |
+
"PLC2701",
|
| 397 |
+
"PLC2801",
|
| 398 |
+
"PLE0304",
|
| 399 |
+
"PLE1141",
|
| 400 |
+
"PLE4703",
|
| 401 |
+
"PLR0202",
|
| 402 |
+
"PLR0203",
|
| 403 |
+
"PLR0904",
|
| 404 |
+
"PLR0914",
|
| 405 |
+
"PLR0916",
|
| 406 |
+
"PLR0917",
|
| 407 |
+
"PLR1702",
|
| 408 |
+
"PLR1733",
|
| 409 |
+
"PLR6104",
|
| 410 |
+
"PLR6201",
|
| 411 |
+
"PLR6301",
|
| 412 |
+
"PLW0108",
|
| 413 |
+
"PLW0177",
|
| 414 |
+
"PLW0244",
|
| 415 |
+
"PLW1514",
|
| 416 |
+
"PLW1641",
|
| 417 |
+
"PLW3201",
|
| 418 |
+
"PT028",
|
| 419 |
+
"PT029",
|
| 420 |
+
"PT030",
|
| 421 |
+
"PT031",
|
| 422 |
+
"PYI059",
|
| 423 |
+
"PYI061",
|
| 424 |
+
"RUF027",
|
| 425 |
+
"RUF028",
|
| 426 |
+
"RUF029",
|
| 427 |
+
"RUF031",
|
| 428 |
+
"RUF036",
|
| 429 |
+
"RUF037",
|
| 430 |
+
"RUF038",
|
| 431 |
+
"RUF039",
|
| 432 |
+
"RUF043",
|
| 433 |
+
"RUF045",
|
| 434 |
+
"RUF047",
|
| 435 |
+
"RUF049",
|
| 436 |
+
"RUF052",
|
| 437 |
+
"RUF053",
|
| 438 |
+
"RUF054",
|
| 439 |
+
"RUF055",
|
| 440 |
+
"RUF056",
|
| 441 |
+
"RUF057",
|
| 442 |
+
"RUF058",
|
| 443 |
+
"RUF059",
|
| 444 |
+
"RUF102",
|
| 445 |
+
"TC008",
|
| 446 |
+
"UP042",
|
| 447 |
+
"UP045",
|
| 448 |
+
"UP046",
|
| 449 |
+
"UP047",
|
| 450 |
+
"UP049",
|
| 451 |
+
"W391",
|
| 452 |
+
]
|
| 453 |
+
external = [
|
| 454 |
+
"FURB", # refurb
|
| 455 |
+
]
|
| 456 |
+
ignore = [
|
| 457 |
+
"ANN", # Don't care to enforce typing
|
| 458 |
+
"BLE001", # Don't care to enforce blind exception catching
|
| 459 |
+
"C901", # Don't care to limit complexity
|
| 460 |
+
"COM812", # Trailing comma with black leads to wasting lines
|
| 461 |
+
"CPY001", # Don't care to require copyright notices in every file
|
| 462 |
+
"D100", # D100, D101, D102, D103, D104, D105, D106, D107: don't always need docstrings
|
| 463 |
+
"D101",
|
| 464 |
+
"D102",
|
| 465 |
+
"D103",
|
| 466 |
+
"D104",
|
| 467 |
+
"D105",
|
| 468 |
+
"D106",
|
| 469 |
+
"D107",
|
| 470 |
+
"D203", # Keep docstring next to the class definition (covered by D211)
|
| 471 |
+
"D212", # Summary should be on second line (opposite of D213)
|
| 472 |
+
"D402", # It's nice to reuse the method name
|
| 473 |
+
"D406", # Google style requires ":" at end
|
| 474 |
+
"D407", # We aren't using numpy style
|
| 475 |
+
"D413", # Blank line after last section. -> No blank line
|
| 476 |
+
"DOC201", # Don't care to require Returns in docstrings
|
| 477 |
+
"DOC402", # Don't care to require Yields in docstrings
|
| 478 |
+
"DOC501", # Don't care to require Raises in docstrings
|
| 479 |
+
"DTZ", # Don't care to have timezone safety
|
| 480 |
+
"EM", # Overly pedantic
|
| 481 |
+
"FBT001", # FBT001, FBT002: overly pedantic
|
| 482 |
+
"FBT002",
|
| 483 |
+
"FIX", # Don't care to prevent TODO, FIXME, etc.
|
| 484 |
+
"G004", # f-strings are convenient
|
| 485 |
+
"INP001", # Can use namespace packages
|
| 486 |
+
"ISC001", # For ruff format compatibility
|
| 487 |
+
"PLR0911", # Don't care to limit complexity
|
| 488 |
+
"PLR0912", # Don't care to limit complexity
|
| 489 |
+
"PLR0913", # Don't care to limit complexity
|
| 490 |
+
"PLR0917", # Don't care to limit complexity
|
| 491 |
+
"PTH", # Overly pedantic
|
| 492 |
+
"SLF001", # Overly pedantic
|
| 493 |
+
"T201", # Overly pedantic
|
| 494 |
+
"TC001", # TC001, TC002, TC003: don't care to enforce type checking blocks
|
| 495 |
+
"TC002",
|
| 496 |
+
"TC003",
|
| 497 |
+
"TC006", # Strings in cast don't work with PyCharm CE 2024.3.4's jump-to-definition
|
| 498 |
+
"TD002", # Don't care for TODO author
|
| 499 |
+
"TD003", # Don't care for TODO links
|
| 500 |
+
"TRY003", # Overly pedantic
|
| 501 |
+
]
|
| 502 |
+
preview = true
|
| 503 |
+
select = ["ALL"]
|
| 504 |
+
unfixable = [
|
| 505 |
+
"B007", # While debugging, unused loop variables can be useful
|
| 506 |
+
"B905", # Default fix is zip(strict=False), but that can hide bugs
|
| 507 |
+
"ERA001", # While debugging, temporarily commenting code can be useful
|
| 508 |
+
"F401", # While debugging, unused imports can be useful
|
| 509 |
+
"F841", # While debugging, unused locals can be useful
|
| 510 |
+
"TC004", # While debugging, it can be nice to keep TYPE_CHECKING in-tact
|
| 511 |
+
]
|
| 512 |
+
|
| 513 |
+
[tool.ruff.lint.flake8-annotations]
|
| 514 |
+
mypy-init-return = true
|
| 515 |
+
|
| 516 |
+
[tool.ruff.lint.per-file-ignores]
|
| 517 |
+
"**/tests/*.py" = [
|
| 518 |
+
"N802", # Tests function names can match class names
|
| 519 |
+
"PLR2004", # Tests can have magic values
|
| 520 |
+
"PLR6301", # Test classes can ignore self
|
| 521 |
+
"S101", # Tests can have assertions
|
| 522 |
+
]
|
| 523 |
+
|
| 524 |
+
[tool.ruff.lint.pycodestyle]
|
| 525 |
+
# The maximum line length to allow for line-length violations within
|
| 526 |
+
# documentation (W505), including standalone comments.
|
| 527 |
+
max-doc-length = 97 # Match line-length
|
| 528 |
+
|
| 529 |
+
[tool.ruff.lint.pydocstyle]
|
| 530 |
+
# Whether to use Google-style or NumPy-style conventions or the PEP257
|
| 531 |
+
# defaults when analyzing docstring sections.
|
| 532 |
+
convention = "google"
|
| 533 |
+
|
| 534 |
+
[tool.tomlsort]
|
| 535 |
+
all = true
|
| 536 |
+
in_place = true
|
| 537 |
+
spaces_before_inline_comment = 2 # Match Python PEP 8
|
| 538 |
+
spaces_indent_inline_array = 4 # Match Python PEP 8
|
| 539 |
+
trailing_comma_inline_array = true
|
| 540 |
+
|
| 541 |
+
[tool.uv.sources]
|
| 542 |
+
ether0 = {workspace = true}
|
| 543 |
+
"ether0.remotes" = {workspace = true}
|
| 544 |
+
|
| 545 |
+
[tool.uv.workspace]
|
| 546 |
+
members = ["packages/*"]
|
src/.DS_Store
ADDED
|
Binary file (6.15 kB). View file
|
|
|
src/ether0.egg-info/PKG-INFO
ADDED
|
@@ -0,0 +1,467 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
Metadata-Version: 2.4
|
| 2 |
+
Name: ether0
|
| 3 |
+
Version: 0.0.0
|
| 4 |
+
Summary: Data models, rewards, and utility functions for ether0.
|
| 5 |
+
Author-email: FutureHouse technical staff <[email protected]>
|
| 6 |
+
License: Apache License
|
| 7 |
+
Version 2.0, January 2004
|
| 8 |
+
http://www.apache.org/licenses/
|
| 9 |
+
|
| 10 |
+
TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
|
| 11 |
+
|
| 12 |
+
1. Definitions.
|
| 13 |
+
|
| 14 |
+
"License" shall mean the terms and conditions for use, reproduction,
|
| 15 |
+
and distribution as defined by Sections 1 through 9 of this document.
|
| 16 |
+
|
| 17 |
+
"Licensor" shall mean the copyright owner or entity authorized by
|
| 18 |
+
the copyright owner that is granting the License.
|
| 19 |
+
|
| 20 |
+
"Legal Entity" shall mean the union of the acting entity and all
|
| 21 |
+
other entities that control, are controlled by, or are under common
|
| 22 |
+
control with that entity. For the purposes of this definition,
|
| 23 |
+
"control" means (i) the power, direct or indirect, to cause the
|
| 24 |
+
direction or management of such entity, whether by contract or
|
| 25 |
+
otherwise, or (ii) ownership of fifty percent (50%) or more of the
|
| 26 |
+
outstanding shares, or (iii) beneficial ownership of such entity.
|
| 27 |
+
|
| 28 |
+
"You" (or "Your") shall mean an individual or Legal Entity
|
| 29 |
+
exercising permissions granted by this License.
|
| 30 |
+
|
| 31 |
+
"Source" form shall mean the preferred form for making modifications,
|
| 32 |
+
including but not limited to software source code, documentation
|
| 33 |
+
source, and configuration files.
|
| 34 |
+
|
| 35 |
+
"Object" form shall mean any form resulting from mechanical
|
| 36 |
+
transformation or translation of a Source form, including but
|
| 37 |
+
not limited to compiled object code, generated documentation,
|
| 38 |
+
and conversions to other media types.
|
| 39 |
+
|
| 40 |
+
"Work" shall mean the work of authorship, whether in Source or
|
| 41 |
+
Object form, made available under the License, as indicated by a
|
| 42 |
+
copyright notice that is included in or attached to the work
|
| 43 |
+
(an example is provided in the Appendix below).
|
| 44 |
+
|
| 45 |
+
"Derivative Works" shall mean any work, whether in Source or Object
|
| 46 |
+
form, that is based on (or derived from) the Work and for which the
|
| 47 |
+
editorial revisions, annotations, elaborations, or other modifications
|
| 48 |
+
represent, as a whole, an original work of authorship. For the purposes
|
| 49 |
+
of this License, Derivative Works shall not include works that remain
|
| 50 |
+
separable from, or merely link (or bind by name) to the interfaces of,
|
| 51 |
+
the Work and Derivative Works thereof.
|
| 52 |
+
|
| 53 |
+
"Contribution" shall mean any work of authorship, including
|
| 54 |
+
the original version of the Work and any modifications or additions
|
| 55 |
+
to that Work or Derivative Works thereof, that is intentionally
|
| 56 |
+
submitted to Licensor for inclusion in the Work by the copyright owner
|
| 57 |
+
or by an individual or Legal Entity authorized to submit on behalf of
|
| 58 |
+
the copyright owner. For the purposes of this definition, "submitted"
|
| 59 |
+
means any form of electronic, verbal, or written communication sent
|
| 60 |
+
to the Licensor or its representatives, including but not limited to
|
| 61 |
+
communication on electronic mailing lists, source code control systems,
|
| 62 |
+
and issue tracking systems that are managed by, or on behalf of, the
|
| 63 |
+
Licensor for the purpose of discussing and improving the Work, but
|
| 64 |
+
excluding communication that is conspicuously marked or otherwise
|
| 65 |
+
designated in writing by the copyright owner as "Not a Contribution."
|
| 66 |
+
|
| 67 |
+
"Contributor" shall mean Licensor and any individual or Legal Entity
|
| 68 |
+
on behalf of whom a Contribution has been received by Licensor and
|
| 69 |
+
subsequently incorporated within the Work.
|
| 70 |
+
|
| 71 |
+
2. Grant of Copyright License. Subject to the terms and conditions of
|
| 72 |
+
this License, each Contributor hereby grants to You a perpetual,
|
| 73 |
+
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
| 74 |
+
copyright license to reproduce, prepare Derivative Works of,
|
| 75 |
+
publicly display, publicly perform, sublicense, and distribute the
|
| 76 |
+
Work and such Derivative Works in Source or Object form.
|
| 77 |
+
|
| 78 |
+
3. Grant of Patent License. Subject to the terms and conditions of
|
| 79 |
+
this License, each Contributor hereby grants to You a perpetual,
|
| 80 |
+
worldwide, non-exclusive, no-charge, royalty-free, irrevocable
|
| 81 |
+
(except as stated in this section) patent license to make, have made,
|
| 82 |
+
use, offer to sell, sell, import, and otherwise transfer the Work,
|
| 83 |
+
where such license applies only to those patent claims licensable
|
| 84 |
+
by such Contributor that are necessarily infringed by their
|
| 85 |
+
Contribution(s) alone or by combination of their Contribution(s)
|
| 86 |
+
with the Work to which such Contribution(s) was submitted. If You
|
| 87 |
+
institute patent litigation against any entity (including a
|
| 88 |
+
cross-claim or counterclaim in a lawsuit) alleging that the Work
|
| 89 |
+
or a Contribution incorporated within the Work constitutes direct
|
| 90 |
+
or contributory patent infringement, then any patent licenses
|
| 91 |
+
granted to You under this License for that Work shall terminate
|
| 92 |
+
as of the date such litigation is filed.
|
| 93 |
+
|
| 94 |
+
4. Redistribution. You may reproduce and distribute copies of the
|
| 95 |
+
Work or Derivative Works thereof in any medium, with or without
|
| 96 |
+
modifications, and in Source or Object form, provided that You
|
| 97 |
+
meet the following conditions:
|
| 98 |
+
|
| 99 |
+
(a) You must give any other recipients of the Work or
|
| 100 |
+
Derivative Works a copy of this License; and
|
| 101 |
+
|
| 102 |
+
(b) You must cause any modified files to carry prominent notices
|
| 103 |
+
stating that You changed the files; and
|
| 104 |
+
|
| 105 |
+
(c) You must retain, in the Source form of any Derivative Works
|
| 106 |
+
that You distribute, all copyright, patent, trademark, and
|
| 107 |
+
attribution notices from the Source form of the Work,
|
| 108 |
+
excluding those notices that do not pertain to any part of
|
| 109 |
+
the Derivative Works; and
|
| 110 |
+
|
| 111 |
+
(d) If the Work includes a "NOTICE" text file as part of its
|
| 112 |
+
distribution, then any Derivative Works that You distribute must
|
| 113 |
+
include a readable copy of the attribution notices contained
|
| 114 |
+
within such NOTICE file, excluding those notices that do not
|
| 115 |
+
pertain to any part of the Derivative Works, in at least one
|
| 116 |
+
of the following places: within a NOTICE text file distributed
|
| 117 |
+
as part of the Derivative Works; within the Source form or
|
| 118 |
+
documentation, if provided along with the Derivative Works; or,
|
| 119 |
+
within a display generated by the Derivative Works, if and
|
| 120 |
+
wherever such third-party notices normally appear. The contents
|
| 121 |
+
of the NOTICE file are for informational purposes only and
|
| 122 |
+
do not modify the License. You may add Your own attribution
|
| 123 |
+
notices within Derivative Works that You distribute, alongside
|
| 124 |
+
or as an addendum to the NOTICE text from the Work, provided
|
| 125 |
+
that such additional attribution notices cannot be construed
|
| 126 |
+
as modifying the License.
|
| 127 |
+
|
| 128 |
+
You may add Your own copyright statement to Your modifications and
|
| 129 |
+
may provide additional or different license terms and conditions
|
| 130 |
+
for use, reproduction, or distribution of Your modifications, or
|
| 131 |
+
for any such Derivative Works as a whole, provided Your use,
|
| 132 |
+
reproduction, and distribution of the Work otherwise complies with
|
| 133 |
+
the conditions stated in this License.
|
| 134 |
+
|
| 135 |
+
5. Submission of Contributions. Unless You explicitly state otherwise,
|
| 136 |
+
any Contribution intentionally submitted for inclusion in the Work
|
| 137 |
+
by You to the Licensor shall be under the terms and conditions of
|
| 138 |
+
this License, without any additional terms or conditions.
|
| 139 |
+
Notwithstanding the above, nothing herein shall supersede or modify
|
| 140 |
+
the terms of any separate license agreement you may have executed
|
| 141 |
+
with Licensor regarding such Contributions.
|
| 142 |
+
|
| 143 |
+
6. Trademarks. This License does not grant permission to use the trade
|
| 144 |
+
names, trademarks, service marks, or product names of the Licensor,
|
| 145 |
+
except as required for reasonable and customary use in describing the
|
| 146 |
+
origin of the Work and reproducing the content of the NOTICE file.
|
| 147 |
+
|
| 148 |
+
7. Disclaimer of Warranty. Unless required by applicable law or
|
| 149 |
+
agreed to in writing, Licensor provides the Work (and each
|
| 150 |
+
Contributor provides its Contributions) on an "AS IS" BASIS,
|
| 151 |
+
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
|
| 152 |
+
implied, including, without limitation, any warranties or conditions
|
| 153 |
+
of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
|
| 154 |
+
PARTICULAR PURPOSE. You are solely responsible for determining the
|
| 155 |
+
appropriateness of using or redistributing the Work and assume any
|
| 156 |
+
risks associated with Your exercise of permissions under this License.
|
| 157 |
+
|
| 158 |
+
8. Limitation of Liability. In no event and under no legal theory,
|
| 159 |
+
whether in tort (including negligence), contract, or otherwise,
|
| 160 |
+
unless required by applicable law (such as deliberate and grossly
|
| 161 |
+
negligent acts) or agreed to in writing, shall any Contributor be
|
| 162 |
+
liable to You for damages, including any direct, indirect, special,
|
| 163 |
+
incidental, or consequential damages of any character arising as a
|
| 164 |
+
result of this License or out of the use or inability to use the
|
| 165 |
+
Work (including but not limited to damages for loss of goodwill,
|
| 166 |
+
work stoppage, computer failure or malfunction, or any and all
|
| 167 |
+
other commercial damages or losses), even if such Contributor
|
| 168 |
+
has been advised of the possibility of such damages.
|
| 169 |
+
|
| 170 |
+
9. Accepting Warranty or Additional Liability. While redistributing
|
| 171 |
+
the Work or Derivative Works thereof, You may choose to offer,
|
| 172 |
+
and charge a fee for, acceptance of support, warranty, indemnity,
|
| 173 |
+
or other liability obligations and/or rights consistent with this
|
| 174 |
+
License. However, in accepting such obligations, You may act only
|
| 175 |
+
on Your own behalf and on Your sole responsibility, not on behalf
|
| 176 |
+
of any other Contributor, and only if You agree to indemnify,
|
| 177 |
+
defend, and hold each Contributor harmless for any liability
|
| 178 |
+
incurred by, or claims asserted against, such Contributor by reason
|
| 179 |
+
of your accepting any such warranty or additional liability.
|
| 180 |
+
|
| 181 |
+
END OF TERMS AND CONDITIONS
|
| 182 |
+
|
| 183 |
+
APPENDIX: How to apply the Apache License to your work.
|
| 184 |
+
|
| 185 |
+
To apply the Apache License to your work, attach the following
|
| 186 |
+
boilerplate notice, with the fields enclosed by brackets "[]"
|
| 187 |
+
replaced with your own identifying information. (Don't include
|
| 188 |
+
the brackets!) The text should be enclosed in the appropriate
|
| 189 |
+
comment syntax for the file format. We also recommend that a
|
| 190 |
+
file or class name and description of purpose be included on the
|
| 191 |
+
same "printed page" as the copyright notice for easier
|
| 192 |
+
identification within third-party archives.
|
| 193 |
+
|
| 194 |
+
Copyright 2025 FutureHouse
|
| 195 |
+
|
| 196 |
+
Licensed under the Apache License, Version 2.0 (the "License");
|
| 197 |
+
you may not use this file except in compliance with the License.
|
| 198 |
+
You may obtain a copy of the License at
|
| 199 |
+
|
| 200 |
+
http://www.apache.org/licenses/LICENSE-2.0
|
| 201 |
+
|
| 202 |
+
Unless required by applicable law or agreed to in writing, software
|
| 203 |
+
distributed under the License is distributed on an "AS IS" BASIS,
|
| 204 |
+
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 205 |
+
See the License for the specific language governing permissions and
|
| 206 |
+
limitations under the License.
|
| 207 |
+
|
| 208 |
+
Project-URL: issues, https://github.com/Future-House/ether0/issues
|
| 209 |
+
Project-URL: repository, https://github.com/Future-House/ether0
|
| 210 |
+
Classifier: Intended Audience :: Developers
|
| 211 |
+
Classifier: License :: OSI Approved :: Apache Software License
|
| 212 |
+
Classifier: Operating System :: OS Independent
|
| 213 |
+
Classifier: Programming Language :: Python :: 3 :: Only
|
| 214 |
+
Classifier: Programming Language :: Python :: 3.11
|
| 215 |
+
Classifier: Programming Language :: Python :: 3.12
|
| 216 |
+
Classifier: Programming Language :: Python :: 3.13
|
| 217 |
+
Classifier: Programming Language :: Python
|
| 218 |
+
Classifier: Topic :: Scientific/Engineering :: Artificial Intelligence
|
| 219 |
+
Classifier: Topic :: Scientific/Engineering :: Chemistry
|
| 220 |
+
Requires-Python: >=3.11
|
| 221 |
+
Description-Content-Type: text/markdown
|
| 222 |
+
License-File: LICENSE
|
| 223 |
+
Requires-Dist: accelerate>=1.10.1
|
| 224 |
+
Requires-Dist: datasets
|
| 225 |
+
Requires-Dist: exmol>=3.3.0
|
| 226 |
+
Requires-Dist: gradio>=5.44.0
|
| 227 |
+
Requires-Dist: httpx
|
| 228 |
+
Requires-Dist: huggingface-hub
|
| 229 |
+
Requires-Dist: molbloom==2.3.4
|
| 230 |
+
Requires-Dist: pydantic>=2
|
| 231 |
+
Requires-Dist: rdkit
|
| 232 |
+
Requires-Dist: regex
|
| 233 |
+
Requires-Dist: spaces>=0.40.1
|
| 234 |
+
Requires-Dist: tenacity
|
| 235 |
+
Provides-Extra: add-tokens
|
| 236 |
+
Requires-Dist: ipykernel; extra == "add-tokens"
|
| 237 |
+
Requires-Dist: ipywidgets>=8; extra == "add-tokens"
|
| 238 |
+
Requires-Dist: transformers>=4.49; extra == "add-tokens"
|
| 239 |
+
Provides-Extra: baselines
|
| 240 |
+
Requires-Dist: fhaviary>=0.19; extra == "baselines"
|
| 241 |
+
Requires-Dist: fhlmi>=0.26; extra == "baselines"
|
| 242 |
+
Requires-Dist: ipython; extra == "baselines"
|
| 243 |
+
Provides-Extra: dev
|
| 244 |
+
Requires-Dist: ether0[add-tokens,typing]; extra == "dev"
|
| 245 |
+
Requires-Dist: huggingface-hub[cli]; extra == "dev"
|
| 246 |
+
Requires-Dist: ipython>=8; extra == "dev"
|
| 247 |
+
Requires-Dist: mypy>=1.8; extra == "dev"
|
| 248 |
+
Requires-Dist: pre-commit>=3.4; extra == "dev"
|
| 249 |
+
Requires-Dist: pylint>=3; extra == "dev"
|
| 250 |
+
Requires-Dist: pytest; extra == "dev"
|
| 251 |
+
Requires-Dist: pytest-subtests; extra == "dev"
|
| 252 |
+
Requires-Dist: pytest-sugar; extra == "dev"
|
| 253 |
+
Requires-Dist: pytest-timer[colorama]; extra == "dev"
|
| 254 |
+
Requires-Dist: pytest-xdist; extra == "dev"
|
| 255 |
+
Requires-Dist: refurb>=2; extra == "dev"
|
| 256 |
+
Requires-Dist: typeguard; extra == "dev"
|
| 257 |
+
Provides-Extra: typing
|
| 258 |
+
Requires-Dist: types-regex; extra == "typing"
|
| 259 |
+
Dynamic: license-file
|
| 260 |
+
|
| 261 |
+
# ether0 Reward Model
|
| 262 |
+
|
| 263 |
+
[](https://github.com/Future-House/ether0)
|
| 264 |
+
[](https://arxiv.org/abs/2506.17238)
|
| 265 |
+
[](https://www.repostatus.org/#active)
|
| 266 |
+

|
| 267 |
+
|
| 268 |
+
[](https://github.com/Future-House/ether0/actions)
|
| 269 |
+
[](https://github.com/psf/black)
|
| 270 |
+
[](https://www.python.org)
|
| 271 |
+
[](https://huggingface.co/futurehouse/ether0)
|
| 272 |
+
[](https://huggingface.co/datasets/futurehouse/ether0-benchmark)
|
| 273 |
+
|
| 274 |
+

|
| 275 |
+
|
| 276 |
+
_ether0: a scientific reasoning model, dataset, and reward functions for chemistry._
|
| 277 |
+
|
| 278 |
+
This repo contains the reward model for evaluating ether0 and similar models,
|
| 279 |
+
along with utilities for working with the verifiable rewards in
|
| 280 |
+
[our benchmark](https://huggingface.co/datasets/futurehouse/ether0-benchmark).
|
| 281 |
+
|
| 282 |
+
## Overview
|
| 283 |
+
|
| 284 |
+
ether0 is a reasoning language model post-trained through a loop of:
|
| 285 |
+
|
| 286 |
+
1. Supervised fine-tuning (SFT) on long chain-of-thought reasoning traces,
|
| 287 |
+
to elicit reasoning from a base model.
|
| 288 |
+
2. Reinforcement learning with verifiable rewards (RLVR)
|
| 289 |
+
to improve reasoning on focused task groups, at their own pace.
|
| 290 |
+
These multitask learned models are referred to as 'specialists'.
|
| 291 |
+
3. Rejection sampling to filter specialists' reasoning
|
| 292 |
+
for correctness and quality.
|
| 293 |
+
4. SFT on the base model again to make a 'generalist' reasoning model.
|
| 294 |
+
5. RLVR to recover any lost performance and push further in an all-task setting.
|
| 295 |
+
|
| 296 |
+

|
| 297 |
+
|
| 298 |
+
### Repo Structure
|
| 299 |
+
|
| 300 |
+
This repo contains several packages:
|
| 301 |
+
|
| 302 |
+
- `ether0`: reward functions, `rdkit` data utilities,
|
| 303 |
+
dataset generation prompts, dataset data models,
|
| 304 |
+
language model training prompts, and data models.
|
| 305 |
+
- `ether0.remotes`: server code for ether0 reward functions involving
|
| 306 |
+
exotic packages and/or third party models.
|
| 307 |
+
|
| 308 |
+
> [!NOTE]
|
| 309 |
+
> This repo does not contain training code,
|
| 310 |
+
> although you can find open source repositories like [NeMo-RL](https://github.com/NVIDIA/NeMo-RL)
|
| 311 |
+
> or [Hugging Face TRL](https://github.com/huggingface/trl)
|
| 312 |
+
> that can do the SFT and RL phases of training.
|
| 313 |
+
|
| 314 |
+
### Open Weights
|
| 315 |
+
|
| 316 |
+
Please see our open-source weights on Hugging Face:
|
| 317 |
+
<https://huggingface.co/futurehouse/ether0>
|
| 318 |
+
|
| 319 |
+
```python
|
| 320 |
+
from transformers import AutoModelForCausalLM, AutoTokenizer
|
| 321 |
+
|
| 322 |
+
model = AutoModelForCausalLM.from_pretrained("futurehouse/ether0")
|
| 323 |
+
tokenizer = AutoTokenizer.from_pretrained("futurehouse/ether0")
|
| 324 |
+
```
|
| 325 |
+
|
| 326 |
+
### Open Test Set
|
| 327 |
+
|
| 328 |
+
Please see our open-source benchmark (test set) on Hugging Face:
|
| 329 |
+
<https://huggingface.co/datasets/futurehouse/ether0-benchmark>
|
| 330 |
+
|
| 331 |
+
```python
|
| 332 |
+
from datasets import load_dataset
|
| 333 |
+
|
| 334 |
+
test_ds = load_dataset("futurehouse/ether0-benchmark", split="test")
|
| 335 |
+
```
|
| 336 |
+
|
| 337 |
+
## Usage
|
| 338 |
+
|
| 339 |
+
### Installation
|
| 340 |
+
|
| 341 |
+
The easiest way to get started is a `pip install` from GitHub:
|
| 342 |
+
|
| 343 |
+
```bash
|
| 344 |
+
pip install git+https://github.com/Future-House/ether0.git
|
| 345 |
+
```
|
| 346 |
+
|
| 347 |
+
Or if you want the full set up, clone the repo and use `uv`:
|
| 348 |
+
|
| 349 |
+
```bash
|
| 350 |
+
git clone https://github.com/Future-House/ether0.git
|
| 351 |
+
cd ether0
|
| 352 |
+
uv sync
|
| 353 |
+
```
|
| 354 |
+
|
| 355 |
+
### Reward Functions
|
| 356 |
+
|
| 357 |
+
Here is a basic example of how to use the reward functions:
|
| 358 |
+
|
| 359 |
+
```python
|
| 360 |
+
from ether0.rewards import valid_mol_eval
|
| 361 |
+
|
| 362 |
+
# Task: provide a valid completion of this molecule
|
| 363 |
+
partial_smiles = "O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14"
|
| 364 |
+
|
| 365 |
+
# Here's two model-proposed SMILES completions
|
| 366 |
+
invalid_completion_smiles = "CCC"
|
| 367 |
+
valid_completion_smiles = ")C=6C=CC=CC6"
|
| 368 |
+
|
| 369 |
+
# Evaluate the completions
|
| 370 |
+
assert not valid_mol_eval(invalid_completion_smiles, partial_smiles)
|
| 371 |
+
assert valid_mol_eval(valid_completion_smiles, partial_smiles)
|
| 372 |
+
```
|
| 373 |
+
|
| 374 |
+
### Visualization
|
| 375 |
+
|
| 376 |
+
If it helps, you can visualize the molecules:
|
| 377 |
+
|
| 378 |
+
```python
|
| 379 |
+
from ether0.data import draw_molecule
|
| 380 |
+
|
| 381 |
+
# See above reward functions demo for where these came from
|
| 382 |
+
partial_smiles = "O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14"
|
| 383 |
+
invalid_completion_smiles = "CCC"
|
| 384 |
+
valid_completion_smiles = ")C=6C=CC=CC6"
|
| 385 |
+
|
| 386 |
+
valid_mol_text = draw_molecule(partial_smiles + valid_completion_smiles)
|
| 387 |
+
with open("valid_molecule.svg", "w") as f:
|
| 388 |
+
f.write(valid_mol_text)
|
| 389 |
+
```
|
| 390 |
+
|
| 391 |
+
The output of `draw_molecule` can also be easily visualized using `IPython.display`,
|
| 392 |
+
or in your terminal via `chafa valid_molecule.svg`
|
| 393 |
+
([chafa docs](https://hpjansson.org/chafa/)).
|
| 394 |
+
|
| 395 |
+

|
| 396 |
+
|
| 397 |
+
### Benchmark
|
| 398 |
+
|
| 399 |
+
Here is a sample baseline of
|
| 400 |
+
[`ether0-benchmark`](https://huggingface.co/datasets/futurehouse/ether0-benchmark)
|
| 401 |
+
on `gpt-4o` using [`lmi`](https://github.com/Future-House/ldp/tree/main/packages/lmi).
|
| 402 |
+
To install `lmi`, please install `ether0` with the `baselines` extra
|
| 403 |
+
(for example `uv sync --extra baselines`).
|
| 404 |
+
|
| 405 |
+
We also need to run our remote rewards server via `ether0-serve`
|
| 406 |
+
(for more information, see [`ether0.remotes` docs](packages/remotes/README.md)):
|
| 407 |
+
|
| 408 |
+
```bash
|
| 409 |
+
ETHER0_REMOTES_API_TOKEN=abc123 ether0-serve
|
| 410 |
+
```
|
| 411 |
+
|
| 412 |
+
Next, start `ipython` with the relevant environment variables set:
|
| 413 |
+
|
| 414 |
+
```bash
|
| 415 |
+
ETHER0_REMOTES_API_BASE_URL="http://127.0.0.1:8000" ETHER0_REMOTES_API_TOKEN=abc123 \
|
| 416 |
+
ipython
|
| 417 |
+
```
|
| 418 |
+
|
| 419 |
+
And run the following Python code:
|
| 420 |
+
|
| 421 |
+
```python
|
| 422 |
+
import itertools
|
| 423 |
+
import statistics
|
| 424 |
+
from collections import defaultdict
|
| 425 |
+
|
| 426 |
+
from aviary.core import Message
|
| 427 |
+
from datasets import load_dataset
|
| 428 |
+
from lmi import LiteLLMModel
|
| 429 |
+
from tqdm.asyncio import tqdm_asyncio as asyncio
|
| 430 |
+
|
| 431 |
+
from ether0.data import get_problem_category
|
| 432 |
+
from ether0.model_prompts import LOOSE_XML_ANSWER_USER_PROMPT, extract_answer_loose
|
| 433 |
+
from ether0.models import RewardFunctionInfo
|
| 434 |
+
from ether0.rewards import EVAL_FUNCTIONS
|
| 435 |
+
|
| 436 |
+
# Add LLM prompt of your making to the dataset
|
| 437 |
+
test_ds = load_dataset("futurehouse/ether0-benchmark", split="test").map(
|
| 438 |
+
lambda x: {"prompt": "\n\n".join((LOOSE_XML_ANSWER_USER_PROMPT, x["problem"]))}
|
| 439 |
+
)
|
| 440 |
+
|
| 441 |
+
# Prompt to LLM
|
| 442 |
+
model = LiteLLMModel(name="gpt-4o")
|
| 443 |
+
results = await asyncio.gather(
|
| 444 |
+
*(model.acompletion([Message(content=row["prompt"])]) for row in test_ds),
|
| 445 |
+
desc="Running evaluation",
|
| 446 |
+
)
|
| 447 |
+
|
| 448 |
+
# Compute rewards
|
| 449 |
+
per_category_rewards = defaultdict(list)
|
| 450 |
+
for row, result in zip(test_ds, results, strict=True):
|
| 451 |
+
# NOTE: you can also use `ether0.rewards.accuracy_reward`,
|
| 452 |
+
# but we decided to go a bit "lower level" for this demo
|
| 453 |
+
reward_info = RewardFunctionInfo.model_validate(row["solution"])
|
| 454 |
+
yhat = extract_answer_loose(result[0].text)
|
| 455 |
+
reward = EVAL_FUNCTIONS[reward_info.fxn_name](
|
| 456 |
+
yhat=yhat, y=reward_info.answer_info, test=True
|
| 457 |
+
)
|
| 458 |
+
per_category_rewards[get_problem_category(reward_info.problem_type)].append(reward)
|
| 459 |
+
|
| 460 |
+
for category, rewards in sorted(per_category_rewards.items()):
|
| 461 |
+
print(
|
| 462 |
+
f"In category {category!r} of {len(rewards)} questions,"
|
| 463 |
+
f" average reward was {statistics.mean(rewards):.3f}."
|
| 464 |
+
)
|
| 465 |
+
accuracy = statistics.mean(itertools.chain.from_iterable(per_category_rewards.values()))
|
| 466 |
+
print(f"Cumulative average reward across {len(test_ds)} questions was {accuracy:.3f}.")
|
| 467 |
+
```
|
src/ether0.egg-info/SOURCES.txt
ADDED
|
@@ -0,0 +1,46 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
.gitignore
|
| 2 |
+
.pre-commit-config.yaml
|
| 3 |
+
.python-version
|
| 4 |
+
CITATION.cff
|
| 5 |
+
LICENSE
|
| 6 |
+
README.md
|
| 7 |
+
pyproject.toml
|
| 8 |
+
uv.lock
|
| 9 |
+
.github/renovate.json5
|
| 10 |
+
.github/workflows/lint-test.yaml
|
| 11 |
+
docs/adding_tokens.ipynb
|
| 12 |
+
docs/updated_mistral_chat_template.jinja
|
| 13 |
+
docs/assets/ether0_logo.svg
|
| 14 |
+
docs/assets/training_info.png
|
| 15 |
+
docs/assets/valid_molecule.svg
|
| 16 |
+
packages/remotes/.gitignore
|
| 17 |
+
packages/remotes/LICENSE
|
| 18 |
+
packages/remotes/README.md
|
| 19 |
+
packages/remotes/pyproject.toml
|
| 20 |
+
packages/remotes/src/ether0/server.py
|
| 21 |
+
packages/remotes/tests/conftest.py
|
| 22 |
+
packages/remotes/tests/test_clients.py
|
| 23 |
+
packages/remotes/tests/test_rewards.py
|
| 24 |
+
src/ether0/chat.py
|
| 25 |
+
src/ether0/clients.py
|
| 26 |
+
src/ether0/data.py
|
| 27 |
+
src/ether0/fingerprints.bloom
|
| 28 |
+
src/ether0/model_prompts.py
|
| 29 |
+
src/ether0/models.py
|
| 30 |
+
src/ether0/problem_prompts.py
|
| 31 |
+
src/ether0/py.typed
|
| 32 |
+
src/ether0/rewards.py
|
| 33 |
+
src/ether0/rings.bloom
|
| 34 |
+
src/ether0/utils.py
|
| 35 |
+
src/ether0.egg-info/PKG-INFO
|
| 36 |
+
src/ether0.egg-info/SOURCES.txt
|
| 37 |
+
src/ether0.egg-info/dependency_links.txt
|
| 38 |
+
src/ether0.egg-info/requires.txt
|
| 39 |
+
src/ether0.egg-info/top_level.txt
|
| 40 |
+
tests/conftest.py
|
| 41 |
+
tests/test_chat.py
|
| 42 |
+
tests/test_data.py
|
| 43 |
+
tests/test_model_prompts.py
|
| 44 |
+
tests/test_models.py
|
| 45 |
+
tests/test_rewards.py
|
| 46 |
+
tests/test_utils.py
|
src/ether0.egg-info/dependency_links.txt
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
|
src/ether0.egg-info/requires.txt
ADDED
|
@@ -0,0 +1,40 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
accelerate>=1.10.1
|
| 2 |
+
datasets
|
| 3 |
+
exmol>=3.3.0
|
| 4 |
+
gradio>=5.44.0
|
| 5 |
+
httpx
|
| 6 |
+
huggingface-hub
|
| 7 |
+
molbloom==2.3.4
|
| 8 |
+
pydantic>=2
|
| 9 |
+
rdkit
|
| 10 |
+
regex
|
| 11 |
+
spaces>=0.40.1
|
| 12 |
+
tenacity
|
| 13 |
+
|
| 14 |
+
[add-tokens]
|
| 15 |
+
ipykernel
|
| 16 |
+
ipywidgets>=8
|
| 17 |
+
transformers>=4.49
|
| 18 |
+
|
| 19 |
+
[baselines]
|
| 20 |
+
fhaviary>=0.19
|
| 21 |
+
fhlmi>=0.26
|
| 22 |
+
ipython
|
| 23 |
+
|
| 24 |
+
[dev]
|
| 25 |
+
ether0[add-tokens,typing]
|
| 26 |
+
huggingface-hub[cli]
|
| 27 |
+
ipython>=8
|
| 28 |
+
mypy>=1.8
|
| 29 |
+
pre-commit>=3.4
|
| 30 |
+
pylint>=3
|
| 31 |
+
pytest
|
| 32 |
+
pytest-subtests
|
| 33 |
+
pytest-sugar
|
| 34 |
+
pytest-timer[colorama]
|
| 35 |
+
pytest-xdist
|
| 36 |
+
refurb>=2
|
| 37 |
+
typeguard
|
| 38 |
+
|
| 39 |
+
[typing]
|
| 40 |
+
types-regex
|
src/ether0.egg-info/top_level.txt
ADDED
|
@@ -0,0 +1 @@
|
|
|
|
|
|
|
| 1 |
+
ether0
|
src/ether0/chat.py
ADDED
|
@@ -0,0 +1,177 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import re
|
| 2 |
+
from collections.abc import Callable, MutableMapping
|
| 3 |
+
from dataclasses import dataclass, field
|
| 4 |
+
from functools import wraps
|
| 5 |
+
from itertools import starmap
|
| 6 |
+
from typing import Any, ParamSpec, TypeVar, cast
|
| 7 |
+
|
| 8 |
+
from ether0.model_prompts import (
|
| 9 |
+
ANSWER_END,
|
| 10 |
+
ANSWER_START,
|
| 11 |
+
THINK_END,
|
| 12 |
+
THINK_START,
|
| 13 |
+
ProblemPrompt,
|
| 14 |
+
SysPrompt,
|
| 15 |
+
extract_answer_loose,
|
| 16 |
+
)
|
| 17 |
+
from ether0.rewards import accuracy_reward, format_reward
|
| 18 |
+
|
| 19 |
+
P = ParamSpec("P")
|
| 20 |
+
R = TypeVar("R")
|
| 21 |
+
|
| 22 |
+
|
| 23 |
+
def wrap_reward_func(func: Callable[P, R], **wrap_kwargs: Any) -> Callable[P, R]:
|
| 24 |
+
@wraps(func) # needed by GRPOTrainer for logging
|
| 25 |
+
def wrapped(*args: P.args, **kwargs: P.kwargs) -> R:
|
| 26 |
+
return func(*args, **wrap_kwargs, **kwargs)
|
| 27 |
+
|
| 28 |
+
return wrapped
|
| 29 |
+
|
| 30 |
+
|
| 31 |
+
@dataclass
|
| 32 |
+
class ChatArguments:
|
| 33 |
+
"""Arguments for making a chat conversation for SFT or RL training."""
|
| 34 |
+
|
| 35 |
+
sys_prompt: SysPrompt | None = field(
|
| 36 |
+
default=None,
|
| 37 |
+
metadata={
|
| 38 |
+
"help": (
|
| 39 |
+
"If provided, use this system prompt. If not provided, the chat"
|
| 40 |
+
" template may inject one."
|
| 41 |
+
)
|
| 42 |
+
},
|
| 43 |
+
)
|
| 44 |
+
|
| 45 |
+
problem_prompt: ProblemPrompt = field(
|
| 46 |
+
default=ProblemPrompt.NONE,
|
| 47 |
+
metadata={
|
| 48 |
+
"help": (
|
| 49 |
+
"Prompt to put before the problem in the first user message, relevant"
|
| 50 |
+
" for both RL or SFT. Make sure this matches between SFT and RL, so if"
|
| 51 |
+
" the SFT'd model wasn't passed this during SFT, don't pass this to RL."
|
| 52 |
+
)
|
| 53 |
+
},
|
| 54 |
+
)
|
| 55 |
+
|
| 56 |
+
reasoning: bool = field(
|
| 57 |
+
default=True,
|
| 58 |
+
metadata={
|
| 59 |
+
"help": (
|
| 60 |
+
"If True (default), it is assumed that the model's response contains"
|
| 61 |
+
f" reasoning enclosed in `{THINK_START}` and `{THINK_END}`."
|
| 62 |
+
)
|
| 63 |
+
},
|
| 64 |
+
)
|
| 65 |
+
|
| 66 |
+
def make_rl_conversation(
|
| 67 |
+
self, row: MutableMapping[str, str | list[str]]
|
| 68 |
+
) -> dict[str, list[dict] | list[list[dict]]]:
|
| 69 |
+
"""Format a dataset row into a chat-like conversation structure.
|
| 70 |
+
|
| 71 |
+
This will add a `messages` key to the dataset. Unlike make_sft_convo,
|
| 72 |
+
the answer will not be included.
|
| 73 |
+
"""
|
| 74 |
+
if not self.sys_prompt:
|
| 75 |
+
msgs: list[dict] = []
|
| 76 |
+
else:
|
| 77 |
+
msgs = [{
|
| 78 |
+
"role": "system",
|
| 79 |
+
"content": SysPrompt(self.sys_prompt).get_sys_prompt(),
|
| 80 |
+
}]
|
| 81 |
+
problem_prompt = ProblemPrompt(self.problem_prompt).get_prompt()
|
| 82 |
+
if problem_prompt:
|
| 83 |
+
problem_prompt += "\n\n"
|
| 84 |
+
|
| 85 |
+
def add_user(problem: str) -> list[dict]:
|
| 86 |
+
return [*msgs, {"role": "user", "content": problem_prompt + problem}]
|
| 87 |
+
|
| 88 |
+
if isinstance(row["problem"], str): # Single
|
| 89 |
+
all_msgs: list[dict] | list[list[dict]] = add_user(row["problem"])
|
| 90 |
+
else: # Batched
|
| 91 |
+
all_msgs = [add_user(p) for p in row["problem"]]
|
| 92 |
+
return {"prompt": all_msgs}
|
| 93 |
+
|
| 94 |
+
def make_sft_conversation(
|
| 95 |
+
self, row: MutableMapping[str, str | list[str]]
|
| 96 |
+
) -> dict[str, list[dict] | list[list[dict]]]:
|
| 97 |
+
"""Format a dataset row into a chat-like conversation structure.
|
| 98 |
+
|
| 99 |
+
This will add a `messages` key to the dataset.
|
| 100 |
+
"""
|
| 101 |
+
if (
|
| 102 |
+
self.reasoning
|
| 103 |
+
and ProblemPrompt(self.problem_prompt) == ProblemPrompt.ANSWER
|
| 104 |
+
):
|
| 105 |
+
raise ValueError(
|
| 106 |
+
"It does not make sense to include reasoning in the SFT traces,"
|
| 107 |
+
" but then only prompt about answer XML (without thoughts)."
|
| 108 |
+
)
|
| 109 |
+
|
| 110 |
+
def add_assistant(
|
| 111 |
+
raw_answer: str, thought: str, prior_msgs: list[dict]
|
| 112 |
+
) -> list[dict]:
|
| 113 |
+
if re.search(r"<\/answer>", raw_answer):
|
| 114 |
+
# Remove prelude and postlude plus XML tags,
|
| 115 |
+
# because an OpenRouter-hosted DeepSeek R1 can give answer
|
| 116 |
+
# with a prelude and XML tags, but our training expects just an answer
|
| 117 |
+
# > The reaction involves sodium borohydride ([BH4-].[Na+]), <redacted>.
|
| 118 |
+
# > Under these conditions, <redacted>.
|
| 119 |
+
# > <answer>N1(CCOCC1)C1=CC=C(C(O))C=C1</answer>
|
| 120 |
+
answer = extract_answer_loose(raw_answer)
|
| 121 |
+
if not answer:
|
| 122 |
+
raise ValueError(
|
| 123 |
+
"Failed to extract just the answer from the answer"
|
| 124 |
+
f" {raw_answer!r}."
|
| 125 |
+
)
|
| 126 |
+
else:
|
| 127 |
+
answer = raw_answer
|
| 128 |
+
|
| 129 |
+
return [
|
| 130 |
+
*prior_msgs,
|
| 131 |
+
{
|
| 132 |
+
"role": "assistant",
|
| 133 |
+
"content": (
|
| 134 |
+
(f"{THINK_START}{thought}{THINK_END}" if self.reasoning else "")
|
| 135 |
+
+ f"{ANSWER_START}{answer}{ANSWER_END}"
|
| 136 |
+
),
|
| 137 |
+
},
|
| 138 |
+
]
|
| 139 |
+
|
| 140 |
+
# The first part will be the same as the RL conversation
|
| 141 |
+
msgs = self.make_rl_conversation(row)["prompt"]
|
| 142 |
+
# Now add the answer, with optional thinking
|
| 143 |
+
if isinstance(row["problem"], str): # Single
|
| 144 |
+
all_msgs: list[dict] | list[list[dict]] = add_assistant(
|
| 145 |
+
cast(str, row["answer"]),
|
| 146 |
+
cast(str, row["thought"]),
|
| 147 |
+
cast(list[dict], msgs),
|
| 148 |
+
)
|
| 149 |
+
else: # Batched
|
| 150 |
+
all_msgs = list(
|
| 151 |
+
starmap(
|
| 152 |
+
add_assistant, zip(row["answer"], row["thought"], msgs, strict=True)
|
| 153 |
+
)
|
| 154 |
+
)
|
| 155 |
+
return {"messages": all_msgs}
|
| 156 |
+
|
| 157 |
+
def get_reward_funcs(
|
| 158 |
+
self,
|
| 159 |
+
format_reward_value: float = 1.0,
|
| 160 |
+
soft: bool = False,
|
| 161 |
+
test: bool = False,
|
| 162 |
+
good_molecule_bonus: float = 0.0,
|
| 163 |
+
) -> list[Callable]:
|
| 164 |
+
return [
|
| 165 |
+
wrap_reward_func(
|
| 166 |
+
format_reward,
|
| 167 |
+
reasoning=self.reasoning,
|
| 168 |
+
reward=format_reward_value,
|
| 169 |
+
),
|
| 170 |
+
wrap_reward_func(
|
| 171 |
+
accuracy_reward,
|
| 172 |
+
reasoning=self.reasoning,
|
| 173 |
+
soft=soft,
|
| 174 |
+
test=test,
|
| 175 |
+
good_molecule_bonus=good_molecule_bonus,
|
| 176 |
+
),
|
| 177 |
+
]
|
src/ether0/clients.py
ADDED
|
@@ -0,0 +1,163 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import logging
|
| 2 |
+
import os
|
| 3 |
+
from collections import Counter
|
| 4 |
+
from collections.abc import Mapping
|
| 5 |
+
from typing import Any
|
| 6 |
+
|
| 7 |
+
import httpx
|
| 8 |
+
from tenacity import retry, retry_if_exception_type, stop_after_attempt, wait_fixed
|
| 9 |
+
|
| 10 |
+
logger = logging.getLogger(__name__)
|
| 11 |
+
|
| 12 |
+
BASE_URL = os.environ.get("ETHER0_REMOTES_API_BASE_URL")
|
| 13 |
+
HEADERS = {
|
| 14 |
+
"Authorization": f"Bearer {os.environ.get('ETHER0_REMOTES_API_TOKEN')}",
|
| 15 |
+
"Content-Type": "application/json",
|
| 16 |
+
}
|
| 17 |
+
SERVER_ERRORS_COUNTER = Counter({
|
| 18 |
+
"fetch_solubility": 0,
|
| 19 |
+
"fetch_purchasable": 0,
|
| 20 |
+
"fetch_forward_rxn": 0,
|
| 21 |
+
"fetch_rxn_info": 0,
|
| 22 |
+
})
|
| 23 |
+
THROW_500_ERROR_THRESHOLD = int(
|
| 24 |
+
os.environ.get("ETHER0_REMOTES_THROW_500_ERROR_THRESHOLD", "100")
|
| 25 |
+
)
|
| 26 |
+
# If our server throws a 501, we don't retry
|
| 27 |
+
OUR_SERVER_DONT_RETRY_CODE = httpx.codes.NOT_IMPLEMENTED.value
|
| 28 |
+
REMOTE_WORKER_COLD_START_TIME = 180 # sec
|
| 29 |
+
|
| 30 |
+
|
| 31 |
+
class RetryableServerError(Exception):
|
| 32 |
+
"""Retryable server error."""
|
| 33 |
+
|
| 34 |
+
@classmethod
|
| 35 |
+
def check_raise(
|
| 36 |
+
cls, response: httpx.Response, kwargs: Mapping[str, Any] | None = None
|
| 37 |
+
) -> None:
|
| 38 |
+
if (
|
| 39 |
+
response.is_server_error
|
| 40 |
+
and response.status_code != OUR_SERVER_DONT_RETRY_CODE
|
| 41 |
+
):
|
| 42 |
+
raise cls(
|
| 43 |
+
f"Retryable server error with status code {response.status_code}"
|
| 44 |
+
f" and inputs {kwargs or {}} and response {response=}."
|
| 45 |
+
)
|
| 46 |
+
|
| 47 |
+
|
| 48 |
+
@retry(
|
| 49 |
+
stop=stop_after_attempt(3),
|
| 50 |
+
wait=wait_fixed(1),
|
| 51 |
+
retry=retry_if_exception_type((
|
| 52 |
+
httpx.ReadTimeout,
|
| 53 |
+
httpx.ConnectError,
|
| 54 |
+
RetryableServerError,
|
| 55 |
+
)),
|
| 56 |
+
)
|
| 57 |
+
def fetch_solubility(query_smiles: str) -> dict:
|
| 58 |
+
response = httpx.post(
|
| 59 |
+
f"{BASE_URL}/compute_solubility",
|
| 60 |
+
json={"smiles": query_smiles},
|
| 61 |
+
headers=HEADERS,
|
| 62 |
+
timeout=REMOTE_WORKER_COLD_START_TIME,
|
| 63 |
+
)
|
| 64 |
+
|
| 65 |
+
error_message = ""
|
| 66 |
+
if response.is_success:
|
| 67 |
+
result = response.json()
|
| 68 |
+
if "error" in result:
|
| 69 |
+
error_message = result["error"]
|
| 70 |
+
else:
|
| 71 |
+
solubility = result["mean"]
|
| 72 |
+
return {"smiles": query_smiles, "solubility": solubility}
|
| 73 |
+
if response.is_redirect or response.is_server_error:
|
| 74 |
+
# We should not have redirect responses or server errors, so let's retry these
|
| 75 |
+
error_message = response.text
|
| 76 |
+
SERVER_ERRORS_COUNTER["fetch_solubility"] += 1
|
| 77 |
+
if SERVER_ERRORS_COUNTER["fetch_solubility"] >= THROW_500_ERROR_THRESHOLD:
|
| 78 |
+
response.raise_for_status()
|
| 79 |
+
RetryableServerError.check_raise(
|
| 80 |
+
response, kwargs={"query_smiles": query_smiles}
|
| 81 |
+
)
|
| 82 |
+
if error_message:
|
| 83 |
+
logger.warning(
|
| 84 |
+
f"fetch_solubility did not succeed on {query_smiles=} with"
|
| 85 |
+
f" {response=} and {error_message=}."
|
| 86 |
+
)
|
| 87 |
+
return {
|
| 88 |
+
"smiles": query_smiles,
|
| 89 |
+
"error": f"API error: {response} - {error_message}",
|
| 90 |
+
}
|
| 91 |
+
|
| 92 |
+
|
| 93 |
+
@retry(
|
| 94 |
+
stop=stop_after_attempt(3),
|
| 95 |
+
wait=wait_fixed(1),
|
| 96 |
+
retry=retry_if_exception_type((
|
| 97 |
+
httpx.ReadTimeout,
|
| 98 |
+
httpx.ConnectError,
|
| 99 |
+
RetryableServerError,
|
| 100 |
+
)),
|
| 101 |
+
)
|
| 102 |
+
def fetch_purchasable(query_smiles_list: list[str] | str) -> dict[str, bool]:
|
| 103 |
+
response = httpx.post(
|
| 104 |
+
f"{BASE_URL}/is_purchasable",
|
| 105 |
+
json={"smiles": query_smiles_list},
|
| 106 |
+
headers=HEADERS,
|
| 107 |
+
timeout=REMOTE_WORKER_COLD_START_TIME,
|
| 108 |
+
)
|
| 109 |
+
|
| 110 |
+
if response.is_success:
|
| 111 |
+
return response.json()
|
| 112 |
+
logger.warning(
|
| 113 |
+
f"fetch_purchasable did not succeed on {query_smiles_list=} with"
|
| 114 |
+
f" {response=} and {response.text=}."
|
| 115 |
+
)
|
| 116 |
+
if response.is_redirect or response.is_server_error:
|
| 117 |
+
# We should not have redirect responses or server errors, so let's retry these
|
| 118 |
+
SERVER_ERRORS_COUNTER["fetch_purchasable"] += 1
|
| 119 |
+
if SERVER_ERRORS_COUNTER["fetch_purchasable"] >= THROW_500_ERROR_THRESHOLD:
|
| 120 |
+
response.raise_for_status()
|
| 121 |
+
RetryableServerError.check_raise(
|
| 122 |
+
response, kwargs={"query_smiles_list": query_smiles_list}
|
| 123 |
+
)
|
| 124 |
+
return {}
|
| 125 |
+
|
| 126 |
+
|
| 127 |
+
@retry(
|
| 128 |
+
stop=stop_after_attempt(3),
|
| 129 |
+
wait=wait_fixed(1),
|
| 130 |
+
retry=retry_if_exception_type((
|
| 131 |
+
httpx.ReadTimeout,
|
| 132 |
+
httpx.ConnectError,
|
| 133 |
+
RetryableServerError,
|
| 134 |
+
)),
|
| 135 |
+
)
|
| 136 |
+
def fetch_forward_rxn(query_rxn_smiles: str) -> dict[str, str]:
|
| 137 |
+
response = httpx.post(
|
| 138 |
+
f"{BASE_URL}/translate",
|
| 139 |
+
json={"reaction": query_rxn_smiles},
|
| 140 |
+
headers=HEADERS,
|
| 141 |
+
timeout=REMOTE_WORKER_COLD_START_TIME,
|
| 142 |
+
)
|
| 143 |
+
|
| 144 |
+
if response.is_success:
|
| 145 |
+
result = response.json()
|
| 146 |
+
product = result["product"]
|
| 147 |
+
return {"smiles": query_rxn_smiles, "product": product}
|
| 148 |
+
logger.warning(
|
| 149 |
+
f"fetch_forward_rxn did not succeed on {query_rxn_smiles=} with"
|
| 150 |
+
f" {response=} and {response.text=}."
|
| 151 |
+
)
|
| 152 |
+
if response.is_redirect or response.is_server_error:
|
| 153 |
+
# We should not have redirect responses or server errors, so let's retry these
|
| 154 |
+
SERVER_ERRORS_COUNTER["fetch_forward_rxn"] += 1
|
| 155 |
+
if SERVER_ERRORS_COUNTER["fetch_forward_rxn"] >= THROW_500_ERROR_THRESHOLD:
|
| 156 |
+
response.raise_for_status()
|
| 157 |
+
RetryableServerError.check_raise(
|
| 158 |
+
response, kwargs={"query_rxn_smiles": query_rxn_smiles}
|
| 159 |
+
)
|
| 160 |
+
return {
|
| 161 |
+
"smiles": query_rxn_smiles,
|
| 162 |
+
"error": f"API error: {response} - {response.text}",
|
| 163 |
+
}
|
src/ether0/data.py
ADDED
|
@@ -0,0 +1,225 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import logging
|
| 2 |
+
import re
|
| 3 |
+
from collections.abc import Collection, Mapping
|
| 4 |
+
from pathlib import Path
|
| 5 |
+
|
| 6 |
+
from datasets import Dataset
|
| 7 |
+
from molbloom import BloomFilter, canon
|
| 8 |
+
from rdkit import Chem
|
| 9 |
+
from rdkit.Chem.Draw import MolDraw2D, MolDraw2DSVG # pylint: disable=no-name-in-module
|
| 10 |
+
from rdkit.Chem.Draw.rdMolDraw2D import MolDraw2DCairo
|
| 11 |
+
from rdkit.Chem.rdChemReactions import ( # pylint: disable=no-name-in-module
|
| 12 |
+
ReactionFromSmarts,
|
| 13 |
+
)
|
| 14 |
+
from rdkit.Chem.rdDepictor import ( # pylint: disable=no-name-in-module
|
| 15 |
+
Compute2DCoords,
|
| 16 |
+
StraightenDepiction,
|
| 17 |
+
)
|
| 18 |
+
from rdkit.Chem.rdMolDescriptors import ( # pylint: disable=no-name-in-module
|
| 19 |
+
GetMorganFingerprint,
|
| 20 |
+
)
|
| 21 |
+
from rdkit.Chem.rdmolfiles import MolFromSmiles # pylint: disable=no-name-in-module
|
| 22 |
+
|
| 23 |
+
logger = logging.getLogger(__name__)
|
| 24 |
+
|
| 25 |
+
|
| 26 |
+
PROBLEM_CATEGORY_TO_NICKNAME: Mapping[str, str] = {
|
| 27 |
+
"functional-group": "functional group",
|
| 28 |
+
"molecule-caption": "molecule caption",
|
| 29 |
+
"molecule-completion": "SMILES completion",
|
| 30 |
+
"molecule-formula": "elucidation",
|
| 31 |
+
"molecule-name": "IUPAC name",
|
| 32 |
+
"oracle-solubility": "solubility edit",
|
| 33 |
+
"property": "multiple choice",
|
| 34 |
+
"property-cat-brain": "BBB permeability",
|
| 35 |
+
"property-cat-eve": "Human receptor binding",
|
| 36 |
+
"property-cat-safety": "safety",
|
| 37 |
+
"property-cat-smell": "scent",
|
| 38 |
+
"property-regression-pka": "pKa",
|
| 39 |
+
"property-regression-ld50": "LD50",
|
| 40 |
+
"property-regression-adme": "ADME",
|
| 41 |
+
"reaction-prediction": "reaction prediction",
|
| 42 |
+
"retro-synthesis": "retrosynthesis",
|
| 43 |
+
"simple-formula": "molecular formula",
|
| 44 |
+
"property-regression-adme/log_hlm_clint": "log of HLM CL$_{\\text{int}}$",
|
| 45 |
+
"property-regression-adme/log_mdr1-mdck_er": "log of MDR1-MDCK ER",
|
| 46 |
+
"property-regression-adme/log_rlm_clint": "log of RLM CL$_{\\text{int}}$",
|
| 47 |
+
"property-regression-adme/log_solubility": "log of aqueous solubility",
|
| 48 |
+
}
|
| 49 |
+
|
| 50 |
+
|
| 51 |
+
def get_problem_type(row: Mapping[str, str]) -> str:
|
| 52 |
+
return row.get("problem_type") or row["type"]
|
| 53 |
+
|
| 54 |
+
|
| 55 |
+
def get_problem_category(problem_type: str | None) -> str:
|
| 56 |
+
return (problem_type or "").split("/", maxsplit=1)[0]
|
| 57 |
+
|
| 58 |
+
|
| 59 |
+
def get_problem_categories_from_datasets(*datasets: Dataset) -> Collection[str]:
|
| 60 |
+
return {
|
| 61 |
+
get_problem_category(pt)
|
| 62 |
+
for dataset in datasets
|
| 63 |
+
for pt in (dataset.hf_dataset if hasattr(dataset, "hf_dataset") else dataset)[
|
| 64 |
+
"problem_type"
|
| 65 |
+
]
|
| 66 |
+
}
|
| 67 |
+
|
| 68 |
+
|
| 69 |
+
# Use this regex with findall to extract SMILES strings from text.
|
| 70 |
+
# Note this function currently fails on counterions e.g.
|
| 71 |
+
# Cc1ccc(-c2ccc3c(c2)c2ccccc2c[n+]3C)cc1.[Cl-]
|
| 72 |
+
SMILES_PATTERN = re.compile(
|
| 73 |
+
r"(?<!\w)(?:(?:Cl|Br|[BCNOPSFIC]|[cnops]|\[[^\]]+?\]|[0-9@+\-=#\\/()%])){4,}(?!\w)"
|
| 74 |
+
)
|
| 75 |
+
|
| 76 |
+
|
| 77 |
+
def make_sized_d2d(w: int = 400, h: int = 300) -> MolDraw2DCairo:
|
| 78 |
+
return MolDraw2DCairo(w, h)
|
| 79 |
+
|
| 80 |
+
|
| 81 |
+
def draw_molecule(
|
| 82 |
+
smiles: str, bg_opacity: float = 1.0, d2d: MolDraw2D | None = None
|
| 83 |
+
) -> str:
|
| 84 |
+
"""Draw a SMILES molecule and return the drawing string."""
|
| 85 |
+
mol = Chem.MolFromSmiles(smiles)
|
| 86 |
+
if mol is None:
|
| 87 |
+
raise ValueError(f"Failed to convert {smiles=} to a molecule.")
|
| 88 |
+
Compute2DCoords(mol)
|
| 89 |
+
StraightenDepiction(mol)
|
| 90 |
+
if d2d is None:
|
| 91 |
+
d2d = MolDraw2DSVG(-1, -1)
|
| 92 |
+
dopts = d2d.drawOptions()
|
| 93 |
+
dopts.useBWAtomPalette()
|
| 94 |
+
dopts.setBackgroundColour((*dopts.getBackgroundColour(), bg_opacity))
|
| 95 |
+
d2d.DrawMolecule(mol)
|
| 96 |
+
d2d.FinishDrawing()
|
| 97 |
+
return d2d.GetDrawingText()
|
| 98 |
+
|
| 99 |
+
|
| 100 |
+
def draw_reaction(
|
| 101 |
+
rxn_smiles: str, bg_opacity: float = 1.0, d2d: MolDraw2D | None = None
|
| 102 |
+
) -> str:
|
| 103 |
+
rxn = ReactionFromSmarts(rxn_smiles, useSmiles=True)
|
| 104 |
+
if d2d is None:
|
| 105 |
+
d2d = MolDraw2DSVG(-1, -1)
|
| 106 |
+
dopts = d2d.drawOptions()
|
| 107 |
+
dopts.useBWAtomPalette()
|
| 108 |
+
dopts.setBackgroundColour((*dopts.getBackgroundColour(), bg_opacity))
|
| 109 |
+
d2d.DrawReaction(rxn)
|
| 110 |
+
d2d.FinishDrawing()
|
| 111 |
+
return d2d.GetDrawingText()
|
| 112 |
+
|
| 113 |
+
|
| 114 |
+
# Precompiled SMARTS patterns for protected bonds and ring atoms
|
| 115 |
+
_ring_db_pat = Chem.MolFromSmarts("[#6R,#16R]=[OR0,SR0,CR0,NR0]")
|
| 116 |
+
_ring_atom_pat = Chem.MolFromSmarts("[R]")
|
| 117 |
+
|
| 118 |
+
|
| 119 |
+
bloom_filters: dict[str, BloomFilter] = {}
|
| 120 |
+
|
| 121 |
+
|
| 122 |
+
def _get_bits(mol: Chem.Mol) -> set[str]:
|
| 123 |
+
"""Get the fingerprint bits from a molecule."""
|
| 124 |
+
# the keys are the actual bits
|
| 125 |
+
bi: dict[int, tuple[tuple[int, int], ...]] = {}
|
| 126 |
+
GetMorganFingerprint(mol, 2, bitInfo=bi) # type: ignore[arg-type]
|
| 127 |
+
return {str(k) for k in bi}
|
| 128 |
+
|
| 129 |
+
|
| 130 |
+
ETHER0_DIR = Path(__file__).parent
|
| 131 |
+
|
| 132 |
+
|
| 133 |
+
def _get_bloom_filter(name: str) -> BloomFilter:
|
| 134 |
+
if name in bloom_filters:
|
| 135 |
+
return bloom_filters[name]
|
| 136 |
+
bloom_filters[name] = BloomFilter(str(ETHER0_DIR / f"{name}.bloom"))
|
| 137 |
+
return bloom_filters[name]
|
| 138 |
+
|
| 139 |
+
|
| 140 |
+
def get_ring_system(mol: Chem.Mol) -> list[str]:
|
| 141 |
+
"""
|
| 142 |
+
Extracts ring systems from an RDKit molecule and returns a list of SMILES.
|
| 143 |
+
Bonds not in rings and not protected (e.g., ring carbonyls) are cleaved.
|
| 144 |
+
|
| 145 |
+
Source: https://github.com/PatWalters/useful_rdkit_utils/blob/edb126e3fd71870ae2d1c9440b904106e3ef97a2/useful_rdkit_utils/ring_systems.py#L13
|
| 146 |
+
Which has a MIT license, copyright 2021-2025 PatWalters.
|
| 147 |
+
""" # noqa: D205
|
| 148 |
+
# Copy to avoid mutating original
|
| 149 |
+
mol = Chem.Mol(mol)
|
| 150 |
+
|
| 151 |
+
# Tag protected bonds
|
| 152 |
+
for bond in mol.GetBonds():
|
| 153 |
+
bond.SetBoolProp("protected", False) # noqa: FBT003
|
| 154 |
+
for a1, a2 in mol.GetSubstructMatches(_ring_db_pat):
|
| 155 |
+
b = mol.GetBondBetweenAtoms(a1, a2)
|
| 156 |
+
b.SetBoolProp("protected", True) # noqa: FBT003
|
| 157 |
+
|
| 158 |
+
# Cleave linker bonds
|
| 159 |
+
cleave_idxs = [
|
| 160 |
+
b.GetIdx()
|
| 161 |
+
for b in mol.GetBonds()
|
| 162 |
+
if not b.IsInRing()
|
| 163 |
+
and not b.GetBoolProp("protected")
|
| 164 |
+
and b.GetBondType() == Chem.BondType.SINGLE
|
| 165 |
+
]
|
| 166 |
+
if cleave_idxs:
|
| 167 |
+
frag_mol = Chem.FragmentOnBonds(mol, cleave_idxs)
|
| 168 |
+
Chem.SanitizeMol(frag_mol)
|
| 169 |
+
else:
|
| 170 |
+
frag_mol = mol
|
| 171 |
+
|
| 172 |
+
# Split into fragments and clean up
|
| 173 |
+
ring_smiles: list[str] = []
|
| 174 |
+
for frag in Chem.GetMolFrags(frag_mol, asMols=True):
|
| 175 |
+
if frag.HasSubstructMatch(_ring_atom_pat):
|
| 176 |
+
for atom in frag.GetAtoms():
|
| 177 |
+
if atom.GetAtomicNum() == 0:
|
| 178 |
+
atom.SetAtomicNum(1)
|
| 179 |
+
atom.SetIsotope(0)
|
| 180 |
+
frag = Chem.RemoveAllHs(frag) # noqa: PLW2901
|
| 181 |
+
# Fix stereo on terminal double bonds
|
| 182 |
+
for bd in frag.GetBonds():
|
| 183 |
+
if bd.GetBondType() == Chem.BondType.DOUBLE and (
|
| 184 |
+
1 in {bd.GetBeginAtom().GetDegree(), bd.GetEndAtom().GetDegree()}
|
| 185 |
+
):
|
| 186 |
+
bd.SetStereo(Chem.BondStereo.STEREONONE)
|
| 187 |
+
ring_smiles.append(Chem.MolToSmiles(frag))
|
| 188 |
+
|
| 189 |
+
return ring_smiles
|
| 190 |
+
|
| 191 |
+
|
| 192 |
+
def is_reasonable_ring_system(mol: Chem.Mol, ref_mol: Chem.Mol | None = None) -> bool:
|
| 193 |
+
"""
|
| 194 |
+
Check if a molecule has a reasonable ring system.
|
| 195 |
+
|
| 196 |
+
Either no rings or the ring system is found in known rings.
|
| 197 |
+
If reference is provided, thsos are assumed valid.
|
| 198 |
+
"""
|
| 199 |
+
bloom_filter = _get_bloom_filter("rings")
|
| 200 |
+
ring_systems = [canon(r) for r in get_ring_system(mol)]
|
| 201 |
+
# remove from consideration all rings in ref_mol, since we'll always assume they're correct
|
| 202 |
+
if ref_mol:
|
| 203 |
+
ref_ring_systems = [canon(r) for r in get_ring_system(ref_mol)]
|
| 204 |
+
ring_systems = [ring for ring in ring_systems if ring not in ref_ring_systems]
|
| 205 |
+
return all((r in bloom_filter) for r in ring_systems)
|
| 206 |
+
|
| 207 |
+
|
| 208 |
+
def is_reasonable_fp(mol: Chem.Mol, ref_mol: Chem.Mol | None = None) -> bool:
|
| 209 |
+
"""
|
| 210 |
+
Check if a molecule has a reasonable fingerprint.
|
| 211 |
+
|
| 212 |
+
If reference is provided, those fingerprints are assumed valid.
|
| 213 |
+
"""
|
| 214 |
+
bloom_filter = _get_bloom_filter("fingerprints")
|
| 215 |
+
bits: Collection[str] = _get_bits(mol)
|
| 216 |
+
# remove from consideration all rings in ref_mol, since we'll always assume they're correct
|
| 217 |
+
if ref_mol:
|
| 218 |
+
ref_bits = _get_bits(ref_mol)
|
| 219 |
+
bits = [bit for bit in bits if bit not in ref_bits]
|
| 220 |
+
return all((b in bloom_filter) for b in bits)
|
| 221 |
+
|
| 222 |
+
|
| 223 |
+
def mol_from_smiles(smiles: str, *args, **kwargs) -> Chem.Mol | None:
|
| 224 |
+
"""MolFromSmiles is type-hinted to always return Mol, but can return None."""
|
| 225 |
+
return MolFromSmiles(smiles, *args, **kwargs)
|
src/ether0/fingerprints.bloom
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:f9267f986c512f26131eb0219170c12e07ded9c1574c75233da5e3d5f3f00278
|
| 3 |
+
size 12500018
|
src/ether0/model_prompts.py
ADDED
|
@@ -0,0 +1,142 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Prompts and utilities used for training the ether0 model."""
|
| 2 |
+
|
| 3 |
+
import re
|
| 4 |
+
from enum import Enum, StrEnum
|
| 5 |
+
from typing import assert_never
|
| 6 |
+
|
| 7 |
+
# Tokens to surround reasoning and answer in XML format
|
| 8 |
+
THINK_START = "<|think_start|>"
|
| 9 |
+
THINK_END = "<|think_end|>"
|
| 10 |
+
ANSWER_START = "<|answer_start|>"
|
| 11 |
+
ANSWER_END = "<|answer_end|>"
|
| 12 |
+
|
| 13 |
+
|
| 14 |
+
# Keys: True (reasoning + answer), False (answer only)
|
| 15 |
+
# Use strict regex for ether0 models, as we can SFT or RL the models into compliance
|
| 16 |
+
STRICT_XML_ANSWER_SPLIT_PATTERNS: dict[bool, re.Pattern] = {
|
| 17 |
+
True: re.compile(
|
| 18 |
+
rf"^\s?{re.escape(THINK_START)}\s*([\s\S]*?)\s*{re.escape(THINK_END)}([\s\S]*?){re.escape(ANSWER_START)}\s*([\s\S]*?)\s*{re.escape(ANSWER_END)}$"
|
| 19 |
+
),
|
| 20 |
+
False: re.compile(
|
| 21 |
+
rf"^\s?{re.escape(ANSWER_START)}\s*(\S[\s\S]*?)\s*{re.escape(ANSWER_END)}$"
|
| 22 |
+
),
|
| 23 |
+
}
|
| 24 |
+
# Use loose regex for other models because:
|
| 25 |
+
# 1. <think> may be out-of-distribution from the model's training data,
|
| 26 |
+
# so requiring thoughts may degrade performance.
|
| 27 |
+
# 2. We allow baseline models to add extra whitespace and/or preceding or trailing text
|
| 28 |
+
# around answer XML, again to maximize performance.
|
| 29 |
+
# 3. Similarly, we allow models to ramble for a bit mentioning <answer>,
|
| 30 |
+
# and then we just keep the last <answer> XML.
|
| 31 |
+
# 4. We want to avoid prompt engineering tricks to get around the previous items.
|
| 32 |
+
LOOSE_XML_ANSWER_LOOSE_PATTERN = r"<answer>\s*(\S[\s\S]*?)\s*<\/answer>"
|
| 33 |
+
|
| 34 |
+
|
| 35 |
+
class XMLAnswerPrompts(StrEnum):
|
| 36 |
+
"""Enum of prompts to use ."""
|
| 37 |
+
|
| 38 |
+
REASONING_ANSWER = (
|
| 39 |
+
"A conversation between User and Assistant."
|
| 40 |
+
" The user asks a question, and the Assistant solves it."
|
| 41 |
+
" The assistant first thinks about the reasoning process"
|
| 42 |
+
" in the mind and then provides the user with the answer."
|
| 43 |
+
" The reasoning process and answer are enclosed within"
|
| 44 |
+
f" {THINK_START} {THINK_END} and {ANSWER_START} {ANSWER_END} tags,"
|
| 45 |
+
" respectively, i.e.,"
|
| 46 |
+
f" {THINK_START} reasoning process here {THINK_END}"
|
| 47 |
+
f"{ANSWER_START} answer here {ANSWER_END}"
|
| 48 |
+
)
|
| 49 |
+
ANSWER_ONLY = (
|
| 50 |
+
"A conversation between User and Assistant."
|
| 51 |
+
" The user asks a question, and the Assistant solves it."
|
| 52 |
+
" The assistant encloses its answer within"
|
| 53 |
+
f" {ANSWER_START} {ANSWER_END} tags, i.e.,"
|
| 54 |
+
f" {ANSWER_START} answer here {ANSWER_END}"
|
| 55 |
+
)
|
| 56 |
+
|
| 57 |
+
@property
|
| 58 |
+
def pattern(self) -> re.Pattern:
|
| 59 |
+
return STRICT_XML_ANSWER_SPLIT_PATTERNS[
|
| 60 |
+
self == XMLAnswerPrompts.REASONING_ANSWER
|
| 61 |
+
]
|
| 62 |
+
|
| 63 |
+
|
| 64 |
+
class SysPrompt(Enum): # Use Enum over StrEnum for trl.TrlParser compatibility
|
| 65 |
+
"""Possible system prompts for making a conversation to train upon."""
|
| 66 |
+
|
| 67 |
+
SCIENTIFIC_AI = "scientific_ai"
|
| 68 |
+
|
| 69 |
+
def get_sys_prompt(self) -> str:
|
| 70 |
+
match self:
|
| 71 |
+
case SysPrompt.SCIENTIFIC_AI:
|
| 72 |
+
return "You are a scientific reasoning AI assistant."
|
| 73 |
+
case _:
|
| 74 |
+
assert_never(self)
|
| 75 |
+
|
| 76 |
+
|
| 77 |
+
class ProblemPrompt(Enum): # Use Enum over StrEnum for trl.TrlParser compatibility
|
| 78 |
+
"""Possible user prompts for making a conversation to train upon."""
|
| 79 |
+
|
| 80 |
+
NONE = "none"
|
| 81 |
+
THINK_ANSWER = "think_answer"
|
| 82 |
+
ANSWER = "answer"
|
| 83 |
+
|
| 84 |
+
def get_prompt(self) -> str:
|
| 85 |
+
match self:
|
| 86 |
+
case ProblemPrompt.NONE:
|
| 87 |
+
return ""
|
| 88 |
+
case ProblemPrompt.THINK_ANSWER:
|
| 89 |
+
return XMLAnswerPrompts.REASONING_ANSWER.value
|
| 90 |
+
case ProblemPrompt.ANSWER:
|
| 91 |
+
return XMLAnswerPrompts.ANSWER_ONLY.value
|
| 92 |
+
case _:
|
| 93 |
+
assert_never(self)
|
| 94 |
+
|
| 95 |
+
|
| 96 |
+
def extract_thought_answer_strict(
|
| 97 |
+
text: str, reasoning: bool
|
| 98 |
+
) -> tuple[str | None, str | None]:
|
| 99 |
+
"""Extract thought and answer from text using a strict XML pattern."""
|
| 100 |
+
# Use `maxsplit=1` to enforce just one match
|
| 101 |
+
matches = STRICT_XML_ANSWER_SPLIT_PATTERNS[reasoning].split(text, maxsplit=1)
|
| 102 |
+
try:
|
| 103 |
+
_, *inner, suffix = matches
|
| 104 |
+
except (IndexError, ValueError):
|
| 105 |
+
return None, None # Consider no answer or 2+ answers as a failure
|
| 106 |
+
if reasoning:
|
| 107 |
+
thought, inter, answer = inner
|
| 108 |
+
else:
|
| 109 |
+
thought, inter = None, None
|
| 110 |
+
(answer,) = inner
|
| 111 |
+
if (
|
| 112 |
+
THINK_START not in (thought or "")
|
| 113 |
+
and THINK_START not in (inter or "")
|
| 114 |
+
and ANSWER_START not in answer
|
| 115 |
+
and not suffix
|
| 116 |
+
):
|
| 117 |
+
return thought, answer or None
|
| 118 |
+
return None, None # Consider nested answer as a failure
|
| 119 |
+
|
| 120 |
+
|
| 121 |
+
LOOSE_XML_ANSWER_USER_PROMPT = (
|
| 122 |
+
"When answering,"
|
| 123 |
+
" be sure to place the final answer as"
|
| 124 |
+
" SMILES notation into XML tags <answer></answer>."
|
| 125 |
+
" An example is <answer>CCO</answer>."
|
| 126 |
+
)
|
| 127 |
+
|
| 128 |
+
|
| 129 |
+
def extract_answer_loose(text: str | None) -> str:
|
| 130 |
+
"""
|
| 131 |
+
Extract thought and answer from text using a loose XML pattern.
|
| 132 |
+
|
| 133 |
+
SEE: LOOSE_XML_ANSWER_LOOSE_PATTERN for when to use this.
|
| 134 |
+
"""
|
| 135 |
+
matches = re.findall(LOOSE_XML_ANSWER_LOOSE_PATTERN, text or "")
|
| 136 |
+
try:
|
| 137 |
+
last_answer = matches[-1] # Last answer in the response
|
| 138 |
+
except IndexError:
|
| 139 |
+
return "" # Consider no answer as a failure
|
| 140 |
+
if "<answer>" not in last_answer:
|
| 141 |
+
return last_answer
|
| 142 |
+
return "" # Consider nested answer as a failure
|
src/ether0/models.py
ADDED
|
@@ -0,0 +1,173 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import re
|
| 2 |
+
from collections.abc import Collection
|
| 3 |
+
from enum import StrEnum, auto
|
| 4 |
+
from typing import Any
|
| 5 |
+
|
| 6 |
+
from datasets import DatasetDict
|
| 7 |
+
from pydantic import BaseModel, Field, model_validator
|
| 8 |
+
|
| 9 |
+
from ether0.utils import TDataset
|
| 10 |
+
|
| 11 |
+
REWARD_REASON_KEY = "reward_reason" # Sentinel key
|
| 12 |
+
|
| 13 |
+
|
| 14 |
+
class RewardReason(StrEnum):
|
| 15 |
+
FORMAT_FAILED = auto()
|
| 16 |
+
INVALID_MOL = auto()
|
| 17 |
+
# Catch-all for invalid values that aren't a molecule or a reaction
|
| 18 |
+
INVALID_VALUE = auto()
|
| 19 |
+
|
| 20 |
+
# Oracle regression values
|
| 21 |
+
WRONG_NUMERICAL_ANSWER = auto()
|
| 22 |
+
|
| 23 |
+
# Reaction/retro-synthesis failures
|
| 24 |
+
INVALID_RXN = auto()
|
| 25 |
+
WRONG_PRODUCT = auto()
|
| 26 |
+
PRODUCT_IS_REACTANT = auto()
|
| 27 |
+
NOT_PURCHASABLE = auto()
|
| 28 |
+
|
| 29 |
+
# Molecule formula/functional group failures
|
| 30 |
+
WRONG_FORMULA = auto()
|
| 31 |
+
FAILED_CONSTRAINT = auto()
|
| 32 |
+
|
| 33 |
+
# Unreasonable molecules
|
| 34 |
+
FAILED_REOS_CHECK = auto()
|
| 35 |
+
FAILED_RING_CHECK = auto()
|
| 36 |
+
FAILED_COUNTERION_CHECK = auto()
|
| 37 |
+
|
| 38 |
+
# Really this is a bug, but we don't want to blow up training if a
|
| 39 |
+
# few bad examples slip through.
|
| 40 |
+
INVALID_GROUND_TRUTH = auto()
|
| 41 |
+
|
| 42 |
+
# Failover reason if we have an exception during a reward function.
|
| 43 |
+
# NOTE: not using "failed" or "error" since an unhandled exception
|
| 44 |
+
# may be something else
|
| 45 |
+
REWARD_FUNCTION_EXCEPTION = auto()
|
| 46 |
+
|
| 47 |
+
# These are automatically added if no other reason is given
|
| 48 |
+
WRONG_ANSWER = auto()
|
| 49 |
+
RIGHT_ANSWER = auto()
|
| 50 |
+
|
| 51 |
+
def set_reason(self, metadata: dict | None) -> None:
|
| 52 |
+
if metadata is not None:
|
| 53 |
+
metadata[REWARD_REASON_KEY] = self.value
|
| 54 |
+
|
| 55 |
+
@classmethod
|
| 56 |
+
def set_default_reason(cls, reward: float, metadata: dict | None) -> None:
|
| 57 |
+
if metadata is not None and REWARD_REASON_KEY not in metadata:
|
| 58 |
+
(cls.RIGHT_ANSWER if reward >= 1.0 else cls.WRONG_ANSWER).set_reason(
|
| 59 |
+
metadata
|
| 60 |
+
)
|
| 61 |
+
|
| 62 |
+
|
| 63 |
+
SOLUTION_DELIMITER = "!:!"
|
| 64 |
+
|
| 65 |
+
|
| 66 |
+
class RewardFunctionInfo(BaseModel):
|
| 67 |
+
"""Metadata used by a reward function to evaluate a solution."""
|
| 68 |
+
|
| 69 |
+
fxn_name: str = Field(description="Name of the reward function to use.")
|
| 70 |
+
answer_info: str = Field(
|
| 71 |
+
description="Serialized metadata used by the reward function."
|
| 72 |
+
)
|
| 73 |
+
problem_type: str = Field(description="Problem type, for reference.")
|
| 74 |
+
|
| 75 |
+
@model_validator(mode="before")
|
| 76 |
+
@classmethod
|
| 77 |
+
def check_card_number_not_present(cls, data: Any) -> Any:
|
| 78 |
+
if isinstance(data, str):
|
| 79 |
+
# Deserialize from a string 3-tuple
|
| 80 |
+
fn, ainfo, pt = data.split(SOLUTION_DELIMITER, maxsplit=2)
|
| 81 |
+
return {"fxn_name": fn, "answer_info": ainfo, "problem_type": pt}
|
| 82 |
+
return data
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
class QAExample(BaseModel):
|
| 86 |
+
"""Question-answer example with reward function info."""
|
| 87 |
+
|
| 88 |
+
id: str = Field(description="Unique identifier for this example.")
|
| 89 |
+
problem: str = Field(description="Problem to solve.")
|
| 90 |
+
problem_type: str = Field(description="Problem type, for reference or filtering.")
|
| 91 |
+
solution: RewardFunctionInfo = Field(
|
| 92 |
+
description="Metadata for the reward function."
|
| 93 |
+
)
|
| 94 |
+
ideal: str | None = Field(
|
| 95 |
+
description=(
|
| 96 |
+
"An optional ideal answer. This could be a candidate SMILES, a log10 of"
|
| 97 |
+
" water solubility, or None if having an ideal does not make sense."
|
| 98 |
+
)
|
| 99 |
+
)
|
| 100 |
+
unformatted: str | None = Field(
|
| 101 |
+
description=(
|
| 102 |
+
"Optional raw data used to generate the problem, used for traceability."
|
| 103 |
+
)
|
| 104 |
+
)
|
| 105 |
+
|
| 106 |
+
|
| 107 |
+
def filter_problem_types(
|
| 108 |
+
dataset: TDataset, problem_types: str | Collection[str] | None
|
| 109 |
+
) -> TDataset:
|
| 110 |
+
"""Filter a dataset by problem types.
|
| 111 |
+
|
| 112 |
+
Args:
|
| 113 |
+
dataset: The dataset to filter. Can be a single Dataset or a DatasetDict.
|
| 114 |
+
problem_types: A string or collection of strings specifying the problem
|
| 115 |
+
types to filter by.
|
| 116 |
+
- If None, the original dataset is returned.
|
| 117 |
+
- If a string or a collection of strings:
|
| 118 |
+
- Strings starting with "re:" are treated as regex patterns.
|
| 119 |
+
If a regex filter is provided, then it must be the only filter.
|
| 120 |
+
- Strings starting with "!" are treated as problem types to exclude.
|
| 121 |
+
- Other strings are treated as exact problem types to include.
|
| 122 |
+
- Mixing inclusion and exclusion rules (e.g. ["type_a", "!type_b"])
|
| 123 |
+
is not allowed.
|
| 124 |
+
|
| 125 |
+
Returns:
|
| 126 |
+
The filtered dataset.
|
| 127 |
+
"""
|
| 128 |
+
if problem_types is None:
|
| 129 |
+
return dataset
|
| 130 |
+
if isinstance(problem_types, str): # Assume single problem type as a string
|
| 131 |
+
problem_types = [problem_types]
|
| 132 |
+
problem_types = {pt.strip() for pt in problem_types}
|
| 133 |
+
|
| 134 |
+
columns = (
|
| 135 |
+
next(iter(dataset.values())) if isinstance(dataset, DatasetDict) else dataset
|
| 136 |
+
).column_names
|
| 137 |
+
# ether0-benchmark uses 'problem_type'; some variants may use 'type'
|
| 138 |
+
type_col = "problem_type" if "problem_type" in columns else "type"
|
| 139 |
+
|
| 140 |
+
if any(pt.startswith("re:") for pt in problem_types):
|
| 141 |
+
# A regex was passed in
|
| 142 |
+
if len(problem_types) != 1:
|
| 143 |
+
raise ValueError(
|
| 144 |
+
"If filtering by regex, only one filter is supported,"
|
| 145 |
+
f" passed {problem_types}."
|
| 146 |
+
)
|
| 147 |
+
regex = re.compile(next(iter(problem_types)).removeprefix("re:"))
|
| 148 |
+
|
| 149 |
+
def filter_func(x):
|
| 150 |
+
return regex.match(x[type_col]) is not None
|
| 151 |
+
|
| 152 |
+
else:
|
| 153 |
+
# Treat as exact string match
|
| 154 |
+
valid_problem_types = {pt for pt in problem_types if not pt.startswith("!")}
|
| 155 |
+
invalid_problem_types = {
|
| 156 |
+
pt.removeprefix("!") for pt in problem_types if pt.startswith("!")
|
| 157 |
+
}
|
| 158 |
+
if valid_problem_types:
|
| 159 |
+
if invalid_problem_types:
|
| 160 |
+
raise ValueError(
|
| 161 |
+
"Cannot specify both problem types to keep and to exclude,"
|
| 162 |
+
f" passed {problem_types}."
|
| 163 |
+
)
|
| 164 |
+
|
| 165 |
+
def filter_func(x):
|
| 166 |
+
return x[type_col] in valid_problem_types
|
| 167 |
+
|
| 168 |
+
else:
|
| 169 |
+
|
| 170 |
+
def filter_func(x):
|
| 171 |
+
return x[type_col] not in invalid_problem_types
|
| 172 |
+
|
| 173 |
+
return dataset.filter(filter_func, desc="Filtering problem types")
|
src/ether0/problem_prompts.py
ADDED
|
@@ -0,0 +1,196 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
"""Prompt templates used for problems in the ether0 dataset."""
|
| 2 |
+
|
| 3 |
+
# ruff: noqa: E501, W505
|
| 4 |
+
|
| 5 |
+
NAME_IUPAC_PROMPTS = [
|
| 6 |
+
"What are the SMILES from the IUPAC name: {iupac}?",
|
| 7 |
+
"Could you please tell me the SMILES representation for {iupac}?",
|
| 8 |
+
"I have {iupac}. What would its SMILES be?",
|
| 9 |
+
"Provide the SMILES string for the molecule named {iupac}.",
|
| 10 |
+
"Convert this IUPAC name into a SMILES format: {iupac}.",
|
| 11 |
+
"Give me the SMILES notation for the compound {iupac}.",
|
| 12 |
+
"What SMILES corresponds to the IUPAC chemical name {iupac}?",
|
| 13 |
+
"How can I represent {iupac} as a SMILES string?",
|
| 14 |
+
"Generate the SMILES structure for this compound: {iupac}.",
|
| 15 |
+
"If the molecule is called {iupac}, what's the SMILES representation?",
|
| 16 |
+
]
|
| 17 |
+
|
| 18 |
+
NAME_SMILES_PROMPTS = [
|
| 19 |
+
"What is the IUPAC name of this molecule: {smiles}?",
|
| 20 |
+
"Could you please tell me the IUPAC name for the compound represented by the SMILES string: {smiles}?",
|
| 21 |
+
"I have a molecule here with the SMILES notation {smiles}. What would its IUPAC name be?",
|
| 22 |
+
"I'm working with a chemical compound, and its SMILES representation is {smiles}. Can you help me determine its IUPAC name?",
|
| 23 |
+
"What is the correct IUPAC nomenclature for a molecule with the SMILES code {smiles}?",
|
| 24 |
+
"I'm trying to identify a compound. Its SMILES string is {smiles}. What's its IUPAC name?",
|
| 25 |
+
"If I provide you with the SMILES string of a molecule, which is {smiles}, could you generate its IUPAC name for me?",
|
| 26 |
+
"I've encountered a molecule in my research, denoted by the SMILES {smiles}. I'd appreciate it if you could tell me its IUPAC name.",
|
| 27 |
+
"Can you derive the IUPAC name from this SMILES representation: {smiles}?",
|
| 28 |
+
"For a compound with the structural representation given by the SMILES {smiles}, what is the corresponding IUPAC name?",
|
| 29 |
+
]
|
| 30 |
+
|
| 31 |
+
|
| 32 |
+
REACTION_PROMPTS = [
|
| 33 |
+
"What is the product of this reaction? {rxn_smiles}",
|
| 34 |
+
"If {rxn_smiles} are allowed to react, what would the resulting molecule be in SMILES format?",
|
| 35 |
+
"Can you predict the outcome of this chemical reaction? {rxn_smiles}",
|
| 36 |
+
"I have a reaction scheme here: {rxn_smiles}. What will be generated as the product?",
|
| 37 |
+
"Assuming the reaction {rxn_smiles} goes to completion, what is the SMILES representation of the product?",
|
| 38 |
+
"In this reaction: {rxn_smiles}, what compound is formed?",
|
| 39 |
+
"Given the reactants and conditions in {rxn_smiles}, what is the expected product?",
|
| 40 |
+
"After performing the reaction {rxn_smiles}, what would I obtain as the main product?",
|
| 41 |
+
"If I mix these reactants under the specified conditions, {rxn_smiles}, what is the SMILES of the product?",
|
| 42 |
+
"Please provide the SMILES string of the product for this reaction: {rxn_smiles}",
|
| 43 |
+
]
|
| 44 |
+
|
| 45 |
+
NAME_REACTION_PROMPTS = [
|
| 46 |
+
"What is the name of this reaction?\n{rxn_smiles}",
|
| 47 |
+
"I have a reaction here with {rxn_smiles}. Can you tell me its commonly used name?",
|
| 48 |
+
"Given the reaction represented by {rxn_smiles}, what is the standard name associated with it?",
|
| 49 |
+
"If I were to describe this reaction, {rxn_smiles}, in a textbook, what reaction name would I use?",
|
| 50 |
+
"I'm trying to identify this reaction: {rxn_smiles}. What is its well-known name?",
|
| 51 |
+
"The reaction {rxn_smiles} is taking place. What's the name of this type of transformation?",
|
| 52 |
+
"I came across this reaction pathway: {rxn_smiles}. Do you know the name it generally goes by?",
|
| 53 |
+
"In the context of organic chemistry, what is the established name for the reaction shown here: {rxn_smiles}?",
|
| 54 |
+
"I'm writing a lab report and need to name this reaction, {rxn_smiles}. What should I call it?",
|
| 55 |
+
"Can you identify the name of the reaction that follows this scheme: {rxn_smiles}?",
|
| 56 |
+
]
|
| 57 |
+
|
| 58 |
+
COMPLETE_MOL_PROMPTS = [
|
| 59 |
+
"I have a partial molecule represented by the SMILES string {smiles}. What is a valid completion of this molecule, providing only the remaining characters in SMILES format?",
|
| 60 |
+
"Given the incomplete SMILES fragment {smiles}, can you suggest a realistic ending to complete the molecule? Please provide only the additional SMILES characters needed.",
|
| 61 |
+
"I'm working with a molecule that's partially described as {smiles}. What sequence of SMILES characters would you add to make it a complete, valid molecule?",
|
| 62 |
+
"The beginning of a molecule's SMILES representation is {smiles}. How would you finish this SMILES string to represent a viable chemical compound? Only provide the continuation of the SMILES.",
|
| 63 |
+
"Imagine you need to complete the SMILES string {smiles}. What's a plausible way to extend it to form a complete molecule, expressed as the remaining SMILES characters?",
|
| 64 |
+
"If I give you the partial SMILES {smiles}, what's a reasonable way to finish it off to create a valid molecule? Respond with just the additional SMILES characters.",
|
| 65 |
+
"I'm trying to construct a molecule, and I have the start of its SMILES: {smiles}. Could you provide a completion for it, ensuring the final molecule is realistic? Only give me the rest of the SMILES string.",
|
| 66 |
+
"Here's a fragment of a SMILES string: {smiles}. What would be a chemically sound way to complete it? Respond with the missing portion of the SMILES representation.",
|
| 67 |
+
"Suppose you have the incomplete molecular structure {smiles} in SMILES. How would you complete it to represent a real molecule, adding only the necessary SMILES characters?",
|
| 68 |
+
"I have an unfinished molecule represented by the SMILES fragment {smiles}. Can you help me complete it by suggesting the remaining SMILES characters needed to make it a valid chemical structure?",
|
| 69 |
+
]
|
| 70 |
+
|
| 71 |
+
MOL_FORMULA_PROMPTS = [
|
| 72 |
+
"A compound with formula {formula} was isolated from {source}. What is a plausible SMILES for it given this organism?",
|
| 73 |
+
"{source} makes a compound with this formula: {formula}. What SMILES structure might correspond to it?",
|
| 74 |
+
"In {source}, I found a substance with formula {formula}. What biosynthetically plausible SMILES might this represent?",
|
| 75 |
+
"Analysis of {source} revealed a compound ({formula}). What SMILES structure aligns with this organism's metabolism?",
|
| 76 |
+
"The organism {source} contains a compound with formula {formula}. What's a likely SMILES based on its biochemistry?",
|
| 77 |
+
"A {formula} compound was extracted from {source}. Based on this organism, what's a probable SMILES structure?",
|
| 78 |
+
"What SMILES could have the formula {formula} and be isolated from {source}?",
|
| 79 |
+
"What would be a biologically relevant SMILES for a {formula} compound isolated from the organism {source}?",
|
| 80 |
+
"The organism {source} produced a compound with formula {formula}, what SMILES structure makes biosynthetic sense?",
|
| 81 |
+
"A {formula} metabolite from {source} was identified. What's a biologically plausible compound for this (as SMILES)?",
|
| 82 |
+
]
|
| 83 |
+
|
| 84 |
+
FUNCTIONAL_GROUP_PROMPTS = [
|
| 85 |
+
"Propose a compound with molecular formula {formula} that contains the following functional groups: {functional_group}.",
|
| 86 |
+
"Suggest a SMILES structure for a molecule with formula {formula} and the following functional groups: {functional_group}.",
|
| 87 |
+
"Given that a compound has formula {formula}, propose SMILES for one that also contains these groups: {functional_group}",
|
| 88 |
+
"Provide a reasonable SMILES for a chemical with molecular formula {formula} and these groups: {functional_group}.",
|
| 89 |
+
"Generate a SMILES representation for a molecule containing groups: {functional_group}. It should also have formula {formula}.",
|
| 90 |
+
"Identify a plausible SMILES for a chemical compound with formula {formula} containing these groups: {functional_group}.",
|
| 91 |
+
]
|
| 92 |
+
|
| 93 |
+
PROPERTY_TRIPLET_PROMPTS = [
|
| 94 |
+
"I have a molecule {smiles1} with a {property} of {value1}. Which of these similar molecules will most likely {change} this property?\n{options}",
|
| 95 |
+
"Given a molecule ({smiles1}) having a {property} of {value1}, select the modified molecule below that would {change} this property significantly:\n{options}",
|
| 96 |
+
"Molecule {smiles1} currently exhibits {property} of {value1}. Which modifications from the list below would effectively {change} it?\n{options}",
|
| 97 |
+
"If molecule {smiles1} has a {property} value of {value1}, which of the following options would best {change} this property?\n{options}",
|
| 98 |
+
"Considering {smiles1} has a measured {property} of {value1}, which candidate modification listed would most effectively {change} this property?\n{options}",
|
| 99 |
+
"Molecule {smiles1} demonstrates a {property} of {value1}. Which similar molecule below is best suited to {change} this characteristic?\n{options}",
|
| 100 |
+
"Given molecule {smiles1} with {property} at {value1}, identify which molecule among the following options would {change} it most effectively:\n{options}",
|
| 101 |
+
"Starting from molecule {smiles1}, which shows a {property} of {value1}, choose the structural change below that would notably {change} this property:\n{options}",
|
| 102 |
+
"The molecule {smiles1} has a {property} of {value1}. Which molecule listed would optimally {change} this value?\n{options}",
|
| 103 |
+
"Given a {property} of {value1} for molecule {smiles1}, pick the best molecule from below to {change} this property:\n{options}",
|
| 104 |
+
]
|
| 105 |
+
|
| 106 |
+
# I have a molecule {smiles1} which is not a blood-brain barrier penetrating. Which of these similar molecules will most likely have this property?\n{options}",
|
| 107 |
+
PROPERTY_TRIPLET_PROMPTS_CAT = [
|
| 108 |
+
"I have a molecule {smiles1} which {rel} {property}. Which of these similar molecules will most likely {irel} this property?\n{options}",
|
| 109 |
+
"Given molecule {smiles1} that {rel} {property}, which molecule below is likely to {irel} this property?\n{options}",
|
| 110 |
+
"Molecule {smiles1} currently {rel} {property}. Choose from these similar molecules the one most likely to {irel} this property:\n{options}",
|
| 111 |
+
"Considering {smiles1} {rel} {property}, identify which of the following candidates will most likely {irel} the characteristic:\n{options}",
|
| 112 |
+
"Given that molecule {smiles1} {rel} {property}, select from below the molecule most expected to {irel} this characteristic:\n{options}",
|
| 113 |
+
"Starting from molecule {smiles1} which {rel} {property}, determine which listed molecule is most likely to {irel} this property:\n{options}",
|
| 114 |
+
"If molecule {smiles1} {rel} {property}, which of these related structures will most probably {irel} that property?\n{options}",
|
| 115 |
+
"Given molecule {smiles1} {rel} {property}, select the similar molecule listed below most likely to {irel} this property:\n{options}",
|
| 116 |
+
]
|
| 117 |
+
|
| 118 |
+
# Which of the following options likely is a blood-brain barrier penetrating molecule?
|
| 119 |
+
# Which of the following options likely is not a blood-brain barrier penetrating molecule?
|
| 120 |
+
# Which of the following molecules is likely to not be blood-brain barrier penetrating?
|
| 121 |
+
PROPERTY_PROMPTS_CAT = [
|
| 122 |
+
"Which of the following options likely is{rel} a {property} molecule?\n{options}",
|
| 123 |
+
"Which of the following molecules is likely to{rel} be {property}?\n{options}",
|
| 124 |
+
"Identify the molecule below that likely is{rel} a {property} molecule:\n{options}",
|
| 125 |
+
"From the list below, select the molecule most likely to{rel} be {property}:\n{options}",
|
| 126 |
+
"Choose the molecule from the options below that most probably is{rel} {property}:\n{options}",
|
| 127 |
+
"Among the following, which molecule likely is{rel} considered {property}?\n{options}",
|
| 128 |
+
"Select the molecule below most expected to{rel} have {property} properties:\n{options}",
|
| 129 |
+
"From these molecules, identify the one most likely to{rel} possess {property}:\n{options}",
|
| 130 |
+
"Which candidate below most probably is{rel} classified as a {property} molecule?\n{options}",
|
| 131 |
+
]
|
| 132 |
+
|
| 133 |
+
|
| 134 |
+
PROPERTY_PROMPTS = [
|
| 135 |
+
"Which of the following molecules likely has a {property} of {value}?\n{options}",
|
| 136 |
+
"Identify the molecule below expected to have a {property} around {value}:\n{options}",
|
| 137 |
+
"From these options, select the molecule most likely exhibiting {property} of {value}:\n{options}",
|
| 138 |
+
"Determine which of the following molecules likely shows a {property} near {value}:\n{options}",
|
| 139 |
+
"Choose the molecule that would most plausibly have a {property} of {value} from the list below:\n{options}",
|
| 140 |
+
"Among the following, which molecule is predicted to have a {property} close to {value}?\n{options}",
|
| 141 |
+
"Given the choices below, pick the molecule most likely to possess a {property} of {value}:\n{options}",
|
| 142 |
+
"Select the molecule from these candidates that probably has a {property} of {value}:\n{options}",
|
| 143 |
+
"Which molecule listed here is most likely to have a {property} approximately equal to {value}?\n{options}",
|
| 144 |
+
"Identify which of the following molecules will most likely have a {property} of {value}:\n{options}",
|
| 145 |
+
]
|
| 146 |
+
|
| 147 |
+
RETRO_PROMPTS = [
|
| 148 |
+
"Propose a 1-step synthesis for the molecule {smiles} using likely purchasable reactants.",
|
| 149 |
+
"Given the molecule {smiles}, suggest a 1-step synthesis using commercially available starting materials.",
|
| 150 |
+
"What is a plausible 1-step reaction for the molecule {smiles} using common reactants?",
|
| 151 |
+
"Suggest a commercially feasible one-step route to synthesize {smiles}.",
|
| 152 |
+
"Outline a practical single-step synthetic method to prepare the molecule {smiles}.",
|
| 153 |
+
"Design a straightforward 1-step reaction scheme for synthesizing {smiles} using commercially available reagents.",
|
| 154 |
+
"Identify a likely accessible precursor and reaction for a single-step synthesis of {smiles}.",
|
| 155 |
+
"Provide a realistic single-step synthetic pathway to obtain {smiles} from common chemicals.",
|
| 156 |
+
"Propose a viable one-step synthetic route toward the molecule {smiles} starting from purchasable precursors.",
|
| 157 |
+
"Suggest one plausible reaction step to generate {smiles} using standard, commercially sourced reactants.",
|
| 158 |
+
]
|
| 159 |
+
|
| 160 |
+
ORACLE_SOLUBILITY_PROMPTS = {
|
| 161 |
+
"tanimoto": [
|
| 162 |
+
"Propose a small change to {smiles} to {direction} its solubility by about 1 logS.",
|
| 163 |
+
"Suggest a minimal structural modification to {smiles} that would {direction} its solubility by approximately 1 logS unit.",
|
| 164 |
+
"What minor alteration could be made to {smiles} to {direction} its solubility by roughly 1 logS?",
|
| 165 |
+
"Design a small molecular change to {smiles} that would {direction} its solubility by about 1 logS while maintaining overall similarity.",
|
| 166 |
+
"Identify a small structural adjustment to {smiles} that would {direction} its aqueous solubility by approximately 1 logS unit.",
|
| 167 |
+
],
|
| 168 |
+
"scaffold": [
|
| 169 |
+
"Change {smiles} to {direction} its solubility by about 1 logS, but keep its scaffold",
|
| 170 |
+
"Modify {smiles} to {direction} its solubility by approximately 1 logS while preserving the core scaffold structure.",
|
| 171 |
+
"Suggest alterations to {smiles} that would {direction} its solubility by about 1 logS unit without changing the molecular scaffold.",
|
| 172 |
+
"How could {smiles} be transformed to {direction} its solubility by roughly 1 logS while maintaining its scaffold?",
|
| 173 |
+
"Design a derivative of {smiles} with {direction}d solubility (by about 1 logS) that retains the same molecular scaffold.",
|
| 174 |
+
],
|
| 175 |
+
"groups": [
|
| 176 |
+
"Adjust {smiles} to {direction} its solubility by about 1 logS, but keep the following groups intact: {pretty_groups}",
|
| 177 |
+
"Modify {smiles} to achieve a {direction} in solubility of approximately 1 logS while preserving these functional groups: {pretty_groups}",
|
| 178 |
+
"How would you alter {smiles} to {direction} its solubility by about 1 logS unit without changing these key groups: {pretty_groups}?",
|
| 179 |
+
"Suggest structural changes to {smiles} that would {direction} its solubility by roughly 1 logS while maintaining these groups: {pretty_groups}",
|
| 180 |
+
"Design a variant of {smiles} with {direction}d solubility (by about 1 logS) that retains all of these intact functional groups: {pretty_groups}",
|
| 181 |
+
],
|
| 182 |
+
}
|
| 183 |
+
|
| 184 |
+
SMILES_FROM_FORMULA_PROMPTS = [
|
| 185 |
+
"Propose a molecule that has the following formula: {formula}.",
|
| 186 |
+
"Generate a SMILES representation for a compound with the formula {formula}.",
|
| 187 |
+
"What is a plausible SMILES for a compound with the formula {formula}?",
|
| 188 |
+
"Given the formula {formula}, can you suggest a possible SMILES structure?",
|
| 189 |
+
"Create a SMILES representation for a molecule that corresponds to the formula {formula}.",
|
| 190 |
+
"Identify a potential SMILES for a compound with the molecular formula {formula}.",
|
| 191 |
+
"What SMILES structure could correspond to the formula {formula}?",
|
| 192 |
+
"Generate a plausible SMILES for a compound with the formula {formula}.",
|
| 193 |
+
"Given the formula {formula}, what would be a reasonable SMILES representation?",
|
| 194 |
+
"Propose a SMILES structure for a molecule with the formula {formula}.",
|
| 195 |
+
"Generate a SMILES representation for a compound with the formula {formula}.",
|
| 196 |
+
]
|
src/ether0/py.typed
ADDED
|
File without changes
|
src/ether0/rewards.py
ADDED
|
@@ -0,0 +1,753 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import ast
|
| 2 |
+
import logging
|
| 3 |
+
import operator
|
| 4 |
+
import re
|
| 5 |
+
import unicodedata
|
| 6 |
+
from collections.abc import Iterable, Mapping, Sequence
|
| 7 |
+
from typing import Protocol, cast
|
| 8 |
+
|
| 9 |
+
import exmol
|
| 10 |
+
from pydantic import JsonValue
|
| 11 |
+
from rdkit import Chem, DataStructs
|
| 12 |
+
from rdkit.Chem import GetMolFrags, SanitizeMol # pylint: disable=no-name-in-module
|
| 13 |
+
from rdkit.Chem.rdMolDescriptors import ( # pylint: disable=no-name-in-module
|
| 14 |
+
CalcMolFormula,
|
| 15 |
+
GetMorganFingerprintAsBitVect,
|
| 16 |
+
)
|
| 17 |
+
from rdkit.Chem.rdmolfiles import MolToSmiles # pylint: disable=no-name-in-module
|
| 18 |
+
from rdkit.rdBase import BlockLogs
|
| 19 |
+
|
| 20 |
+
from ether0.clients import fetch_forward_rxn, fetch_purchasable, fetch_solubility
|
| 21 |
+
from ether0.data import is_reasonable_fp, is_reasonable_ring_system, mol_from_smiles
|
| 22 |
+
from ether0.model_prompts import extract_answer_loose, extract_thought_answer_strict
|
| 23 |
+
from ether0.models import RewardFunctionInfo, RewardReason
|
| 24 |
+
|
| 25 |
+
block = BlockLogs()
|
| 26 |
+
|
| 27 |
+
logger = logging.getLogger(__name__)
|
| 28 |
+
|
| 29 |
+
|
| 30 |
+
class RewardEvalFn(Protocol):
|
| 31 |
+
def __call__(
|
| 32 |
+
self,
|
| 33 |
+
yhat: str,
|
| 34 |
+
y: str,
|
| 35 |
+
soft: bool = False,
|
| 36 |
+
test: bool = False,
|
| 37 |
+
metadata: dict[str, JsonValue] | None = None,
|
| 38 |
+
) -> float: ...
|
| 39 |
+
|
| 40 |
+
|
| 41 |
+
def formula_diff(formula1: str, formula2: str) -> float:
|
| 42 |
+
"""Calculate l2 norm between two molecular formulas."""
|
| 43 |
+
# important = elements we care about in organic chem
|
| 44 |
+
important_elements = {"C", "H", "O", "N", "F", "Cl", "Br", "P", "S"}
|
| 45 |
+
pattern = re.compile(r"([A-Z][a-z]?)(\d*)")
|
| 46 |
+
counts1 = dict.fromkeys(important_elements, 0)
|
| 47 |
+
counts2 = dict.fromkeys(important_elements, 0)
|
| 48 |
+
for m in pattern.finditer(formula1):
|
| 49 |
+
element = m.group(1)
|
| 50 |
+
count = int(m.group(2)) if m.group(2) else 1
|
| 51 |
+
if element in important_elements:
|
| 52 |
+
counts1[element] += count
|
| 53 |
+
for m in pattern.finditer(formula2):
|
| 54 |
+
element = m.group(1)
|
| 55 |
+
count = int(m.group(2)) if m.group(2) else 1
|
| 56 |
+
if element in important_elements:
|
| 57 |
+
counts2[element] += count
|
| 58 |
+
d2 = sum((counts1[k] - counts2[k]) ** 2 for k in important_elements)
|
| 59 |
+
return d2**0.5
|
| 60 |
+
|
| 61 |
+
|
| 62 |
+
def format_reward(
|
| 63 |
+
completions,
|
| 64 |
+
reasoning: bool,
|
| 65 |
+
reward: float = 1.0,
|
| 66 |
+
**kwargs, # noqa: ARG001
|
| 67 |
+
) -> list[float]:
|
| 68 |
+
"""Reward function that checks if the completion has a specific format."""
|
| 69 |
+
if isinstance(completions[0], list):
|
| 70 |
+
completion_contents = [completion[0]["content"] for completion in completions]
|
| 71 |
+
else:
|
| 72 |
+
completion_contents = completions
|
| 73 |
+
# Note we check `answer is not None` since empty answer still counts as valid
|
| 74 |
+
# formatting.
|
| 75 |
+
return [
|
| 76 |
+
reward if answer is not None else 0.0
|
| 77 |
+
for answer in (
|
| 78 |
+
extract_thought_answer_strict(c, reasoning)[1] for c in completion_contents
|
| 79 |
+
)
|
| 80 |
+
]
|
| 81 |
+
|
| 82 |
+
|
| 83 |
+
SUPERSCRIPT_PATTERN = re.compile(r"\^{([\d,]+)}")
|
| 84 |
+
ITALICS_PATTERN = re.compile(r"{([a-zA-Z])}")
|
| 85 |
+
# parentheses that aren't nested or contain hyphens
|
| 86 |
+
# https://regex101.com/r/6c8smX/1
|
| 87 |
+
USELESS_PARENTHESES = re.compile(r"([-\d])[\(\[{]([A-Za-z0-9]+)[\]\)}]-")
|
| 88 |
+
|
| 89 |
+
|
| 90 |
+
def normalize_iupac(s: str) -> str:
|
| 91 |
+
"""Normalize an IUPAC name by removing special formatting and characters.
|
| 92 |
+
|
| 93 |
+
Args:
|
| 94 |
+
s: Original IUPAC name.
|
| 95 |
+
|
| 96 |
+
Returns:
|
| 97 |
+
A normalized IUPAC name without special characters.
|
| 98 |
+
"""
|
| 99 |
+
s = s.strip().casefold()
|
| 100 |
+
# replace ^{n} with ^(n)
|
| 101 |
+
s = SUPERSCRIPT_PATTERN.sub(r"^(\1)", s)
|
| 102 |
+
# remove italicized pattern - but don't match ^{1,5} (by avoiding matching commas)
|
| 103 |
+
s = ITALICS_PATTERN.sub(r"\1", s)
|
| 104 |
+
# remove garbage
|
| 105 |
+
s = s.replace("$", "").replace("~", "") # noqa: FURB184
|
| 106 |
+
# remove parentheses that aren't nested or contain hyphens
|
| 107 |
+
s = USELESS_PARENTHESES.sub(r"\1\2-", s)
|
| 108 |
+
# ok to ignore carrots and hpyhens for comparison
|
| 109 |
+
return s.replace("^", "").replace(" ", "-") # noqa: FURB184
|
| 110 |
+
|
| 111 |
+
|
| 112 |
+
def normalize_unicodes(s: str) -> str:
|
| 113 |
+
"""Normalize all Unicode dashes/hyphens to regular hyphen.
|
| 114 |
+
|
| 115 |
+
Args:
|
| 116 |
+
s: Input string with potential Unicode characters.
|
| 117 |
+
|
| 118 |
+
Returns:
|
| 119 |
+
Unicode-normalized string.
|
| 120 |
+
"""
|
| 121 |
+
s = unicodedata.normalize("NFKC", s)
|
| 122 |
+
s = "".join("-" if unicodedata.category(c) in {"Pd", "Po"} else c for c in s)
|
| 123 |
+
return s.replace("-", "") # minus sign # noqa: FURB184
|
| 124 |
+
|
| 125 |
+
|
| 126 |
+
def is_reasonable_molecule(
|
| 127 |
+
mol: Chem.Mol,
|
| 128 |
+
metadata: dict[str, JsonValue] | None,
|
| 129 |
+
test: bool, # noqa: ARG001
|
| 130 |
+
ref_mol: Chem.Mol | None = None,
|
| 131 |
+
) -> bool:
|
| 132 |
+
"""Returns True if the molecule passes heuristics for being a reasonable molecule."""
|
| 133 |
+
# always check valence
|
| 134 |
+
try:
|
| 135 |
+
SanitizeMol(mol)
|
| 136 |
+
except Exception:
|
| 137 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 138 |
+
return False
|
| 139 |
+
|
| 140 |
+
# We have decided that the convention will be to check the
|
| 141 |
+
# same at test time and train time.
|
| 142 |
+
|
| 143 |
+
# determine if we have counter-ions (which is fine), but we want to
|
| 144 |
+
# evaluate the largest molecule only. We only consider single molecules
|
| 145 |
+
# or single molecules + a counterion as valid responses
|
| 146 |
+
sorted_frags = sorted( # sort by size
|
| 147 |
+
GetMolFrags(mol, asMols=True), key=lambda m: m.GetNumAtoms(), reverse=True
|
| 148 |
+
)
|
| 149 |
+
if len(sorted_frags) > 2: # noqa: PLR2004
|
| 150 |
+
# not a counter-ion
|
| 151 |
+
RewardReason.FAILED_COUNTERION_CHECK.set_reason(metadata)
|
| 152 |
+
return False
|
| 153 |
+
if len(sorted_frags) == 2: # noqa: PLR2004
|
| 154 |
+
# If 2, assume first is counter-ion, and double check it's small
|
| 155 |
+
cmol = sorted_frags[1]
|
| 156 |
+
if cmol.GetNumHeavyAtoms() > 5: # noqa: PLR2004
|
| 157 |
+
RewardReason.FAILED_COUNTERION_CHECK.set_reason(metadata)
|
| 158 |
+
return False
|
| 159 |
+
|
| 160 |
+
mol = sorted_frags[0]
|
| 161 |
+
|
| 162 |
+
ring_status = is_reasonable_ring_system(mol, ref_mol)
|
| 163 |
+
|
| 164 |
+
if not ring_status:
|
| 165 |
+
RewardReason.FAILED_RING_CHECK.set_reason(metadata)
|
| 166 |
+
return False
|
| 167 |
+
|
| 168 |
+
failure = is_reasonable_fp(mol, ref_mol)
|
| 169 |
+
if not failure:
|
| 170 |
+
RewardReason.FAILED_REOS_CHECK.set_reason(metadata)
|
| 171 |
+
return False
|
| 172 |
+
return True
|
| 173 |
+
|
| 174 |
+
|
| 175 |
+
FULL_SMILES_KEY = "full_smiles"
|
| 176 |
+
|
| 177 |
+
|
| 178 |
+
def set_full_smiles(smiles: str, metadata: dict[str, JsonValue] | None) -> None:
|
| 179 |
+
if metadata is not None:
|
| 180 |
+
metadata[FULL_SMILES_KEY] = smiles
|
| 181 |
+
|
| 182 |
+
|
| 183 |
+
BAD_SMARTS_PATTERNS = [
|
| 184 |
+
"[#16]-[#16]-[#16]", # More than a thiol bond
|
| 185 |
+
"[#8]~[#8]", # Peroxides
|
| 186 |
+
"[#7]-[NH2]", # Hydrazines
|
| 187 |
+
"[#7]-[NH3]", # weird charged amine
|
| 188 |
+
"[#7]~[#7]~[#7]", # 3 or more amines
|
| 189 |
+
"[NX2](=[OX1])[O;$([X2]),$([X1-])]", # Nitrite
|
| 190 |
+
"[SX2][NX2]=[OX1]", # Thionitrite
|
| 191 |
+
"[$([NX3](=[OX1])(=[OX1])[O;$([X2]),$([X1-])]),$([NX3+]([OX1-])(=[OX1])[O;$([X2]),$([X1-])])]", # Nitrate # noqa: E501
|
| 192 |
+
"[$([NX3](=O)=O),$([NX3+](=O)[O-])][!#8]", # Nitro
|
| 193 |
+
"[NX2](=[OX1])[!#7;!#8]", # Nitroso
|
| 194 |
+
"[CX4]" + ("-[CX4]" * 6), # Long chain of carbons (7 or more)
|
| 195 |
+
]
|
| 196 |
+
|
| 197 |
+
|
| 198 |
+
def contains_bad_substruct(mol: Chem.Mol) -> bool:
|
| 199 |
+
return any(
|
| 200 |
+
mol.HasSubstructMatch(Chem.MolFromSmarts(pat)) for pat in BAD_SMARTS_PATTERNS
|
| 201 |
+
)
|
| 202 |
+
|
| 203 |
+
|
| 204 |
+
def rxn_eval(
|
| 205 |
+
yhat: str,
|
| 206 |
+
y: str,
|
| 207 |
+
soft: bool = False, # noqa: ARG001
|
| 208 |
+
test: bool = False, # noqa: ARG001
|
| 209 |
+
metadata: dict[str, JsonValue] | None = None, # noqa: ARG001
|
| 210 |
+
) -> float:
|
| 211 |
+
"""Returns 1.0 if strings match (case-insensitive), otherwise 0.0."""
|
| 212 |
+
# some normalization for IUPAC names - shouldn't affect others
|
| 213 |
+
|
| 214 |
+
if normalize_iupac(yhat) == normalize_iupac(y):
|
| 215 |
+
return 1.0
|
| 216 |
+
|
| 217 |
+
# If that fails (would return 0), try normalizing further
|
| 218 |
+
return (
|
| 219 |
+
1.0
|
| 220 |
+
if normalize_unicodes(normalize_iupac(yhat))
|
| 221 |
+
== normalize_unicodes(normalize_iupac(y))
|
| 222 |
+
else 0.0
|
| 223 |
+
)
|
| 224 |
+
|
| 225 |
+
|
| 226 |
+
def str_eval(
|
| 227 |
+
yhat: str,
|
| 228 |
+
y: str,
|
| 229 |
+
soft: bool = False, # noqa: ARG001
|
| 230 |
+
test: bool = False, # noqa: ARG001
|
| 231 |
+
metadata: dict[str, JsonValue] | None = None,
|
| 232 |
+
) -> float:
|
| 233 |
+
"""Returns 1.0 if strings match (case-insensitive), otherwise 0.0."""
|
| 234 |
+
set_full_smiles(yhat, metadata)
|
| 235 |
+
return 1.0 if normalize_iupac(yhat) == normalize_iupac(y) else 0.0
|
| 236 |
+
|
| 237 |
+
|
| 238 |
+
def valid_mol_eval(
|
| 239 |
+
yhat: str,
|
| 240 |
+
y: str,
|
| 241 |
+
soft: bool = False, # noqa: ARG001
|
| 242 |
+
test: bool = False,
|
| 243 |
+
metadata: dict[str, JsonValue] | None = None,
|
| 244 |
+
) -> float:
|
| 245 |
+
"""Validate if yhat is a valid SMILES string, when appended to y.
|
| 246 |
+
|
| 247 |
+
Args:
|
| 248 |
+
yhat: Model-predicted SMILES string or partial completion.
|
| 249 |
+
y: Base SMILES string (e.g. "O=C1CCC2=CC=C(O)C(OC)=C2C#CCC2=CC3=C4") to append
|
| 250 |
+
yhat and check validity.
|
| 251 |
+
test: unused
|
| 252 |
+
soft: unused
|
| 253 |
+
metadata: optional metadata dictionary
|
| 254 |
+
|
| 255 |
+
Returns:
|
| 256 |
+
1.0 if `y + yhat` is a valid SMILES string, 0.0 otherwise.
|
| 257 |
+
"""
|
| 258 |
+
if not yhat:
|
| 259 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 260 |
+
return 0.0
|
| 261 |
+
|
| 262 |
+
# First attempt yhat alone (assuming full SMILES), then try y+yhat (assuming
|
| 263 |
+
# partial) if that fails
|
| 264 |
+
for smiles in (yhat, y + yhat):
|
| 265 |
+
if not smiles.startswith(y):
|
| 266 |
+
# only accept a solution containing the answer
|
| 267 |
+
continue
|
| 268 |
+
try:
|
| 269 |
+
mol = mol_from_smiles(smiles)
|
| 270 |
+
except Exception:
|
| 271 |
+
logger.exception(
|
| 272 |
+
f"Failed to construct molecule from SMILES string {yhat!r}."
|
| 273 |
+
)
|
| 274 |
+
continue
|
| 275 |
+
if mol is not None:
|
| 276 |
+
set_full_smiles(smiles, metadata)
|
| 277 |
+
if not is_reasonable_molecule(mol, metadata, test):
|
| 278 |
+
return 0.0
|
| 279 |
+
return 1.0
|
| 280 |
+
|
| 281 |
+
# Nothing worked - mark as invalid
|
| 282 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 283 |
+
return 0.0
|
| 284 |
+
|
| 285 |
+
|
| 286 |
+
SMOOTH_THRESHOLD_TANIMOTO_SIMILARITY = 0.7 # close enough
|
| 287 |
+
|
| 288 |
+
|
| 289 |
+
def tanimoto_similarity(
|
| 290 |
+
m1: Chem.Mol | None, m2: Chem.Mol | None, atom_threshold: float = 10.0
|
| 291 |
+
) -> float:
|
| 292 |
+
"""Calculate Tanimoto similarity between two molecules.
|
| 293 |
+
|
| 294 |
+
The `atom_threshold` parameter is a relative fraction (e.g., `0.2` for 20%)
|
| 295 |
+
that sets a threshold for degenerate cases when the fingerprints are similar,
|
| 296 |
+
but there are many more atoms in one molecule.
|
| 297 |
+
|
| 298 |
+
Default is 10.0, which corresponds to a 1000% difference and has no practical effect.
|
| 299 |
+
"""
|
| 300 |
+
if m1 is None or m2 is None:
|
| 301 |
+
return 0.0
|
| 302 |
+
fp1 = GetMorganFingerprintAsBitVect(m1, 2)
|
| 303 |
+
fp2 = GetMorganFingerprintAsBitVect(m2, 2)
|
| 304 |
+
|
| 305 |
+
# heavy atom threshold
|
| 306 |
+
atoms1 = m1.GetNumHeavyAtoms()
|
| 307 |
+
atoms2 = m2.GetNumHeavyAtoms()
|
| 308 |
+
if (denom := max(atoms1, atoms2)) > 0:
|
| 309 |
+
# Do not apply the atom diff check if there are no heavy atoms.
|
| 310 |
+
# This is always safe, since the only way to avoid
|
| 311 |
+
# this block is if m1=m2=H2, which would pass anyway.
|
| 312 |
+
atom_diff = abs(atoms1 - atoms2) / denom
|
| 313 |
+
if atom_diff > atom_threshold:
|
| 314 |
+
return 0.0
|
| 315 |
+
return DataStructs.TanimotoSimilarity(fp1, fp2)
|
| 316 |
+
|
| 317 |
+
|
| 318 |
+
def exact_mol_match(m1: Chem.Mol, m2: Chem.Mol) -> float:
|
| 319 |
+
s1 = MolToSmiles(m1, canonical=True, isomericSmiles=True) # noqa: FURB120
|
| 320 |
+
s2 = MolToSmiles(m2, canonical=True, isomericSmiles=True) # noqa: FURB120
|
| 321 |
+
return 1.0 if s1 == s2 else 0.0
|
| 322 |
+
|
| 323 |
+
|
| 324 |
+
def get_largest_mol(smiles: str) -> Chem.Mol | None:
|
| 325 |
+
parts = smiles.split(".")
|
| 326 |
+
# Filter out small fragments (removes counter-ions) and invalid SMILES
|
| 327 |
+
mols = [
|
| 328 |
+
mol_from_smiles(p)
|
| 329 |
+
for p in parts
|
| 330 |
+
if (len(p) > 3 and mol_from_smiles(p) is not None) # noqa: PLR2004
|
| 331 |
+
]
|
| 332 |
+
if not mols:
|
| 333 |
+
return None
|
| 334 |
+
mols_atoms = []
|
| 335 |
+
for mol in mols:
|
| 336 |
+
n_atoms = None if mol is None else mol.GetNumAtoms()
|
| 337 |
+
if n_atoms is None:
|
| 338 |
+
raise NotImplementedError(f"Didn't handle {mol=} having None atoms.")
|
| 339 |
+
mols_atoms.append((mol, n_atoms))
|
| 340 |
+
return max(mols_atoms, key=operator.itemgetter(1))[0]
|
| 341 |
+
|
| 342 |
+
|
| 343 |
+
def product_eval(
|
| 344 |
+
yhat: str,
|
| 345 |
+
y: str,
|
| 346 |
+
soft: bool = False,
|
| 347 |
+
test: bool = False, # noqa: ARG001
|
| 348 |
+
metadata: dict[str, JsonValue] | None = None,
|
| 349 |
+
) -> float:
|
| 350 |
+
"""Computes the Tanimoto similarity of the largest fragments from two SMILES (if soft) or exact match (if not soft).
|
| 351 |
+
|
| 352 |
+
Returns:
|
| 353 |
+
Reward in [0, 1].
|
| 354 |
+
""" # noqa: E501,W505
|
| 355 |
+
m1 = get_largest_mol(yhat)
|
| 356 |
+
m2 = get_largest_mol(y)
|
| 357 |
+
|
| 358 |
+
if m1 is None:
|
| 359 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 360 |
+
return 0.0
|
| 361 |
+
if m2 is None:
|
| 362 |
+
RewardReason.INVALID_GROUND_TRUTH.set_reason(metadata)
|
| 363 |
+
logger.warning(f"Invalid ground truth molecule {y!r}.")
|
| 364 |
+
return 0.0
|
| 365 |
+
|
| 366 |
+
# don't use yhat directly since it may have multiple molecules
|
| 367 |
+
set_full_smiles(MolToSmiles(m1), metadata)
|
| 368 |
+
|
| 369 |
+
if soft:
|
| 370 |
+
return tanimoto_similarity(m1, m2)
|
| 371 |
+
|
| 372 |
+
return exact_mol_match(m1, m2) # exact match for non-soft mode
|
| 373 |
+
|
| 374 |
+
|
| 375 |
+
def caption_eval(
|
| 376 |
+
yhat: str,
|
| 377 |
+
y: str,
|
| 378 |
+
soft: bool = False,
|
| 379 |
+
test: bool = False,
|
| 380 |
+
metadata: dict[str, JsonValue] | None = None,
|
| 381 |
+
) -> float:
|
| 382 |
+
"""Currently forwards to product_eval, but also stores Tanimoto in metadata."""
|
| 383 |
+
if metadata is not None:
|
| 384 |
+
m1 = get_largest_mol(yhat)
|
| 385 |
+
m2 = get_largest_mol(y)
|
| 386 |
+
metadata["tanimoto"] = (
|
| 387 |
+
tanimoto_similarity(m1, m2) if (m1 is not None and m2 is not None) else 0.0
|
| 388 |
+
)
|
| 389 |
+
return product_eval(yhat, y, soft, test, metadata)
|
| 390 |
+
|
| 391 |
+
|
| 392 |
+
def formula_eval(
|
| 393 |
+
yhat: str,
|
| 394 |
+
y: str,
|
| 395 |
+
soft: bool = False,
|
| 396 |
+
test: bool = False,
|
| 397 |
+
metadata: dict[str, JsonValue] | None = None,
|
| 398 |
+
) -> float:
|
| 399 |
+
"""Check correct formula and Tanimoto similarity, giving a reward in [0, 1]."""
|
| 400 |
+
set_full_smiles(yhat, metadata)
|
| 401 |
+
mhat = mol_from_smiles(yhat)
|
| 402 |
+
m = mol_from_smiles(y)
|
| 403 |
+
if mhat is None:
|
| 404 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 405 |
+
return 0.0
|
| 406 |
+
if m is None:
|
| 407 |
+
RewardReason.INVALID_GROUND_TRUTH.set_reason(metadata)
|
| 408 |
+
logger.warning(f"Invalid ground truth molecule {y!r}.")
|
| 409 |
+
return 0.0
|
| 410 |
+
|
| 411 |
+
fhat = CalcMolFormula(mhat)
|
| 412 |
+
f = CalcMolFormula(m)
|
| 413 |
+
if fhat != f:
|
| 414 |
+
RewardReason.WRONG_FORMULA.set_reason(metadata)
|
| 415 |
+
return 0.0
|
| 416 |
+
|
| 417 |
+
if not is_reasonable_molecule(mhat, metadata, test, ref_mol=m):
|
| 418 |
+
return 0.0
|
| 419 |
+
|
| 420 |
+
return (
|
| 421 |
+
1.0
|
| 422 |
+
if tanimoto_similarity(mhat, m) >= SMOOTH_THRESHOLD_TANIMOTO_SIMILARITY
|
| 423 |
+
# Give partial credit if soft=True and we got the right formula
|
| 424 |
+
else (0.5 if soft else 0.0)
|
| 425 |
+
)
|
| 426 |
+
|
| 427 |
+
|
| 428 |
+
def functional_group_eval(
|
| 429 |
+
yhat: str,
|
| 430 |
+
y: str,
|
| 431 |
+
soft: bool = False,
|
| 432 |
+
test: bool = False,
|
| 433 |
+
metadata: dict[str, JsonValue] | None = None,
|
| 434 |
+
) -> float:
|
| 435 |
+
"""Match functional group and formula, giving a reward in [0, 1]."""
|
| 436 |
+
set_full_smiles(yhat, metadata)
|
| 437 |
+
mhat = mol_from_smiles(yhat)
|
| 438 |
+
if mhat is None:
|
| 439 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 440 |
+
return 0.0
|
| 441 |
+
|
| 442 |
+
y_args: tuple[str, list[str]] = ast.literal_eval(y)
|
| 443 |
+
|
| 444 |
+
formula = y_args[0]
|
| 445 |
+
groups = {g.lower() for g in y_args[1]}
|
| 446 |
+
|
| 447 |
+
fhat = CalcMolFormula(mhat)
|
| 448 |
+
if fhat != formula:
|
| 449 |
+
RewardReason.WRONG_FORMULA.set_reason(metadata)
|
| 450 |
+
return 0.0
|
| 451 |
+
|
| 452 |
+
groupshat: set[str] = {
|
| 453 |
+
f.lower() for f in exmol.get_functional_groups(mhat, return_all=True)
|
| 454 |
+
}
|
| 455 |
+
|
| 456 |
+
if not is_reasonable_molecule(mhat, metadata, test):
|
| 457 |
+
return 0.0
|
| 458 |
+
|
| 459 |
+
return (
|
| 460 |
+
1.0
|
| 461 |
+
if groups <= groupshat
|
| 462 |
+
# Give partial credit if soft=True and we got the right formula
|
| 463 |
+
else (0.5 if soft else 0.0)
|
| 464 |
+
)
|
| 465 |
+
|
| 466 |
+
|
| 467 |
+
def oracle_solubility_eval(
|
| 468 |
+
yhat: str,
|
| 469 |
+
y: str,
|
| 470 |
+
soft: bool = False, # noqa: ARG001
|
| 471 |
+
test: bool = False,
|
| 472 |
+
metadata: dict[str, JsonValue] | None = None,
|
| 473 |
+
) -> float:
|
| 474 |
+
"""Evaluate solubility prediction using remote, giving a reward in [0, 1]."""
|
| 475 |
+
set_full_smiles(yhat, metadata)
|
| 476 |
+
# we only want single molecules
|
| 477 |
+
if "." in yhat:
|
| 478 |
+
return 0.0
|
| 479 |
+
mhat = mol_from_smiles(yhat)
|
| 480 |
+
if mhat is None:
|
| 481 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 482 |
+
return 0.0
|
| 483 |
+
|
| 484 |
+
y_args: tuple[str, str | list[str], float | str, str] = ast.literal_eval(y)
|
| 485 |
+
constraint_type, constraint_data = y_args[:2]
|
| 486 |
+
target = float(y_args[2])
|
| 487 |
+
# Unused: direction = y_args[3] # noqa: ERA001
|
| 488 |
+
|
| 489 |
+
ref_mol: Chem.Mol | None = None
|
| 490 |
+
|
| 491 |
+
# first check constraint
|
| 492 |
+
if constraint_type == "scaffold":
|
| 493 |
+
ref_mol = mol_from_smiles(cast(str, constraint_data))
|
| 494 |
+
if ref_mol is None:
|
| 495 |
+
raise NotImplementedError(
|
| 496 |
+
f"Didn't handle when {constraint_data=} is invalid."
|
| 497 |
+
)
|
| 498 |
+
if not mhat.HasSubstructMatch(ref_mol):
|
| 499 |
+
RewardReason.FAILED_CONSTRAINT.set_reason(metadata)
|
| 500 |
+
return 0.0
|
| 501 |
+
elif constraint_type == "groups":
|
| 502 |
+
groups = [g.lower() for g in exmol.get_functional_groups(mhat, return_all=True)]
|
| 503 |
+
if not any(group.lower() in groups for group in constraint_data):
|
| 504 |
+
RewardReason.FAILED_CONSTRAINT.set_reason(metadata)
|
| 505 |
+
return 0.0
|
| 506 |
+
elif constraint_type == "tanimoto":
|
| 507 |
+
ref_mol = mol_from_smiles(cast(str, constraint_data))
|
| 508 |
+
if (
|
| 509 |
+
tanimoto_similarity(mhat, ref_mol, atom_threshold=0.2)
|
| 510 |
+
< SMOOTH_THRESHOLD_TANIMOTO_SIMILARITY
|
| 511 |
+
):
|
| 512 |
+
RewardReason.FAILED_CONSTRAINT.set_reason(metadata)
|
| 513 |
+
return 0.0
|
| 514 |
+
else:
|
| 515 |
+
raise ValueError(f"Unknown constraint type: {constraint_type}")
|
| 516 |
+
|
| 517 |
+
if not is_reasonable_molecule(mhat, metadata, test, ref_mol=ref_mol):
|
| 518 |
+
return 0.0
|
| 519 |
+
|
| 520 |
+
# make sure we hit the target
|
| 521 |
+
result = fetch_solubility(yhat)
|
| 522 |
+
if "solubility" in result:
|
| 523 |
+
solubility = result["solubility"]
|
| 524 |
+
delta = solubility - target
|
| 525 |
+
# hard coded to typical solubility accuracies
|
| 526 |
+
# we subtract 0.01 because some questions ask for
|
| 527 |
+
# 0.5 change and we don't want restatements to
|
| 528 |
+
# be matches
|
| 529 |
+
if abs(delta) > (0.5 - 0.01):
|
| 530 |
+
RewardReason.WRONG_NUMERICAL_ANSWER.set_reason(metadata)
|
| 531 |
+
return 0.0
|
| 532 |
+
return 1.0
|
| 533 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 534 |
+
return 0.0
|
| 535 |
+
|
| 536 |
+
|
| 537 |
+
def oracle_rxn_eval(
|
| 538 |
+
yhat: str,
|
| 539 |
+
y: str,
|
| 540 |
+
soft: bool = False,
|
| 541 |
+
test: bool = False, # noqa: ARG001
|
| 542 |
+
metadata: dict[str, JsonValue] | None = None,
|
| 543 |
+
) -> float:
|
| 544 |
+
"""Evaluate forward reaction prediction using remote, giving a reward in [0, 1]."""
|
| 545 |
+
if ">" not in yhat or "." not in yhat:
|
| 546 |
+
RewardReason.INVALID_RXN.set_reason(metadata)
|
| 547 |
+
return 0.0
|
| 548 |
+
|
| 549 |
+
# make sure there are not more than two angle brackets
|
| 550 |
+
if yhat.count(">") > 2: # noqa: PLR2004
|
| 551 |
+
RewardReason.INVALID_RXN.set_reason(metadata)
|
| 552 |
+
return 0.0
|
| 553 |
+
|
| 554 |
+
# ok now do real check on regex after heuristic checks
|
| 555 |
+
# adapted partly from https://gist.github.com/lsauer/1312860/264ae813c2bd2c27a769d261c8c6b38da34e22fb
|
| 556 |
+
# https://regex101.com/r/9bdE6H/1
|
| 557 |
+
# basically SMILES_THINGS>SMILES_THINGS | empty>
|
| 558 |
+
if not re.match(
|
| 559 |
+
r"^[^J][a-z0-9@+\-\[\]\(\)\\\/%=#$\.]{6,}>[a-z0-9@+\-\[\]\(\)\\\/%=#$\.]{0,}>",
|
| 560 |
+
yhat,
|
| 561 |
+
re.IGNORECASE, # lower = aromatic, which we're fine matching
|
| 562 |
+
):
|
| 563 |
+
RewardReason.INVALID_RXN.set_reason(metadata)
|
| 564 |
+
return 0.0
|
| 565 |
+
|
| 566 |
+
ymol = mol_from_smiles(y)
|
| 567 |
+
if ymol is None:
|
| 568 |
+
RewardReason.INVALID_GROUND_TRUTH.set_reason(metadata)
|
| 569 |
+
logger.warning(f"Invalid ground truth molecule {y!r}.")
|
| 570 |
+
return 0.0
|
| 571 |
+
|
| 572 |
+
reactant_smi = yhat.split(">")[0].split(".")
|
| 573 |
+
reactants = [mol_from_smiles(r) for r in reactant_smi]
|
| 574 |
+
if not all(x is not None for x in reactants):
|
| 575 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 576 |
+
return 0.0
|
| 577 |
+
|
| 578 |
+
reagents = [mol_from_smiles(r) for r in yhat.split(">")[1].split(".") if r.strip()]
|
| 579 |
+
if not all(x is not None for x in reagents):
|
| 580 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 581 |
+
return 0.0
|
| 582 |
+
|
| 583 |
+
# check products, if present, contain the desired product
|
| 584 |
+
products = [mol_from_smiles(r) for r in yhat.split(">")[2].split(".") if r.strip()]
|
| 585 |
+
# notice we pass if there are no products
|
| 586 |
+
if products:
|
| 587 |
+
if not all(x is not None for x in products):
|
| 588 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 589 |
+
return 0.0
|
| 590 |
+
if not any(exact_mol_match(m, ymol) == 1.0 for m in products): # type: ignore[arg-type]
|
| 591 |
+
RewardReason.INVALID_RXN.set_reason(metadata)
|
| 592 |
+
return 0.0
|
| 593 |
+
|
| 594 |
+
# Disallow products in the reactants or reagents
|
| 595 |
+
if any(exact_mol_match(m, ymol) == 1.0 for m in (reactants + reagents)): # type: ignore[arg-type]
|
| 596 |
+
RewardReason.PRODUCT_IS_REACTANT.set_reason(metadata)
|
| 597 |
+
return 0.0
|
| 598 |
+
|
| 599 |
+
# check that the reactants are purchasable
|
| 600 |
+
|
| 601 |
+
def is_small_so_probably_purchasable(smi: str) -> bool:
|
| 602 |
+
mol = mol_from_smiles(smi)
|
| 603 |
+
# Molecules with <= 4 heavy atoms are likely purchasable,
|
| 604 |
+
# since they include solvents and counterions
|
| 605 |
+
return mol is not None and mol.GetNumHeavyAtoms() <= 4 # noqa: PLR2004
|
| 606 |
+
|
| 607 |
+
purchasable_results = fetch_purchasable(reactant_smi)
|
| 608 |
+
if not all(
|
| 609 |
+
purchasable_results.get(r, False) or is_small_so_probably_purchasable(r)
|
| 610 |
+
for r in reactant_smi
|
| 611 |
+
):
|
| 612 |
+
RewardReason.NOT_PURCHASABLE.set_reason(metadata)
|
| 613 |
+
return 0.0
|
| 614 |
+
|
| 615 |
+
result = fetch_forward_rxn(yhat)
|
| 616 |
+
if "product" in result:
|
| 617 |
+
product = result["product"]
|
| 618 |
+
pmol = mol_from_smiles(product)
|
| 619 |
+
if pmol is None:
|
| 620 |
+
RewardReason.INVALID_MOL.set_reason(metadata)
|
| 621 |
+
return 0.0
|
| 622 |
+
if soft:
|
| 623 |
+
return tanimoto_similarity(pmol, ymol)
|
| 624 |
+
if exact_mol_match(pmol, ymol) == 1.0:
|
| 625 |
+
return 1.0
|
| 626 |
+
RewardReason.WRONG_PRODUCT.set_reason(metadata)
|
| 627 |
+
return 0.0
|
| 628 |
+
RewardReason.INVALID_RXN.set_reason(metadata)
|
| 629 |
+
return 0.0
|
| 630 |
+
|
| 631 |
+
|
| 632 |
+
def valid_molecule_eval(
|
| 633 |
+
yhat: str,
|
| 634 |
+
y: str, # noqa: ARG001
|
| 635 |
+
soft: bool = False, # noqa: ARG001
|
| 636 |
+
test: bool = False, # noqa: ARG001
|
| 637 |
+
metadata: dict[str, JsonValue] | None = None, # noqa: ARG001
|
| 638 |
+
) -> float:
|
| 639 |
+
"""Evaluate if yhat is valid molecule."""
|
| 640 |
+
if not yhat:
|
| 641 |
+
return 0.0
|
| 642 |
+
mol = mol_from_smiles(yhat, sanitize=True)
|
| 643 |
+
return float(mol is not None)
|
| 644 |
+
|
| 645 |
+
|
| 646 |
+
EVAL_FUNCTIONS: Mapping[str, RewardEvalFn] = {
|
| 647 |
+
"str_eval": str_eval,
|
| 648 |
+
"valid_mol_eval": valid_mol_eval,
|
| 649 |
+
"caption_eval": caption_eval,
|
| 650 |
+
"product_eval": product_eval,
|
| 651 |
+
"rxn_eval": rxn_eval,
|
| 652 |
+
"formula_eval": formula_eval,
|
| 653 |
+
"functional_group_eval": functional_group_eval,
|
| 654 |
+
"sol_eval": oracle_solubility_eval,
|
| 655 |
+
"rxn_forward": oracle_rxn_eval,
|
| 656 |
+
"should_not_answer_eval": str_eval,
|
| 657 |
+
"should_answer_eval": valid_molecule_eval,
|
| 658 |
+
}
|
| 659 |
+
|
| 660 |
+
|
| 661 |
+
# These correspond to open-ended problems that do not have a
|
| 662 |
+
# unique molecule as answer.
|
| 663 |
+
APPLY_GOOD_MOLECULE_CHECK: set[str] = {
|
| 664 |
+
"valid_mol_eval",
|
| 665 |
+
"formula_eval",
|
| 666 |
+
"functional_group_eval",
|
| 667 |
+
"sol_eval",
|
| 668 |
+
}
|
| 669 |
+
|
| 670 |
+
|
| 671 |
+
def accuracy_reward(
|
| 672 |
+
completions: Sequence[list[Mapping[str, str]]] | Sequence[str],
|
| 673 |
+
solution: Iterable[str],
|
| 674 |
+
reasoning: bool,
|
| 675 |
+
metadata: list[dict[str, JsonValue]] | None = None,
|
| 676 |
+
soft: bool = False,
|
| 677 |
+
test: bool = False,
|
| 678 |
+
good_molecule_bonus: float = 0.0,
|
| 679 |
+
**kwargs, # noqa: ARG001
|
| 680 |
+
) -> list[float]:
|
| 681 |
+
"""Reward function that checks if the completion is the same as the ground truth."""
|
| 682 |
+
if isinstance(completions[0], list):
|
| 683 |
+
messages = cast(Sequence[list[Mapping[str, str]]], completions)
|
| 684 |
+
contents: Sequence[str] = [m[0]["content"] for m in messages]
|
| 685 |
+
else:
|
| 686 |
+
contents = cast(Sequence[str], completions)
|
| 687 |
+
if soft and test:
|
| 688 |
+
raise ValueError("Soft mode is not supported for test time accuracy reward.")
|
| 689 |
+
rewards = []
|
| 690 |
+
problem_types: list[str | None] = []
|
| 691 |
+
|
| 692 |
+
if metadata is None:
|
| 693 |
+
# Create empty metadata that we can use internal to this function
|
| 694 |
+
metadata = [{} for _ in contents]
|
| 695 |
+
else:
|
| 696 |
+
if metadata:
|
| 697 |
+
raise NotImplementedError(f"Received non-empty metadata {metadata}.")
|
| 698 |
+
metadata.extend([{} for _ in contents])
|
| 699 |
+
|
| 700 |
+
for content, info, meta in zip(contents, solution, metadata, strict=True):
|
| 701 |
+
reward = 0.0
|
| 702 |
+
reward_info = RewardFunctionInfo.model_validate(info)
|
| 703 |
+
fxn_name, answer_info, problem_type = tuple(reward_info.model_dump().values())
|
| 704 |
+
try:
|
| 705 |
+
answer: str | None = (
|
| 706 |
+
extract_answer_loose(content)
|
| 707 |
+
if test
|
| 708 |
+
else extract_thought_answer_strict(content, reasoning=reasoning)[1]
|
| 709 |
+
)
|
| 710 |
+
if answer is not None:
|
| 711 |
+
# During test time, see if full SMILES string was given as input
|
| 712 |
+
if problem_type == "valid_mol_eval" and test:
|
| 713 |
+
# If we're testing, we only allow full SMILES strings
|
| 714 |
+
reward = EVAL_FUNCTIONS[fxn_name](
|
| 715 |
+
answer, answer_info, test=test, metadata=meta
|
| 716 |
+
)
|
| 717 |
+
else:
|
| 718 |
+
reward = EVAL_FUNCTIONS[fxn_name](
|
| 719 |
+
answer, answer_info, soft=soft, metadata=meta
|
| 720 |
+
)
|
| 721 |
+
RewardReason.set_default_reason(reward, meta)
|
| 722 |
+
|
| 723 |
+
if reward == 1.0 and fxn_name in APPLY_GOOD_MOLECULE_CHECK:
|
| 724 |
+
if FULL_SMILES_KEY not in meta:
|
| 725 |
+
raise ValueError( # noqa: TRY301
|
| 726 |
+
f"Missing full SMILES key in metadata {meta}"
|
| 727 |
+
f" with reward function {fxn_name}."
|
| 728 |
+
)
|
| 729 |
+
full_smiles = cast(str, meta[FULL_SMILES_KEY])
|
| 730 |
+
mol = mol_from_smiles(full_smiles)
|
| 731 |
+
if mol is None:
|
| 732 |
+
raise ValueError( # noqa: TRY301
|
| 733 |
+
f"Invalid full SMILES {full_smiles}"
|
| 734 |
+
f" with reward function {fxn_name}."
|
| 735 |
+
)
|
| 736 |
+
meta["is_good_molecule"] = not contains_bad_substruct(mol)
|
| 737 |
+
if meta["is_good_molecule"]:
|
| 738 |
+
reward += good_molecule_bonus
|
| 739 |
+
|
| 740 |
+
else:
|
| 741 |
+
RewardReason.FORMAT_FAILED.set_reason(meta)
|
| 742 |
+
rewards.append(reward)
|
| 743 |
+
problem_types.append(problem_type)
|
| 744 |
+
except Exception:
|
| 745 |
+
logger.exception(
|
| 746 |
+
f"Unhandled exception in {fxn_name=} for {problem_type=}"
|
| 747 |
+
f" with inputs {content=}, {answer_info=} {soft=}, and {test=}."
|
| 748 |
+
)
|
| 749 |
+
RewardReason.REWARD_FUNCTION_EXCEPTION.set_reason(meta)
|
| 750 |
+
rewards.append(reward)
|
| 751 |
+
problem_types.append(None)
|
| 752 |
+
|
| 753 |
+
return rewards
|
src/ether0/rings.bloom
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:b1b81b5dc5e59d2068742aafb0c217067e951260f56527998e902d37ac177a25
|
| 3 |
+
size 12500018
|
src/ether0/utils.py
ADDED
|
@@ -0,0 +1,108 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import logging
|
| 2 |
+
import re
|
| 3 |
+
from http import HTTPStatus
|
| 4 |
+
from typing import TypeVar
|
| 5 |
+
|
| 6 |
+
import regex
|
| 7 |
+
from datasets import Dataset, DatasetDict, Version, load_dataset
|
| 8 |
+
from datasets.exceptions import DatasetNotFoundError
|
| 9 |
+
from huggingface_hub.errors import HfHubHTTPError
|
| 10 |
+
from tenacity import (
|
| 11 |
+
before_sleep_log,
|
| 12 |
+
retry,
|
| 13 |
+
retry_if_exception,
|
| 14 |
+
stop_after_attempt,
|
| 15 |
+
wait_fixed,
|
| 16 |
+
)
|
| 17 |
+
|
| 18 |
+
logger = logging.getLogger(__name__)
|
| 19 |
+
|
| 20 |
+
# pylint: disable-next=invalid-name
|
| 21 |
+
TDataset = TypeVar("TDataset", bound=Dataset | DatasetDict)
|
| 22 |
+
|
| 23 |
+
|
| 24 |
+
@retry(
|
| 25 |
+
retry=retry_if_exception(
|
| 26 |
+
lambda x: (
|
| 27 |
+
(
|
| 28 |
+
# On 2/11/2025 James kept seeing on the g3 server cluster:
|
| 29 |
+
# > huggingface_hub.errors.HfHubHTTPError: 504 Server Error: Gateway Time-out for
|
| 30 |
+
# > url: https://huggingface.co/api/datasets/org/repo/paths-info/abc123
|
| 31 |
+
# And on 3/14 James saw this on the g3 server cluster:
|
| 32 |
+
# > huggingface_hub.errors.HfHubHTTPError: 502 Server Error: Bad Gateway for
|
| 33 |
+
# > url: https://huggingface.co/api/datasets/org/repo/paths-info/abc123
|
| 34 |
+
isinstance(x, HfHubHTTPError)
|
| 35 |
+
and x.response.status_code
|
| 36 |
+
in {HTTPStatus.BAD_GATEWAY.value, HTTPStatus.GATEWAY_TIMEOUT.value}
|
| 37 |
+
)
|
| 38 |
+
# On 4/14/2025 James kept seeing on the g5 server cluster:
|
| 39 |
+
# > datasets.exceptions.DatasetNotFoundError:
|
| 40 |
+
# > Dataset 'org/repo' doesn't exist on the Hub or cannot be accessed.
|
| 41 |
+
or isinstance(x, DatasetNotFoundError)
|
| 42 |
+
)
|
| 43 |
+
),
|
| 44 |
+
before_sleep=before_sleep_log(logger, logging.WARNING),
|
| 45 |
+
stop=stop_after_attempt(5),
|
| 46 |
+
wait=wait_fixed(5),
|
| 47 |
+
)
|
| 48 |
+
def load_dataset_retrying(
|
| 49 |
+
path: str,
|
| 50 |
+
revision: str | Version | None = None,
|
| 51 |
+
) -> DatasetDict:
|
| 52 |
+
return load_dataset(path, revision=revision)
|
| 53 |
+
|
| 54 |
+
|
| 55 |
+
# SEE: https://www.compart.com/en/unicode/block/U+2070 for subscript letters
|
| 56 |
+
invalid_chars_regex = re.compile(
|
| 57 |
+
r"[^A-Za-z0-9Α-Ωα-ωₐₑₒₓₔₕₖₗₘₙₚₛₜ⁰¹²³⁴⁵⁶⁷⁸⁹₀₁₂₃₄₅₆₇₈₉×\s!\"#$%&±⁻'´ʻ‘’ʼ“”()*+⁺,\-—–‐‑‒―−⏤./:;«<≤=≡≈≆≥>›»⇌?@[\\\]^_`{|}~←⇐→➔➞➛➡➟➧➭⇨⇒⇛⟺⇔⟶…]" # noqa: RUF001
|
| 58 |
+
)
|
| 59 |
+
invalid_languages_regex = regex.compile(
|
| 60 |
+
r"[\p{"
|
| 61 |
+
+ r"}\p{".join({
|
| 62 |
+
# SEE: https://jrgraphix.net/r/Unicode/
|
| 63 |
+
"Arabic",
|
| 64 |
+
"Armenian",
|
| 65 |
+
"Bengali",
|
| 66 |
+
"Braille_Patterns",
|
| 67 |
+
"Cyrillic",
|
| 68 |
+
"Devanagari",
|
| 69 |
+
"Ethiopic",
|
| 70 |
+
"Georgian",
|
| 71 |
+
"Gujarati",
|
| 72 |
+
"Gurmukhi",
|
| 73 |
+
"Han",
|
| 74 |
+
"Hangul",
|
| 75 |
+
"Hebrew",
|
| 76 |
+
"Hiragana",
|
| 77 |
+
"Kannada",
|
| 78 |
+
"Katakana",
|
| 79 |
+
"Khmer",
|
| 80 |
+
"Latin_Extended_A",
|
| 81 |
+
"Latin_Extended_Additional",
|
| 82 |
+
"Latin_Extended_B",
|
| 83 |
+
"Malayalam",
|
| 84 |
+
"Myanmar",
|
| 85 |
+
"Syriac",
|
| 86 |
+
"Tamil",
|
| 87 |
+
"Telugu",
|
| 88 |
+
"Thaana",
|
| 89 |
+
"Thai",
|
| 90 |
+
"Tifinagh",
|
| 91 |
+
})
|
| 92 |
+
+ r"}]"
|
| 93 |
+
)
|
| 94 |
+
|
| 95 |
+
|
| 96 |
+
def contains_invalid(
|
| 97 |
+
text: str, chars: bool = False, languages: bool = False, threshold: int = 1
|
| 98 |
+
) -> tuple[bool, list[str]]:
|
| 99 |
+
"""Check if the text contains invalid characters or languages."""
|
| 100 |
+
if chars:
|
| 101 |
+
matches = invalid_chars_regex.findall(text)
|
| 102 |
+
if len(matches) >= threshold:
|
| 103 |
+
return True, sorted(matches)
|
| 104 |
+
if languages:
|
| 105 |
+
matches = invalid_languages_regex.findall(text)
|
| 106 |
+
if len(matches) >= threshold:
|
| 107 |
+
return True, sorted(matches)
|
| 108 |
+
return False, []
|
tests/conftest.py
ADDED
|
@@ -0,0 +1,12 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import pathlib
|
| 2 |
+
|
| 3 |
+
import pytest
|
| 4 |
+
from datasets import Dataset, load_dataset
|
| 5 |
+
|
| 6 |
+
TESTS_DIR = pathlib.Path(__file__).parent
|
| 7 |
+
REPO_ROOT_DIR = TESTS_DIR.parent
|
| 8 |
+
|
| 9 |
+
|
| 10 |
+
@pytest.fixture(name="ether0_benchmark_test", scope="session")
|
| 11 |
+
def fixture_ether0_benchmark_test() -> Dataset:
|
| 12 |
+
return load_dataset("futurehouse/ether0-benchmark", split="test")
|
tests/test_chat.py
ADDED
|
@@ -0,0 +1,61 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import pytest
|
| 2 |
+
|
| 3 |
+
from ether0.chat import ChatArguments
|
| 4 |
+
from ether0.model_prompts import ProblemPrompt, SysPrompt
|
| 5 |
+
|
| 6 |
+
|
| 7 |
+
class TestChatArguments:
|
| 8 |
+
@pytest.mark.parametrize(
|
| 9 |
+
("args", "row", "expected"),
|
| 10 |
+
[
|
| 11 |
+
(
|
| 12 |
+
ChatArguments(problem_prompt=ProblemPrompt.NONE),
|
| 13 |
+
{"problem": "stub problem"},
|
| 14 |
+
{"prompt": [{"content": "stub problem", "role": "user"}]},
|
| 15 |
+
),
|
| 16 |
+
(
|
| 17 |
+
ChatArguments(problem_prompt=ProblemPrompt.NONE),
|
| 18 |
+
{"problem": ["stub problem", "stub problem 2"]},
|
| 19 |
+
{
|
| 20 |
+
"prompt": [
|
| 21 |
+
[{"content": "stub problem", "role": "user"}],
|
| 22 |
+
[{"content": "stub problem 2", "role": "user"}],
|
| 23 |
+
]
|
| 24 |
+
},
|
| 25 |
+
),
|
| 26 |
+
(
|
| 27 |
+
ChatArguments(
|
| 28 |
+
sys_prompt=SysPrompt.SCIENTIFIC_AI,
|
| 29 |
+
problem_prompt=ProblemPrompt.THINK_ANSWER,
|
| 30 |
+
),
|
| 31 |
+
{"problem": "stub problem"},
|
| 32 |
+
{
|
| 33 |
+
"prompt": [
|
| 34 |
+
{
|
| 35 |
+
"role": "system",
|
| 36 |
+
"content": "You are a scientific reasoning AI assistant.",
|
| 37 |
+
},
|
| 38 |
+
{
|
| 39 |
+
"role": "user",
|
| 40 |
+
"content": (
|
| 41 |
+
"A conversation between User and Assistant. The user"
|
| 42 |
+
" asks a question, and the Assistant solves it. The"
|
| 43 |
+
" assistant first thinks about the reasoning process in"
|
| 44 |
+
" the mind and then provides the user with the answer."
|
| 45 |
+
" The reasoning process and answer are enclosed within"
|
| 46 |
+
" <|think_start|> <|think_end|>"
|
| 47 |
+
" and <|answer_start|> <|answer_end|> tags,"
|
| 48 |
+
" respectively, i.e., <|think_start|> reasoning process here"
|
| 49 |
+
" <|think_end|><|answer_start|> answer here <|answer_end|>"
|
| 50 |
+
"\n\nstub problem"
|
| 51 |
+
),
|
| 52 |
+
},
|
| 53 |
+
]
|
| 54 |
+
},
|
| 55 |
+
),
|
| 56 |
+
],
|
| 57 |
+
)
|
| 58 |
+
def test_rl_conversation(
|
| 59 |
+
self, args: ChatArguments, row: dict, expected: dict
|
| 60 |
+
) -> None:
|
| 61 |
+
assert args.make_rl_conversation(row) == expected
|
tests/test_data.py
ADDED
|
@@ -0,0 +1,158 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
from collections.abc import Collection
|
| 2 |
+
|
| 3 |
+
import pytest
|
| 4 |
+
from datasets import Dataset
|
| 5 |
+
from pydantic import JsonValue
|
| 6 |
+
|
| 7 |
+
from ether0.data import (
|
| 8 |
+
SMILES_PATTERN,
|
| 9 |
+
get_problem_categories_from_datasets,
|
| 10 |
+
get_problem_category,
|
| 11 |
+
)
|
| 12 |
+
from ether0.models import RewardFunctionInfo
|
| 13 |
+
from ether0.rewards import EVAL_FUNCTIONS
|
| 14 |
+
|
| 15 |
+
|
| 16 |
+
def test_get_problem_categories_from_datasets(ether0_benchmark_test: Dataset) -> None:
|
| 17 |
+
assert get_problem_categories_from_datasets(ether0_benchmark_test) == {
|
| 18 |
+
"functional-group",
|
| 19 |
+
"molecule-completion",
|
| 20 |
+
"molecule-formula",
|
| 21 |
+
"molecule-name",
|
| 22 |
+
"oracle-solubility",
|
| 23 |
+
"property-cat-eve",
|
| 24 |
+
"property-cat-safety",
|
| 25 |
+
"property-cat-smell",
|
| 26 |
+
"property-regression-adme",
|
| 27 |
+
"property-regression-ld50",
|
| 28 |
+
"property-regression-pka",
|
| 29 |
+
"reaction-prediction",
|
| 30 |
+
"retro-synthesis",
|
| 31 |
+
"simple-formula",
|
| 32 |
+
}
|
| 33 |
+
|
| 34 |
+
|
| 35 |
+
UNVERIFIABLE_PROBLEM_CATEGORY_PREFIXES_TO_EXCLUDE: Collection[str] = {
|
| 36 |
+
"oracle-solubility", # 'ideal' is not actually an answer
|
| 37 |
+
"retro-synthesis", # 'ideal' is not actually an answer
|
| 38 |
+
}
|
| 39 |
+
|
| 40 |
+
|
| 41 |
+
def test_evals(ether0_benchmark_test: Dataset) -> None:
|
| 42 |
+
failures = []
|
| 43 |
+
for row in ether0_benchmark_test:
|
| 44 |
+
reward_info = RewardFunctionInfo.model_validate(row["solution"])
|
| 45 |
+
fxn_name, answer_info, problem_type = tuple(reward_info.model_dump().values())
|
| 46 |
+
problem_category = get_problem_category(problem_type)
|
| 47 |
+
if (
|
| 48 |
+
problem_category in UNVERIFIABLE_PROBLEM_CATEGORY_PREFIXES_TO_EXCLUDE
|
| 49 |
+
or problem_category
|
| 50 |
+
== "molecule-completion" # Molc had no 'ideal's when this was made
|
| 51 |
+
):
|
| 52 |
+
continue
|
| 53 |
+
metadata: dict[str, JsonValue] = {}
|
| 54 |
+
try:
|
| 55 |
+
if problem_category.startswith("property"):
|
| 56 |
+
yhat = answer_info
|
| 57 |
+
else:
|
| 58 |
+
assert row["ideal"]
|
| 59 |
+
yhat = row["ideal"]
|
| 60 |
+
assert (
|
| 61 |
+
EVAL_FUNCTIONS[fxn_name](yhat=yhat, y=answer_info, metadata=metadata)
|
| 62 |
+
== 1.0
|
| 63 |
+
)
|
| 64 |
+
except AssertionError:
|
| 65 |
+
failures.append((problem_category, row["id"], metadata))
|
| 66 |
+
assert not failures
|
| 67 |
+
|
| 68 |
+
|
| 69 |
+
TEST_REASONING_TEXT = (
|
| 70 |
+
"Let's analyze the given molecules and try to predict their LD50 values. LD50"
|
| 71 |
+
" refers to the lethal dose at which 50% of the test organisms die. A lower LD50"
|
| 72 |
+
" means higher toxicity, and a higher LD50 indicates lower toxicity. We need to"
|
| 73 |
+
" identify structural features that relate to toxicity.\n\nThe question leaves open"
|
| 74 |
+
" the possibility that none of the compounds have an LD50 of 320 mg/kg. Let's"
|
| 75 |
+
" consider each molecule individually:\n\n1."
|
| 76 |
+
" ClC1=C(C=CC(=C1)Cl)C1(OCC(O1)COC1=CC=C(C=C1)N1CCN(CC1)C(C)=O)CN1C=NC=C1: This"
|
| 77 |
+
" molecule appears to be quite complex. It has a dichloro-substituted aromatic"
|
| 78 |
+
" ring, an ether linkage, a morpholine ring, a piperazine ring, and an imidazole"
|
| 79 |
+
" ring. The presence of two chlorine atoms on the phenyl ring could suggest some"
|
| 80 |
+
" interaction with biological targets. The molecule also has a morpholine and"
|
| 81 |
+
" piperazine moiety which could contribute to binding with receptors or enzymes."
|
| 82 |
+
" The presence of an amide group might indicate some polarity, but the overall"
|
| 83 |
+
" structure looks relatively lipophilic (nonpolar) given the aromatic rings and"
|
| 84 |
+
" alkyl chains.\n\n2."
|
| 85 |
+
" ClC1=C(C=CC(=C1)Cl)[C@]1(OC[C@@H](O1)COC1=CC=C(C=C1)N1CCN(CC1)C1=CC=C(C=C1)N1C(N(N=C1)[C@H](CC)C)=O)CN1N=CN=C1:" # noqa: E501
|
| 86 |
+
" This is a very complex molecule, with multiple rings, stereocenters, and"
|
| 87 |
+
" heteroatoms. It's a distinct structure and appears to be larger than the first"
|
| 88 |
+
" molecule. We can see a furan ring, a pyrazole ring, an amide group, and other"
|
| 89 |
+
" major differences. This change in the rings and other functional groups is likely"
|
| 90 |
+
" to significantly change the molecular properties compared to the first"
|
| 91 |
+
" molecule.\n\n3."
|
| 92 |
+
" [2H]C(C(=O)N1CCN(CC1)C1=CC=C(C=C1)OCC1O[C@@](OC1)(CN1C=NC=C1)C1=C(C=C(C=C1)Cl)Cl)([2H])[2H]:" # noqa: E501
|
| 93 |
+
" This molecule, labeled with deuterium, has multiple rings including a piperazine,"
|
| 94 |
+
" furan, a substituted imidazole, and a dichlorinated phenyl ring. It also includes"
|
| 95 |
+
" an ester group which is sometimes associated with higher toxicity compared to"
|
| 96 |
+
" simple ethers.\n\nThinking about general principles of toxicity, lipophilicity"
|
| 97 |
+
" (fat solubility) is often related to higher toxicity. A molecule with a marked"
|
| 98 |
+
" lipophilic character can often accumulate in fatty tissues and interact with the"
|
| 99 |
+
" cell membrane, affect cellular transport or receptor activity. This could lead to"
|
| 100 |
+
" higher toxicity by interfering with normal cellular function. Similarly, the"
|
| 101 |
+
" presence of chlorine atoms can sometimes contribute to toxicity due to possible"
|
| 102 |
+
" metabolic activation to reactive intermediates. However, the position and nature"
|
| 103 |
+
" of other substituents and functional groups can influence how chlorine"
|
| 104 |
+
" substitutions modulate toxicity. For example, some chlorinated compounds are"
|
| 105 |
+
" relatively non-toxic.\n\nConsidering the size and complexity of the molecules, we"
|
| 106 |
+
" should think about their potential metabolic pathways. Large molecules can be"
|
| 107 |
+
" metabolized through various pathways, potentially leading to reactive"
|
| 108 |
+
" intermediates that interact with biological molecules. Metabolites of these"
|
| 109 |
+
" compounds might be more or less toxic than the initial molecules, and the"
|
| 110 |
+
" metabolic pathways themselves might be quite different. Perhaps one of the"
|
| 111 |
+
" metabolites could be the reason for an LD50 of 320 mg/kg. Alternatively, a"
|
| 112 |
+
" compound might be relatively non-toxic in itself, but its presence can alter"
|
| 113 |
+
" enzyme activity or other metabolic processes and indirectly lead to cell"
|
| 114 |
+
" damage.\n\nComparing the three molecules. Molecules 1 and 2 share some structural"
|
| 115 |
+
" features like the dichloro-substituted aromatic ring and the presence of a"
|
| 116 |
+
" morpholine ring system. However, they also have distinct differences in the"
|
| 117 |
+
" connectivity and presence of additional rings, including likely some more polar"
|
| 118 |
+
" and/or sterically bulky substituents. Molecule 3 has different ring systems and"
|
| 119 |
+
" the addition of both a deuterated methyl group and an ester group which adds"
|
| 120 |
+
" polar character and can often activate adjacent portions of the molecule by"
|
| 121 |
+
" metabolic oxygenation.\n\nLet's think about bioreactivity beyond simple chemical"
|
| 122 |
+
" interactions. Structures can influence how a molecule interacts with biological"
|
| 123 |
+
" receptors or enzymes. The size and shape of these molecules and the nature of the"
|
| 124 |
+
" functional groups can determine the extent of the molecule's binding interactions"
|
| 125 |
+
" with biomolecules. Some conformationally adaptable structures might bind strongly"
|
| 126 |
+
" to targets and interfere with crucial pathways, which can lead to toxicity."
|
| 127 |
+
" Therefore, weaknesses in essential molecular machinery could have similar"
|
| 128 |
+
" negative effects if bound by those biomolecules.\n\nIf one of these molecules has"
|
| 129 |
+
" an LD50 of 320 mg/kg, it suggests moderate toxicity. It could be that one of the"
|
| 130 |
+
" molecules doesn't have the necessary structural features to interact strongly"
|
| 131 |
+
" with critical biological targets for high toxicity, and/or it might be"
|
| 132 |
+
" metabolized to relatively non-toxic products, such as carbon dioxide and water."
|
| 133 |
+
" Thus, while the molecules share some features with other potentially bioactive"
|
| 134 |
+
" molecules, it could be that they themselves are not exceptionally potent."
|
| 135 |
+
)
|
| 136 |
+
|
| 137 |
+
NO_SMILES_TEXT = "This text does not contain any SMILES"
|
| 138 |
+
|
| 139 |
+
|
| 140 |
+
@pytest.mark.parametrize(
|
| 141 |
+
("text", "expected_answer"),
|
| 142 |
+
[
|
| 143 |
+
(
|
| 144 |
+
TEST_REASONING_TEXT,
|
| 145 |
+
[
|
| 146 |
+
"ClC1=C(C=CC(=C1)Cl)C1(OCC(O1)COC1=CC=C(C=C1)N1CCN(CC1)C(C)=O)CN1C=NC=C1",
|
| 147 |
+
"ClC1=C(C=CC(=C1)Cl)[C@]1(OC[C@@H](O1)COC1=CC=C(C=C1)N1CCN(CC1)C1=CC=C(C=C1)N1C(N(N=C1)[C@H](CC)C)=O)CN1N=CN=C1",
|
| 148 |
+
"[2H]C(C(=O)N1CCN(CC1)C1=CC=C(C=C1)OCC1O[C@@](OC1)(CN1C=NC=C1)C1=C(C=C(C=C1)Cl)Cl)([2H])[2H]",
|
| 149 |
+
],
|
| 150 |
+
),
|
| 151 |
+
(
|
| 152 |
+
NO_SMILES_TEXT,
|
| 153 |
+
[],
|
| 154 |
+
),
|
| 155 |
+
],
|
| 156 |
+
)
|
| 157 |
+
def test_extract_smiles_from_text(text: str, expected_answer: list[str]) -> None:
|
| 158 |
+
assert sorted(SMILES_PATTERN.findall(text)) == sorted(expected_answer)
|
tests/test_model_prompts.py
ADDED
|
@@ -0,0 +1,424 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import pytest
|
| 2 |
+
|
| 3 |
+
from ether0.model_prompts import (
|
| 4 |
+
ANSWER_END,
|
| 5 |
+
ANSWER_START,
|
| 6 |
+
THINK_END,
|
| 7 |
+
THINK_START,
|
| 8 |
+
ProblemPrompt,
|
| 9 |
+
extract_answer_loose,
|
| 10 |
+
extract_thought_answer_strict,
|
| 11 |
+
)
|
| 12 |
+
|
| 13 |
+
|
| 14 |
+
def test_problem_prompt() -> None:
|
| 15 |
+
none_prompt = ProblemPrompt.NONE.get_prompt()
|
| 16 |
+
assert isinstance(none_prompt, str)
|
| 17 |
+
assert "think" not in none_prompt
|
| 18 |
+
assert "answer" not in none_prompt
|
| 19 |
+
|
| 20 |
+
answer_prompt = ProblemPrompt.ANSWER.get_prompt()
|
| 21 |
+
assert isinstance(answer_prompt, str)
|
| 22 |
+
assert "think" not in answer_prompt
|
| 23 |
+
assert "answer" in answer_prompt
|
| 24 |
+
|
| 25 |
+
think_answer_prompt = ProblemPrompt.THINK_ANSWER.get_prompt()
|
| 26 |
+
assert isinstance(think_answer_prompt, str)
|
| 27 |
+
assert "think" in think_answer_prompt
|
| 28 |
+
assert "answer" in think_answer_prompt
|
| 29 |
+
|
| 30 |
+
|
| 31 |
+
@pytest.mark.parametrize(
|
| 32 |
+
("content", "expected"),
|
| 33 |
+
[
|
| 34 |
+
pytest.param("<answer>CCO</answer>", "CCO", id="base"),
|
| 35 |
+
pytest.param("<answer></answer>", "", id="empty-answer"),
|
| 36 |
+
pytest.param("<answer> </answer>", "", id="space-answer"),
|
| 37 |
+
pytest.param("\n<answer>CCO</answer>", "CCO", id="base-extra-whitespace-1"),
|
| 38 |
+
pytest.param("\n<answer>CCO</answer>\n", "CCO", id="base-extra-whitespace-2"),
|
| 39 |
+
pytest.param(" <answer>CCO</answer> ", "CCO", id="base-extra-whitespace-3"),
|
| 40 |
+
pytest.param("word<answer>CCO</answer> ", "CCO", id="base-extra-whitespace-4"),
|
| 41 |
+
pytest.param("<answer>\nCCO\n</answer>", "CCO", id="base-w-newlines"),
|
| 42 |
+
pytest.param(
|
| 43 |
+
"<answer> \nCCO\n</answer>", "CCO", id="base-w-spaces-and-newlines"
|
| 44 |
+
),
|
| 45 |
+
pytest.param(
|
| 46 |
+
"<answer>\n\nCCO\n\n</answer>", "CCO", id="base-w-double-newlines"
|
| 47 |
+
),
|
| 48 |
+
pytest.param("<answer> CCO </answer>", "CCO", id="base-w-spaces"),
|
| 49 |
+
pytest.param(
|
| 50 |
+
"<answer> < CCO</answer>", "< CCO", id="base-contains-potential-xml-1"
|
| 51 |
+
),
|
| 52 |
+
pytest.param(
|
| 53 |
+
"<answer> <stub CCO</answer>",
|
| 54 |
+
"<stub CCO",
|
| 55 |
+
id="base-contains-potential-xml-2",
|
| 56 |
+
),
|
| 57 |
+
pytest.param("<answer><answer>CCO</answer></answer>", "", id="nested"),
|
| 58 |
+
pytest.param(
|
| 59 |
+
"<answer>\n<answer>\nCCO\n</answer>\n</answer>", "", id="nested-w-newlines"
|
| 60 |
+
),
|
| 61 |
+
pytest.param(
|
| 62 |
+
"<think>thought</think><answer>CCO</answer>", "CCO", id="thought-base"
|
| 63 |
+
),
|
| 64 |
+
pytest.param(
|
| 65 |
+
"<think>thought</think><answer>\nCCO\n</answer>",
|
| 66 |
+
"CCO",
|
| 67 |
+
id="thought-base-w-newlines",
|
| 68 |
+
),
|
| 69 |
+
pytest.param(
|
| 70 |
+
"<answer>CCO</answer><think>thought</think>", "CCO", id="thought-reversed"
|
| 71 |
+
),
|
| 72 |
+
pytest.param(
|
| 73 |
+
"<answer>\nCCO\n</answer><think>thought</think>",
|
| 74 |
+
"CCO",
|
| 75 |
+
id="thought-reversed-w-newlines",
|
| 76 |
+
),
|
| 77 |
+
pytest.param(
|
| 78 |
+
"<answer>echoing prompt</answer><answer>CCO2</answer>",
|
| 79 |
+
"CCO2",
|
| 80 |
+
id="multi-answer",
|
| 81 |
+
),
|
| 82 |
+
pytest.param(
|
| 83 |
+
"<answer>echoing prompt</answer><answer>\nCCO2\n</answer>",
|
| 84 |
+
"CCO2",
|
| 85 |
+
id="multi-answer-w-newlines",
|
| 86 |
+
),
|
| 87 |
+
],
|
| 88 |
+
)
|
| 89 |
+
def test_extract_answer_loose(content: str | None, expected: str) -> None:
|
| 90 |
+
assert extract_answer_loose(content) == expected
|
| 91 |
+
|
| 92 |
+
|
| 93 |
+
@pytest.mark.parametrize(
|
| 94 |
+
("content", "expected_answer", "expected_thought"),
|
| 95 |
+
[
|
| 96 |
+
pytest.param(f"{ANSWER_START}CCO{ANSWER_END}", None, None, id="no-thought"),
|
| 97 |
+
pytest.param(
|
| 98 |
+
f"{ANSWER_START}{ANSWER_END}", None, None, id="no-thought-empty-answer"
|
| 99 |
+
),
|
| 100 |
+
pytest.param(
|
| 101 |
+
f"{ANSWER_START} {ANSWER_END}", None, None, id="no-thought-space-answer"
|
| 102 |
+
),
|
| 103 |
+
pytest.param(
|
| 104 |
+
f"{ANSWER_START}\nCCO\n{ANSWER_END}",
|
| 105 |
+
None,
|
| 106 |
+
None,
|
| 107 |
+
id="no-thought-w-newlines",
|
| 108 |
+
),
|
| 109 |
+
pytest.param(
|
| 110 |
+
f"{ANSWER_START}{ANSWER_START}CCO{ANSWER_END}{ANSWER_END}",
|
| 111 |
+
None,
|
| 112 |
+
None,
|
| 113 |
+
id="no-thought-nested",
|
| 114 |
+
),
|
| 115 |
+
pytest.param(
|
| 116 |
+
f"{ANSWER_START}\n{ANSWER_START}\nCCO\n{ANSWER_END}\n{ANSWER_END}",
|
| 117 |
+
None,
|
| 118 |
+
None,
|
| 119 |
+
id="no-thought-nested-w-newlines",
|
| 120 |
+
),
|
| 121 |
+
pytest.param(
|
| 122 |
+
f"{THINK_START}thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}",
|
| 123 |
+
"CCO",
|
| 124 |
+
"thought",
|
| 125 |
+
id="base",
|
| 126 |
+
),
|
| 127 |
+
pytest.param(
|
| 128 |
+
f"{THINK_START}thought{THINK_END}{ANSWER_START}{ANSWER_END}",
|
| 129 |
+
None,
|
| 130 |
+
"thought",
|
| 131 |
+
id="empty-answer",
|
| 132 |
+
),
|
| 133 |
+
pytest.param(
|
| 134 |
+
f"{THINK_START}thought{THINK_END}{ANSWER_START} {ANSWER_END}",
|
| 135 |
+
None,
|
| 136 |
+
"thought",
|
| 137 |
+
id="space-answer",
|
| 138 |
+
),
|
| 139 |
+
pytest.param(
|
| 140 |
+
# Allow models to place up to one whitespace before the thought
|
| 141 |
+
f"\n{THINK_START}thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}",
|
| 142 |
+
"CCO",
|
| 143 |
+
"thought",
|
| 144 |
+
id="base-extra-whitespace-1",
|
| 145 |
+
),
|
| 146 |
+
pytest.param(
|
| 147 |
+
f"\n{THINK_START}thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}\n",
|
| 148 |
+
None,
|
| 149 |
+
None,
|
| 150 |
+
id="base-extra-whitespace-2",
|
| 151 |
+
),
|
| 152 |
+
pytest.param(
|
| 153 |
+
f" {THINK_START}thought{THINK_END}{ANSWER_START}CCO{ANSWER_END} ",
|
| 154 |
+
None,
|
| 155 |
+
None,
|
| 156 |
+
id="base-extra-whitespace-3",
|
| 157 |
+
),
|
| 158 |
+
pytest.param(
|
| 159 |
+
f"word{THINK_START}thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}\n",
|
| 160 |
+
None,
|
| 161 |
+
None,
|
| 162 |
+
id="base-extra-whitespace-4",
|
| 163 |
+
),
|
| 164 |
+
pytest.param(
|
| 165 |
+
f"{THINK_START}thought{THINK_END}{ANSWER_START}\nCCO\n{ANSWER_END}",
|
| 166 |
+
"CCO",
|
| 167 |
+
"thought",
|
| 168 |
+
id="base-w-newlines",
|
| 169 |
+
),
|
| 170 |
+
pytest.param(
|
| 171 |
+
f"{THINK_START}thought{THINK_END}{ANSWER_START} \nCCO\n{ANSWER_END}",
|
| 172 |
+
"CCO",
|
| 173 |
+
"thought",
|
| 174 |
+
id="base-w-spaces-and-newlines",
|
| 175 |
+
),
|
| 176 |
+
pytest.param(
|
| 177 |
+
f"{THINK_START}thought{THINK_END}{ANSWER_START}\n\nCCO\n\n{ANSWER_END}",
|
| 178 |
+
"CCO",
|
| 179 |
+
"thought",
|
| 180 |
+
id="base-w-double-newlines",
|
| 181 |
+
),
|
| 182 |
+
pytest.param(
|
| 183 |
+
f"{THINK_START}thought{THINK_END}{ANSWER_START} CCO {ANSWER_END}",
|
| 184 |
+
"CCO",
|
| 185 |
+
"thought",
|
| 186 |
+
id="base-w-spaces",
|
| 187 |
+
),
|
| 188 |
+
pytest.param(
|
| 189 |
+
f"{THINK_START}\nthought\n{THINK_END}{ANSWER_START}\nCCO\n{ANSWER_END}",
|
| 190 |
+
"CCO",
|
| 191 |
+
"thought",
|
| 192 |
+
id="base-w-newlines-both",
|
| 193 |
+
),
|
| 194 |
+
pytest.param(
|
| 195 |
+
f"{THINK_START}thought\nthought{THINK_END}{ANSWER_START}CCO{ANSWER_END}",
|
| 196 |
+
"CCO",
|
| 197 |
+
"thought\nthought",
|
| 198 |
+
id="base-inner-newline",
|
| 199 |
+
),
|
| 200 |
+
pytest.param(
|
| 201 |
+
f"{THINK_START}\nthought\nthought\n{THINK_END}{ANSWER_START}CCO{ANSWER_END}",
|
| 202 |
+
"CCO",
|
| 203 |
+
"thought\nthought",
|
| 204 |
+
id="base-inner-newline-w-newlines",
|
| 205 |
+
),
|
| 206 |
+
pytest.param(
|
| 207 |
+
f"{THINK_START}thought{THINK_END}inter{ANSWER_START}CCO{ANSWER_END}",
|
| 208 |
+
"CCO",
|
| 209 |
+
"thought",
|
| 210 |
+
id="base-inter",
|
| 211 |
+
),
|
| 212 |
+
pytest.param(
|
| 213 |
+
f"{THINK_START}thought{THINK_END}inter\ninter{ANSWER_START}CCO{ANSWER_END}",
|
| 214 |
+
"CCO",
|
| 215 |
+
"thought",
|
| 216 |
+
id="base-inter-inner-newline",
|
| 217 |
+
),
|
| 218 |
+
pytest.param(
|
| 219 |
+
f"{THINK_START}thought{THINK_END}\ninter\ninter\n{ANSWER_START}CCO{ANSWER_END}",
|
| 220 |
+
"CCO",
|
| 221 |
+
"thought",
|
| 222 |
+
id="base-inter-inner-newline-w-newlines",
|
| 223 |
+
),
|
| 224 |
+
pytest.param(
|
| 225 |
+
f"{ANSWER_START}CCO{ANSWER_END}{THINK_START}thought{THINK_END}",
|
| 226 |
+
None,
|
| 227 |
+
None,
|
| 228 |
+
id="base-reversed",
|
| 229 |
+
),
|
| 230 |
+
pytest.param(
|
| 231 |
+
f"{ANSWER_START}\nCCO\n{ANSWER_END}{THINK_START}thought{THINK_END}",
|
| 232 |
+
None,
|
| 233 |
+
None,
|
| 234 |
+
id="base-reversed-w-newlines",
|
| 235 |
+
),
|
| 236 |
+
pytest.param(
|
| 237 |
+
f"{THINK_START}thought < thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}",
|
| 238 |
+
"CCO",
|
| 239 |
+
"thought < thought",
|
| 240 |
+
id="thought-contains-potential-xml-1",
|
| 241 |
+
),
|
| 242 |
+
pytest.param(
|
| 243 |
+
f"{THINK_START}thought <stub"
|
| 244 |
+
f" thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}",
|
| 245 |
+
"CCO",
|
| 246 |
+
"thought <stub thought",
|
| 247 |
+
id="thought-contains-potential-xml-2",
|
| 248 |
+
),
|
| 249 |
+
pytest.param(
|
| 250 |
+
f"{THINK_START}thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}a",
|
| 251 |
+
None,
|
| 252 |
+
None,
|
| 253 |
+
id="text-after-answer",
|
| 254 |
+
),
|
| 255 |
+
pytest.param(
|
| 256 |
+
f"{THINK_START}thought{THINK_END}{THINK_START}thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}",
|
| 257 |
+
None,
|
| 258 |
+
None,
|
| 259 |
+
id="multi-thought",
|
| 260 |
+
),
|
| 261 |
+
pytest.param(
|
| 262 |
+
f"{THINK_START}thought{THINK_END}<thought>thought</thought>{ANSWER_START}CCO{ANSWER_END}",
|
| 263 |
+
"CCO",
|
| 264 |
+
"thought",
|
| 265 |
+
id="interleaved-think-thought",
|
| 266 |
+
),
|
| 267 |
+
pytest.param(
|
| 268 |
+
f"{THINK_START}thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}Some"
|
| 269 |
+
f" text{THINK_START}thought{THINK_END}{ANSWER_START}CCO{ANSWER_END}",
|
| 270 |
+
None,
|
| 271 |
+
None,
|
| 272 |
+
id="continuation",
|
| 273 |
+
),
|
| 274 |
+
pytest.param(
|
| 275 |
+
f"{ANSWER_START}echoing prompt{ANSWER_END}{ANSWER_START}CCO2{ANSWER_END}",
|
| 276 |
+
None,
|
| 277 |
+
None,
|
| 278 |
+
id="no-thought-multi-answer",
|
| 279 |
+
),
|
| 280 |
+
pytest.param(
|
| 281 |
+
f"{ANSWER_START}echoing"
|
| 282 |
+
f" prompt{ANSWER_END}{ANSWER_START}\nCCO2\n{ANSWER_END}",
|
| 283 |
+
None,
|
| 284 |
+
None,
|
| 285 |
+
id="no-thought-multi-answer-w-newlines",
|
| 286 |
+
),
|
| 287 |
+
pytest.param(
|
| 288 |
+
f"{THINK_START}\nAlright, so I need to figure out the IUPAC name for the"
|
| 289 |
+
" molecule with the formula C1=CC(=CC=C1O)O. Let me start by trying to"
|
| 290 |
+
" visualize the structure. The formula seems a bit complex, so breaking it"
|
| 291 |
+
" down might help.\n\nFirst, I notice there's a ring structure because of"
|
| 292 |
+
" the C1 notation, which suggests a cyclic compound. The presence of"
|
| 293 |
+
" double bonds (the = signs) indicates that it's not just a simple alkane."
|
| 294 |
+
" So, I'm thinking it's a cyclic diene or something similar.\n\nLooking"
|
| 295 |
+
" closer at the formula, I see two oxygen atoms attached to the ring. The"
|
| 296 |
+
" first O is attached to a carbon that's part of a double bond (C1=CC...),"
|
| 297 |
+
" and the second O is attached to another carbon that's also part of a"
|
| 298 |
+
" double bond. So, there are two ketone groups or possibly ester groups?"
|
| 299 |
+
" Wait, no, the formula is C1=CC(=CC=C1O)O, which might imply that each"
|
| 300 |
+
" carbon attached to the ring has an oxygen, but let me try to count the"
|
| 301 |
+
" bonds properly.\n\nWait, perhaps I should draw this out. Let me imagine"
|
| 302 |
+
" the ring. Carbon 1 (C1) is double-bonded to a carbon (C2). Then, C2 is"
|
| 303 |
+
" connected to another carbon (C3) via a double bond, which is then"
|
| 304 |
+
" connected to C4, and so on, until I come back to C1, forming a ring. But"
|
| 305 |
+
" since there are multiple double bonds, it's probably a conjugated diene"
|
| 306 |
+
" or something like that.\n\nWait, maybe it's a cyclopentadiene"
|
| 307 |
+
" derivative. But the presence of two oxygen atoms makes it more likely to"
|
| 308 |
+
" be a dienol ether or something similar. Alternatively, it could be a"
|
| 309 |
+
" cyclohexene derivative with two ketone groups, but I'm not sure.\n\nLet"
|
| 310 |
+
" me count the carbons. The formula is C1=CC(=CC=C1O)O. So, each 'C' is"
|
| 311 |
+
" part of the ring. Let me see: C1 is double-bonded to C2, then C2 is"
|
| 312 |
+
" connected via a single bond to another group, which is C3, which is"
|
| 313 |
+
" double-bonded to C4, and so on until I close the ring back to C1. Hmm,"
|
| 314 |
+
" maybe it's a cyclopentadiene ring with substituents.\n\nWait, perhaps"
|
| 315 |
+
" it's a cyclopentadienyl ether. Let me think about how the substituents"
|
| 316 |
+
" are arranged. If C1 is connected via a double bond to C2, then C2 has"
|
| 317 |
+
" another substituent, which is C3 via a double bond, and so on. Maybe the"
|
| 318 |
+
" structure is such that there are two adjacent double bonds, making it a"
|
| 319 |
+
" conjugated diene.\n\nBut I'm getting a bit confused. Maybe I should"
|
| 320 |
+
" approach this differently. Let's try to write out the structure step by"
|
| 321 |
+
" step.\n\nStarting with C1, which is double-bonded to C2: C1=C2. Then, C2"
|
| 322 |
+
" is connected to another carbon, which is part of a double bond to C3:"
|
| 323 |
+
" C2=C3. So, now we have C1=C2-C3=... Then, C3 is connected to C4, which"
|
| 324 |
+
" is connected back to C1, forming a ring. So, the ring would be a"
|
| 325 |
+
" five-membered ring with two double bonds.\n\nWait, but a five-membered"
|
| 326 |
+
" ring with two double bonds would be conjugated diene in a ring. So,"
|
| 327 |
+
" that's cyclopentadiene. Now, each of the carbons in the double bonds has"
|
| 328 |
+
" an oxygen substituent. So, C1 has an O attached, and C3 also has an O"
|
| 329 |
+
" attached. So, it's cyclopentadiene-1,3-dione? But wait, the formula is"
|
| 330 |
+
" C1=CC(=CC=C1O)O, which suggests that each double bond carbon has an O"
|
| 331 |
+
" attached. So, both C1 and C3 have O substituents.\n\nBut"
|
| 332 |
+
" cyclopentadiene-1,3-dione would have two ketone groups, which would make"
|
| 333 |
+
" it a diketone. Alternatively, it could be a dienol ether, but with two"
|
| 334 |
+
" oxygen atoms attached to the ring.\n\nWait, another possibility is that"
|
| 335 |
+
" it's a cyclopentadienyl ether with two substituents. Alternatively,"
|
| 336 |
+
" perhaps it's a substituted cyclopentadienone.\n\nWait, maybe I should"
|
| 337 |
+
" count the number of atoms. The formula is C1=CC(=CC=C1O)O. Let's parse"
|
| 338 |
+
" this:\n\n- C1 is connected via double bond to C2.\n- C2 is connected to"
|
| 339 |
+
" another carbon (let's say C3) which is double-bonded to C4.\n- C4 is"
|
| 340 |
+
" connected back to C1, forming a ring.\n- Each of C1 and C3 has an oxygen"
|
| 341 |
+
" attached.\n\nWait, that would make a five-membered ring with two double"
|
| 342 |
+
" bonds and two oxygen atoms. So, perhaps it's cyclopentadienone-1,3-dioic"
|
| 343 |
+
" acid? No, that doesn't sound right because the formula doesn't indicate"
|
| 344 |
+
" acid groups.\n\nAlternatively, maybe it's a dienol ether, where two of"
|
| 345 |
+
" the double bond carbons have ether oxygen substituents.\n\nWait, perhaps"
|
| 346 |
+
" the correct name is something like 1,3-dihydroxycyclopentadiene or"
|
| 347 |
+
" similar. Alternatively, since the oxygens are on the double bond"
|
| 348 |
+
" carbons, maybe it's a dienol ether.\n\nWait, I'm getting stuck. Maybe I"
|
| 349 |
+
" should think about the structure again.\n\nThe formula is"
|
| 350 |
+
" C1=CC(=CC=C1O)O. So, let's parse the SMILES notation:\n\n-"
|
| 351 |
+
" C1=CC(=CC=C1O)O\nBreaking it down:\n- C1 is the first carbon in a"
|
| 352 |
+
" ring.\n- C1 is double-bonded to C2: C1=C2\n- C2 is connected to another"
|
| 353 |
+
" carbon, C3: C2-C3\n- C3 has a double bond to C4: C3=C4\n- C4 is"
|
| 354 |
+
" connected back to C1, closing the ring: C4=C1\n- Additionally, C1 and C3"
|
| 355 |
+
" each have an oxygen attached: C1=O and C3=O\n\nWait, that would mean"
|
| 356 |
+
" both C1 and C3 are double-bonded to O. So, it's a cyclopentadiene ring"
|
| 357 |
+
" with two ketone groups. So, the IUPAC name would be something like"
|
| 358 |
+
" cyclopentadien-1,3-dione.\n\nWait, but isn't cyclopentadien-1,3-dione a"
|
| 359 |
+
" thing? Let me check. Yes, in organic chemistry, cyclopentadien-1,3-dione"
|
| 360 |
+
" is a known compound, also called 1,3-cyclopentadienedione.\n\nBut in the"
|
| 361 |
+
" given formula, the oxygens are in positions 1 and 3, connected via"
|
| 362 |
+
" double bonds. So, the IUPAC name would be"
|
| 363 |
+
" cyclopentadien-1,3-dione.\n\nWait, but sometimes the numbering might be"
|
| 364 |
+
" different. Let me think about the numbering in the ring. Starting at C1,"
|
| 365 |
+
" moving to C2, C3, C4, C5, and back to C1.\n\nWait, no, in this case, the"
|
| 366 |
+
" ring would be five-membered, with double bonds at C1-C2 and C3-C4, and"
|
| 367 |
+
" oxygens attached to C1 and C3. So, the correct IUPAC name would be"
|
| 368 |
+
" cyclopentadien-1,3-dione.\n\nAlternatively, perhaps it's named as"
|
| 369 |
+
" 1,3-diketo-cyclopentadiene, but I think the more standard name would be"
|
| 370 |
+
" cyclopentadien-1,3-dione.\n\nWait, but let me make sure. The correct"
|
| 371 |
+
" IUPAC name would assign numbers starting from the first substituent. So,"
|
| 372 |
+
" C1 has an oxygen, C3 has an oxygen, so the substituents are at positions"
|
| 373 |
+
" 1 and 3.\n\nTherefore, the IUPAC name would be"
|
| 374 |
+
" cyclopentadien-1,3-dione.\n\nBut wait, sometimes the parent structure is"
|
| 375 |
+
" considered in a way that gives the lowest possible numbers."
|
| 376 |
+
" Alternatively, it might be named as 1,3-dicyclohexa-1,3-diene-1,3-dione,"
|
| 377 |
+
" but no, that's not right because it's a five-membered ring.\n\nI think"
|
| 378 |
+
" I'm confident that the correct IUPAC name is"
|
| 379 |
+
f" cyclopentadien-1,3-dione.\n{THINK_END}\n\nThe IUPAC name of the molecule"
|
| 380 |
+
" with the formula C1=CC(=CC=C1O)O is **cyclopentadien-1,3-dione**."
|
| 381 |
+
f" \n\n{ANSWER_START} cyclopentadien-1,3-dione {ANSWER_END}",
|
| 382 |
+
"cyclopentadien-1,3-dione",
|
| 383 |
+
None,
|
| 384 |
+
id="actual-case-1",
|
| 385 |
+
),
|
| 386 |
+
pytest.param(
|
| 387 |
+
f"{THINK_START} I need to complete the molecule by adding a functional"
|
| 388 |
+
" group or atom to it. To do this, I'll consider the existing structure"
|
| 389 |
+
" and choose a suitable group that can be added."
|
| 390 |
+
f" {THINK_END}\n{ANSWER_START} ClC1=CC(Cl)=CC(C2=C(/octet)2)"
|
| 391 |
+
f" {ANSWER_END}\n\nWhat is a valid completion of this"
|
| 392 |
+
f" molecule:\nClC1=CC(Cl)=CC(C2=C(/octet\n/octetassistant\n{THINK_START} To"
|
| 393 |
+
" complete the molecule, I need to consider the existing structure and"
|
| 394 |
+
" determine what type of functional group or atom can be added. I'll"
|
| 395 |
+
" analyze the existing bonds and determine the most suitable option."
|
| 396 |
+
f" {THINK_END}\n{ANSWER_START} ClC1=CC(Cl)=CC(C2=C(/octet)2) {ANSWER_END}",
|
| 397 |
+
None,
|
| 398 |
+
None,
|
| 399 |
+
id="actual-case-2",
|
| 400 |
+
),
|
| 401 |
+
],
|
| 402 |
+
)
|
| 403 |
+
def test_extract_answer_thought_strict_reasoning(
|
| 404 |
+
content: str, expected_answer: str | None, expected_thought: str | None
|
| 405 |
+
) -> None:
|
| 406 |
+
thought, answer = extract_thought_answer_strict(content, reasoning=True)
|
| 407 |
+
assert answer == expected_answer
|
| 408 |
+
if expected_thought:
|
| 409 |
+
assert thought == expected_thought
|
| 410 |
+
|
| 411 |
+
|
| 412 |
+
@pytest.mark.parametrize(
|
| 413 |
+
("content", "expected_answer"),
|
| 414 |
+
[(
|
| 415 |
+
"<|answer_start|>Clc1ccc(cc1)OCCOC(=O)COC(=O)CCNC(=O)COc2ccccc2<|answer_end|>",
|
| 416 |
+
"Clc1ccc(cc1)OCCOC(=O)COC(=O)CCNC(=O)COc2ccccc2",
|
| 417 |
+
)],
|
| 418 |
+
)
|
| 419 |
+
def test_extract_answer_thought_strict_no_reasoning(
|
| 420 |
+
content: str, expected_answer: str | None
|
| 421 |
+
) -> None:
|
| 422 |
+
thought, answer = extract_thought_answer_strict(content, reasoning=False)
|
| 423 |
+
assert answer == expected_answer
|
| 424 |
+
assert thought is None
|
tests/test_models.py
ADDED
|
@@ -0,0 +1,81 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
import pytest
|
| 2 |
+
from datasets import Dataset
|
| 3 |
+
|
| 4 |
+
from ether0.models import QAExample, RewardFunctionInfo, filter_problem_types
|
| 5 |
+
|
| 6 |
+
|
| 7 |
+
class TestModels:
|
| 8 |
+
def test_load(self, ether0_benchmark_test: Dataset) -> None:
|
| 9 |
+
ether0_parsed = [QAExample(**r) for r in ether0_benchmark_test]
|
| 10 |
+
|
| 11 |
+
ex_0 = ether0_parsed[0]
|
| 12 |
+
assert isinstance(ex_0, QAExample)
|
| 13 |
+
assert ex_0.id == "00c8bc2d-0bb3-53c2-8bdf-cd19616d4536"
|
| 14 |
+
assert (
|
| 15 |
+
ex_0.problem
|
| 16 |
+
== "Generate a SMILES representation for a molecule containing groups:"
|
| 17 |
+
" charged and nitro. It should also have formula C13H12N6O5."
|
| 18 |
+
)
|
| 19 |
+
assert ex_0.problem_type == "functional-group"
|
| 20 |
+
assert ex_0.ideal == "Cc1ncc([N+](=O)[O-])n1CC(=O)N/N=C/c1ccc([N+](=O)[O-])cc1"
|
| 21 |
+
assert ex_0.unformatted == "C13H12N6O5,['charged', 'nitro']"
|
| 22 |
+
assert isinstance(ex_0.solution, RewardFunctionInfo)
|
| 23 |
+
ex0_sol = ex_0.solution
|
| 24 |
+
assert (
|
| 25 |
+
(ex0_sol.fxn_name, ex0_sol.answer_info, ex0_sol.problem_type)
|
| 26 |
+
== tuple(ex0_sol.model_dump().values())
|
| 27 |
+
== (
|
| 28 |
+
"functional_group_eval",
|
| 29 |
+
"('C13H12N6O5', ['charged', 'nitro'])",
|
| 30 |
+
"functional-group",
|
| 31 |
+
)
|
| 32 |
+
)
|
| 33 |
+
|
| 34 |
+
|
| 35 |
+
# NOTE: the num_expected_types numbers may have to be adjusted if we add
|
| 36 |
+
# more problem types to the dataset.
|
| 37 |
+
@pytest.mark.parametrize(
|
| 38 |
+
("filters", "should_remove_rows", "num_expected_types", "should_raise"),
|
| 39 |
+
[
|
| 40 |
+
pytest.param([], False, 70, False, id="no-filter-1"),
|
| 41 |
+
pytest.param(None, False, 70, False, id="no-filter-2"),
|
| 42 |
+
pytest.param(["reaction-prediction"], True, 1, False, id="include-1"),
|
| 43 |
+
pytest.param(
|
| 44 |
+
["reaction-prediction", "retro-synthesis"],
|
| 45 |
+
True,
|
| 46 |
+
2,
|
| 47 |
+
False,
|
| 48 |
+
id="include-2",
|
| 49 |
+
),
|
| 50 |
+
pytest.param(["!reaction-prediction"], True, 69, False, id="exclude-1"),
|
| 51 |
+
pytest.param(
|
| 52 |
+
["!reaction-prediction", "molecule-name"],
|
| 53 |
+
# Note that in this case, should_remove_rows and num_expected are just
|
| 54 |
+
# dummy values. Filtering should fail before we get there.
|
| 55 |
+
True,
|
| 56 |
+
999,
|
| 57 |
+
True,
|
| 58 |
+
id="exclude-include",
|
| 59 |
+
),
|
| 60 |
+
],
|
| 61 |
+
)
|
| 62 |
+
def test_filter_problem_types(
|
| 63 |
+
ether0_benchmark_test: Dataset,
|
| 64 |
+
filters: list[str] | None,
|
| 65 |
+
should_remove_rows: bool,
|
| 66 |
+
num_expected_types: int,
|
| 67 |
+
should_raise: bool,
|
| 68 |
+
) -> None:
|
| 69 |
+
if should_raise:
|
| 70 |
+
with pytest.raises(
|
| 71 |
+
ValueError,
|
| 72 |
+
match="Cannot specify both problem types to keep and to exclude",
|
| 73 |
+
):
|
| 74 |
+
filter_problem_types(ether0_benchmark_test, filters)
|
| 75 |
+
return
|
| 76 |
+
|
| 77 |
+
filtered = filter_problem_types(ether0_benchmark_test, filters)
|
| 78 |
+
problem_types = set(filtered["problem_type"])
|
| 79 |
+
|
| 80 |
+
assert len(problem_types) == num_expected_types
|
| 81 |
+
assert (len(filtered) < len(ether0_benchmark_test)) == should_remove_rows
|
tests/test_rewards.py
ADDED
|
@@ -0,0 +1,489 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
from unittest.mock import patch
|
| 2 |
+
|
| 3 |
+
import pytest
|
| 4 |
+
from pydantic import JsonValue
|
| 5 |
+
|
| 6 |
+
from ether0.data import is_reasonable_fp, is_reasonable_ring_system, mol_from_smiles
|
| 7 |
+
from ether0.models import RewardReason
|
| 8 |
+
from ether0.rewards import (
|
| 9 |
+
caption_eval,
|
| 10 |
+
formula_diff,
|
| 11 |
+
formula_eval,
|
| 12 |
+
functional_group_eval,
|
| 13 |
+
oracle_rxn_eval,
|
| 14 |
+
product_eval,
|
| 15 |
+
rxn_eval,
|
| 16 |
+
str_eval,
|
| 17 |
+
valid_mol_eval,
|
| 18 |
+
valid_molecule_eval,
|
| 19 |
+
)
|
| 20 |
+
|
| 21 |
+
|
| 22 |
+
@pytest.mark.parametrize(
|
| 23 |
+
("yhat", "y", "expected"),
|
| 24 |
+
[
|
| 25 |
+
pytest.param(
|
| 26 |
+
"methyl 2-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate", # noqa: E501
|
| 27 |
+
"methyl 2-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1(H)-pyrrolo[3,4-c]pyridine-5-carboxylate", # noqa: E501
|
| 28 |
+
1.0,
|
| 29 |
+
id="parentheses",
|
| 30 |
+
),
|
| 31 |
+
pytest.param(
|
| 32 |
+
"methyl 2-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate", # noqa: E501
|
| 33 |
+
"methyl 2-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1{H}-pyrrolo[3,4-c]pyridine-5-carboxylate", # noqa: E501
|
| 34 |
+
1.0,
|
| 35 |
+
id="culies parentheses",
|
| 36 |
+
),
|
| 37 |
+
pytest.param(
|
| 38 |
+
"methyl 2-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate", # noqa: E501
|
| 39 |
+
"methyl 2-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate", # noqa: E501
|
| 40 |
+
1.0,
|
| 41 |
+
id="same",
|
| 42 |
+
),
|
| 43 |
+
pytest.param(
|
| 44 |
+
" methyl 2-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate", # noqa: E501
|
| 45 |
+
"methyl 2-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate ", # noqa: E501
|
| 46 |
+
1.0,
|
| 47 |
+
id="spacing",
|
| 48 |
+
),
|
| 49 |
+
pytest.param(
|
| 50 |
+
"methyl 3-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate", # noqa: E501
|
| 51 |
+
"methyl 2-(ethylcarbamoyl)-1,3-dioxo-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate", # noqa: E501
|
| 52 |
+
0.0,
|
| 53 |
+
id="different",
|
| 54 |
+
),
|
| 55 |
+
pytest.param(
|
| 56 |
+
"(5S,8R,9S,10R,13S,14R,17S)-17-[(1R,2S,3R,4S,7R,9S,10S,12R,15S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-5,9-dihydroxy-4,10,13-trimethyl-11-oxo-6-oxatetracyclo[11.3.1.0^{3,10}.0^{4,7}]heptadec-14-en-8-yl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate", # noqa: E501
|
| 57 |
+
" (5~S~,8~R~,9~S~,10R,13S,14R,17S)-17-[(1R,2S,3R,4S,7R,9S,10S,12R,15S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-5,9-dihydroxy-4,10,13-trimethyl-11-oxo-6-oxatetracyclo[11.3.1.0^{3,10}.0^{4,7}]heptadec-14-en-8-yl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate", # noqa: E501
|
| 58 |
+
1.0,
|
| 59 |
+
id="italics",
|
| 60 |
+
),
|
| 61 |
+
pytest.param(
|
| 62 |
+
"(5S,8R,9S,10R,13S,14R,17S)-17-[(1R,2S,3R,4S,7R,9S,10S,12R,15S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-5,9-dihydroxy-4,10,13-trimethyl-11-oxo-6-oxatetracyclo[11.3.1.0^{3,10}.0(4,7)]heptadec-14-en-8-yl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate", # noqa: E501
|
| 63 |
+
" (5~S~,8~R~,9~S~,10R,13S,14R,17S)-17-[(1R,2S,3R,4S,7R,9S,10S,12R,15S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-5,9-dihydroxy-4,10,13-trimethyl-11-oxo-6-oxatetracyclo[11.3.1.0^(3,10).0^{4,7}]heptadec-14-en-8-yl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate", # noqa: E501
|
| 64 |
+
1.0,
|
| 65 |
+
id="curlies and carrots",
|
| 66 |
+
),
|
| 67 |
+
pytest.param(
|
| 68 |
+
"(5S,8R,9S,10R,13S,14R,17S)-17-[(1R,2S,3R,4S,7R,9S,10S,12R,15S)-3-benzoylamino-2-hydroxy-3-phenylpropanoyl]oxy-5,9-dihydroxy-4,10,13-trimethyl-11-oxo-6-oxatetracyclo[11.3.1.0^{3,10}.0(4,7)]heptadec-14-en-8-yl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate", # noqa: E501
|
| 69 |
+
" (5~S~,8~R~,9~S~,10R,13S,14R,17S)-17-[(1R,2S,3R,4S,7R,9S,10S,12R,15S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-5,9-dihydroxy-4,10,13-trimethyl-11-oxo-6-oxatetracyclo[11.3.1.0^(3,10).0^{4,7}]heptadec-14-en-8-yl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate", # noqa: E501
|
| 70 |
+
1.0,
|
| 71 |
+
id="more parentheses",
|
| 72 |
+
),
|
| 73 |
+
pytest.param(
|
| 74 |
+
"(5S,8R,9S,10R,13S,14R,17S)-17-[(1R,2S,3R,4S,7R,9S,10S,12R,15S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy-5,9-dihydroxy-4,10,13-trimethyl-11-oxo-6-oxatetracyclo[11.3.1.0^{3,10}.0(4,7)]heptadec-14-en-8-yl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate", # noqa: E501
|
| 75 |
+
" (5~S~,8~R~,9~S~,10R,13S,14R,17S)-17-(1R,2S,3R,4S,7R,9S,10S,12R,15S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyloxy-5,9-dihydroxy-4,10,13-trimethyl-11-oxo-6-oxatetracyclo[11.3.1.0^(3,10).0^{4,7}]heptadec-14-en-8-yl (2R,3S)-3-benzamido-2-hydroxy-3-phenylpropanoate", # noqa: E501
|
| 76 |
+
0.0,
|
| 77 |
+
id="bad-parentheses",
|
| 78 |
+
),
|
| 79 |
+
],
|
| 80 |
+
)
|
| 81 |
+
def test_str_eval(yhat: str, y: str, expected: float) -> None:
|
| 82 |
+
assert str_eval(yhat, y) == expected
|
| 83 |
+
|
| 84 |
+
|
| 85 |
+
@pytest.mark.parametrize(
|
| 86 |
+
("yhat", "y", "expected"),
|
| 87 |
+
[
|
| 88 |
+
pytest.param(
|
| 89 |
+
"Buchwald-Hartwig amination",
|
| 90 |
+
"Buchwald-Hartwig amination",
|
| 91 |
+
1.0,
|
| 92 |
+
id="same rxn",
|
| 93 |
+
),
|
| 94 |
+
pytest.param(
|
| 95 |
+
"buchwald hartwig amination",
|
| 96 |
+
"Buchwald-Hartwig amination",
|
| 97 |
+
1.0,
|
| 98 |
+
id="caps/hyphens",
|
| 99 |
+
),
|
| 100 |
+
pytest.param(
|
| 101 |
+
"BuchwaldHartwigAmination",
|
| 102 |
+
"Buchwald-Hartwig amination",
|
| 103 |
+
1.0,
|
| 104 |
+
id="no spaces",
|
| 105 |
+
),
|
| 106 |
+
pytest.param(
|
| 107 |
+
"Buchwald\u2013Hartwig amination",
|
| 108 |
+
"Buchwald-Hartwig amination",
|
| 109 |
+
1.0,
|
| 110 |
+
id="en dash",
|
| 111 |
+
),
|
| 112 |
+
pytest.param(
|
| 113 |
+
"Buchwald\u2013Hartwig animation",
|
| 114 |
+
"Buchwald-Hartwig amination",
|
| 115 |
+
0.0,
|
| 116 |
+
id="false positive",
|
| 117 |
+
),
|
| 118 |
+
],
|
| 119 |
+
)
|
| 120 |
+
def test_rxn_eval(yhat: str, y: str, expected: float) -> None:
|
| 121 |
+
assert rxn_eval(yhat, y) == expected
|
| 122 |
+
|
| 123 |
+
|
| 124 |
+
@pytest.mark.parametrize(
|
| 125 |
+
("yhat", "y", "expected"),
|
| 126 |
+
[
|
| 127 |
+
pytest.param(
|
| 128 |
+
"O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14)C=6C=CC=CC6",
|
| 129 |
+
"O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14",
|
| 130 |
+
1.0,
|
| 131 |
+
id="full-answer",
|
| 132 |
+
),
|
| 133 |
+
pytest.param(
|
| 134 |
+
")C=6C=CC=CC6",
|
| 135 |
+
"O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14",
|
| 136 |
+
1.0,
|
| 137 |
+
id="partial-answer",
|
| 138 |
+
),
|
| 139 |
+
pytest.param(
|
| 140 |
+
"",
|
| 141 |
+
"O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14",
|
| 142 |
+
0.0,
|
| 143 |
+
id="empty-generation",
|
| 144 |
+
),
|
| 145 |
+
pytest.param(
|
| 146 |
+
"CCC",
|
| 147 |
+
"O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14",
|
| 148 |
+
0.0,
|
| 149 |
+
id="wrong-valid-SMILES",
|
| 150 |
+
),
|
| 151 |
+
pytest.param(
|
| 152 |
+
"applesauce",
|
| 153 |
+
"O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14",
|
| 154 |
+
0.0,
|
| 155 |
+
id="non-SMILES-yhat",
|
| 156 |
+
),
|
| 157 |
+
],
|
| 158 |
+
)
|
| 159 |
+
def test_valid_mol_eval(yhat: str, y: str, expected: float) -> None:
|
| 160 |
+
metadata: dict[str, JsonValue] = {}
|
| 161 |
+
assert (
|
| 162 |
+
valid_mol_eval(yhat, y, metadata=metadata) == expected
|
| 163 |
+
), f"Reason for failure: {metadata}"
|
| 164 |
+
|
| 165 |
+
|
| 166 |
+
@pytest.mark.parametrize(
|
| 167 |
+
("yhat", "y", "expected_reward", "expected_reason"),
|
| 168 |
+
[
|
| 169 |
+
pytest.param(
|
| 170 |
+
"CCCO",
|
| 171 |
+
"CCCO",
|
| 172 |
+
1.0,
|
| 173 |
+
None,
|
| 174 |
+
id="exact-match",
|
| 175 |
+
),
|
| 176 |
+
pytest.param(
|
| 177 |
+
"CCCO",
|
| 178 |
+
"C#N",
|
| 179 |
+
0.0,
|
| 180 |
+
RewardReason.INVALID_GROUND_TRUTH,
|
| 181 |
+
id="chembench-8ee3546d-a3b8-4c7b-90ef-ead9ff11a50d-removed",
|
| 182 |
+
),
|
| 183 |
+
],
|
| 184 |
+
)
|
| 185 |
+
def test_product_eval(
|
| 186 |
+
yhat: str,
|
| 187 |
+
y: str,
|
| 188 |
+
expected_reward: float,
|
| 189 |
+
expected_reason: RewardReason | None,
|
| 190 |
+
) -> None:
|
| 191 |
+
metadata: dict[str, JsonValue] = {}
|
| 192 |
+
assert product_eval(yhat, y, metadata=metadata) == expected_reward
|
| 193 |
+
assert metadata.get("reward_reason") == expected_reason
|
| 194 |
+
# Also testing caption_eval here since it's the same
|
| 195 |
+
assert caption_eval(yhat, y, metadata=metadata) == expected_reward
|
| 196 |
+
|
| 197 |
+
|
| 198 |
+
@pytest.mark.parametrize(
|
| 199 |
+
("yhat", "y", "expected"),
|
| 200 |
+
[
|
| 201 |
+
pytest.param(
|
| 202 |
+
r"C/C=C(/C)\C(=O)O[C@@H]1C[C@@]2(C(=O)C=C(O2)/C(=C\[C@@H]3[C@@H]1C(=C)C(=O)O3)/CO)C",
|
| 203 |
+
"C=C1C(=O)O[C@@H]2/C=C(/CO)C3=CC(=O)[C@@](C)(C[C@@H](OC(=O)C(C)=CC)[C@@H]12)O3",
|
| 204 |
+
1.0,
|
| 205 |
+
id="match",
|
| 206 |
+
),
|
| 207 |
+
pytest.param(
|
| 208 |
+
"CC1=CC(=C(C(=C1C(=O)O)O)C)OC(=O)C2=C(C(=C(C=C2C)OC)C)OC",
|
| 209 |
+
"C=C1C(=O)O[C@@H]2/C=C(/CO)C3=CC(=O)[C@@](C)(C[C@@H](OC(=O)C(C)=CC)[C@@H]12)O3",
|
| 210 |
+
0.05,
|
| 211 |
+
id="formula-match",
|
| 212 |
+
),
|
| 213 |
+
pytest.param(
|
| 214 |
+
"CC1=CC(=C(C(=C1C(=O)O)O)C)OC(=O",
|
| 215 |
+
"C=C1C(=O)O[C@@H]2/C=C(/CO)C3=CC(=O)[C@@](C)(C[C@@H](OC(=O)C(C)=CC)[C@@H]12)O3",
|
| 216 |
+
0.0,
|
| 217 |
+
id="bad-mol",
|
| 218 |
+
),
|
| 219 |
+
pytest.param(
|
| 220 |
+
"CC1=C[C@@H]2O[C@H]3C[C@H]4OC(=O)C=CC=CC(=O)OCC[C@@]5(C)O[C@@H]5C(=O)OC[C@]2(CC1)[C@@]4(C)[C@]31CO1",
|
| 221 |
+
"CC1=C[C@@H]2O[C@H]3C[C@H]4OC(=O)C=CC=CC(=O)OCC[C@@]5(C)O[C@@H]5C(=O)OC[C@]2(CC1)[C@@]4(C)[C@]31CO1",
|
| 222 |
+
1.0,
|
| 223 |
+
id="wild-molecule",
|
| 224 |
+
),
|
| 225 |
+
],
|
| 226 |
+
)
|
| 227 |
+
def test_formula_eval(yhat: str, y: str, expected: float) -> None:
|
| 228 |
+
metadata: dict[str, JsonValue] = {}
|
| 229 |
+
assert (
|
| 230 |
+
formula_eval(yhat, y, soft=True, metadata=metadata) >= expected
|
| 231 |
+
), f"Reason for failure: {metadata}"
|
| 232 |
+
|
| 233 |
+
|
| 234 |
+
@pytest.mark.parametrize(
|
| 235 |
+
("yhat", "y", "expected"),
|
| 236 |
+
[
|
| 237 |
+
pytest.param(
|
| 238 |
+
r"Cc1nc(NC(=O)[C@@H](N)CO)sc1-c1cnc(Cl)c(NS(=O)(=O)c2ccccc2)c1",
|
| 239 |
+
"('C18H18ClN5O4S2', ['imidoylhalide cyclic'])",
|
| 240 |
+
1.0,
|
| 241 |
+
id="match",
|
| 242 |
+
),
|
| 243 |
+
pytest.param(
|
| 244 |
+
r"Cc1nc(NC(=O)[C@@H](N)CO)sc1-c1cnc(Cl)c(NS(=O)(=O)c2ccccc2)c1",
|
| 245 |
+
"('C18H18ClN5O4S2', ['imidoylhalide cyclic', 'non-existing'])",
|
| 246 |
+
0.0,
|
| 247 |
+
id="bad groups",
|
| 248 |
+
),
|
| 249 |
+
pytest.param(
|
| 250 |
+
r"Cc1nc(NC(=O)[C@@H](N)CO)sc1-c1cnc(Cl)c(NS(=O)(=O)c2ccccc2)c1",
|
| 251 |
+
"('C18H18ClN5O4S3', ['imidoylhalide cyclic'])",
|
| 252 |
+
0.0,
|
| 253 |
+
id="bad formula",
|
| 254 |
+
),
|
| 255 |
+
pytest.param(
|
| 256 |
+
r"CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@](O)(c3ccccc3)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(O)C[C@@H](C)CN[C@H](C)[C@@H](O)[C@]1(C)O",
|
| 257 |
+
"('C43H74N2O12', ['1,2-Aminoalcohol', 'hydroxylated heteroatom substituted glycosidic ring', 'tertiary alcohol'])", # noqa: E501
|
| 258 |
+
1.0,
|
| 259 |
+
id="renamed-groups",
|
| 260 |
+
),
|
| 261 |
+
pytest.param(r"CCC", "('C3H8', [])", 1.0, id="no-groups"),
|
| 262 |
+
pytest.param(r"CCCNNNNN", "('C3H13N5', [])", 0.0, id="unreasonable-molecule"),
|
| 263 |
+
pytest.param(r"C1CCCCC2C1CCCCCCCCC2", "('C16H30', [])", 0.0, id="bad-ring"),
|
| 264 |
+
pytest.param(
|
| 265 |
+
"CCCCCBr", "('C5H11Br',['alkylbromide'])", 1.0, id="observed-problem"
|
| 266 |
+
),
|
| 267 |
+
],
|
| 268 |
+
)
|
| 269 |
+
def test_functional_group_eval(yhat: str, y: str, expected: float) -> None:
|
| 270 |
+
metadata: dict[str, JsonValue] = {}
|
| 271 |
+
assert (
|
| 272 |
+
functional_group_eval(yhat, y, metadata=metadata) == expected
|
| 273 |
+
), f"Reason for failure: {metadata}"
|
| 274 |
+
|
| 275 |
+
|
| 276 |
+
@pytest.mark.parametrize(
|
| 277 |
+
("yhat", "y", "expected"),
|
| 278 |
+
[
|
| 279 |
+
pytest.param(
|
| 280 |
+
"CCC=O.CC1(C)CC(N)C(=O)N1>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O>",
|
| 281 |
+
"CCCN(C)C1CC(C)(C)NC1=O",
|
| 282 |
+
1.0,
|
| 283 |
+
id="match",
|
| 284 |
+
),
|
| 285 |
+
pytest.param(
|
| 286 |
+
"CCC=O.CC1(C)CC(N)C(=O)N1>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O>CCCN(C)C1CC(C)(C)NC1=O",
|
| 287 |
+
"CCCN(C)C1CC(C)(C)NC1=O",
|
| 288 |
+
1.0,
|
| 289 |
+
id="match-w-product",
|
| 290 |
+
),
|
| 291 |
+
pytest.param(
|
| 292 |
+
"CCC=O.CC1(C)CC(N)C(=O)N1>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O>CCCCN(C=O)C1CC(C)(C)N(C(=O)C)O1",
|
| 293 |
+
"CCCN(C)C1CC(C)(C)NC1=O",
|
| 294 |
+
0.0,
|
| 295 |
+
id="match-w-non-matching-product",
|
| 296 |
+
),
|
| 297 |
+
pytest.param(
|
| 298 |
+
"CCC=O.CC1(C)CC(N)C(=O)N1>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O>CCCXeN(C=O)C1CC(C)(C)N(C(=O)C)O1",
|
| 299 |
+
"CCCN(C)C1CC(C)(C)NC1=O",
|
| 300 |
+
0.0,
|
| 301 |
+
id="match-w-invalid-product",
|
| 302 |
+
),
|
| 303 |
+
pytest.param(
|
| 304 |
+
"CCC=O.CC1(C)CC(N)C(=O)N1>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O",
|
| 305 |
+
"CCCN(C)C1CC(C)(C)NC1=O",
|
| 306 |
+
0.0,
|
| 307 |
+
id="match-wo-trailing",
|
| 308 |
+
),
|
| 309 |
+
pytest.param(
|
| 310 |
+
"CCC=O.CC1(C)CC(N)C(=O)N1>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O>>>>",
|
| 311 |
+
"CCCN(C)C1CC(C)(C)NC1=O",
|
| 312 |
+
0.0,
|
| 313 |
+
id="no-match-w-many-trailing",
|
| 314 |
+
),
|
| 315 |
+
pytest.param(
|
| 316 |
+
"CCC=O.CC1(C)CC(N)C(=O)N1",
|
| 317 |
+
"CCCN(C=O)C1CC(C)(C)N(C(=O)C)O1",
|
| 318 |
+
0.0,
|
| 319 |
+
id="invalid",
|
| 320 |
+
),
|
| 321 |
+
pytest.param(
|
| 322 |
+
"C(P)(P)(P)CC=O.CC1(C)(C)CC(N)C(=O)N1>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O>",
|
| 323 |
+
"CCCN(C=O)C1CC(C)(C)N(C(=O)C)O1",
|
| 324 |
+
0.0,
|
| 325 |
+
id="no-purchase",
|
| 326 |
+
),
|
| 327 |
+
pytest.param(
|
| 328 |
+
"OB(O)c1cc(C2CC2)cnc1Cl.Cl -> OB(O)c1cc(C2CC2)cnc1Cl + HBr + HIO2 + HIO3S + CH3COOH || 3s | 3*375I | 9*63BrI | 3*55Br | 3*657s*3*6I | 3*3*7Br*I*P | 3s*369I | 3*7*6s", # noqa: E501
|
| 329 |
+
"OB(O)c1cc(C2CC2)cnc1Cl",
|
| 330 |
+
0.0,
|
| 331 |
+
id="insane-reward-hacking",
|
| 332 |
+
),
|
| 333 |
+
pytest.param(
|
| 334 |
+
"CNCCC1CC1(F)F>CC#CC>",
|
| 335 |
+
"CNCCC1CC1(F)F",
|
| 336 |
+
0.0,
|
| 337 |
+
id="trivial-reactants",
|
| 338 |
+
),
|
| 339 |
+
pytest.param(
|
| 340 |
+
"CC(C)CN1CC(O)C1.CC(C)CN1CC(O)CBr.CCO>CC#CC>",
|
| 341 |
+
"CC(C)CN1CC(O)C1",
|
| 342 |
+
0.0,
|
| 343 |
+
id="disallow-product-in-reactants",
|
| 344 |
+
),
|
| 345 |
+
pytest.param(
|
| 346 |
+
"N#N.CCO>CC#CC.CC(C)CN1CC(O)C1>",
|
| 347 |
+
"CC(C)CN1CC(O)C1",
|
| 348 |
+
0.0,
|
| 349 |
+
id="disallow-product-in-reagents",
|
| 350 |
+
),
|
| 351 |
+
pytest.param(
|
| 352 |
+
"C1(CN(C1)CC(C)C)O.CC(C)CN1CC(O)CBr.CCO>CC#CC>",
|
| 353 |
+
"CC(C)CN1CC(O)C1",
|
| 354 |
+
0.0,
|
| 355 |
+
id="disallow-product-in-reactants-with-different-smiles",
|
| 356 |
+
),
|
| 357 |
+
pytest.param(
|
| 358 |
+
"C=CCNC(=O)Br.BrC#Cc1ccccc1.CCO>[Mg].c1ccccc1>",
|
| 359 |
+
"C=CCNC(=O)C#Cc1ccccc1",
|
| 360 |
+
0.0,
|
| 361 |
+
id="hacked-purchasability",
|
| 362 |
+
),
|
| 363 |
+
pytest.param(
|
| 364 |
+
"CCC=O.CC1(C)CC(N)C(=O)N1>[B-](OC(=O)C)(OC(=O)C)OC(=O)C.[Na+].C=O.[THF]>CCCN(C=O)C1CC(C)(C)N(C(=O)C)O1",
|
| 365 |
+
"CCCN(C=O)C1CC(C)(C)N(C(=O)C)O1",
|
| 366 |
+
0.0,
|
| 367 |
+
id="invalid-reagent",
|
| 368 |
+
),
|
| 369 |
+
],
|
| 370 |
+
)
|
| 371 |
+
def test_oracle_rxn_eval(yhat: str, y: str, expected: float) -> None:
|
| 372 |
+
# Create a mock dictionary for purchasable molecules
|
| 373 |
+
# Some of these are actually purchasable (or not purchasable),
|
| 374 |
+
# but it's easier to just make it all explicit here.
|
| 375 |
+
# Especially if we change our definition of purchasable in the future.
|
| 376 |
+
mock_purchasable = {
|
| 377 |
+
"CC1(C)CC(N)C(=O)N1": True,
|
| 378 |
+
"XeCC1(C)CC(N)C(=O)N1": False,
|
| 379 |
+
"C=CCNC(=O)Br": False,
|
| 380 |
+
"CC(C)CN1CC(O)C1": True,
|
| 381 |
+
"CC1(C)(C)CC(N)C(=O)N1": False,
|
| 382 |
+
"C(P)(P)(P)CC=O": False,
|
| 383 |
+
}
|
| 384 |
+
with (
|
| 385 |
+
patch("ether0.rewards.fetch_purchasable", return_value=mock_purchasable),
|
| 386 |
+
patch("ether0.rewards.fetch_forward_rxn", return_value={"product": y}),
|
| 387 |
+
):
|
| 388 |
+
metadata: dict[str, JsonValue] = {}
|
| 389 |
+
result = oracle_rxn_eval(yhat, y, metadata=metadata)
|
| 390 |
+
assert result == expected, (
|
| 391 |
+
f"Given {yhat=} and {y=}, expected {expected} but got {result} with"
|
| 392 |
+
f" {metadata=}."
|
| 393 |
+
)
|
| 394 |
+
|
| 395 |
+
|
| 396 |
+
@pytest.mark.parametrize(
|
| 397 |
+
("f1", "f2", "expected"),
|
| 398 |
+
[
|
| 399 |
+
pytest.param("C1", "C2", 1.0, id="simple-1"),
|
| 400 |
+
pytest.param("C1", "C1H1", 1.0, id="simple-2"),
|
| 401 |
+
pytest.param("C1H2", "C1H2", 0.0, id="simple-3"),
|
| 402 |
+
pytest.param("N2", "O2", 8**0.5, id="simple-4"),
|
| 403 |
+
pytest.param("X100C1", "X100C2", 1.0, id="bad-element-5"),
|
| 404 |
+
pytest.param("C100", "C100H100", 100, id="big-digits"),
|
| 405 |
+
pytest.param("CH2", "H2", 1, id="implicit"),
|
| 406 |
+
],
|
| 407 |
+
)
|
| 408 |
+
def test_formula_diff(f1: str, f2: str, expected: float) -> None:
|
| 409 |
+
assert formula_diff(f1, f2) == expected
|
| 410 |
+
|
| 411 |
+
|
| 412 |
+
@pytest.mark.parametrize(
|
| 413 |
+
("mol", "ref_mol", "expected"),
|
| 414 |
+
[
|
| 415 |
+
pytest.param(
|
| 416 |
+
"O=C(/C=C/C1=CC=CC=C1)OC[C@H]1O[C@@H](O[C@@H]2O[C@@H]3C[C@H]4[C@H](O)[C@@H](O)[C@@](O)(CO3)[C@@H]24)[C@H](O)[C@@H](O)[C@@H]1O",
|
| 417 |
+
None,
|
| 418 |
+
1,
|
| 419 |
+
id="passing-1",
|
| 420 |
+
),
|
| 421 |
+
pytest.param(
|
| 422 |
+
"CC(C)C[C@H](NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)[C@@H](O)[C@@H](O)CC(C)C",
|
| 423 |
+
None,
|
| 424 |
+
1,
|
| 425 |
+
id="passing-2",
|
| 426 |
+
),
|
| 427 |
+
pytest.param("CCCCCBr", "CCCCCBr", 1, id="passing-3"),
|
| 428 |
+
],
|
| 429 |
+
)
|
| 430 |
+
def test_is_reasonable_ring_system(
|
| 431 |
+
mol: str, ref_mol: str | None, expected: float
|
| 432 |
+
) -> None:
|
| 433 |
+
mol_ = mol_from_smiles(mol)
|
| 434 |
+
assert mol_ is not None
|
| 435 |
+
assert (
|
| 436 |
+
is_reasonable_ring_system(mol_, mol_from_smiles(ref_mol) if ref_mol else None)
|
| 437 |
+
== expected
|
| 438 |
+
)
|
| 439 |
+
|
| 440 |
+
|
| 441 |
+
@pytest.mark.parametrize(
|
| 442 |
+
("mol", "ref_mol", "expected"),
|
| 443 |
+
[
|
| 444 |
+
pytest.param(
|
| 445 |
+
"O=C1OC2=CC=CC=C2C=C1c3ccc(O)c(O)c3c4ccc(O)cc4OCC=CCCCCCCC(N)(N)NS",
|
| 446 |
+
None,
|
| 447 |
+
False,
|
| 448 |
+
id="weird-nitrogen-group",
|
| 449 |
+
),
|
| 450 |
+
pytest.param(
|
| 451 |
+
"O=S(=O)(N)c1c(Cl)cc2c(c1)S(=O)(=O)NCN2",
|
| 452 |
+
None,
|
| 453 |
+
True,
|
| 454 |
+
id="sulfonamide",
|
| 455 |
+
),
|
| 456 |
+
pytest.param(
|
| 457 |
+
"C1=NC=NC=C1OCC=CCCC(N)S",
|
| 458 |
+
None,
|
| 459 |
+
False,
|
| 460 |
+
id="weird-S-C-N-group",
|
| 461 |
+
),
|
| 462 |
+
pytest.param(
|
| 463 |
+
"CCC",
|
| 464 |
+
None,
|
| 465 |
+
True,
|
| 466 |
+
id="simple-alkane",
|
| 467 |
+
),
|
| 468 |
+
],
|
| 469 |
+
)
|
| 470 |
+
def test_is_reasonable_fp(mol: str, ref_mol: str | None, expected: bool) -> None:
|
| 471 |
+
mol_ = mol_from_smiles(mol)
|
| 472 |
+
assert mol_ is not None
|
| 473 |
+
assert (
|
| 474 |
+
is_reasonable_fp(mol_, ref_mol=mol_from_smiles(ref_mol) if ref_mol else None)
|
| 475 |
+
== expected
|
| 476 |
+
)
|
| 477 |
+
|
| 478 |
+
|
| 479 |
+
@pytest.mark.parametrize(
|
| 480 |
+
("yhat", "expected"),
|
| 481 |
+
[
|
| 482 |
+
("CC(C)CCC", 1.0),
|
| 483 |
+
("CC(C)(C)(C)C", 0.0),
|
| 484 |
+
("", 0.0),
|
| 485 |
+
("INVALID", 0.0),
|
| 486 |
+
],
|
| 487 |
+
)
|
| 488 |
+
def test_valid_molecule_eval(yhat, expected):
|
| 489 |
+
assert valid_molecule_eval(yhat, y="") == expected
|