# app.py
# AI-Powered Drug Discovery Pipeline Streamlit Application
# This script integrates four phases of drug discovery into a single, interactive web app.

import streamlit as st
import pandas as pd
import numpy as np
import matplotlib.pyplot as plt
import seaborn as sns
import requests
import io
import re
from PIL import Image
import base64

# RDKit and BioPython imports
from rdkit import Chem
from rdkit.Chem import Draw, AllChem, Descriptors
from Bio import SeqIO

# Scikit-learn for ML models
from sklearn.ensemble import RandomForestClassifier
from sklearn.model_selection import train_test_split

# 3D Visualization
import py3Dmol

# Bokeh plotting
from bokeh.plotting import figure
from bokeh.models import ColumnDataSource, HoverTool
from bokeh.layouts import gridplot
from bokeh.transform import factor_cmap, cumsum
from math import pi

# Suppress warnings for cleaner output
import warnings
warnings.filterwarnings('ignore')

# --- Page Configuration ---
st.set_page_config(
    page_title="AI Drug Discovery Pipeline",
    page_icon="🔬",
    layout="wide",
    initial_sidebar_state="collapsed", # Sidebar is removed, but this is good practice
)

# Custom CSS for a professional, minimalist look
def apply_custom_styling():
    st.markdown(
        """
        <style>
        @import url('https://fonts.googleapis.com/css2?family=Roboto:wght@400;700&display=swap');
        
        html, body, [class*="st-"] {
            font-family: 'Roboto', sans-serif;
        }

        .stApp {
            background-color: rgb(28, 28, 28);
            color: white;
        }

        /* Tab styles */
        .stTabs [data-baseweb="tab-list"] {
            gap: 24px;
        }

        .stTabs [data-baseweb="tab"] {
            height: 50px;
            white-space: pre-wrap;
            background: none;
            border-radius: 0px;
            border-bottom: 2px solid #333;
            padding: 10px 4px;
            color: #AAA;
        }
        
        .stTabs [data-baseweb="tab"]:hover {
            background: #222;
            color: #FFF;
        }

        .stTabs [aria-selected="true"] {
            border-bottom: 2px solid #00A0FF; /* Highlight color for active tab */
            color: #FFF;
        }
        
        /* Button styles */
        .stButton>button {
            border-color: #00A0FF;
            color: #00A0FF;
        }
        
        .stButton>button:hover {
            border-color: #FFF;
            color: #FFF;
            background-color: #00A0FF;
        }

        </style>
        """,
        unsafe_allow_html=True
    )

apply_custom_styling()


# --- 2. Core Functions from All Phases ---
# These functions are adapted from the provided Python scripts.

# ===== Phase 1 Functions =====

@st.cache_data(show_spinner="Fetching PDB structure...")
def fetch_pdb_structure(pdb_id: str):
    """
    Fetches a PDB file and returns its content.
    """
    log = ""
    try:
        url = f"https://files.rcsb.org/download/{pdb_id}.pdb"
        response = requests.get(url, timeout=20)
        if response.status_code == 200:
            log += f"✅ Successfully fetched PDB data for {pdb_id}.\n"
            return response.text, log
        else:
            log += f"⚠️ Failed to fetch PDB file for {pdb_id} (Status: {response.status_code}). Please check the PDB ID and try again.\n"
            return None, log
    except Exception as e:
        log += f"❌ An error occurred while fetching PDB data: {e}\n"
        return None, log

@st.cache_data(show_spinner="Fetching FASTA sequence...")
def fetch_fasta_sequence(protein_id: str):
    """
    Fetches a protein's FASTA sequence from NCBI.
    """
    log = ""
    try:
        url = f"https://eutils.ncbi.nlm.nih.gov/entrez/eutils/efetch.fcgi?db=protein&id={protein_id}&rettype=fasta&retmode=text"
        response = requests.get(url, timeout=20)
        if response.status_code == 200:
            parsed_fasta = SeqIO.read(io.StringIO(response.text), "fasta")
            log += f"✅ Successfully fetched FASTA sequence for {protein_id}.\n\n"
            log += f"--- Protein Sequence Information ---\n"
            log += f"ID: {parsed_fasta.id}\n"
            log += f"Description: {parsed_fasta.description}\n"
            log += f"Sequence Length: {len(parsed_fasta.seq)}\n"
            log += f"Sequence Preview: {parsed_fasta.seq[:60]}...\n"
            return log
        else:
            log += f"⚠️ Failed to fetch FASTA file (Status: {response.status_code}).\n"
            return log
    except Exception as e:
        log += f"❌ An error occurred while fetching FASTA data: {e}\n"
        return log

def visualize_protein_3d(pdb_data: str, title="Protein 3D Structure"):
    """
    Generates an interactive 3D protein visualization using py3Dmol.
    """
    if not pdb_data:
        return None, "Cannot generate 3D view: No PDB data provided."
    try:
        viewer = py3Dmol.view(width='100%', height=600)
        viewer.setBackgroundColor('#1C1C1C') 
        viewer.addModel(pdb_data, "pdb")
        viewer.setStyle({'cartoon': {'color': 'spectrum', 'thickness': 0.8}})
        viewer.addSurface(py3Dmol.VDW, {'opacity': 0.3, 'color': 'lightblue'})
        viewer.zoomTo()
        html = viewer._make_html()
        log = f"✅ Generated 3D visualization for {title}."
        return html, log
    except Exception as e:
        return None, f"❌ 3D visualization error: {e}"

def create_sample_molecules():
    """
    Returns a dictionary of sample molecules in Name:SMILES format.
    """
    return {
        "Oseltamivir": "CCC(CC)O[C@H]1[C@H]([C@@H]([C@H](C=C1C(=O)OCC)N)N)NC(=O)C",
        "Zanamivir": "C[C@H](N)C(=O)N[C@H]1[C@@H](O)C=C(O[C@H]1[C@@H](O)[C@H](O)CO)C(O)=O",
        "Aspirin": "CC(=O)OC1=CC=CC=C1C(=O)O",
        "Ibuprofen": "CC(C)CC1=CC=C(C=C1)C(C)C(=O)O",
    }

def calculate_molecular_properties(smiles_dict: dict):
    """
    Calculates key physicochemical properties for a dictionary of molecules using RDKit.
    """
    properties = []
    log = ""
    for name, smiles in smiles_dict.items():
        mol = Chem.MolFromSmiles(smiles)
        if mol:
            props = {
                'Molecule': name, # Use the provided name
                'SMILES': smiles,
                'MW': Descriptors.MolWt(mol),
                'LogP': Descriptors.MolLogP(mol),
                'HBD': Descriptors.NumHDonors(mol),
                'HBA': Descriptors.NumHAcceptors(mol),
                'TPSA': Descriptors.TPSA(mol),
                'RotBonds': Descriptors.NumRotatableBonds(mol),
            }
            properties.append(props)
        else:
            log += f"⚠️ Invalid SMILES string skipped for {name}: {smiles}\n"
    
    df = pd.DataFrame(properties).round(2)
    log += f"✅ Calculated properties for {len(df)} valid molecules.\n"
    return df, log

def assess_drug_likeness(df: pd.DataFrame):
    """
    Assesses drug-likeness based on Lipinski's Rule of Five.
    This version returns a boolean for plotting and a formatted string for display.
    """
    if df.empty:
        return pd.DataFrame(), pd.DataFrame(), "Cannot assess drug-likeness: No properties data."
    
    # Create a copy for analysis to avoid modifying the original dataframe
    analysis_df = df.copy()
    analysis_df['MW_OK'] = analysis_df['MW'] <= 500
    analysis_df['LogP_OK'] = analysis_df['LogP'] <= 5
    analysis_df['HBD_OK'] = analysis_df['HBD'] <= 5
    analysis_df['HBA_OK'] = analysis_df['HBA'] <= 10
    analysis_df['Lipinski_Violations'] = (~analysis_df[['MW_OK', 'LogP_OK', 'HBD_OK', 'HBA_OK']]).sum(axis=1)
    
    # This boolean column is for the plotting function
    analysis_df['Drug_Like'] = analysis_df['Lipinski_Violations'] <= 1
    
    # Create a separate DataFrame for display purposes with emojis
    display_df = df.copy()
    display_df['Lipinski_Violations'] = analysis_df['Lipinski_Violations']
    display_df['Drug_Like'] = analysis_df['Drug_Like'].apply(lambda x: '✅ Yes' if x else '❌ No')
    
    log = "✅ Assessed drug-likeness using Lipinski's Rule of Five.\n"
    
    # Return both the analysis_df (for plotting) and display_df (for tables)
    return analysis_df, display_df, log


def plot_properties_dashboard(df: pd.DataFrame):
    """Creates a professional 2x2 dashboard of molecular property visualizations using Bokeh."""
    from math import pi, cos, sin
    if df.empty or 'Drug_Like' not in df.columns:
        return None, "Cannot plot: No analysis data or 'Drug_Like' column missing."

    if df['Drug_Like'].dtype != bool:
        return None, f"Cannot plot: 'Drug_Like' column must be boolean, but it is {df['Drug_Like'].dtype}."

    # Prepare data
    df['Category'] = df['Drug_Like'].apply(lambda x: 'Drug-Like' if x else 'Non-Drug-Like')
    source = ColumnDataSource(df)
    
    # Professional color palette
    colors = ['#00D4AA', '#FF6B6B']  # Teal for drug-like, coral for non-drug-like
    color_mapper = factor_cmap('Category', palette=colors, factors=["Drug-Like", "Non-Drug-Like"])
    
    # Enhanced hover tooltip
    hover = HoverTool(tooltips=[
        ("Compound", "@Molecule"),
        ("MW", "@MW{0.0} Da"),
        ("LogP", "@LogP{0.00}"),
        ("HBD", "@HBD"),
        ("HBA", "@HBA"),
        ("TPSA", "@TPSA{0.0} Ų"),
        ("Category", "@Category")
    ])
    
    # Common plot configuration - responsive plots with no background fill
    plot_config = {
        'tools': [hover, 'pan,wheel_zoom,box_zoom,reset,save'],
        'sizing_mode': 'scale_width', 
        'background_fill_color': None,
        'border_fill_color': None, 
        'outline_line_color': '#333333',
        'min_border_left': 50,
        'min_border_right': 50,
        'min_border_top': 50,
        'min_border_bottom': 50
    }
    
    def style_plot(p, x_label, y_label, title):
        """Apply consistent professional styling to plots."""
        p.title.text = title
        p.title.text_color = '#FFFFFF'
        p.title.text_font_size = '14pt'
        p.title.text_font_style = 'bold'
        
        p.xaxis.axis_label = x_label
        p.yaxis.axis_label = y_label
        p.axis.axis_label_text_color = '#CCCCCC'
        p.axis.axis_label_text_font_size = '11pt'
        p.axis.major_label_text_color = '#AAAAAA'
        p.axis.major_label_text_font_size = '10pt'
        
        p.grid.grid_line_color = '#2A2A2A'
        p.grid.grid_line_alpha = 0.3
        
        if p.legend:
            p.legend.location = "top_right"
            p.legend.background_fill_color = '#1A1A1A'
            p.legend.background_fill_alpha = 0.8
            p.legend.border_line_color = '#444444'
            p.legend.label_text_color = '#FFFFFF'
            p.legend.label_text_font_size = '10pt'
            p.legend.click_policy = "mute"
            p.legend.glyph_height = 15
            p.legend.spacing = 5
        
        return p

    # Plot 1: MW vs LogP with Lipinski guidelines
    p1 = figure(title="Molecular Weight vs LogP", **plot_config)
    p1.scatter('MW', 'LogP', source=source, legend_group='Category', 
               color=color_mapper, size=12, alpha=0.8, line_color='white', line_width=0.5)
    
    # Add Lipinski rule lines
    p1.line([500, 500], [df['LogP'].min()-0.5, df['LogP'].max()+0.5], 
            line_dash="dashed", line_color="#FFD700", line_width=2, alpha=0.7, legend_label="MW ≤ 500")
    p1.line([df['MW'].min()-50, df['MW'].max()+50], [5, 5], 
            line_dash="dashed", line_color="#FFD700", line_width=2, alpha=0.7, legend_label="LogP ≤ 5")
    
    style_plot(p1, "Molecular Weight (Da)", "LogP", "Lipinski Rule: MW vs LogP")

    # Plot 2: HBD vs HBA
    p2 = figure(title="Hydrogen Bonding Profile", **plot_config)
    p2.scatter('HBD', 'HBA', source=source, legend_group='Category',
               color=color_mapper, size=12, alpha=0.8, line_color='white', line_width=0.5)
    
    # Add Lipinski rule lines
    p2.line([5, 5], [df['HBA'].min()-1, df['HBA'].max()+1], 
            line_dash="dashed", line_color="#FFD700", line_width=2, alpha=0.7, legend_label="HBD ≤ 5")
    p2.line([df['HBD'].min()-1, df['HBD'].max()+1], [10, 10], 
            line_dash="dashed", line_color="#FFD700", line_width=2, alpha=0.7, legend_label="HBA ≤ 10")
    
    style_plot(p2, "Hydrogen Bond Donors", "Hydrogen Bond Acceptors", "Lipinski Rule: Hydrogen Bonding")

    # --- MODIFICATION ---
    # Plot 3: TPSA vs Rotatable Bonds with guidelines
    p3 = figure(title="Molecular Flexibility & Polarity", **plot_config)
    p3.scatter('TPSA', 'RotBonds', source=source, legend_group='Category',
               color=color_mapper, size=12, alpha=0.8, line_color='white', line_width=0.5)
    
    # Add permeability guideline lines
    p3.line([140, 140], [df['RotBonds'].min()-1, df['RotBonds'].max()+1], 
            line_dash="dashed", line_color="#FFD700", line_width=2, alpha=0.7, legend_label="TPSA ≤ 140")
    p3.line([df['TPSA'].min()-10, df['TPSA'].max()+10], [10, 10], 
            line_dash="dashed", line_color="#FFD700", line_width=2, alpha=0.7, legend_label="RotBonds ≤ 10")
    
    style_plot(p3, "Topological Polar Surface Area (Ų)", "Rotatable Bonds", "Drug Permeability Indicators")

    # Plot 4: Enhanced Donut Chart
    p4_config = plot_config.copy()
    p4_config.update({'tools': "hover", 'x_range': (-1.0, 1.0), 'y_range': (-1.0, 1.0)})
    p4 = figure(title="Drug-Likeness Distribution", **p4_config)
    
    # Calculate percentages and create donut chart
    counts = df['Category'].value_counts()
    total = counts.sum()
    data = pd.DataFrame({
        'category': counts.index,
        'value': counts.values,
        'percentage': (counts.values / total * 100).round(1),
        'angle': counts.values / total * 2 * pi,
        'color': [colors[0] if cat == 'Drug-Like' else colors[1] for cat in counts.index]
    })
    
    # Calculate start and end angles for each wedge
    data['start_angle'] = 0
    data['end_angle'] = 0
    cumulative_angle = 0
    for i in range(len(data)):
        data.iloc[i, data.columns.get_loc('start_angle')] = cumulative_angle
        cumulative_angle += data.iloc[i]['angle']
        data.iloc[i, data.columns.get_loc('end_angle')] = cumulative_angle
    
    donut_source = ColumnDataSource(data)
    
    # Create donut using annular wedges (outer ring) - sized to fit within boundaries
    p4.annular_wedge(x=0, y=0, inner_radius=0.25, outer_radius=0.45,
                     start_angle='start_angle', end_angle='end_angle',
                     line_color="white", line_width=3, fill_color='color', 
                     legend_field='category', source=donut_source)
    
    # Add percentage text to each slice
    for i, row in data.iterrows():
        # Calculate middle angle for text positioning
        mid_angle = (row['start_angle'] + row['end_angle']) / 2
        # Position text at middle radius of the annular wedge
        text_radius = 0.35
        x_pos = text_radius * cos(mid_angle)
        y_pos = text_radius * sin(mid_angle)
        
        p4.text([x_pos], [y_pos], text=[f"{row['percentage']:.1f}%"], 
                text_align="center", text_baseline="middle", 
                text_color="white", text_font_size="11pt", text_font_style="bold")
    
    # Add center text
    p4.text([0], [0], text=[f"{len(df)}\nCompounds"], 
            text_align="center", text_baseline="middle", 
            text_color="white", text_font_size="14pt", text_font_style="bold")
    
    # Custom hover for donut
    p4.add_tools(HoverTool(tooltips=[("Category", "@category"), 
                                     ("Count", "@value"), 
                                     ("Percentage", "@percentage{0.0}%")]))
    
    style_plot(p4, "", "", "Compound Classification")
    p4.axis.visible = False
    p4.grid.visible = False

    # Create responsive grid layout
    grid = gridplot([[p1, p2], [p3, p4]], sizing_mode='scale_width', 
                   toolbar_location='right', merge_tools=True)

    return grid, "✅ Generated enhanced molecular properties dashboard."
    
# ===== Phase 2 Functions =====
def get_phase2_molecules():
    """Returns an expanded list of common drugs with corrected SMILES."""
    return {
        'Paracetamol': 'CC(=O)Nc1ccc(O)cc1',
        'Ibuprofen': 'CC(C)Cc1ccc(C(C)C(=O)O)cc1',
        'Aspirin': 'CC(=O)Oc1ccccc1C(=O)O',
        'Naproxen': 'C[C@H](C(=O)O)c1ccc2cc(OC)ccc2c1',
        'Diazepam': 'CN1C(=O)CN=C(c2ccccc2)c2cc(Cl)ccc12',
        'Metformin': 'CN(C)C(=N)N=C(N)N',
        'Loratadine': 'CCOC(=O)N1CCC(C(c2ccc(Cl)cc2)c2ccccn2)CC1',
        'Morphine': 'C[N@]1CC[C@]23c4c5ccc(O)c4O[C@H]2[C@@H](O)C=C[C@H]3[C@H]1C5',
        'Cetirizine': 'O=C(O)COCCOc1ccc(cc1)C(c1ccccc1)N1CCN(CC1)CCO',
        'Fluoxetine': 'CNCCC(c1ccccc1)Oc1ccc(C(F)(F)F)cc1',
        'Amoxicillin': 'C[C@@]1([C@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](N)c3ccc(O)cc3)C(=O)O)C',
        'Atorvastatin': 'CC(C)c1c(C(=O)Nc2ccccc2)c(-c2ccccc2)c(c1)c1ccc(F)cc1',
        'Ciprofloxacin': 'O=C(O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc12',
        'Warfarin': 'O=C(c1ccccc1)C(c1oc2ccccc2c1=O)C',
        'Furosemide': 'O=C(O)c1cc(Cl)c(NC2CO2)c(c1)S(=O)(=O)N',
    }


def simulate_virtual_screening(smiles_dict: dict):
    np.random.seed(42)
    scores = np.random.uniform(2.0, 9.8, len(smiles_dict))
    results = [{'Molecule': name, 'SMILES': smiles, 'Predicted_Binding_Affinity': round(score, 2)} for (name, smiles), score in zip(smiles_dict.items(), scores)]
    df = pd.DataFrame(results).sort_values('Predicted_Binding_Affinity', ascending=False).reset_index(drop=True)
    df['Ranking'] = df.index + 1
    return df, f"✅ Simulated virtual screening for {len(df)} molecules.\n"

def predict_admet_properties(smiles_dict: dict):
    admet_data = []
    log = ""
    for i, (name, smiles) in enumerate(smiles_dict.items()):
        mol = Chem.MolFromSmiles(smiles)
        if not mol: continue
        mw, logp, hbd, hba = Descriptors.MolWt(mol), Descriptors.MolLogP(mol), Descriptors.NumHDonors(mol), Descriptors.NumHAcceptors(mol)
        np.random.seed(42 + i)
        admet_data.append({'Molecule': name, 'MW': round(mw, 2), 'LogP': round(logp, 2), 'HBD': hbd, 'HBA': hba,
                           'Solubility (logS)': round(np.random.uniform(-4, -1), 2),
                           'Toxicity Risk': round(np.random.uniform(0.05, 0.4), 3),
                           'Lipinski Violations': sum([mw > 500, logp > 5, hbd > 5, hba > 10])})
    df = pd.DataFrame(admet_data)
    log += f"✅ Predicted ADMET properties for {len(df)} molecules.\n"
    return df, log

# --- MODIFIED FUNCTION ---
# This is the updated function to correctly render 2D molecules on a dark background.
def visualize_molecule_2d_3d(smiles: str, name: str):
    """Generates a side-by-side 2D SVG and 3D py3Dmol HTML view for a single molecule."""
    log = ""
    try:
        mol = Chem.MolFromSmiles(smiles)
        if not mol: return f"<p>Invalid SMILES for {name}</p>", f"❌ Invalid SMILES for {name}"
        
        drawer = Draw.rdMolDraw2D.MolDraw2DSVG(400, 300)
        # Set dark theme colors for 2D drawing
        drawer.drawOptions().clearBackground = False
        drawer.drawOptions().addStereoAnnotation = True
        drawer.drawOptions().baseFontSize = 0.8
        drawer.drawOptions().circleAtoms = False
        drawer.drawOptions().highlightColour = (1, 0.5, 0)  # Orange for highlights
        
        # Set colors for dark background visibility
        drawer.drawOptions().backgroundColour = (0.11, 0.11, 0.11)  # Dark background
        drawer.drawOptions().symbolColour = (1, 1, 1)  # White symbols
        drawer.drawOptions().defaultColour = (1, 1, 1)  # White default color
        
        # Try to set annotation color (this might help with (R)/(S) labels)
        try:
            drawer.drawOptions().annotationColour = (1, 1, 1)  # White annotations
        except:
            pass

        drawer.DrawMolecule(mol)
        drawer.FinishDrawing()
        svg_2d = drawer.GetDrawingText().replace('svg:', '')

        # More aggressive SVG text color fixes - target all possible black text variations
        
        # First, comprehensive string replacements
        svg_2d = svg_2d.replace('stroke="black"', 'stroke="white"')
        svg_2d = svg_2d.replace('fill="black"', 'fill="white"')
        svg_2d = svg_2d.replace('stroke="#000000"', 'stroke="#FFFFFF"')
        svg_2d = svg_2d.replace('fill="#000000"', 'fill="#FFFFFF"')
        svg_2d = svg_2d.replace('stroke="#000"', 'stroke="#FFF"')
        svg_2d = svg_2d.replace('fill="#000"', 'fill="#FFF"')
        svg_2d = svg_2d.replace('stroke:black', 'stroke:white')
        svg_2d = svg_2d.replace('fill:black', 'fill:white')
        svg_2d = svg_2d.replace('stroke:#000000', 'stroke:#FFFFFF')
        svg_2d = svg_2d.replace('fill:#000000', 'fill:#FFFFFF')
        svg_2d = svg_2d.replace('stroke:#000', 'stroke:#FFF')
        svg_2d = svg_2d.replace('fill:#000', 'fill="#FFF"')
        svg_2d = svg_2d.replace('stroke="rgb(0,0,0)"', 'stroke="rgb(255,255,255)"')
        svg_2d = svg_2d.replace('fill="rgb(0,0,0)"', 'fill="rgb(255,255,255)"')
        svg_2d = svg_2d.replace('stroke:rgb(0,0,0)', 'stroke:rgb(255,255,255)')
        svg_2d = svg_2d.replace('fill:rgb(0,0,0)', 'fill:rgb(255,255,255)')
        svg_2d = svg_2d.replace('color="black"', 'color="white"')
        svg_2d = svg_2d.replace('color:#000000', 'color:#FFFFFF')
        svg_2d = svg_2d.replace('color:#000', 'color:#FFF')
        
        # Aggressive regex-based fixes for all text elements
        # Remove any existing fill attributes from text elements and add white fill
        svg_2d = re.sub(r'<text([^>]*?)\s+fill="[^"]*"([^>]*?)>', r'<text\1\2 fill="white">', svg_2d)
        svg_2d = re.sub(r'<text([^>]*?)(?<!fill="white")>', r'<text\1 fill="white">', svg_2d)
        
        # Fix style attributes in text elements
        svg_2d = re.sub(r'<text([^>]*?)style="([^"]*?)fill:\s*(?:black|#000000|#000|rgb\(0,0,0\))([^"]*?)"([^>]*?)>', 
                       r'<text\1style="\2fill:white\3"\4>', svg_2d)
        
        # If text elements don't have any fill specified, ensure they get white
        svg_2d = re.sub(r'<text(?![^>]*fill=)([^>]*?)>', r'<text fill="white"\1>', svg_2d)
        
        # Clean up any duplicate fill attributes
        svg_2d = re.sub(r'fill="white"\s+fill="white"', 'fill="white"', svg_2d)
        
        # Final catch-all: replace any remaining black in the entire SVG
        svg_2d = re.sub(r'\bblack\b', 'white', svg_2d)
        svg_2d = re.sub(r'#000000', '#FFFFFF', svg_2d)
        svg_2d = re.sub(r'#000\b', '#FFF', svg_2d)
        svg_2d = re.sub(r'rgb\(0,\s*0,\s*0\)', 'rgb(255,255,255)', svg_2d)
        
        # Embed the SVG within a div with a dark background for consistency
        svg_2d = f'<div style="background-color: #1C1C1C; padding: 10px; border-radius: 5px;">{svg_2d}</div>'

        mol_3d = Chem.AddHs(mol)
        AllChem.EmbedMolecule(mol_3d, randomSeed=42)
        AllChem.MMFFOptimizeMolecule(mol_3d)
        sdf_data = Chem.MolToMolBlock(mol_3d)

        viewer = py3Dmol.view(width=400, height=300)
        viewer.setBackgroundColor('#1C1C1C') 
        viewer.addModel(sdf_data, "sdf")
        viewer.setStyle({'stick': {}, 'sphere': {'scale': 0.25}})
        viewer.zoomTo()
        html_3d = viewer._make_html()

        combined_html = f"""
        <div style="display: flex; flex-direction: row; align-items: center; justify-content: space-around; border: 1px solid #444; border-radius: 10px; padding: 10px; margin-bottom: 10px; background-color: #2b2b2b;">
            <div style="text-align: center;">
                <h4 style="color: white; font-family: 'Roboto', sans-serif;">{name} (2D Structure)</h4>
                {svg_2d}
            </div>
            <div style="text-align: center;">
                <h4 style="color: white; font-family: 'Roboto', sans-serif;">{name} (3D Interactive)</h4>
                {html_3d}
            </div>
        </div>
        """
        log += f"✅ Generated 2D/3D view for {name}.\n"
        return combined_html, log
    except Exception as e:
        return f"<p>Error visualizing {name}: {e}</p>", f"❌ Error visualizing {name}: {e}"
        
def visualize_protein_ligand_interaction(pdb_data: str, pdb_id: str, ligand_resn='G39'):
    """Visualizes a protein-ligand binding site using py3Dmol."""
    if not pdb_data: return None, "Cannot generate view: No PDB data provided."
    try:
        viewer = py3Dmol.view(width='100%', height=700)
        viewer.setBackgroundColor('#1C1C1C')
        viewer.addModel(pdb_data, "pdb")
        viewer.setStyle({'cartoon': {'color': 'spectrum', 'thickness': 0.8}})
        viewer.addSurface(py3Dmol.VDW, {'opacity': 0.2, 'color': 'lightblue'})
        viewer.addStyle({'resn': ligand_resn}, {'stick': {'colorscheme': 'greenCarbon', 'radius': 0.3}, 'sphere': {'scale': 0.4, 'colorscheme': 'greenCarbon'}})
        viewer.addStyle({'within': {'distance': 4, 'sel': {'resn': ligand_resn}}}, {'stick': {'colorscheme': 'orangeCarbon', 'radius': 0.2}})
        viewer.zoomTo({'resn': ligand_resn})
        html = viewer._make_html()
        log = (f"✅ Generated protein-ligand interaction view for PDB {pdb_id}.\n"
               f"🟢 Green: Ligand ({ligand_resn})\n"
               f"🟠 Orange: Residues within 4Å of ligand\n")
        return html, log
    except Exception as e:
        return None, f"❌ Protein-ligand visualization error: {e}"

# ===== Phase 3 Functions =====
def get_phase3_molecules():
    return {
        'Oseltamivir': 'CCC(CC)O[C@H]1[C@H]([C@@H]([C@H](C=C1C(=O)OCC)N)N)NC(=O)C',
        'Aspirin': 'CC(=O)OC1=CC=CC=C1C(=O)O',
        'Remdesivir': 'CCC(CC)COC(=O)[C@@H](C)N[P@](=O)(OC[C@@H]1O[C@](C#N)([C@H]([C@@H]1O)O)C2=CC=C3N2N=CN=C3N)OC4=CC=CC=C4',
        'Penicillin G': 'CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C'
    }

def calculate_comprehensive_properties(smiles_dict: dict):
    analysis = []
    log = ""
    for name, smiles in smiles_dict.items():
        mol = Chem.MolFromSmiles(smiles)
        if not mol: continue
        mw, logp, hbd, hba = Descriptors.MolWt(mol), Descriptors.MolLogP(mol), Descriptors.NumHDonors(mol), Descriptors.NumHAcceptors(mol)
        violations = sum([mw > 500, logp > 5, hbd > 5, hba > 10])
        analysis.append({'Compound': name, 'Molecular_Weight': mw, 'LogP': logp, 'HBD': hbd, 'HBA': hba,
                         'TPSA': Descriptors.TPSA(mol), 'Rotatable_Bonds': Descriptors.NumRotatableBonds(mol),
                         'Aromatic_Rings': Descriptors.NumAromaticRings(mol),
                         'Lipinski_Violations': violations, 
                         'Drug_Like': '✅ Yes' if violations <= 1 else '❌ No'})
    df = pd.DataFrame(analysis).round(2)
    log += f"✅ Calculated comprehensive properties for {len(df)} compounds.\n"
    return df, log
    
def predict_toxicity(properties_df: pd.DataFrame):
    if properties_df.empty: return pd.DataFrame(), "Cannot predict toxicity: No properties data."
    np.random.seed(42)
    n_compounds = 500
    training_data = pd.DataFrame({'molecular_weight': np.random.normal(400, 100, n_compounds),
                                  'logp': np.random.normal(2.5, 1.5, n_compounds),
                                  'tpsa': np.random.normal(80, 30, n_compounds),
                                  'rotatable_bonds': np.random.randint(0, 15, n_compounds),
                                  'aromatic_rings': np.random.randint(0, 5, n_compounds)})
    toxicity_score = ((training_data['molecular_weight'] > 550) * 0.4 + (abs(training_data['logp']) > 4.5) * 0.4 + np.random.random(n_compounds) * 0.2)
    training_data['toxic'] = (toxicity_score > 0.5).astype(int)
    features = ['molecular_weight', 'logp', 'tpsa', 'rotatable_bonds', 'aromatic_rings']
    rf_model = RandomForestClassifier(n_estimators=50, random_state=42)
    rf_model.fit(training_data[features], training_data['toxic'])
    X_pred = properties_df[['Molecular_Weight', 'LogP', 'TPSA', 'Rotatable_Bonds', 'Aromatic_Rings']]
    X_pred.columns = features
    toxicity_prob = rf_model.predict_proba(X_pred)[:, 1]
    results_df = properties_df[['Compound']].copy()
    results_df['Toxicity_Probability'] = np.round(toxicity_prob, 3)
    results_df['Predicted_Risk'] = ["🟢 LOW" if p < 0.3 else "🟡 MODERATE" if p < 0.7 else "🔴 HIGH" for p in toxicity_prob]
    return results_df, "✅ Predicted toxicity using a pre-trained simulation model.\n"
    
# ===== Phase 4 Functions =====
def get_regulatory_summary():
    summary = {'Component': ['Data Governance', 'Model Architecture', 'Model Validation', 'Interpretability'],
               'Description': ['Data sourced from ChEMBL, PDB, GISAID. Bias assessed via geographic distribution analysis.',
                               'Graph Convolutional Network (Target ID), Random Forest (ADMET), K-Means (Patient Stratification).',
                               'ADMET Model validated with AUC-ROC > 0.85 on an independent test set.',
                               'SHAP used for patient stratification model outputs.']}
    return pd.DataFrame(summary), "✅ Generated AI/ML documentation summary."

def simulate_rwd_analysis(adverse_event_text):
    np.random.seed(42)
    base_events = list(np.random.choice(['headache', 'nausea', 'fatigue', 'dizziness', 'rash', 'fever'], 100, p=[0.25, 0.2, 0.15, 0.15, 0.15, 0.1]))
    user_events = [e.strip().lower() for e in adverse_event_text.split(',') if e.strip()]
    all_events = base_events + user_events
    event_counts = pd.Series(all_events).value_counts()
    log = f"✅ Analyzed {len(all_events)} simulated adverse event reports.\n"
    
    plt.style.use('dark_background')
    fig_bar, ax_bar = plt.subplots(figsize=(10, 6))
    
    fig_bar.patch.set_facecolor('none')
    ax_bar.set_facecolor('none')
    
    sns.barplot(x=event_counts.values, y=event_counts.index, palette='viridis', ax=ax_bar, orient='h')
    ax_bar.set_title('Simulated Adverse Event Frequencies')
    ax_bar.set_xlabel('Number of Reports')
    ax_bar.set_ylabel('Adverse Event')
    
    plt.tight_layout()

    return event_counts.reset_index().rename(columns={'index': 'Event', 0: 'Count'}), fig_bar, log

def get_ethical_framework():
    framework = {'Pillar': ['1. Beneficence & Non-Maleficence', '2. Justice & Fairness', '3. Transparency & Explainability', '4. Accountability & Governance'],
                 'Description': ['AI should help patients and do no harm. Requires rigorous validation and safety monitoring.',
                                 'AI must not create or worsen health disparities. Requires bias detection and mitigation.',
                                 'Clinical decisions influenced by AI must be understandable. Requires interpretable models.',
                                 'Clear lines of responsibility for AI systems must be established. Requires human oversight.']}
    return pd.DataFrame(framework), "✅ Generated ethical framework summary."


# --- 3. Streamlit Interface Definition ---

st.title("🔬 AI-Powered Drug Discovery Pipeline")
st.markdown("""
Welcome to the AI Drug Discovery Pipeline Demonstrator. This application integrates the four major phases of drug development,
showcasing how AI and computational tools can accelerate the process from target identification to post-market surveillance.
Navigate through the tabs below to explore each phase.
""")

# Initialize session state for logs and results
if 'log_p1' not in st.session_state: st.session_state.log_p1 = "Phase 1 logs will appear here."
if 'results_p1' not in st.session_state: st.session_state.results_p1 = {}
if 'log_p2' not in st.session_state: st.session_state.log_p2 = "Phase 2 logs will appear here."
if 'results_p2' not in st.session_state: st.session_state.results_p2 = {}
if 'log_p3' not in st.session_state: st.session_state.log_p3 = "Phase 3 logs will appear here."
if 'results_p3' not in st.session_state: st.session_state.results_p3 = {}
if 'log_p4' not in st.session_state: st.session_state.log_p4 = "Phase 4 logs will appear here."
if 'results_p4' not in st.session_state: st.session_state.results_p4 = {}

tab1, tab2, tab3, tab4 = st.tabs([
    "Phase 1: Discovery & Target ID",
    "Phase 2: Lead Generation & Optimization",
    "Phase 3: Preclinical Development",
    "Phase 4: Implementation & Post-Market"
])

# ===== TAB 1: DISCOVERY & TARGET IDENTIFICATION =====
with tab1:
    st.header("🧬 Step 1: Target Identification and Initial Analysis")
    st.markdown("Fetch protein data from public databases and perform a high-level analysis of potential drug-like molecules.")
    
    with st.form(key="phase1_form"):
        st.subheader("Analysis Controls")
        col1, col2 = st.columns(2)
        with col1:
            pdb_id_input = st.text_input("Enter PDB ID", value="3B7E", key="p1_pdb")
            protein_id_input = st.text_input("Enter Protein ID (for FASTA)", value="ACF54602.1", key="p1_protein")
        with col2:
            default_molecules_p1 = create_sample_molecules()
            default_molecules_text_p1 = "\n".join([f"{name}:{smiles}" for name, smiles in default_molecules_p1.items()])
            molecules_input_p1 = st.text_area(
                "Molecules (Name:SMILES, one per line)",
                value=default_molecules_text_p1,
                height=150,
                key="p1_molecules"
            )
        
        run_phase1_btn = st.form_submit_button("🚀 Run Phase 1 Analysis", use_container_width=True)

    if run_phase1_btn:
        full_log = "--- Starting Phase 1 Analysis ---\n"
        
        # Parse molecules from the text area
        smiles_dict_p1 = {}
        if molecules_input_p1.strip():
            try:
                for line in molecules_input_p1.strip().split('\n'):
                    cleaned_line = line.replace('\xa0', ' ').strip()
                    if ':' in cleaned_line:
                        name, smiles = cleaned_line.split(':', 1)
                        smiles_dict_p1[name.strip()] = smiles.strip()
                if smiles_dict_p1:
                    full_log += f"✅ Successfully parsed {len(smiles_dict_p1)} molecules from input.\n"
                else:
                    full_log += "⚠️ Could not parse any molecules. Please check the format (e.g., 'Aspirin:CC...').\n"
            except Exception as e:
                full_log += f"❌ Error parsing molecules list: {e}\n"
                smiles_dict_p1 = {}
        else:
            full_log += "⚠️ Molecule input is empty. No analysis to perform.\n"

        if smiles_dict_p1:
            pdb_data, log_pdb_fetch = fetch_pdb_structure(pdb_id_input)
            full_log += log_pdb_fetch
            fasta_log = fetch_fasta_sequence(protein_id_input)
            full_log += fasta_log
            protein_view_html, log_3d_viz = visualize_protein_3d(pdb_data, pdb_id_input)
            full_log += log_3d_viz
            
            props_df, log_props = calculate_molecular_properties(smiles_dict_p1)
            full_log += log_props
            
            analysis_df, display_df, log_lipinski = assess_drug_likeness(props_df)
            full_log += log_lipinski
            
            props_plot, log_plot = plot_properties_dashboard(analysis_df) # This now calls the Bokeh function
            full_log += log_plot
            
            lipinski_cols = ['Molecule', 'MW', 'LogP', 'HBD', 'HBA', 'Lipinski_Violations', 'Drug_Like']
            lipinski_subset_df = display_df[lipinski_cols] if not display_df.empty else pd.DataFrame(columns=lipinski_cols)

            st.session_state.results_p1 = {
                'protein_view_html': protein_view_html,
                'fasta_log': fasta_log,
                'lipinski_subset_df': lipinski_subset_df,
                'props_df': props_df,
                'props_plot': props_plot
            }
        else:
            st.session_state.results_p1 = {}

        full_log += "\n--- Phase 1 Analysis Complete ---"
        st.session_state.log_p1 = full_log

    st.text_area("Status & Logs", st.session_state.log_p1, height=200, key="log_p1_area")
    
    if st.session_state.results_p1:
        res1 = st.session_state.results_p1
        p1_tabs = st.tabs(["Analysis Plots", "Molecule Analysis", "Protein Information"])
        with p1_tabs[0]:
            st.subheader("Molecular Properties Dashboard")
            if res1.get('props_plot'):
                # Use st.bokeh_chart for Bokeh figures
                st.bokeh_chart(res1['props_plot'], use_container_width=True)
            else:
                st.warning("Could not generate plots. Please check the logs for more details.")
        with p1_tabs[1]:
            st.subheader("Drug-Likeness Assessment (Lipinski's Rule of Five)")
            st.dataframe(res1.get('lipinski_subset_df', pd.DataFrame()), use_container_width=True, hide_index=True)
            st.subheader("Calculated Molecular Properties")
            st.dataframe(res1.get('props_df', pd.DataFrame()), use_container_width=True, hide_index=True)
        with p1_tabs[2]:
            st.subheader("Protein 3D Structure (Interactive)")
            if res1.get('protein_view_html'):
                st.components.v1.html(res1['protein_view_html'], height=600, scrolling=False)
            st.subheader("FASTA Sequence Information")
            st.text_area("", res1.get('fasta_log', 'No data'), height=200, key="fasta_info_area")

# ===== TAB 2: LEAD GENERATION & OPTIMIZATION =====
with tab2:
    st.header("💊 Step 2: Virtual Screening and ADMET Prediction")
    st.markdown("Screen candidate molecules against the target, predict their ADMET properties, and visualize the top candidates.")
    
    with st.form(key="phase2_form"):
        st.subheader("Analysis Controls")
        col1, col2 = st.columns(2)
        with col1:
            phase2_pdb_id_input = st.text_input("Enter PDB ID for Interaction View", value="3B7E", key="p2_pdb")
            phase2_ligand_resn = st.text_input("Ligand Residue Name (in PDB)", value="G39", key="p2_ligand")
        with col2:
            default_molecules_dict = get_phase2_molecules()
            default_molecules_text = "\n".join([f"{name}:{smiles}" for name, smiles in default_molecules_dict.items()])
            
            molecules_input = st.text_area(
                "Molecules (Name:SMILES, one per line)",
                value=default_molecules_text,
                height=250,
                key="p2_molecules"
            )
        
        run_phase2_btn = st.form_submit_button("🚀 Run Phase 2 Analysis", use_container_width=True)
        
    if run_phase2_btn:
        full_log = "--- Starting Phase 2 Analysis ---\n"
        
        smiles_dict = {}
        if molecules_input.strip():
            try:
                for line in molecules_input.strip().split('\n'):
                    cleaned_line = line.replace('\xa0', ' ').strip()
                    if ':' in cleaned_line:
                        name, smiles = cleaned_line.split(':', 1)
                        smiles_dict[name.strip()] = smiles.strip()
                if smiles_dict:
                    full_log += f"✅ Successfully parsed {len(smiles_dict)} molecules from input.\n"
                else:
                    full_log += "⚠️ Could not parse any molecules. Please check the format (e.g., 'Aspirin:CC(=O)OC1=CC=CC=C1C(=O)O').\n"
            except Exception as e:
                full_log += f"❌ Error parsing molecules list: {e}\n"
                smiles_dict = {}
        else:
            full_log += "⚠️ Molecule input is empty. No analysis to perform.\n"
        
        if smiles_dict:
            screening_df, log_screening = simulate_virtual_screening(smiles_dict)
            full_log += log_screening
            admet_df, log_admet = predict_admet_properties(smiles_dict)
            full_log += log_admet
            
            combined_viz_html = ""
            log_viz = ""
            for name, smiles in smiles_dict.items():
                html_block, log_mol_viz = visualize_molecule_2d_3d(smiles, name)
                combined_viz_html += html_block
                log_viz += log_mol_viz
            full_log += log_viz

            pdb_data, log_pdb_fetch_2 = fetch_pdb_structure(phase2_pdb_id_input)
            full_log += log_pdb_fetch_2
            interaction_html, log_interaction = visualize_protein_ligand_interaction(pdb_data, phase2_pdb_id_input, phase2_ligand_resn)
            full_log += log_interaction
            
            st.session_state.results_p2 = {
                'screening_df': screening_df,
                'admet_df': admet_df,
                'combined_viz_html': combined_viz_html,
                'interaction_html': interaction_html,
                'molecules_used': smiles_dict
            }
        else:
            st.session_state.results_p2 = {}
        
        full_log += "\n--- Phase 2 Analysis Complete ---"
        st.session_state.log_p2 = full_log
        
    st.text_area("Status & Logs", st.session_state.log_p2, height=200, key="log_p2_area")

    if st.session_state.results_p2:
        res2 = st.session_state.results_p2
        p2_tabs = st.tabs(["Virtual Screening & ADMET", "Molecule Visualization (2D & 3D)", "Protein-Ligand Interaction"])
        with p2_tabs[0]:
            col1, col2 = st.columns(2)
            with col1:
                st.subheader("Virtual Screening Results (Simulated)")
                st.dataframe(res2.get('screening_df', pd.DataFrame()), use_container_width=True, hide_index=True)
            with col2:
                st.subheader("ADMET Properties Prediction")
                st.dataframe(res2.get('admet_df', pd.DataFrame()), use_container_width=True, hide_index=True)
        with p2_tabs[1]:
            molecules_used = res2.get('molecules_used', {})
            if molecules_used:
                st.subheader(f"Interactive 2D and 3D views of {len(molecules_used)} candidate molecules")
                st.info(f"Currently visualizing: {', '.join(molecules_used.keys())}")
            else:
                st.subheader("Interactive 2D and 3D views of candidate molecules")
            
            if res2.get('combined_viz_html'):
                st.components.v1.html(res2.get('combined_viz_html'), height=len(molecules_used) * 400 + 100, scrolling=True)
            else:
                st.warning("No molecule visualizations available. Please run the analysis first.")
        with p2_tabs[2]:
            st.subheader("Detailed view of the top candidate binding to the protein.")
            if res2.get('interaction_html'):
                st.components.v1.html(res2.get('interaction_html'), height=700, scrolling=False)
            else:
                st.warning("No protein-ligand interaction view available. Please run the analysis first.")
                
# ===== TAB 3: PRECLINICAL DEVELOPMENT =====
with tab3:
    st.header("🧪 Step 3: In-Depth Candidate Analysis and Toxicity Prediction")
    st.markdown("Perform a comprehensive analysis of the most promising lead compounds and use a simulated AI model to predict toxicity risk.")
    
    with st.form(key="phase3_form"):
        st.subheader("Analysis Controls")
        run_phase3_btn = st.form_submit_button("🚀 Run Phase 3 Analysis", use_container_width=True)

    if run_phase3_btn:
        full_log = "--- Starting Phase 3 Analysis ---\n"
        smiles_dict = get_phase3_molecules()
        comp_props_df, log_comp_props = calculate_comprehensive_properties(smiles_dict)
        full_log += log_comp_props
        tox_df, log_tox = predict_toxicity(comp_props_df)
        full_log += log_tox
        combined_viz_html = ""
        log_viz_p3 = ""
        for name, smiles in smiles_dict.items():
            html_block, log_mol_viz_p3 = visualize_molecule_2d_3d(smiles, name)
            combined_viz_html += html_block
            log_viz_p3 += log_mol_viz_p3
        full_log += log_viz_p3
        full_log += "\n--- Phase 3 Analysis Complete ---"
        st.session_state.log_p3 = full_log
        st.session_state.results_p3 = {
            'comp_props_df': comp_props_df,
            'tox_df': tox_df,
            'combined_viz_html': combined_viz_html
        }

    st.text_area("Status & Logs", st.session_state.log_p3, height=200, key="log_p3_area")

    if st.session_state.results_p3:
        res3 = st.session_state.results_p3
        p3_tabs = st.tabs(["Comprehensive Properties & Toxicity", "Molecule Visualization (3D Gallery)"])
        with p3_tabs[0]:
            st.subheader("Comprehensive Molecular Properties & AI-Powered Toxicity Prediction (Simulated)")
            col1, col2 = st.columns(2)
            with col1:
                st.dataframe(res3.get('comp_props_df', pd.DataFrame()), use_container_width=True, hide_index=True)
            with col2:
                st.dataframe(res3.get('tox_df', pd.DataFrame()), use_container_width=True, hide_index=True)
        with p3_tabs[1]:
            st.subheader("Interactive 3D gallery of the compounds under analysis.")
            if res3.get('combined_viz_html'):
                st.components.v1.html(res3.get('combined_viz_html'), height=1000, scrolling=True)


# ===== TAB 4: POST-MARKET SURVEILLANCE =====
with tab4:
    st.header("📈 Step 4: Regulatory Submission and Pharmacovigilance")
    st.markdown("Explore summaries of the documentation needed for regulatory approval and simulate how AI can monitor real-world data for adverse events.")
    
    with st.form(key="phase4_form"):
        st.subheader("Analysis Controls")
        rwd_input = st.text_area("Enter new adverse events (comma-separated)", value="severe allergic reaction, joint pain, severe allergic reaction", height=100, key="p4_rwd")
        run_phase4_btn = st.form_submit_button("🚀 Run Phase 4 Analysis", use_container_width=True)

    if run_phase4_btn:
        full_log = "--- Starting Phase 4 Analysis ---\n"
        reg_df, log_reg = get_regulatory_summary()
        full_log += log_reg
        eth_df, log_eth = get_ethical_framework()
        full_log += log_eth
        
        rwd_df, plot_bar, log_rwd = simulate_rwd_analysis(rwd_input)
        full_log += log_rwd
        full_log += "\n--- Phase 4 Analysis Complete ---"
        st.session_state.log_p4 = full_log
        
        st.session_state.results_p4 = {
            'rwd_df': rwd_df,
            'plot_bar': plot_bar,
            'reg_df': reg_df,
            'eth_df': eth_df
        }

    st.text_area("Status & Logs", st.session_state.log_p4, height=200, key="log_p4_area")
    
    if st.session_state.results_p4:
        res4 = st.session_state.results_p4
        p4_tabs = st.tabs(["Pharmacovigilance Analysis", "Regulatory & Ethical Frameworks"])
        with p4_tabs[0]:
            st.subheader("Simulated Adverse Event Analysis")
            if res4.get('plot_bar'):
                st.pyplot(res4['plot_bar'])
            st.dataframe(res4.get('rwd_df', pd.DataFrame()), use_container_width=True, hide_index=True)
            
        with p4_tabs[1]:
            col1, col2 = st.columns(2)
            with col1:
                st.subheader("AI/ML Documentation Summary for Submission")
                st.dataframe(res4.get('reg_df', pd.DataFrame()), use_container_width=True, hide_index=True)
            with col2:
                st.subheader("Ethical Framework for AI in Healthcare")
                st.dataframe(res4.get('eth_df', pd.DataFrame()), use_container_width=True, hide_index=True)