import gradio as gr from huggingface_hub import HfApi, get_collection, list_collections, list_models #from utils import MolecularPropertyPredictionModel, dataset_task_types, dataset_descriptions, dataset_property_names, dataset_property_names_to_dataset from utils import MolecularGenerationModel import pandas as pd import os import spaces #candidate_models = get_models() #task_names = { # 'mit_synthesis': 'Reaction Synthesis', # 'full_retro': 'Reaction Retro Synthesis' #} #task_names_to_tasks = {v: k for k, v in task_names.items()} #tasks = list(candidate_models.keys()) #task_descriptions = { # 'mit_synthesis': 'Predict the reaction products given the reactants and reagents. \n' + \ # '1. This model is trained on the USPTO MIT dataset. \n' + \ # '2. The reactants and reagents are mixed in the input SMILES string. \n' + \ # '3. Different compounds are separated by ".". \n' + \ # '4. Input SMILES string example: C1CCOC1.N#Cc1ccsc1N.O=[N+]([O-])c1cc(F)c(F)cc1F.[H-].[Na+]', # 'full_retro': 'Predict the reaction precursors given the reaction products. \n' + \ # '1. This model is trained on the USPTO Full dataset. \n' + \ # '2. In this dataset, we consider only a single product in the input SMILES string. \n' + \ # '3. Input SMILES string example: CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)C3=CC[C@@]21C' #} #property_names = list(candidate_models.keys()) model = MolecularGenerationModel() @spaces.GPU(duration=120) def predict_single_label(logp, tpas, sas, qed, logp_choose, tpsa_choose, sas_choose, qed_choose): input_dict = dict() if logp_choose: input_dict['logP'] = logp if tpsa_choose: input_dict['TPSA'] = tpas if sas_choose: input_dict['SAS'] = sas if qed_choose: input_dict['QED'] = qed if len(input_dict) == 0: return "NA", "No input is selected" print(input_dict) try: running_status = None prediction = None prediction = model.predict_single_smiles(input_dict) #prediction = model.predict(smiles, property_name, adapter_id) #prediction = model.predict_single_smiles(smiles, task) if prediction is None: return "NA", "Invalid SMILES string" except Exception as e: # no matter what the error is, we should return print(e) return "NA", "Generation failed" #prediction = "\n".join([f"{idx+1}. {item}" for idx, item in enumerate(prediction)]) return prediction, "Generation is done" """ def get_description(task_name): task = task_names_to_tasks[task_name] return task_descriptions[task] #@spaces.GPU(duration=10) """ """ @spaces.GPU(duration=30) def predict_file(file, property_name): property_id = dataset_property_names_to_dataset[property_name] try: adapter_id = candidate_models[property_id] info = model.swith_adapter(property_id, adapter_id) running_status = None if info == "keep": running_status = "Adapter is the same as the current one" #print("Adapter is the same as the current one") elif info == "switched": running_status = "Adapter is switched successfully" #print("Adapter is switched successfully") elif info == "error": running_status = "Adapter is not found" #print("Adapter is not found") return None, None, file, running_status else: running_status = "Unknown error" return None, None, file, running_status df = pd.read_csv(file) # we have already checked the file contains the "smiles" column df = model.predict_file(df, dataset_task_types[property_id]) # we should save this file to the disk to be downloaded # rename the file to have "_prediction" suffix prediction_file = file.replace(".csv", "_prediction.csv") if file.endswith(".csv") else file.replace(".smi", "_prediction.csv") print(file, prediction_file) # save the file to the disk df.to_csv(prediction_file, index=False) except Exception as e: # no matter what the error is, we should return print(e) return gr.update(visible=True), gr.update(visible=False), gr.update(visible=False), file, "Prediction failed" return gr.update(visible=False), gr.DownloadButton(label="Download", value=prediction_file, visible=True), gr.update(visible=False), prediction_file, "Prediction is done" def validate_file(file): try: if file.endswith(".csv"): df = pd.read_csv(file) if "smiles" not in df.columns: # we should clear the file input return "Invalid file content. The csv file must contain column named 'smiles'", \ None, gr.update(visible=False), gr.update(visible=False) # check the length of the smiles length = len(df["smiles"]) elif file.endswith(".smi"): return "Invalid file extension", \ None, gr.update(visible=False), gr.update(visible=False) else: return "Invalid file extension", \ None, gr.update(visible=False), gr.update(visible=False) except Exception as e: return "Invalid file content.", \ None, gr.update(visible=False), gr.update(visible=False) if length > 100: return "The space does not support the file containing more than 100 SMILES", \ None, gr.update(visible=False), gr.update(visible=False) return "Valid file", file, gr.update(visible=True), gr.update(visible=False) """ def raise_error(status): if status != "Valid file": raise gr.Error(status) return None """ def clear_file(download_button): # we might need to delete the prediction file and uploaded file prediction_path = download_button print(prediction_path) if prediction_path and os.path.exists(prediction_path): os.remove(prediction_path) original_data_file_0 = prediction_path.replace("_prediction.csv", ".csv") original_data_file_1 = prediction_path.replace("_prediction.csv", ".smi") if os.path.exists(original_data_file_0): os.remove(original_data_file_0) if os.path.exists(original_data_file_1): os.remove(original_data_file_1) #if os.path.exists(file): # os.remove(file) #prediction_file = file.replace(".csv", "_prediction.csv") if file.endswith(".csv") else file.replace(".smi", "_prediction.csv") #if os.path.exists(prediction_file): # os.remove(prediction_file) return gr.update(visible=False), gr.update(visible=False), None """ def toggle_slider(checked): return gr.update(interactive=checked) def toggle_sliders_based_on_checkboxes(checked_values): """Enable or disable sliders based on the corresponding checkbox values.""" return [gr.update(interactive=checked_values[i]) for i in range(4)] def build_inference(): with gr.Blocks() as demo: # first row - Dropdown input #with gr.Row(): #gr.Markdown(f"If you run out of your GPU quota, you can use the CPU-powered space but with much lower performance.") #dropdown = gr.Dropdown([task_names[key] for key in tasks], label="Task", value=task_names[tasks[0]]) description = f"This space allows you to generate ten possible molecules based on given conditions. \n" \ f"1. You can enable or disable specific properties using checkboxes and adjust their values with sliders. \n" \ f"2. The generated SMILES strings and their corresponding predicted properties will be displayed in the generations section. \n" \ f"3. The properties include logP, TPSA, SAS, and QED. \n" \ f"4. Model trained on the GuacaMol dataset for molecular design. " description_box = gr.Textbox(label="Task description", lines=5, interactive=False, value= description) # third row - Textbox input and prediction label with gr.Row(equal_height=True): with gr.Column(): checkbox_1 = gr.Checkbox(label="logP", value=True) slider_1 = gr.Slider(1, 7, value=4, label="logP", info="Choose between 1 and 7") checkbox_1.change(toggle_slider, checkbox_1, slider_1) with gr.Column(): checkbox_2 = gr.Checkbox(label="TPSA", value=True) slider_2 = gr.Slider(20, 140, value=80, label="TPSA", info="Choose between 20 and 140") checkbox_2.change(toggle_slider, checkbox_2, slider_2) with gr.Column(): checkbox_3 = gr.Checkbox(label="SAS", value=True) slider_3 = gr.Slider(1, 5, value=3, label="SAS", info="Choose between 1 and 5") checkbox_3.change(toggle_slider, checkbox_3, slider_3) with gr.Column(): checkbox_4 = gr.Checkbox(label="QED", value=True) slider_4 = gr.Slider(0.1, 0.9, value=0.5, label="QED", info="Choose between 0.1 and 0.9") checkbox_4.change(toggle_slider, checkbox_4, slider_4) predict_single_smiles_button = gr.Button("Generate", size='sm') #prediction = gr.Label("Prediction will appear here") #prediction = gr.Textbox(label="Predictions", type="text", placeholder=None, lines=10, interactive=False) prediction = gr.Dataframe(label="Generations", type="pandas", interactive=False) running_terminal_label = gr.Textbox(label="Running status", type="text", placeholder=None, lines=10, interactive=False) # dropdown change event # predict single button click event predict_single_label.zerogpu=True predict_single_smiles_button.click(lambda:(gr.update(interactive=False), gr.update(interactive=False), gr.update(interactive=False), gr.update(interactive=False), gr.update(interactive=False), gr.update(interactive=False), gr.update(interactive=False), gr.update(interactive=False), gr.update(interactive=False), gr.update(interactive=False), ) , outputs=[slider_1, slider_2, slider_3, slider_4, checkbox_1, checkbox_2, checkbox_3, checkbox_4, predict_single_smiles_button, running_terminal_label])\ .then(predict_single_label, inputs=[slider_1, slider_2, slider_3, slider_4, checkbox_1, checkbox_2, checkbox_3, checkbox_4 ], outputs=[prediction, running_terminal_label])\ .then(lambda a, b, c, d: toggle_sliders_based_on_checkboxes([a, b, c, d]) + [gr.update(interactive=True)] * 6, inputs=[checkbox_1, checkbox_2, checkbox_3, checkbox_4], outputs=[slider_1, slider_2, slider_3, slider_4, checkbox_1, checkbox_2, checkbox_3, checkbox_4, predict_single_smiles_button, running_terminal_label]) return demo demo = build_inference() if __name__ == '__main__': demo.launch()